/* ------------------------------------------------------------------------------ Licensing information can be found at the end of the file. ------------------------------------------------------------------------------ https.h - v0.1 - Basic HTTP/HTTPS protocol implementation over sockets. Do this: #define HTTPS_IMPLEMENTATION before you include this file in *one* C/C++ file to create the implementation. ------------------------------------------------------------------------------ This is a HTTP protocol implementation including the TLSe library for SSL functionality (https://github.com/eduardsui/tlse),and the LibTomCrypt library for crypto functions (https://github.com/libtom/libtomcrypt). Both of these libraries are available under a public domain license, so I'm releasing this library under my usual dual license (MIT and Public Domain). As they are C libraries, I have modified them to compile under C++ as well (mostly fixing automatic casts from void*, which C++ doesn't support). / Mattias Gustavsson ( mattias@mattiasgustavsson.com ) */ #ifndef https_h #define https_h #define _CRT_NONSTDC_NO_DEPRECATE #define _CRT_SECURE_NO_WARNINGS #include // for size_t typedef enum https_status_t { HTTPS_STATUS_PENDING, HTTPS_STATUS_COMPLETED, HTTPS_STATUS_FAILED, } https_status_t; typedef struct https_t { https_status_t status; int status_code; char const* reason_phrase; char const* content_type; size_t response_size; void* response_data; } https_t; https_t* https_get( char const* url, void* memctx ); https_t* https_post( char const* url, void const* data, size_t size, void* memctx ); https_status_t https_process( https_t* https ); void https_release( https_t* https ); #endif /* https_h */ /** Example ======= #define HTTPS_IMPLEMENTATION #include "https.h" int main( int argc, char** argv ) { (void) argc, argv; return 0; } API Documentation ================= https.h is a small library for making https requests from a web server. It only supports GET and POST https commands, and is designed for when you just need a very basic way of communicating over https. https.h is a single-header library, and does not need any .lib files or other binaries, or any build scripts. To use it, you just include https.h to get the API declarations. To get the definitions, you must include https.h from *one* single C or C++ file, and #define the symbol `HTTPS_IMPLEMENTATION` before you do. Customization ------------- ### Custom memory allocators For working memory and to store the retrieved data, https.h needs to do dynamic allocation by calling `malloc`. Programs might want to keep track of allocations done, or use custom defined pools to allocate memory from. https.h allows for specifying custom memory allocation functions for `malloc` and `free`. This is done with the following code: #define HTTPS_IMPLEMENTATION #define HTTPS_MALLOC( ctx, size ) ( my_custom_malloc( ctx, size ) ) #define HTTPS_FREE( ctx, ptr ) ( my_custom_free( ctx, ptr ) ) #include "https.h" where `my_custom_malloc` and `my_custom_free` are your own memory allocation/deallocation functions. The `ctx` parameter is an optional parameter of type `void*`. When `https_get` or `https_post` is called, , you can pass in a `memctx` parameter, which can be a pointer to anything you like, and which will be passed through as the `ctx` parameter to every `HTTPS_MALLOC`/`HTTPS_FREE` call. For example, if you are doing memory tracking, you can pass a pointer to your tracking data as `memctx`, and in your custom allocation/deallocation function, you can cast the `ctx` param back to the right type, and access the tracking data. If no custom allocator is defined, https.h will default to `malloc` and `free` from the C runtime library. https_get --------- https_t* https_get( char const* url, void* memctx ) Initiates a https GET request with the specified url. `url` is a zero terminated string containing the request location, just like you would type it in a browser, for example `https://www.mattiasgustavsson.com:443/http_test.txt`. `memctx` is a pointer to user defined data which will be passed through to the custom HTTPS_MALLOC/HTTPS_FREE calls. It can be NULL if no user defined data is needed. Returns a `https_t` instance, which needs to be passed to `https_process` to process the request. When the request is finished (or have failed), the returned `https_t` instance needs to be released by calling `https_release`. If the request was invalid, `https_get` returns NULL. https_post ---------- https_t* https_post( char const* url, void const* data, size_t size, void* memctx ) Initiates a https POST request with the specified url. `url` is a zero terminated string containing the request location, just like you would type it in a browser, for example `https://www.mattiasgustavsson.com:443/http_test.txt`. `data` is a pointer to the data to be sent along as part of the request, and `size` is the number of bytes to send. `memctx` is a pointer to user defined data which will be passed through to the custom HTTPS_MALLOC/HTTPS_FREE calls. It can be NULL if no user defined data is needed. Returns a `https_t` instance, which needs to be passed to `https_process` to process the request. When the request is finished (or have failed), the returned `https_t` instance needs to be released by calling `https_release`. If the request was invalid, `https_post` returns NULL. https_process ------------- https_status_t https_process( https_t* https ) https.h uses non-blocking sockets, so after a request have been made by calling either `https_get` or `https_post`, you have to keep calling `https_process` for as long as it returns `HTTPS_STATUS_PENDING`. You can call it from a loop which does other work too, for example from inside a game loop or from a loop which calls `https_process` on multiple requests. If the request fails, `https_process` returns `HTTPS_STATUS_FAILED`, and the fields `status_code` and `reason_phrase` may contain more details (for example, status code can be 404 if the requested resource was not found on the server). If the request completes successfully, it returns `HTTPS_STATUS_COMPLETED`. In this case, the `https_t` instance will contain details about the result. `status_code` and `reason_phrase` contains the details about the result, as specified in the HTTPS protocol. `content_type` contains the MIME type for the returns resource, for example `text/html` for a normal web page. `response_data` is the pointer to the received data, and `resonse_size` is the number of bytes it contains. In the case when the response data is in text format, https.h ensures there is a zero terminator placed immediately after the response data block, so it is safe to interpret the resonse data as a `char*`. Note that the data size in this case will be the length of the data without the additional zero terminator. https_release ------------- void https_release( https_t* https ) Releases the resources acquired by `https_get` or `https_post`. Should be call when you are finished with the request. */ /* ---------------------- IMPLEMENTATION ---------------------- */ #ifdef HTTPS_IMPLEMENTATION #undef HTTPS_IMPLEMENTATION #if defined(_MSC_VER) && _MSC_VER < 1600 typedef __int8 int8_t; typedef unsigned __int8 uint8_t; typedef __int16 int16_t; typedef unsigned __int16 uint16_t; typedef __int32 int32_t; typedef unsigned __int32 uint32_t; typedef __int64 int64_t; typedef unsigned __int64 uint64_t; #else #include #endif #ifdef _WIN32 #undef _CRT_NONSTDC_NO_DEPRECATE #define _CRT_NONSTDC_NO_DEPRECATE #undef _CRT_SECURE_NO_WARNINGS #define _CRT_SECURE_NO_WARNINGS #if !defined( _WIN32_WINNT ) || _WIN32_WINNT < 0x0501 #undef _WIN32_WINNT #define _WIN32_WINNT 0x501// requires Windows XP minimum #endif #pragma warning( push ) #pragma warning( disable: 4619 ) // pragma warning : there is no warning number 'number' #pragma warning( disable: 4127 ) // conditional expression is constant #pragma warning( disable: 4255 ) #pragma warning( disable: 4365 ) // 'action' : conversion from 'type_1' to 'type_2', signed/unsigned mismatch #pragma warning( disable: 4574 ) // 'Identifier' is defined to be '0': did you mean to use '#if identifier'? #pragma warning( disable: 4668 ) // 'symbol' is not defined as a preprocessor macro, replacing with '0' for 'directive' #pragma warning( disable: 4706 ) // assignment within conditional expression #include #include #pragma warning( pop ) #pragma comment (lib, "Ws2_32") //< @r-lyeh removed .lib (tcc support) #include #include #define HTTPS_SOCKET SOCKET #define HTTPS_INVALID_SOCKET INVALID_SOCKET #else #include #include #include #include #include #include #include #include #include #include #define HTTPS_SOCKET int #define HTTPS_INVALID_SOCKET -1 #endif static int https_snprintf( char* s, size_t n, char const* format, ... ) { va_list args; va_start( args, format ); #ifdef _WIN32 int r = _vsnprintf( s, n, format, args ); #else int r = vsnprintf( s, n, format, args ); #endif va_end( args ); return r; } #ifndef HTTPS_ASSERT #undef _CRT_NONSTDC_NO_DEPRECATE #define _CRT_NONSTDC_NO_DEPRECATE #undef _CRT_SECURE_NO_WARNINGS #define _CRT_SECURE_NO_WARNINGS #include #define HTTPS_ASSERT( expression, message ) assert( ( expression ) && ( message ) ) #endif #ifndef HTTPS_MALLOC #undef _CRT_NONSTDC_NO_DEPRECATE #define _CRT_NONSTDC_NO_DEPRECATE #undef _CRT_SECURE_NO_WARNINGS #define _CRT_SECURE_NO_WARNINGS #include #define HTTPS_MALLOC( ctx, size ) memset( MALLOC( size ), 0, size ) //< @r-lyeh: unify #define HTTPS_FREE( ctx, ptr ) ( FREE( ptr ) ) //< @r-lyeh: unify #endif #define XMALLOC https_internal_xmalloc #define XREALLOC https_internal_xrealloc #define XCALLOC https_internal_xcalloc #define XFREE https_internal_xfree void tls_init(); void* https_internal_memctx( void* set ); #define HTTPS_NO_THREADING 0 #if HTTPS_NO_THREADING void* https_internal_memctx( void* set ) { return 0; } #else #if defined( _WIN32 ) #ifdef __cplusplus extern "C" { #endif #ifdef __TINYC__ //#include // PRTL_RUN_ONCE typedef struct _RTL_RUN_ONCE { PVOID Ptr; } RTL_RUN_ONCE, *PRTL_RUN_ONCE; typedef DWORD (WINAPI *PRTL_RUN_ONCE_INIT_FN)(PRTL_RUN_ONCE, PVOID, PVOID *); #endif #if is(tcc) // ndef __MINGW64__ //< @r-lyeh WINBASEAPI BOOL WINAPI InitOnceExecuteOnce( PRTL_RUN_ONCE InitOnce, BOOL (WINAPI*)( PRTL_RUN_ONCE, PVOID, PVOID* ), PVOID Parameter, LPVOID * Context ); #endif #ifdef __cplusplus } #endif static RTL_RUN_ONCE https_internal_one_time_init_instance = { 0 }; static DWORD https_internal_tls = TLS_OUT_OF_INDEXES; BOOL CALLBACK https_internal_one_time_init( PRTL_RUN_ONCE InitOnce, PVOID Parameter, PVOID *lpContext) { (void)InitOnce; (void)Parameter; (void)lpContext; // WSADATA wsa_data; // int result = WSAStartup( MAKEWORD( 1, 0 ), &wsa_data ); // HTTPS_ASSERT( result == 0, "Failed to initialize winsock" ); // (void) result; // do_once { WSADATA data; (void)WSAStartup(MAKEWORD(2,2), &data); // } https_internal_tls = TlsAlloc(); HTTPS_ASSERT( https_internal_tls != TLS_OUT_OF_INDEXES, "Failed to initialize thread local storage" ); tls_init(); return TRUE; } #else static pthread_once_t https_internal_one_time_init_instance = PTHREAD_ONCE_INIT; static pthread_key_t https_internal_tls; void https_internal_one_time_init( void ) { int result = pthread_key_create( &https_internal_tls, NULL ); HTTPS_ASSERT( result == 0, "Failed to initialize thread local storage" ); tls_init(); } #endif // _WIN32 void* https_internal_memctx( void* set ) { if( set ) { #if defined( _WIN32 ) TlsSetValue( https_internal_tls, set ); #else pthread_setspecific( https_internal_tls, set ); #endif return NULL; } else { #if defined( _WIN32 ) return TlsGetValue( https_internal_tls ); #else return pthread_getspecific( https_internal_tls ); #endif } } #endif // if 0 void* https_internal_xmalloc( size_t n ) { uint64_t* ptr = (uint64_t*) HTTPS_MALLOC( https_internal_memctx( NULL ), n + sizeof( uint64_t ) ); *ptr = (uint64_t) n; return (void*)( ptr + 1 ); } void* https_internal_xcalloc( size_t n, size_t s ) { void* ptr = https_internal_xmalloc( n * s ); memset( ptr, 0, n * s ); return ptr; } void https_internal_xfree( void* p ) { if( !p ) return; void* real_ptr = (void*)( ( (uint64_t*) p ) - 1 ); HTTPS_FREE( https_internal_memctx( NULL ), real_ptr ); } void* https_internal_xrealloc( void* p, size_t n ) { if( !p ) return https_internal_xmalloc( n ); void* real_ptr = (void*)( ( (uint64_t*) p ) - 1 ); size_t prev_size = (size_t)( *(uint64_t*) real_ptr ); if( prev_size >= n ) return p; // Never make smaller void* new_ptr = https_internal_xmalloc( n ); memcpy( new_ptr, p, prev_size ); https_internal_xfree( p ); return new_ptr; } #ifdef __cplusplus // MG: As there were hundreds of places where the C code relied on implicit casts from void* to some other pointer // type, I'm using this construct to make it easier to add the casts. It's a simple template which allows you to // to cast, via the template operator, to anything. In the rest of the code, I have just added the AUTO_CAST // macro where needed (which has no effect in C builds). template< typename T > struct void_cast_helper { void_cast_helper( T const& x_ ) : x( x_ ) { } template< typename U > operator U() { return (U)x; } void_cast_helper& operator=( void_cast_helper const& ); // no assignment operator as we're storing a const T const& x; }; template< typename T > void_cast_helper void_cast( T const& x ) { return void_cast_helper( x ); } #define AUTO_CAST( x ) void_cast( x ) #else #define AUTO_CAST( x ) x #endif #pragma warning( disable: 4619 ) #pragma warning( disable: 4005 ) #pragma warning( disable: 4018 ) #pragma warning( disable: 4055 ) #pragma warning( disable: 4047 ) #pragma warning( disable: 4100 ) #pragma warning( disable: 4127 ) #pragma warning( disable: 4242 ) #pragma warning( disable: 4244 ) #pragma warning( disable: 4245 ) #pragma warning( disable: 4255 ) #pragma warning( disable: 4267 ) #pragma warning( disable: 4302 ) #pragma warning( disable: 4311 ) #pragma warning( disable: 4333 ) #pragma warning( disable: 4334 ) #pragma warning( disable: 4365 ) #pragma warning( disable: 4388 ) #pragma warning( disable: 4431 ) #pragma warning( disable: 4668 ) #define LTC_NO_PROTOTYPES #ifndef HTTPS_NO_LIBTOMCRYPT #define HTTPS_NO_LIBTOMCRYPT /* ------------------------------------------------------------------------------ BEGIN libtomcrypt.c ------------------------------------------------------------------------------ */ #ifdef _WIN32 #pragma comment( lib, "Advapi32" ) //< @r-lyeh, tcc support (remove .lib) #endif #ifdef __GNUC__ #define LTC_NO_ASM //< @r-lyeh, gcc support (Error: incorrect register `%eax' used with `q' suffix) #endif #define CRYPT 0x0117 #define LTC_NO_ROLC /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://math.libtomcrypt.com */ #ifndef BN_H_ #define BN_H_ #include #include #include #if !(defined(LTM1) && defined(LTM2) && defined(LTM3)) #if defined(LTM2) #define LTM3 #endif #if defined(LTM1) #define LTM2 #endif #define LTM1 #if defined(LTM_ALL) #define BN_ERROR_C #define BN_FAST_MP_INVMOD_C #define BN_FAST_MP_MONTGOMERY_REDUCE_C #define BN_FAST_S_MP_MUL_DIGS_C #define BN_FAST_S_MP_MUL_HIGH_DIGS_C #define BN_FAST_S_MP_SQR_C #define BN_MP_2EXPT_C #define BN_MP_ABS_C #define BN_MP_ADD_C #define BN_MP_ADD_D_C #define BN_MP_ADDMOD_C #define BN_MP_AND_C #define BN_MP_CLAMP_C #define BN_MP_CLEAR_C #define BN_MP_CLEAR_MULTI_C #define BN_MP_CMP_C #define BN_MP_CMP_D_C #define BN_MP_CMP_MAG_C #define BN_MP_CNT_LSB_C #define BN_MP_COPY_C #define BN_MP_COUNT_BITS_C #define BN_MP_DIV_C #define BN_MP_DIV_2_C #define BN_MP_DIV_2D_C #define BN_MP_DIV_3_C #define BN_MP_DIV_D_C #define BN_MP_DR_IS_MODULUS_C #define BN_MP_DR_REDUCE_C #define BN_MP_DR_SETUP_C #define BN_MP_EXCH_C #define BN_MP_EXPORT_C #define BN_MP_EXPT_D_C #define BN_MP_EXPT_D_EX_C #define BN_MP_EXPTMOD_C #define BN_MP_EXPTMOD_FAST_C #define BN_MP_EXTEUCLID_C #define BN_MP_FREAD_C #define BN_MP_FWRITE_C #define BN_MP_GCD_C #define BN_MP_GET_INT_C #define BN_MP_GET_LONG_C #define BN_MP_GET_LONG_LONG_C #define BN_MP_GROW_C #define BN_MP_IMPORT_C #define BN_MP_INIT_C #define BN_MP_INIT_COPY_C #define BN_MP_INIT_MULTI_C #define BN_MP_INIT_SET_C #define BN_MP_INIT_SET_INT_C #define BN_MP_INIT_SIZE_C #define BN_MP_INVMOD_C #define BN_MP_INVMOD_SLOW_C #define BN_MP_IS_SQUARE_C #define BN_MP_JACOBI_C #define BN_MP_KARATSUBA_MUL_C #define BN_MP_KARATSUBA_SQR_C #define BN_MP_LCM_C #define BN_MP_LSHD_C #define BN_MP_MOD_C #define BN_MP_MOD_2D_C #define BN_MP_MOD_D_C #define BN_MP_MONTGOMERY_CALC_NORMALIZATION_C #define BN_MP_MONTGOMERY_REDUCE_C #define BN_MP_MONTGOMERY_SETUP_C #define BN_MP_MUL_C #define BN_MP_MUL_2_C #define BN_MP_MUL_2D_C #define BN_MP_MUL_D_C #define BN_MP_MULMOD_C #define BN_MP_N_ROOT_C #define BN_MP_N_ROOT_EX_C #define BN_MP_NEG_C #define BN_MP_OR_C #define BN_MP_PRIME_FERMAT_C #define BN_MP_PRIME_IS_DIVISIBLE_C #define BN_MP_PRIME_IS_PRIME_C #define BN_MP_PRIME_MILLER_RABIN_C #define BN_MP_PRIME_NEXT_PRIME_C #define BN_MP_PRIME_RABIN_MILLER_TRIALS_C #define BN_MP_PRIME_RANDOM_EX_C #define BN_MP_RADIX_SIZE_C #define BN_MP_RADIX_SMAP_C #define BN_MP_RAND_C #define BN_MP_READ_RADIX_C #define BN_MP_READ_SIGNED_BIN_C #define BN_MP_READ_UNSIGNED_BIN_C #define BN_MP_REDUCE_C #define BN_MP_REDUCE_2K_C #define BN_MP_REDUCE_2K_L_C #define BN_MP_REDUCE_2K_SETUP_C #define BN_MP_REDUCE_2K_SETUP_L_C #define BN_MP_REDUCE_IS_2K_C #define BN_MP_REDUCE_IS_2K_L_C #define BN_MP_REDUCE_SETUP_C #define BN_MP_RSHD_C #define BN_MP_SET_C #define BN_MP_SET_INT_C #define BN_MP_SET_LONG_C #define BN_MP_SET_LONG_LONG_C #define BN_MP_SHRINK_C #define BN_MP_SIGNED_BIN_SIZE_C #define BN_MP_SQR_C #define BN_MP_SQRMOD_C #define BN_MP_SQRT_C #define BN_MP_SQRTMOD_PRIME_C #define BN_MP_SUB_C #define BN_MP_SUB_D_C #define BN_MP_SUBMOD_C #define BN_MP_TO_SIGNED_BIN_C #define BN_MP_TO_SIGNED_BIN_N_C #define BN_MP_TO_UNSIGNED_BIN_C #define BN_MP_TO_UNSIGNED_BIN_N_C #define BN_MP_TOOM_MUL_C #define BN_MP_TOOM_SQR_C #define BN_MP_TORADIX_C #define BN_MP_TORADIX_N_C #define BN_MP_UNSIGNED_BIN_SIZE_C #define BN_MP_XOR_C #define BN_MP_ZERO_C #define BN_PRIME_TAB_C #define BN_REVERSE_C #define BN_S_MP_ADD_C #define BN_S_MP_EXPTMOD_C #define BN_S_MP_MUL_DIGS_C #define BN_S_MP_MUL_HIGH_DIGS_C #define BN_S_MP_SQR_C #define BN_S_MP_SUB_C #define BNCORE_C #endif #if defined(BN_ERROR_C) #define BN_MP_ERROR_TO_STRING_C #endif #if defined(BN_FAST_MP_INVMOD_C) #define BN_MP_ISEVEN_C #define BN_MP_INIT_MULTI_C #define BN_MP_COPY_C #define BN_MP_MOD_C #define BN_MP_SET_C #define BN_MP_DIV_2_C #define BN_MP_ISODD_C #define BN_MP_SUB_C #define BN_MP_CMP_C #define BN_MP_ISZERO_C #define BN_MP_CMP_D_C #define BN_MP_ADD_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_FAST_MP_MONTGOMERY_REDUCE_C) #define BN_MP_GROW_C #define BN_MP_RSHD_C #define BN_MP_CLAMP_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_FAST_S_MP_MUL_DIGS_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_FAST_S_MP_MUL_HIGH_DIGS_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_FAST_S_MP_SQR_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_2EXPT_C) #define BN_MP_ZERO_C #define BN_MP_GROW_C #endif #if defined(BN_MP_ABS_C) #define BN_MP_COPY_C #endif #if defined(BN_MP_ADD_C) #define BN_S_MP_ADD_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_ADD_D_C) #define BN_MP_GROW_C #define BN_MP_SUB_D_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_ADDMOD_C) #define BN_MP_INIT_C #define BN_MP_ADD_C #define BN_MP_CLEAR_C #define BN_MP_MOD_C #endif #if defined(BN_MP_AND_C) #define BN_MP_INIT_COPY_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_CLAMP_C) #endif #if defined(BN_MP_CLEAR_C) #endif #if defined(BN_MP_CLEAR_MULTI_C) #define BN_MP_CLEAR_C #endif #if defined(BN_MP_CMP_C) #define BN_MP_CMP_MAG_C #endif #if defined(BN_MP_CMP_D_C) #endif #if defined(BN_MP_CMP_MAG_C) #endif #if defined(BN_MP_CNT_LSB_C) #define BN_MP_ISZERO_C #endif #if defined(BN_MP_COPY_C) #define BN_MP_GROW_C #endif #if defined(BN_MP_COUNT_BITS_C) #endif #if defined(BN_MP_DIV_C) #define BN_MP_ISZERO_C #define BN_MP_CMP_MAG_C #define BN_MP_COPY_C #define BN_MP_ZERO_C #define BN_MP_INIT_MULTI_C #define BN_MP_SET_C #define BN_MP_COUNT_BITS_C #define BN_MP_ABS_C #define BN_MP_MUL_2D_C #define BN_MP_CMP_C #define BN_MP_SUB_C #define BN_MP_ADD_C #define BN_MP_DIV_2D_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_MULTI_C #define BN_MP_INIT_SIZE_C #define BN_MP_INIT_C #define BN_MP_INIT_COPY_C #define BN_MP_LSHD_C #define BN_MP_RSHD_C #define BN_MP_MUL_D_C #define BN_MP_CLAMP_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_DIV_2_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_DIV_2D_C) #define BN_MP_COPY_C #define BN_MP_ZERO_C #define BN_MP_INIT_C #define BN_MP_MOD_2D_C #define BN_MP_CLEAR_C #define BN_MP_RSHD_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #endif #if defined(BN_MP_DIV_3_C) #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_DIV_D_C) #define BN_MP_ISZERO_C #define BN_MP_COPY_C #define BN_MP_DIV_2D_C #define BN_MP_DIV_3_C #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_DR_IS_MODULUS_C) #endif #if defined(BN_MP_DR_REDUCE_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_DR_SETUP_C) #endif #if defined(BN_MP_EXCH_C) #endif #if defined(BN_MP_EXPORT_C) #define BN_MP_INIT_COPY_C #define BN_MP_COUNT_BITS_C #define BN_MP_DIV_2D_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_EXPT_D_C) #define BN_MP_EXPT_D_EX_C #endif #if defined(BN_MP_EXPT_D_EX_C) #define BN_MP_INIT_COPY_C #define BN_MP_SET_C #define BN_MP_MUL_C #define BN_MP_CLEAR_C #define BN_MP_SQR_C #endif #if defined(BN_MP_EXPTMOD_C) #define BN_MP_INIT_C #define BN_MP_INVMOD_C #define BN_MP_CLEAR_C #define BN_MP_ABS_C #define BN_MP_CLEAR_MULTI_C #define BN_MP_REDUCE_IS_2K_L_C #define BN_S_MP_EXPTMOD_C #define BN_MP_DR_IS_MODULUS_C #define BN_MP_REDUCE_IS_2K_C #define BN_MP_ISODD_C #define BN_MP_EXPTMOD_FAST_C #endif #if defined(BN_MP_EXPTMOD_FAST_C) #define BN_MP_COUNT_BITS_C #define BN_MP_INIT_C #define BN_MP_CLEAR_C #define BN_MP_MONTGOMERY_SETUP_C #define BN_FAST_MP_MONTGOMERY_REDUCE_C #define BN_MP_MONTGOMERY_REDUCE_C #define BN_MP_DR_SETUP_C #define BN_MP_DR_REDUCE_C #define BN_MP_REDUCE_2K_SETUP_C #define BN_MP_REDUCE_2K_C #define BN_MP_MONTGOMERY_CALC_NORMALIZATION_C #define BN_MP_MULMOD_C #define BN_MP_SET_C #define BN_MP_MOD_C #define BN_MP_COPY_C #define BN_MP_SQR_C #define BN_MP_MUL_C #define BN_MP_EXCH_C #endif #if defined(BN_MP_EXTEUCLID_C) #define BN_MP_INIT_MULTI_C #define BN_MP_SET_C #define BN_MP_COPY_C #define BN_MP_ISZERO_C #define BN_MP_DIV_C #define BN_MP_MUL_C #define BN_MP_SUB_C #define BN_MP_NEG_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_FREAD_C) #define BN_MP_ZERO_C #define BN_MP_S_RMAP_C #define BN_MP_MUL_D_C #define BN_MP_ADD_D_C #define BN_MP_CMP_D_C #endif #if defined(BN_MP_FWRITE_C) #define BN_MP_RADIX_SIZE_C #define BN_MP_TORADIX_C #endif #if defined(BN_MP_GCD_C) #define BN_MP_ISZERO_C #define BN_MP_ABS_C #define BN_MP_INIT_COPY_C #define BN_MP_CNT_LSB_C #define BN_MP_DIV_2D_C #define BN_MP_CMP_MAG_C #define BN_MP_EXCH_C #define BN_S_MP_SUB_C #define BN_MP_MUL_2D_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_GET_INT_C) #endif #if defined(BN_MP_GET_LONG_C) #endif #if defined(BN_MP_GET_LONG_LONG_C) #endif #if defined(BN_MP_GROW_C) #endif #if defined(BN_MP_IMPORT_C) #define BN_MP_ZERO_C #define BN_MP_MUL_2D_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_INIT_C) #endif #if defined(BN_MP_INIT_COPY_C) #define BN_MP_INIT_SIZE_C #define BN_MP_COPY_C #endif #if defined(BN_MP_INIT_MULTI_C) #define BN_MP_ERR_C #define BN_MP_INIT_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_INIT_SET_C) #define BN_MP_INIT_C #define BN_MP_SET_C #endif #if defined(BN_MP_INIT_SET_INT_C) #define BN_MP_INIT_C #define BN_MP_SET_INT_C #endif #if defined(BN_MP_INIT_SIZE_C) #define BN_MP_INIT_C #endif #if defined(BN_MP_INVMOD_C) #define BN_MP_ISZERO_C #define BN_MP_ISODD_C #define BN_FAST_MP_INVMOD_C #define BN_MP_INVMOD_SLOW_C #endif #if defined(BN_MP_INVMOD_SLOW_C) #define BN_MP_ISZERO_C #define BN_MP_INIT_MULTI_C #define BN_MP_MOD_C #define BN_MP_COPY_C #define BN_MP_ISEVEN_C #define BN_MP_SET_C #define BN_MP_DIV_2_C #define BN_MP_ISODD_C #define BN_MP_ADD_C #define BN_MP_SUB_C #define BN_MP_CMP_C #define BN_MP_CMP_D_C #define BN_MP_CMP_MAG_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_IS_SQUARE_C) #define BN_MP_MOD_D_C #define BN_MP_INIT_SET_INT_C #define BN_MP_MOD_C #define BN_MP_GET_INT_C #define BN_MP_SQRT_C #define BN_MP_SQR_C #define BN_MP_CMP_MAG_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_JACOBI_C) #define BN_MP_CMP_D_C #define BN_MP_ISZERO_C #define BN_MP_INIT_COPY_C #define BN_MP_CNT_LSB_C #define BN_MP_DIV_2D_C #define BN_MP_MOD_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_KARATSUBA_MUL_C) #define BN_MP_MUL_C #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_S_MP_ADD_C #define BN_MP_ADD_C #define BN_S_MP_SUB_C #define BN_MP_LSHD_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_KARATSUBA_SQR_C) #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_SQR_C #define BN_S_MP_ADD_C #define BN_S_MP_SUB_C #define BN_MP_LSHD_C #define BN_MP_ADD_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_LCM_C) #define BN_MP_INIT_MULTI_C #define BN_MP_GCD_C #define BN_MP_CMP_MAG_C #define BN_MP_DIV_C #define BN_MP_MUL_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_LSHD_C) #define BN_MP_GROW_C #define BN_MP_RSHD_C #endif #if defined(BN_MP_MOD_C) #define BN_MP_INIT_C #define BN_MP_DIV_C #define BN_MP_CLEAR_C #define BN_MP_ISZERO_C #define BN_MP_EXCH_C #define BN_MP_ADD_C #endif #if defined(BN_MP_MOD_2D_C) #define BN_MP_ZERO_C #define BN_MP_COPY_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_MOD_D_C) #define BN_MP_DIV_D_C #endif #if defined(BN_MP_MONTGOMERY_CALC_NORMALIZATION_C) #define BN_MP_COUNT_BITS_C #define BN_MP_2EXPT_C #define BN_MP_SET_C #define BN_MP_MUL_2_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_MONTGOMERY_REDUCE_C) #define BN_FAST_MP_MONTGOMERY_REDUCE_C #define BN_MP_GROW_C #define BN_MP_CLAMP_C #define BN_MP_RSHD_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_MONTGOMERY_SETUP_C) #endif #if defined(BN_MP_MUL_C) #define BN_MP_TOOM_MUL_C #define BN_MP_KARATSUBA_MUL_C #define BN_FAST_S_MP_MUL_DIGS_C #define BN_S_MP_MUL_C #define BN_S_MP_MUL_DIGS_C #endif #if defined(BN_MP_MUL_2_C) #define BN_MP_GROW_C #endif #if defined(BN_MP_MUL_2D_C) #define BN_MP_COPY_C #define BN_MP_GROW_C #define BN_MP_LSHD_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_MUL_D_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_MULMOD_C) #define BN_MP_INIT_C #define BN_MP_MUL_C #define BN_MP_CLEAR_C #define BN_MP_MOD_C #endif #if defined(BN_MP_N_ROOT_C) #define BN_MP_N_ROOT_EX_C #endif #if defined(BN_MP_N_ROOT_EX_C) #define BN_MP_INIT_C #define BN_MP_SET_C #define BN_MP_COPY_C #define BN_MP_EXPT_D_EX_C #define BN_MP_MUL_C #define BN_MP_SUB_C #define BN_MP_MUL_D_C #define BN_MP_DIV_C #define BN_MP_CMP_C #define BN_MP_SUB_D_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_NEG_C) #define BN_MP_COPY_C #define BN_MP_ISZERO_C #endif #if defined(BN_MP_OR_C) #define BN_MP_INIT_COPY_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_PRIME_FERMAT_C) #define BN_MP_CMP_D_C #define BN_MP_INIT_C #define BN_MP_EXPTMOD_C #define BN_MP_CMP_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_PRIME_IS_DIVISIBLE_C) #define BN_MP_MOD_D_C #endif #if defined(BN_MP_PRIME_IS_PRIME_C) #define BN_MP_CMP_D_C #define BN_MP_PRIME_IS_DIVISIBLE_C #define BN_MP_INIT_C #define BN_MP_SET_C #define BN_MP_PRIME_MILLER_RABIN_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_PRIME_MILLER_RABIN_C) #define BN_MP_CMP_D_C #define BN_MP_INIT_COPY_C #define BN_MP_SUB_D_C #define BN_MP_CNT_LSB_C #define BN_MP_DIV_2D_C #define BN_MP_EXPTMOD_C #define BN_MP_CMP_C #define BN_MP_SQRMOD_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_PRIME_NEXT_PRIME_C) #define BN_MP_CMP_D_C #define BN_MP_SET_C #define BN_MP_SUB_D_C #define BN_MP_ISEVEN_C #define BN_MP_MOD_D_C #define BN_MP_INIT_C #define BN_MP_ADD_D_C #define BN_MP_PRIME_MILLER_RABIN_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_PRIME_RABIN_MILLER_TRIALS_C) #endif #if defined(BN_MP_PRIME_RANDOM_EX_C) #define BN_MP_READ_UNSIGNED_BIN_C #define BN_MP_PRIME_IS_PRIME_C #define BN_MP_SUB_D_C #define BN_MP_DIV_2_C #define BN_MP_MUL_2_C #define BN_MP_ADD_D_C #endif #if defined(BN_MP_RADIX_SIZE_C) #define BN_MP_ISZERO_C #define BN_MP_COUNT_BITS_C #define BN_MP_INIT_COPY_C #define BN_MP_DIV_D_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_RADIX_SMAP_C) #define BN_MP_S_RMAP_C #endif #if defined(BN_MP_RAND_C) #define BN_MP_ZERO_C #define BN_MP_ADD_D_C #define BN_MP_LSHD_C #endif #if defined(BN_MP_READ_RADIX_C) #define BN_MP_ZERO_C #define BN_MP_S_RMAP_C #define BN_MP_MUL_D_C #define BN_MP_ADD_D_C #define BN_MP_ISZERO_C #endif #if defined(BN_MP_READ_SIGNED_BIN_C) #define BN_MP_READ_UNSIGNED_BIN_C #endif #if defined(BN_MP_READ_UNSIGNED_BIN_C) #define BN_MP_GROW_C #define BN_MP_ZERO_C #define BN_MP_MUL_2D_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_REDUCE_C) #define BN_MP_REDUCE_SETUP_C #define BN_MP_INIT_COPY_C #define BN_MP_RSHD_C #define BN_MP_MUL_C #define BN_S_MP_MUL_HIGH_DIGS_C #define BN_FAST_S_MP_MUL_HIGH_DIGS_C #define BN_MP_MOD_2D_C #define BN_S_MP_MUL_DIGS_C #define BN_MP_SUB_C #define BN_MP_CMP_D_C #define BN_MP_SET_C #define BN_MP_LSHD_C #define BN_MP_ADD_C #define BN_MP_CMP_C #define BN_S_MP_SUB_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_REDUCE_2K_C) #define BN_MP_INIT_C #define BN_MP_COUNT_BITS_C #define BN_MP_DIV_2D_C #define BN_MP_MUL_D_C #define BN_S_MP_ADD_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_REDUCE_2K_L_C) #define BN_MP_INIT_C #define BN_MP_COUNT_BITS_C #define BN_MP_DIV_2D_C #define BN_MP_MUL_C #define BN_S_MP_ADD_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_REDUCE_2K_SETUP_C) #define BN_MP_INIT_C #define BN_MP_COUNT_BITS_C #define BN_MP_2EXPT_C #define BN_MP_CLEAR_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_REDUCE_2K_SETUP_L_C) #define BN_MP_INIT_C #define BN_MP_2EXPT_C #define BN_MP_COUNT_BITS_C #define BN_S_MP_SUB_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_REDUCE_IS_2K_C) #define BN_MP_REDUCE_2K_C #define BN_MP_COUNT_BITS_C #endif #if defined(BN_MP_REDUCE_IS_2K_L_C) #endif #if defined(BN_MP_REDUCE_SETUP_C) #define BN_MP_2EXPT_C #define BN_MP_DIV_C #endif #if defined(BN_MP_RSHD_C) #define BN_MP_ZERO_C #endif #if defined(BN_MP_SET_C) #define BN_MP_ZERO_C #endif #if defined(BN_MP_SET_INT_C) #define BN_MP_ZERO_C #define BN_MP_MUL_2D_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_SET_LONG_C) #endif #if defined(BN_MP_SET_LONG_LONG_C) #endif #if defined(BN_MP_SHRINK_C) #endif #if defined(BN_MP_SIGNED_BIN_SIZE_C) #define BN_MP_UNSIGNED_BIN_SIZE_C #endif #if defined(BN_MP_SQR_C) #define BN_MP_TOOM_SQR_C #define BN_MP_KARATSUBA_SQR_C #define BN_FAST_S_MP_SQR_C #define BN_S_MP_SQR_C #endif #if defined(BN_MP_SQRMOD_C) #define BN_MP_INIT_C #define BN_MP_SQR_C #define BN_MP_CLEAR_C #define BN_MP_MOD_C #endif #if defined(BN_MP_SQRT_C) #define BN_MP_N_ROOT_C #define BN_MP_ISZERO_C #define BN_MP_ZERO_C #define BN_MP_INIT_COPY_C #define BN_MP_RSHD_C #define BN_MP_DIV_C #define BN_MP_ADD_C #define BN_MP_DIV_2_C #define BN_MP_CMP_MAG_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_SQRTMOD_PRIME_C) #define BN_MP_CMP_D_C #define BN_MP_ZERO_C #define BN_MP_JACOBI_C #define BN_MP_INIT_MULTI_C #define BN_MP_MOD_D_C #define BN_MP_ADD_D_C #define BN_MP_DIV_2_C #define BN_MP_EXPTMOD_C #define BN_MP_COPY_C #define BN_MP_SUB_D_C #define BN_MP_ISEVEN_C #define BN_MP_SET_INT_C #define BN_MP_SQRMOD_C #define BN_MP_MULMOD_C #define BN_MP_SET_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_SUB_C) #define BN_S_MP_ADD_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_SUB_D_C) #define BN_MP_GROW_C #define BN_MP_ADD_D_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_SUBMOD_C) #define BN_MP_INIT_C #define BN_MP_SUB_C #define BN_MP_CLEAR_C #define BN_MP_MOD_C #endif #if defined(BN_MP_TO_SIGNED_BIN_C) #define BN_MP_TO_UNSIGNED_BIN_C #endif #if defined(BN_MP_TO_SIGNED_BIN_N_C) #define BN_MP_SIGNED_BIN_SIZE_C #define BN_MP_TO_SIGNED_BIN_C #endif #if defined(BN_MP_TO_UNSIGNED_BIN_C) #define BN_MP_INIT_COPY_C #define BN_MP_ISZERO_C #define BN_MP_DIV_2D_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_TO_UNSIGNED_BIN_N_C) #define BN_MP_UNSIGNED_BIN_SIZE_C #define BN_MP_TO_UNSIGNED_BIN_C #endif #if defined(BN_MP_TOOM_MUL_C) #define BN_MP_INIT_MULTI_C #define BN_MP_MOD_2D_C #define BN_MP_COPY_C #define BN_MP_RSHD_C #define BN_MP_MUL_C #define BN_MP_MUL_2_C #define BN_MP_ADD_C #define BN_MP_SUB_C #define BN_MP_DIV_2_C #define BN_MP_MUL_2D_C #define BN_MP_MUL_D_C #define BN_MP_DIV_3_C #define BN_MP_LSHD_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_TOOM_SQR_C) #define BN_MP_INIT_MULTI_C #define BN_MP_MOD_2D_C #define BN_MP_COPY_C #define BN_MP_RSHD_C #define BN_MP_SQR_C #define BN_MP_MUL_2_C #define BN_MP_ADD_C #define BN_MP_SUB_C #define BN_MP_DIV_2_C #define BN_MP_MUL_2D_C #define BN_MP_MUL_D_C #define BN_MP_DIV_3_C #define BN_MP_LSHD_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_TORADIX_C) #define BN_MP_ISZERO_C #define BN_MP_INIT_COPY_C #define BN_MP_DIV_D_C #define BN_MP_CLEAR_C #define BN_MP_S_RMAP_C #endif #if defined(BN_MP_TORADIX_N_C) #define BN_MP_ISZERO_C #define BN_MP_INIT_COPY_C #define BN_MP_DIV_D_C #define BN_MP_CLEAR_C #define BN_MP_S_RMAP_C #endif #if defined(BN_MP_UNSIGNED_BIN_SIZE_C) #define BN_MP_COUNT_BITS_C #endif #if defined(BN_MP_XOR_C) #define BN_MP_INIT_COPY_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_ZERO_C) #endif #if defined(BN_PRIME_TAB_C) #endif #if defined(BN_REVERSE_C) #endif #if defined(BN_S_MP_ADD_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_S_MP_EXPTMOD_C) #define BN_MP_COUNT_BITS_C #define BN_MP_INIT_C #define BN_MP_CLEAR_C #define BN_MP_REDUCE_SETUP_C #define BN_MP_REDUCE_C #define BN_MP_REDUCE_2K_SETUP_L_C #define BN_MP_REDUCE_2K_L_C #define BN_MP_MOD_C #define BN_MP_COPY_C #define BN_MP_SQR_C #define BN_MP_MUL_C #define BN_MP_SET_C #define BN_MP_EXCH_C #endif #if defined(BN_S_MP_MUL_DIGS_C) #define BN_FAST_S_MP_MUL_DIGS_C #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_S_MP_MUL_HIGH_DIGS_C) #define BN_FAST_S_MP_MUL_HIGH_DIGS_C #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_S_MP_SQR_C) #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_S_MP_SUB_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BNCORE_C) #endif #ifdef LTM3 #define LTM_LAST #endif /* super class file for PK algos */ /* default ... include all MPI */ #define LTM_ALL /* RSA only (does not support DH/DSA/ECC) */ /* #define SC_RSA_1 */ /* For reference.... On an Athlon64 optimizing for speed... LTM's mpi.o with all functions [striped] is 142KiB in size. */ /* Works for RSA only, mpi.o is 68KiB */ #ifdef SC_RSA_1 #define BN_MP_SHRINK_C #define BN_MP_LCM_C #define BN_MP_PRIME_RANDOM_EX_C #define BN_MP_INVMOD_C #define BN_MP_GCD_C #define BN_MP_MOD_C #define BN_MP_MULMOD_C #define BN_MP_ADDMOD_C #define BN_MP_EXPTMOD_C #define BN_MP_SET_INT_C #define BN_MP_INIT_MULTI_C #define BN_MP_CLEAR_MULTI_C #define BN_MP_UNSIGNED_BIN_SIZE_C #define BN_MP_TO_UNSIGNED_BIN_C #define BN_MP_MOD_D_C #define BN_MP_PRIME_RABIN_MILLER_TRIALS_C #define BN_REVERSE_C #define BN_PRIME_TAB_C /* other modifiers */ #define BN_MP_DIV_SMALL /* Slower division, not critical */ /* here we are on the last pass so we turn things off. The functions classes are still there * but we remove them specifically from the build. This also invokes tweaks in functions * like removing support for even moduli, etc... */ #ifdef LTM_LAST #undef BN_MP_TOOM_MUL_C #undef BN_MP_TOOM_SQR_C #undef BN_MP_KARATSUBA_MUL_C #undef BN_MP_KARATSUBA_SQR_C #undef BN_MP_REDUCE_C #undef BN_MP_REDUCE_SETUP_C #undef BN_MP_DR_IS_MODULUS_C #undef BN_MP_DR_SETUP_C #undef BN_MP_DR_REDUCE_C #undef BN_MP_REDUCE_IS_2K_C #undef BN_MP_REDUCE_2K_SETUP_C #undef BN_MP_REDUCE_2K_C #undef BN_S_MP_EXPTMOD_C #undef BN_MP_DIV_3_C #undef BN_S_MP_MUL_HIGH_DIGS_C #undef BN_FAST_S_MP_MUL_HIGH_DIGS_C #undef BN_FAST_MP_INVMOD_C /* To safely undefine these you have to make sure your RSA key won't exceed the Comba threshold * which is roughly 255 digits [7140 bits for 32-bit machines, 15300 bits for 64-bit machines] * which means roughly speaking you can handle upto 2536-bit RSA keys with these defined without * trouble. */ #undef BN_S_MP_MUL_DIGS_C #undef BN_S_MP_SQR_C #undef BN_MP_MONTGOMERY_REDUCE_C #endif #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #if !(defined(LTM1) && defined(LTM2) && defined(LTM3)) #if defined(LTM2) #define LTM3 #endif #if defined(LTM1) #define LTM2 #endif #define LTM1 #if defined(LTM_ALL) #define BN_ERROR_C #define BN_FAST_MP_INVMOD_C #define BN_FAST_MP_MONTGOMERY_REDUCE_C #define BN_FAST_S_MP_MUL_DIGS_C #define BN_FAST_S_MP_MUL_HIGH_DIGS_C #define BN_FAST_S_MP_SQR_C #define BN_MP_2EXPT_C #define BN_MP_ABS_C #define BN_MP_ADD_C #define BN_MP_ADD_D_C #define BN_MP_ADDMOD_C #define BN_MP_AND_C #define BN_MP_CLAMP_C #define BN_MP_CLEAR_C #define BN_MP_CLEAR_MULTI_C #define BN_MP_CMP_C #define BN_MP_CMP_D_C #define BN_MP_CMP_MAG_C #define BN_MP_CNT_LSB_C #define BN_MP_COPY_C #define BN_MP_COUNT_BITS_C #define BN_MP_DIV_C #define BN_MP_DIV_2_C #define BN_MP_DIV_2D_C #define BN_MP_DIV_3_C #define BN_MP_DIV_D_C #define BN_MP_DR_IS_MODULUS_C #define BN_MP_DR_REDUCE_C #define BN_MP_DR_SETUP_C #define BN_MP_EXCH_C #define BN_MP_EXPORT_C #define BN_MP_EXPT_D_C #define BN_MP_EXPT_D_EX_C #define BN_MP_EXPTMOD_C #define BN_MP_EXPTMOD_FAST_C #define BN_MP_EXTEUCLID_C #define BN_MP_FREAD_C #define BN_MP_FWRITE_C #define BN_MP_GCD_C #define BN_MP_GET_INT_C #define BN_MP_GET_LONG_C #define BN_MP_GET_LONG_LONG_C #define BN_MP_GROW_C #define BN_MP_IMPORT_C #define BN_MP_INIT_C #define BN_MP_INIT_COPY_C #define BN_MP_INIT_MULTI_C #define BN_MP_INIT_SET_C #define BN_MP_INIT_SET_INT_C #define BN_MP_INIT_SIZE_C #define BN_MP_INVMOD_C #define BN_MP_INVMOD_SLOW_C #define BN_MP_IS_SQUARE_C #define BN_MP_JACOBI_C #define BN_MP_KARATSUBA_MUL_C #define BN_MP_KARATSUBA_SQR_C #define BN_MP_LCM_C #define BN_MP_LSHD_C #define BN_MP_MOD_C #define BN_MP_MOD_2D_C #define BN_MP_MOD_D_C #define BN_MP_MONTGOMERY_CALC_NORMALIZATION_C #define BN_MP_MONTGOMERY_REDUCE_C #define BN_MP_MONTGOMERY_SETUP_C #define BN_MP_MUL_C #define BN_MP_MUL_2_C #define BN_MP_MUL_2D_C #define BN_MP_MUL_D_C #define BN_MP_MULMOD_C #define BN_MP_N_ROOT_C #define BN_MP_N_ROOT_EX_C #define BN_MP_NEG_C #define BN_MP_OR_C #define BN_MP_PRIME_FERMAT_C #define BN_MP_PRIME_IS_DIVISIBLE_C #define BN_MP_PRIME_IS_PRIME_C #define BN_MP_PRIME_MILLER_RABIN_C #define BN_MP_PRIME_NEXT_PRIME_C #define BN_MP_PRIME_RABIN_MILLER_TRIALS_C #define BN_MP_PRIME_RANDOM_EX_C #define BN_MP_RADIX_SIZE_C #define BN_MP_RADIX_SMAP_C #define BN_MP_RAND_C #define BN_MP_READ_RADIX_C #define BN_MP_READ_SIGNED_BIN_C #define BN_MP_READ_UNSIGNED_BIN_C #define BN_MP_REDUCE_C #define BN_MP_REDUCE_2K_C #define BN_MP_REDUCE_2K_L_C #define BN_MP_REDUCE_2K_SETUP_C #define BN_MP_REDUCE_2K_SETUP_L_C #define BN_MP_REDUCE_IS_2K_C #define BN_MP_REDUCE_IS_2K_L_C #define BN_MP_REDUCE_SETUP_C #define BN_MP_RSHD_C #define BN_MP_SET_C #define BN_MP_SET_INT_C #define BN_MP_SET_LONG_C #define BN_MP_SET_LONG_LONG_C #define BN_MP_SHRINK_C #define BN_MP_SIGNED_BIN_SIZE_C #define BN_MP_SQR_C #define BN_MP_SQRMOD_C #define BN_MP_SQRT_C #define BN_MP_SQRTMOD_PRIME_C #define BN_MP_SUB_C #define BN_MP_SUB_D_C #define BN_MP_SUBMOD_C #define BN_MP_TO_SIGNED_BIN_C #define BN_MP_TO_SIGNED_BIN_N_C #define BN_MP_TO_UNSIGNED_BIN_C #define BN_MP_TO_UNSIGNED_BIN_N_C #define BN_MP_TOOM_MUL_C #define BN_MP_TOOM_SQR_C #define BN_MP_TORADIX_C #define BN_MP_TORADIX_N_C #define BN_MP_UNSIGNED_BIN_SIZE_C #define BN_MP_XOR_C #define BN_MP_ZERO_C #define BN_PRIME_TAB_C #define BN_REVERSE_C #define BN_S_MP_ADD_C #define BN_S_MP_EXPTMOD_C #define BN_S_MP_MUL_DIGS_C #define BN_S_MP_MUL_HIGH_DIGS_C #define BN_S_MP_SQR_C #define BN_S_MP_SUB_C #define BNCORE_C #endif #if defined(BN_ERROR_C) #define BN_MP_ERROR_TO_STRING_C #endif #if defined(BN_FAST_MP_INVMOD_C) #define BN_MP_ISEVEN_C #define BN_MP_INIT_MULTI_C #define BN_MP_COPY_C #define BN_MP_MOD_C #define BN_MP_SET_C #define BN_MP_DIV_2_C #define BN_MP_ISODD_C #define BN_MP_SUB_C #define BN_MP_CMP_C #define BN_MP_ISZERO_C #define BN_MP_CMP_D_C #define BN_MP_ADD_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_FAST_MP_MONTGOMERY_REDUCE_C) #define BN_MP_GROW_C #define BN_MP_RSHD_C #define BN_MP_CLAMP_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_FAST_S_MP_MUL_DIGS_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_FAST_S_MP_MUL_HIGH_DIGS_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_FAST_S_MP_SQR_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_2EXPT_C) #define BN_MP_ZERO_C #define BN_MP_GROW_C #endif #if defined(BN_MP_ABS_C) #define BN_MP_COPY_C #endif #if defined(BN_MP_ADD_C) #define BN_S_MP_ADD_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_ADD_D_C) #define BN_MP_GROW_C #define BN_MP_SUB_D_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_ADDMOD_C) #define BN_MP_INIT_C #define BN_MP_ADD_C #define BN_MP_CLEAR_C #define BN_MP_MOD_C #endif #if defined(BN_MP_AND_C) #define BN_MP_INIT_COPY_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_CLAMP_C) #endif #if defined(BN_MP_CLEAR_C) #endif #if defined(BN_MP_CLEAR_MULTI_C) #define BN_MP_CLEAR_C #endif #if defined(BN_MP_CMP_C) #define BN_MP_CMP_MAG_C #endif #if defined(BN_MP_CMP_D_C) #endif #if defined(BN_MP_CMP_MAG_C) #endif #if defined(BN_MP_CNT_LSB_C) #define BN_MP_ISZERO_C #endif #if defined(BN_MP_COPY_C) #define BN_MP_GROW_C #endif #if defined(BN_MP_COUNT_BITS_C) #endif #if defined(BN_MP_DIV_C) #define BN_MP_ISZERO_C #define BN_MP_CMP_MAG_C #define BN_MP_COPY_C #define BN_MP_ZERO_C #define BN_MP_INIT_MULTI_C #define BN_MP_SET_C #define BN_MP_COUNT_BITS_C #define BN_MP_ABS_C #define BN_MP_MUL_2D_C #define BN_MP_CMP_C #define BN_MP_SUB_C #define BN_MP_ADD_C #define BN_MP_DIV_2D_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_MULTI_C #define BN_MP_INIT_SIZE_C #define BN_MP_INIT_C #define BN_MP_INIT_COPY_C #define BN_MP_LSHD_C #define BN_MP_RSHD_C #define BN_MP_MUL_D_C #define BN_MP_CLAMP_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_DIV_2_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_DIV_2D_C) #define BN_MP_COPY_C #define BN_MP_ZERO_C #define BN_MP_INIT_C #define BN_MP_MOD_2D_C #define BN_MP_CLEAR_C #define BN_MP_RSHD_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #endif #if defined(BN_MP_DIV_3_C) #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_DIV_D_C) #define BN_MP_ISZERO_C #define BN_MP_COPY_C #define BN_MP_DIV_2D_C #define BN_MP_DIV_3_C #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_DR_IS_MODULUS_C) #endif #if defined(BN_MP_DR_REDUCE_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_DR_SETUP_C) #endif #if defined(BN_MP_EXCH_C) #endif #if defined(BN_MP_EXPORT_C) #define BN_MP_INIT_COPY_C #define BN_MP_COUNT_BITS_C #define BN_MP_DIV_2D_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_EXPT_D_C) #define BN_MP_EXPT_D_EX_C #endif #if defined(BN_MP_EXPT_D_EX_C) #define BN_MP_INIT_COPY_C #define BN_MP_SET_C #define BN_MP_MUL_C #define BN_MP_CLEAR_C #define BN_MP_SQR_C #endif #if defined(BN_MP_EXPTMOD_C) #define BN_MP_INIT_C #define BN_MP_INVMOD_C #define BN_MP_CLEAR_C #define BN_MP_ABS_C #define BN_MP_CLEAR_MULTI_C #define BN_MP_REDUCE_IS_2K_L_C #define BN_S_MP_EXPTMOD_C #define BN_MP_DR_IS_MODULUS_C #define BN_MP_REDUCE_IS_2K_C #define BN_MP_ISODD_C #define BN_MP_EXPTMOD_FAST_C #endif #if defined(BN_MP_EXPTMOD_FAST_C) #define BN_MP_COUNT_BITS_C #define BN_MP_INIT_C #define BN_MP_CLEAR_C #define BN_MP_MONTGOMERY_SETUP_C #define BN_FAST_MP_MONTGOMERY_REDUCE_C #define BN_MP_MONTGOMERY_REDUCE_C #define BN_MP_DR_SETUP_C #define BN_MP_DR_REDUCE_C #define BN_MP_REDUCE_2K_SETUP_C #define BN_MP_REDUCE_2K_C #define BN_MP_MONTGOMERY_CALC_NORMALIZATION_C #define BN_MP_MULMOD_C #define BN_MP_SET_C #define BN_MP_MOD_C #define BN_MP_COPY_C #define BN_MP_SQR_C #define BN_MP_MUL_C #define BN_MP_EXCH_C #endif #if defined(BN_MP_EXTEUCLID_C) #define BN_MP_INIT_MULTI_C #define BN_MP_SET_C #define BN_MP_COPY_C #define BN_MP_ISZERO_C #define BN_MP_DIV_C #define BN_MP_MUL_C #define BN_MP_SUB_C #define BN_MP_NEG_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_FREAD_C) #define BN_MP_ZERO_C #define BN_MP_S_RMAP_C #define BN_MP_MUL_D_C #define BN_MP_ADD_D_C #define BN_MP_CMP_D_C #endif #if defined(BN_MP_FWRITE_C) #define BN_MP_RADIX_SIZE_C #define BN_MP_TORADIX_C #endif #if defined(BN_MP_GCD_C) #define BN_MP_ISZERO_C #define BN_MP_ABS_C #define BN_MP_INIT_COPY_C #define BN_MP_CNT_LSB_C #define BN_MP_DIV_2D_C #define BN_MP_CMP_MAG_C #define BN_MP_EXCH_C #define BN_S_MP_SUB_C #define BN_MP_MUL_2D_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_GET_INT_C) #endif #if defined(BN_MP_GET_LONG_C) #endif #if defined(BN_MP_GET_LONG_LONG_C) #endif #if defined(BN_MP_GROW_C) #endif #if defined(BN_MP_IMPORT_C) #define BN_MP_ZERO_C #define BN_MP_MUL_2D_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_INIT_C) #endif #if defined(BN_MP_INIT_COPY_C) #define BN_MP_INIT_SIZE_C #define BN_MP_COPY_C #endif #if defined(BN_MP_INIT_MULTI_C) #define BN_MP_ERR_C #define BN_MP_INIT_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_INIT_SET_C) #define BN_MP_INIT_C #define BN_MP_SET_C #endif #if defined(BN_MP_INIT_SET_INT_C) #define BN_MP_INIT_C #define BN_MP_SET_INT_C #endif #if defined(BN_MP_INIT_SIZE_C) #define BN_MP_INIT_C #endif #if defined(BN_MP_INVMOD_C) #define BN_MP_ISZERO_C #define BN_MP_ISODD_C #define BN_FAST_MP_INVMOD_C #define BN_MP_INVMOD_SLOW_C #endif #if defined(BN_MP_INVMOD_SLOW_C) #define BN_MP_ISZERO_C #define BN_MP_INIT_MULTI_C #define BN_MP_MOD_C #define BN_MP_COPY_C #define BN_MP_ISEVEN_C #define BN_MP_SET_C #define BN_MP_DIV_2_C #define BN_MP_ISODD_C #define BN_MP_ADD_C #define BN_MP_SUB_C #define BN_MP_CMP_C #define BN_MP_CMP_D_C #define BN_MP_CMP_MAG_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_IS_SQUARE_C) #define BN_MP_MOD_D_C #define BN_MP_INIT_SET_INT_C #define BN_MP_MOD_C #define BN_MP_GET_INT_C #define BN_MP_SQRT_C #define BN_MP_SQR_C #define BN_MP_CMP_MAG_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_JACOBI_C) #define BN_MP_CMP_D_C #define BN_MP_ISZERO_C #define BN_MP_INIT_COPY_C #define BN_MP_CNT_LSB_C #define BN_MP_DIV_2D_C #define BN_MP_MOD_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_KARATSUBA_MUL_C) #define BN_MP_MUL_C #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_S_MP_ADD_C #define BN_MP_ADD_C #define BN_S_MP_SUB_C #define BN_MP_LSHD_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_KARATSUBA_SQR_C) #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_SQR_C #define BN_S_MP_ADD_C #define BN_S_MP_SUB_C #define BN_MP_LSHD_C #define BN_MP_ADD_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_LCM_C) #define BN_MP_INIT_MULTI_C #define BN_MP_GCD_C #define BN_MP_CMP_MAG_C #define BN_MP_DIV_C #define BN_MP_MUL_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_LSHD_C) #define BN_MP_GROW_C #define BN_MP_RSHD_C #endif #if defined(BN_MP_MOD_C) #define BN_MP_INIT_C #define BN_MP_DIV_C #define BN_MP_CLEAR_C #define BN_MP_ISZERO_C #define BN_MP_EXCH_C #define BN_MP_ADD_C #endif #if defined(BN_MP_MOD_2D_C) #define BN_MP_ZERO_C #define BN_MP_COPY_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_MOD_D_C) #define BN_MP_DIV_D_C #endif #if defined(BN_MP_MONTGOMERY_CALC_NORMALIZATION_C) #define BN_MP_COUNT_BITS_C #define BN_MP_2EXPT_C #define BN_MP_SET_C #define BN_MP_MUL_2_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_MONTGOMERY_REDUCE_C) #define BN_FAST_MP_MONTGOMERY_REDUCE_C #define BN_MP_GROW_C #define BN_MP_CLAMP_C #define BN_MP_RSHD_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_MONTGOMERY_SETUP_C) #endif #if defined(BN_MP_MUL_C) #define BN_MP_TOOM_MUL_C #define BN_MP_KARATSUBA_MUL_C #define BN_FAST_S_MP_MUL_DIGS_C #define BN_S_MP_MUL_C #define BN_S_MP_MUL_DIGS_C #endif #if defined(BN_MP_MUL_2_C) #define BN_MP_GROW_C #endif #if defined(BN_MP_MUL_2D_C) #define BN_MP_COPY_C #define BN_MP_GROW_C #define BN_MP_LSHD_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_MUL_D_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_MULMOD_C) #define BN_MP_INIT_C #define BN_MP_MUL_C #define BN_MP_CLEAR_C #define BN_MP_MOD_C #endif #if defined(BN_MP_N_ROOT_C) #define BN_MP_N_ROOT_EX_C #endif #if defined(BN_MP_N_ROOT_EX_C) #define BN_MP_INIT_C #define BN_MP_SET_C #define BN_MP_COPY_C #define BN_MP_EXPT_D_EX_C #define BN_MP_MUL_C #define BN_MP_SUB_C #define BN_MP_MUL_D_C #define BN_MP_DIV_C #define BN_MP_CMP_C #define BN_MP_SUB_D_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_NEG_C) #define BN_MP_COPY_C #define BN_MP_ISZERO_C #endif #if defined(BN_MP_OR_C) #define BN_MP_INIT_COPY_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_PRIME_FERMAT_C) #define BN_MP_CMP_D_C #define BN_MP_INIT_C #define BN_MP_EXPTMOD_C #define BN_MP_CMP_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_PRIME_IS_DIVISIBLE_C) #define BN_MP_MOD_D_C #endif #if defined(BN_MP_PRIME_IS_PRIME_C) #define BN_MP_CMP_D_C #define BN_MP_PRIME_IS_DIVISIBLE_C #define BN_MP_INIT_C #define BN_MP_SET_C #define BN_MP_PRIME_MILLER_RABIN_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_PRIME_MILLER_RABIN_C) #define BN_MP_CMP_D_C #define BN_MP_INIT_COPY_C #define BN_MP_SUB_D_C #define BN_MP_CNT_LSB_C #define BN_MP_DIV_2D_C #define BN_MP_EXPTMOD_C #define BN_MP_CMP_C #define BN_MP_SQRMOD_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_PRIME_NEXT_PRIME_C) #define BN_MP_CMP_D_C #define BN_MP_SET_C #define BN_MP_SUB_D_C #define BN_MP_ISEVEN_C #define BN_MP_MOD_D_C #define BN_MP_INIT_C #define BN_MP_ADD_D_C #define BN_MP_PRIME_MILLER_RABIN_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_PRIME_RABIN_MILLER_TRIALS_C) #endif #if defined(BN_MP_PRIME_RANDOM_EX_C) #define BN_MP_READ_UNSIGNED_BIN_C #define BN_MP_PRIME_IS_PRIME_C #define BN_MP_SUB_D_C #define BN_MP_DIV_2_C #define BN_MP_MUL_2_C #define BN_MP_ADD_D_C #endif #if defined(BN_MP_RADIX_SIZE_C) #define BN_MP_ISZERO_C #define BN_MP_COUNT_BITS_C #define BN_MP_INIT_COPY_C #define BN_MP_DIV_D_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_RADIX_SMAP_C) #define BN_MP_S_RMAP_C #endif #if defined(BN_MP_RAND_C) #define BN_MP_ZERO_C #define BN_MP_ADD_D_C #define BN_MP_LSHD_C #endif #if defined(BN_MP_READ_RADIX_C) #define BN_MP_ZERO_C #define BN_MP_S_RMAP_C #define BN_MP_MUL_D_C #define BN_MP_ADD_D_C #define BN_MP_ISZERO_C #endif #if defined(BN_MP_READ_SIGNED_BIN_C) #define BN_MP_READ_UNSIGNED_BIN_C #endif #if defined(BN_MP_READ_UNSIGNED_BIN_C) #define BN_MP_GROW_C #define BN_MP_ZERO_C #define BN_MP_MUL_2D_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_REDUCE_C) #define BN_MP_REDUCE_SETUP_C #define BN_MP_INIT_COPY_C #define BN_MP_RSHD_C #define BN_MP_MUL_C #define BN_S_MP_MUL_HIGH_DIGS_C #define BN_FAST_S_MP_MUL_HIGH_DIGS_C #define BN_MP_MOD_2D_C #define BN_S_MP_MUL_DIGS_C #define BN_MP_SUB_C #define BN_MP_CMP_D_C #define BN_MP_SET_C #define BN_MP_LSHD_C #define BN_MP_ADD_C #define BN_MP_CMP_C #define BN_S_MP_SUB_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_REDUCE_2K_C) #define BN_MP_INIT_C #define BN_MP_COUNT_BITS_C #define BN_MP_DIV_2D_C #define BN_MP_MUL_D_C #define BN_S_MP_ADD_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_REDUCE_2K_L_C) #define BN_MP_INIT_C #define BN_MP_COUNT_BITS_C #define BN_MP_DIV_2D_C #define BN_MP_MUL_C #define BN_S_MP_ADD_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_REDUCE_2K_SETUP_C) #define BN_MP_INIT_C #define BN_MP_COUNT_BITS_C #define BN_MP_2EXPT_C #define BN_MP_CLEAR_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_REDUCE_2K_SETUP_L_C) #define BN_MP_INIT_C #define BN_MP_2EXPT_C #define BN_MP_COUNT_BITS_C #define BN_S_MP_SUB_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_REDUCE_IS_2K_C) #define BN_MP_REDUCE_2K_C #define BN_MP_COUNT_BITS_C #endif #if defined(BN_MP_REDUCE_IS_2K_L_C) #endif #if defined(BN_MP_REDUCE_SETUP_C) #define BN_MP_2EXPT_C #define BN_MP_DIV_C #endif #if defined(BN_MP_RSHD_C) #define BN_MP_ZERO_C #endif #if defined(BN_MP_SET_C) #define BN_MP_ZERO_C #endif #if defined(BN_MP_SET_INT_C) #define BN_MP_ZERO_C #define BN_MP_MUL_2D_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_SET_LONG_C) #endif #if defined(BN_MP_SET_LONG_LONG_C) #endif #if defined(BN_MP_SHRINK_C) #endif #if defined(BN_MP_SIGNED_BIN_SIZE_C) #define BN_MP_UNSIGNED_BIN_SIZE_C #endif #if defined(BN_MP_SQR_C) #define BN_MP_TOOM_SQR_C #define BN_MP_KARATSUBA_SQR_C #define BN_FAST_S_MP_SQR_C #define BN_S_MP_SQR_C #endif #if defined(BN_MP_SQRMOD_C) #define BN_MP_INIT_C #define BN_MP_SQR_C #define BN_MP_CLEAR_C #define BN_MP_MOD_C #endif #if defined(BN_MP_SQRT_C) #define BN_MP_N_ROOT_C #define BN_MP_ISZERO_C #define BN_MP_ZERO_C #define BN_MP_INIT_COPY_C #define BN_MP_RSHD_C #define BN_MP_DIV_C #define BN_MP_ADD_C #define BN_MP_DIV_2_C #define BN_MP_CMP_MAG_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_SQRTMOD_PRIME_C) #define BN_MP_CMP_D_C #define BN_MP_ZERO_C #define BN_MP_JACOBI_C #define BN_MP_INIT_MULTI_C #define BN_MP_MOD_D_C #define BN_MP_ADD_D_C #define BN_MP_DIV_2_C #define BN_MP_EXPTMOD_C #define BN_MP_COPY_C #define BN_MP_SUB_D_C #define BN_MP_ISEVEN_C #define BN_MP_SET_INT_C #define BN_MP_SQRMOD_C #define BN_MP_MULMOD_C #define BN_MP_SET_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_SUB_C) #define BN_S_MP_ADD_C #define BN_MP_CMP_MAG_C #define BN_S_MP_SUB_C #endif #if defined(BN_MP_SUB_D_C) #define BN_MP_GROW_C #define BN_MP_ADD_D_C #define BN_MP_CLAMP_C #endif #if defined(BN_MP_SUBMOD_C) #define BN_MP_INIT_C #define BN_MP_SUB_C #define BN_MP_CLEAR_C #define BN_MP_MOD_C #endif #if defined(BN_MP_TO_SIGNED_BIN_C) #define BN_MP_TO_UNSIGNED_BIN_C #endif #if defined(BN_MP_TO_SIGNED_BIN_N_C) #define BN_MP_SIGNED_BIN_SIZE_C #define BN_MP_TO_SIGNED_BIN_C #endif #if defined(BN_MP_TO_UNSIGNED_BIN_C) #define BN_MP_INIT_COPY_C #define BN_MP_ISZERO_C #define BN_MP_DIV_2D_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_TO_UNSIGNED_BIN_N_C) #define BN_MP_UNSIGNED_BIN_SIZE_C #define BN_MP_TO_UNSIGNED_BIN_C #endif #if defined(BN_MP_TOOM_MUL_C) #define BN_MP_INIT_MULTI_C #define BN_MP_MOD_2D_C #define BN_MP_COPY_C #define BN_MP_RSHD_C #define BN_MP_MUL_C #define BN_MP_MUL_2_C #define BN_MP_ADD_C #define BN_MP_SUB_C #define BN_MP_DIV_2_C #define BN_MP_MUL_2D_C #define BN_MP_MUL_D_C #define BN_MP_DIV_3_C #define BN_MP_LSHD_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_TOOM_SQR_C) #define BN_MP_INIT_MULTI_C #define BN_MP_MOD_2D_C #define BN_MP_COPY_C #define BN_MP_RSHD_C #define BN_MP_SQR_C #define BN_MP_MUL_2_C #define BN_MP_ADD_C #define BN_MP_SUB_C #define BN_MP_DIV_2_C #define BN_MP_MUL_2D_C #define BN_MP_MUL_D_C #define BN_MP_DIV_3_C #define BN_MP_LSHD_C #define BN_MP_CLEAR_MULTI_C #endif #if defined(BN_MP_TORADIX_C) #define BN_MP_ISZERO_C #define BN_MP_INIT_COPY_C #define BN_MP_DIV_D_C #define BN_MP_CLEAR_C #define BN_MP_S_RMAP_C #endif #if defined(BN_MP_TORADIX_N_C) #define BN_MP_ISZERO_C #define BN_MP_INIT_COPY_C #define BN_MP_DIV_D_C #define BN_MP_CLEAR_C #define BN_MP_S_RMAP_C #endif #if defined(BN_MP_UNSIGNED_BIN_SIZE_C) #define BN_MP_COUNT_BITS_C #endif #if defined(BN_MP_XOR_C) #define BN_MP_INIT_COPY_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_MP_ZERO_C) #endif #if defined(BN_PRIME_TAB_C) #endif #if defined(BN_REVERSE_C) #endif #if defined(BN_S_MP_ADD_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BN_S_MP_EXPTMOD_C) #define BN_MP_COUNT_BITS_C #define BN_MP_INIT_C #define BN_MP_CLEAR_C #define BN_MP_REDUCE_SETUP_C #define BN_MP_REDUCE_C #define BN_MP_REDUCE_2K_SETUP_L_C #define BN_MP_REDUCE_2K_L_C #define BN_MP_MOD_C #define BN_MP_COPY_C #define BN_MP_SQR_C #define BN_MP_MUL_C #define BN_MP_SET_C #define BN_MP_EXCH_C #endif #if defined(BN_S_MP_MUL_DIGS_C) #define BN_FAST_S_MP_MUL_DIGS_C #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_S_MP_MUL_HIGH_DIGS_C) #define BN_FAST_S_MP_MUL_HIGH_DIGS_C #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_S_MP_SQR_C) #define BN_MP_INIT_SIZE_C #define BN_MP_CLAMP_C #define BN_MP_EXCH_C #define BN_MP_CLEAR_C #endif #if defined(BN_S_MP_SUB_C) #define BN_MP_GROW_C #define BN_MP_CLAMP_C #endif #if defined(BNCORE_C) #endif #ifdef LTM3 #define LTM_LAST #endif #else #define LTM_LAST #endif #else #define LTM_LAST #endif /* detect 64-bit mode if possible */ #if defined(__x86_64__) #if !(defined(MP_32BIT) || defined(MP_16BIT) || defined(MP_8BIT)) #define MP_64BIT #endif #endif /* some default configurations. * * A "mp_digit" must be able to hold DIGIT_BIT + 1 bits * A "mp_word" must be able to hold 2*DIGIT_BIT + 1 bits * * At the very least a mp_digit must be able to hold 7 bits * [any size beyond that is ok provided it doesn't overflow the data type] */ #ifdef MP_8BIT typedef uint8_t mp_digit; typedef uint16_t mp_word; #define MP_SIZEOF_MP_DIGIT 1 #ifdef DIGIT_BIT #error You must not define DIGIT_BIT when using MP_8BIT #endif #elif defined(MP_16BIT) typedef uint16_t mp_digit; typedef uint32_t mp_word; #define MP_SIZEOF_MP_DIGIT 2 #ifdef DIGIT_BIT #error You must not define DIGIT_BIT when using MP_16BIT #endif #elif defined(MP_64BIT) && !defined(__TINYC__) && !(defined(_WIN32) && defined(__clang__)) //< @r-lyeh bypass __int128 on clang-cl (unresolved external symbol __udivti3 otherwise) /* for GCC only on supported platforms */ #ifndef CRYPT typedef unsigned long long ulong64; typedef signed long long long64; #endif typedef uint64_t mp_digit; #if defined(_WIN32) typedef unsigned __int128 mp_word; #elif defined(__GNUC__) typedef unsigned long mp_word __attribute__ ((mode(TI))); #else /* it seems you have a problem * but we assume you can somewhere define your own uint128_t */ typedef uint128_t mp_word; #endif #define DIGIT_BIT 60 #else /* this is the default case, 28-bit digits */ /* this is to make porting into LibTomCrypt easier :-) */ #ifndef CRYPT typedef unsigned long long ulong64; typedef signed long long long64; #endif typedef uint32_t mp_digit; typedef uint64_t mp_word; #ifdef MP_31BIT /* this is an extension that uses 31-bit digits */ #define DIGIT_BIT 31 #else /* default case is 28-bit digits, defines MP_28BIT as a handy macro to test */ #define DIGIT_BIT 28 #define MP_28BIT #endif #endif /* otherwise the bits per digit is calculated automatically from the size of a mp_digit */ #ifndef DIGIT_BIT #define DIGIT_BIT (((CHAR_BIT * MP_SIZEOF_MP_DIGIT) - 1)) /* bits per digit */ typedef uint_least32_t mp_min_u32; #else typedef mp_digit mp_min_u32; #endif /* platforms that can use a better rand function */ #if defined(__FreeBSD__) || defined(__OpenBSD__) || defined(__NetBSD__) || defined(__DragonFly__) #define MP_USE_ALT_RAND 1 #endif /* use arc4random on platforms that support it */ #ifdef MP_USE_ALT_RAND #define MP_GEN_RANDOM() arc4random() #else #define MP_GEN_RANDOM() rand() #endif #define MP_DIGIT_BIT DIGIT_BIT #define MP_MASK ((((mp_digit)1) << ((mp_digit)DIGIT_BIT)) - ((mp_digit)1)) #define MP_DIGIT_MAX MP_MASK /* equalities */ #define MP_LT -1 /* less than */ #define MP_EQ 0 /* equal to */ #define MP_GT 1 /* greater than */ #define MP_ZPOS 0 /* positive integer */ #define MP_NEG 1 /* negative */ #define MP_OKAY 0 /* ok result */ #define MP_MEM -2 /* out of mem */ #define MP_VAL -3 /* invalid input */ #define MP_RANGE MP_VAL #define MP_YES 1 /* yes response */ #define MP_NO 0 /* no response */ /* Primality generation flags */ #define LTM_PRIME_BBS 0x0001 /* BBS style prime */ #define LTM_PRIME_SAFE 0x0002 /* Safe prime (p-1)/2 == prime */ #define LTM_PRIME_2MSB_ON 0x0008 /* force 2nd MSB to 1 */ typedef int mp_err; /* you'll have to tune these... */ extern int KARATSUBA_MUL_CUTOFF, KARATSUBA_SQR_CUTOFF, TOOM_MUL_CUTOFF, TOOM_SQR_CUTOFF; /* define this to use lower memory usage routines (exptmods mostly) */ /* #define MP_LOW_MEM */ /* default precision */ #ifndef MP_PREC #ifndef MP_LOW_MEM #define MP_PREC 32 /* default digits of precision */ #else #define MP_PREC 8 /* default digits of precision */ #endif #endif /* size of comba arrays, should be at least 2 * 2**(BITS_PER_WORD - BITS_PER_DIGIT*2) */ #define MP_WARRAY (1 << (((sizeof(mp_word) * CHAR_BIT) - (2 * DIGIT_BIT)) + 1)) /* the infamous mp_int structure */ typedef struct { int used, alloc, sign; mp_digit *dp; } mp_int; /* callback for mp_prime_random, should fill dst with random bytes and return how many read [upto len] */ typedef int ltm_prime_callback (unsigned char *dst, int len, void *dat); #define USED(m) ((m)->used) #define DIGIT(m, k) ((m)->dp[(k)]) #define SIGN(m) ((m)->sign) /* error code to char* string */ const char *mp_error_to_string(int code); /* ---> init and deinit bignum functions <--- */ /* init a bignum */ int mp_init(mp_int *a); /* free a bignum */ void mp_clear(mp_int *a); /* init a null terminated series of arguments */ int mp_init_multi(mp_int *mp, ...); /* clear a null terminated series of arguments */ void mp_clear_multi(mp_int *mp, ...); /* exchange two ints */ void mp_exch(mp_int *a, mp_int *b); /* shrink ram required for a bignum */ int mp_shrink(mp_int *a); /* grow an int to a given size */ int mp_grow(mp_int *a, int size); /* init to a given number of digits */ int mp_init_size(mp_int *a, int size); /* ---> Basic Manipulations <--- */ #define mp_iszero(a) (((a)->used == 0) ? MP_YES : MP_NO) #define mp_iseven(a) ((((a)->used > 0) && (((a)->dp[0] & 1u) == 0u)) ? MP_YES : MP_NO) #define mp_isodd(a) ((((a)->used > 0) && (((a)->dp[0] & 1u) == 1u)) ? MP_YES : MP_NO) #define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) /* set to zero */ void mp_zero(mp_int *a); /* set to a digit */ void mp_set(mp_int *a, mp_digit b); /* set a 32-bit const */ int mp_set_int(mp_int *a, unsigned long b); /* set a platform dependent unsigned long value */ int mp_set_long(mp_int *a, unsigned long b); /* set a platform dependent unsigned long long value */ int mp_set_long_long(mp_int *a, unsigned long long b); /* get a 32-bit value */ unsigned long mp_get_int(mp_int *a); /* get a platform dependent unsigned long value */ unsigned long mp_get_long(mp_int *a); /* get a platform dependent unsigned long long value */ unsigned long long mp_get_long_long(mp_int *a); /* initialize and set a digit */ int mp_init_set(mp_int *a, mp_digit b); /* initialize and set 32-bit value */ int mp_init_set_int(mp_int *a, unsigned long b); /* copy, b = a */ int mp_copy(mp_int *a, mp_int *b); /* inits and copies, a = b */ int mp_init_copy(mp_int *a, mp_int *b); /* trim unused digits */ void mp_clamp(mp_int *a); /* import binary data */ int mp_import(mp_int *rop, size_t count, int order, size_t size, int endian, size_t nails, const void *op); /* export binary data */ int mp_export(void *rop, size_t *countp, int order, size_t size, int endian, size_t nails, mp_int *op); /* ---> digit manipulation <--- */ /* right shift by "b" digits */ void mp_rshd(mp_int *a, int b); /* left shift by "b" digits */ int mp_lshd(mp_int *a, int b); /* c = a / 2**b, implemented as c = a >> b */ int mp_div_2d(mp_int *a, int b, mp_int *c, mp_int *d); /* b = a/2 */ int mp_div_2(mp_int *a, mp_int *b); /* c = a * 2**b, implemented as c = a << b */ int mp_mul_2d(mp_int *a, int b, mp_int *c); /* b = a*2 */ int mp_mul_2(mp_int *a, mp_int *b); /* c = a mod 2**b */ int mp_mod_2d(mp_int *a, int b, mp_int *c); /* computes a = 2**b */ int mp_2expt(mp_int *a, int b); /* Counts the number of lsbs which are zero before the first zero bit */ int mp_cnt_lsb(mp_int *a); /* I Love Earth! */ /* makes a pseudo-random int of a given size */ int mp_rand(mp_int *a, int digits); /* ---> binary operations <--- */ /* c = a XOR b */ int mp_xor(mp_int *a, mp_int *b, mp_int *c); /* c = a OR b */ int mp_or(mp_int *a, mp_int *b, mp_int *c); /* c = a AND b */ int mp_and(mp_int *a, mp_int *b, mp_int *c); /* ---> Basic arithmetic <--- */ /* b = -a */ int mp_neg(mp_int *a, mp_int *b); /* b = |a| */ int mp_abs(mp_int *a, mp_int *b); /* compare a to b */ int mp_cmp(mp_int *a, mp_int *b); /* compare |a| to |b| */ int mp_cmp_mag(mp_int *a, mp_int *b); /* c = a + b */ int mp_add(mp_int *a, mp_int *b, mp_int *c); /* c = a - b */ int mp_sub(mp_int *a, mp_int *b, mp_int *c); /* c = a * b */ int mp_mul(mp_int *a, mp_int *b, mp_int *c); /* b = a*a */ int mp_sqr(mp_int *a, mp_int *b); /* a/b => cb + d == a */ int mp_div(mp_int *a, mp_int *b, mp_int *c, mp_int *d); /* c = a mod b, 0 <= c < b */ int mp_mod(mp_int *a, mp_int *b, mp_int *c); /* ---> single digit functions <--- */ /* compare against a single digit */ int mp_cmp_d(mp_int *a, mp_digit b); /* c = a + b */ int mp_add_d(mp_int *a, mp_digit b, mp_int *c); /* c = a - b */ int mp_sub_d(mp_int *a, mp_digit b, mp_int *c); /* c = a * b */ int mp_mul_d(mp_int *a, mp_digit b, mp_int *c); /* a/b => cb + d == a */ int mp_div_d(mp_int *a, mp_digit b, mp_int *c, mp_digit *d); /* a/3 => 3c + d == a */ int mp_div_3(mp_int *a, mp_int *c, mp_digit *d); /* c = a**b */ int mp_expt_d(mp_int *a, mp_digit b, mp_int *c); int mp_expt_d_ex(mp_int *a, mp_digit b, mp_int *c, int fast); /* c = a mod b, 0 <= c < b */ int mp_mod_d(mp_int *a, mp_digit b, mp_digit *c); /* ---> number theory <--- */ /* d = a + b (mod c) */ int mp_addmod(mp_int *a, mp_int *b, mp_int *c, mp_int *d); /* d = a - b (mod c) */ int mp_submod(mp_int *a, mp_int *b, mp_int *c, mp_int *d); /* d = a * b (mod c) */ int mp_mulmod(mp_int *a, mp_int *b, mp_int *c, mp_int *d); /* c = a * a (mod b) */ int mp_sqrmod(mp_int *a, mp_int *b, mp_int *c); /* c = 1/a (mod b) */ int mp_invmod(mp_int *a, mp_int *b, mp_int *c); /* c = (a, b) */ int mp_gcd(mp_int *a, mp_int *b, mp_int *c); /* produces value such that U1*a + U2*b = U3 */ int mp_exteuclid(mp_int *a, mp_int *b, mp_int *U1, mp_int *U2, mp_int *U3); /* c = [a, b] or (a*b)/(a, b) */ int mp_lcm(mp_int *a, mp_int *b, mp_int *c); /* finds one of the b'th root of a, such that |c|**b <= |a| * * returns error if a < 0 and b is even */ int mp_n_root(mp_int *a, mp_digit b, mp_int *c); int mp_n_root_ex(mp_int *a, mp_digit b, mp_int *c, int fast); /* special sqrt algo */ int mp_sqrt(mp_int *arg, mp_int *ret); /* special sqrt (mod prime) */ int mp_sqrtmod_prime(mp_int *arg, mp_int *prime, mp_int *ret); /* is number a square? */ int mp_is_square(mp_int *arg, int *ret); /* computes the jacobi c = (a | n) (or Legendre if b is prime) */ int mp_jacobi(mp_int *a, mp_int *n, int *c); /* used to setup the Barrett reduction for a given modulus b */ int mp_reduce_setup(mp_int *a, mp_int *b); /* Barrett Reduction, computes a (mod b) with a precomputed value c * * Assumes that 0 < a <= b*b, note if 0 > a > -(b*b) then you can merely * compute the reduction as -1 * mp_reduce(mp_abs(a)) [pseudo code]. */ int mp_reduce(mp_int *a, mp_int *b, mp_int *c); /* setups the montgomery reduction */ int mp_montgomery_setup(mp_int *a, mp_digit *mp); /* computes a = B**n mod b without division or multiplication useful for * normalizing numbers in a Montgomery system. */ int mp_montgomery_calc_normalization(mp_int *a, mp_int *b); /* computes x/R == x (mod N) via Montgomery Reduction */ int mp_montgomery_reduce(mp_int *a, mp_int *m, mp_digit mp); /* returns 1 if a is a valid DR modulus */ int mp_dr_is_modulus(mp_int *a); /* sets the value of "d" required for mp_dr_reduce */ void mp_dr_setup(mp_int *a, mp_digit *d); /* reduces a modulo b using the Diminished Radix method */ int mp_dr_reduce(mp_int *a, mp_int *b, mp_digit mp); /* returns true if a can be reduced with mp_reduce_2k */ int mp_reduce_is_2k(mp_int *a); /* determines k value for 2k reduction */ int mp_reduce_2k_setup(mp_int *a, mp_digit *d); /* reduces a modulo b where b is of the form 2**p - k [0 <= a] */ int mp_reduce_2k(mp_int *a, mp_int *n, mp_digit d); /* returns true if a can be reduced with mp_reduce_2k_l */ int mp_reduce_is_2k_l(mp_int *a); /* determines k value for 2k reduction */ int mp_reduce_2k_setup_l(mp_int *a, mp_int *d); /* reduces a modulo b where b is of the form 2**p - k [0 <= a] */ int mp_reduce_2k_l(mp_int *a, mp_int *n, mp_int *d); /* d = a**b (mod c) */ int mp_exptmod(mp_int *a, mp_int *b, mp_int *c, mp_int *d); /* ---> Primes <--- */ /* number of primes */ #ifdef MP_8BIT #define PRIME_SIZE 31 #else #define PRIME_SIZE 256 #endif /* table of first PRIME_SIZE primes */ extern const mp_digit ltm_prime_tab[PRIME_SIZE]; /* result=1 if a is divisible by one of the first PRIME_SIZE primes */ int mp_prime_is_divisible(mp_int *a, int *result); /* performs one Fermat test of "a" using base "b". * Sets result to 0 if composite or 1 if probable prime */ int mp_prime_fermat(mp_int *a, mp_int *b, int *result); /* performs one Miller-Rabin test of "a" using base "b". * Sets result to 0 if composite or 1 if probable prime */ int mp_prime_miller_rabin(mp_int *a, mp_int *b, int *result); /* This gives [for a given bit size] the number of trials required * such that Miller-Rabin gives a prob of failure lower than 2^-96 */ int mp_prime_rabin_miller_trials(int size); /* performs t rounds of Miller-Rabin on "a" using the first * t prime bases. Also performs an initial sieve of trial * division. Determines if "a" is prime with probability * of error no more than (1/4)**t. * * Sets result to 1 if probably prime, 0 otherwise */ int mp_prime_is_prime(mp_int *a, int t, int *result); /* finds the next prime after the number "a" using "t" trials * of Miller-Rabin. * * bbs_style = 1 means the prime must be congruent to 3 mod 4 */ int mp_prime_next_prime(mp_int *a, int t, int bbs_style); /* makes a truly random prime of a given size (bytes), * call with bbs = 1 if you want it to be congruent to 3 mod 4 * * You have to supply a callback which fills in a buffer with random bytes. "dat" is a parameter you can * have passed to the callback (e.g. a state or something). This function doesn't use "dat" itself * so it can be NULL * * The prime generated will be larger than 2^(8*size). */ #define mp_prime_random(a, t, size, bbs, cb, dat) mp_prime_random_ex(a, t, ((size) * 8) + 1, (bbs == 1) ? LTM_PRIME_BBS : 0, cb, dat) /* makes a truly random prime of a given size (bits), * * Flags are as follows: * * LTM_PRIME_BBS - make prime congruent to 3 mod 4 * LTM_PRIME_SAFE - make sure (p-1)/2 is prime as well (implies LTM_PRIME_BBS) * LTM_PRIME_2MSB_ON - make the 2nd highest bit one * * You have to supply a callback which fills in a buffer with random bytes. "dat" is a parameter you can * have passed to the callback (e.g. a state or something). This function doesn't use "dat" itself * so it can be NULL * */ int mp_prime_random_ex(mp_int *a, int t, int size, int flags, ltm_prime_callback cb, void *dat); /* ---> radix conversion <--- */ int mp_count_bits(mp_int *a); int mp_unsigned_bin_size(mp_int *a); int mp_read_unsigned_bin(mp_int *a, const unsigned char *b, int c); int mp_to_unsigned_bin(mp_int *a, unsigned char *b); int mp_to_unsigned_bin_n(mp_int *a, unsigned char *b, unsigned long *outlen); int mp_signed_bin_size(mp_int *a); int mp_read_signed_bin(mp_int *a, const unsigned char *b, int c); int mp_to_signed_bin(mp_int *a, unsigned char *b); int mp_to_signed_bin_n(mp_int *a, unsigned char *b, unsigned long *outlen); int mp_read_radix(mp_int *a, const char *str, int radix); int mp_toradix(mp_int *a, char *str, int radix); int mp_toradix_n(mp_int *a, char *str, int radix, int maxlen); int mp_radix_size(mp_int *a, int radix, int *size); #ifndef LTM_NO_FILE int mp_fread(mp_int *a, int radix, FILE *stream); int mp_fwrite(mp_int *a, int radix, FILE *stream); #endif #define mp_read_raw(mp, str, len) mp_read_signed_bin((mp), (str), (len)) #define mp_raw_size(mp) mp_signed_bin_size(mp) #define mp_toraw(mp, str) mp_to_signed_bin((mp), (str)) #define mp_read_mag(mp, str, len) mp_read_unsigned_bin((mp), (str), (len)) #define mp_mag_size(mp) mp_unsigned_bin_size(mp) #define mp_tomag(mp, str) mp_to_unsigned_bin((mp), (str)) #define mp_tobinary(M, S) mp_toradix((M), (S), 2) #define mp_tooctal(M, S) mp_toradix((M), (S), 8) #define mp_todecimal(M, S) mp_toradix((M), (S), 10) #define mp_tohex(M, S) mp_toradix((M), (S), 16) #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://math.libtomcrypt.com */ #ifndef TOMMATH_PRIV_H_ #define TOMMATH_PRIV_H_ #include #ifndef MIN #define MIN(x, y) (((x) < (y)) ? (x) : (y)) #endif #ifndef MAX #define MAX(x, y) (((x) > (y)) ? (x) : (y)) #endif /* C++ compilers don't like assigning void * to mp_digit * */ #define OPT_CAST(x) (x *) /* define heap macros */ #ifndef XMALLOC /* default to libc stuff */ #define XMALLOC malloc #define XFREE free #define XREALLOC realloc #define XCALLOC calloc #elif 0 //< @r-lyeh /* prototypes for our heap functions */ extern void *XMALLOC(size_t n); extern void *XREALLOC(void *p, size_t n); extern void *XCALLOC(size_t n, size_t s); extern void XFREE(void *p); #endif /* lowlevel functions, do not call! */ int s_mp_add(mp_int *a, mp_int *b, mp_int *c); int s_mp_sub(mp_int *a, mp_int *b, mp_int *c); #define s_mp_mul(a, b, c) s_mp_mul_digs(a, b, c, (a)->used + (b)->used + 1) int fast_s_mp_mul_digs(mp_int *a, mp_int *b, mp_int *c, int digs); int s_mp_mul_digs(mp_int *a, mp_int *b, mp_int *c, int digs); int fast_s_mp_mul_high_digs(mp_int *a, mp_int *b, mp_int *c, int digs); int s_mp_mul_high_digs(mp_int *a, mp_int *b, mp_int *c, int digs); int fast_s_mp_sqr(mp_int *a, mp_int *b); int s_mp_sqr(mp_int *a, mp_int *b); int mp_karatsuba_mul(mp_int *a, mp_int *b, mp_int *c); int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c); int mp_karatsuba_sqr(mp_int *a, mp_int *b); int mp_toom_sqr(mp_int *a, mp_int *b); int fast_mp_invmod(mp_int *a, mp_int *b, mp_int *c); int mp_invmod_slow(mp_int *a, mp_int *b, mp_int *c); int fast_mp_montgomery_reduce(mp_int *x, mp_int *n, mp_digit rho); int mp_exptmod_fast(mp_int *G, mp_int *X, mp_int *P, mp_int *Y, int redmode); int s_mp_exptmod(mp_int *G, mp_int *X, mp_int *P, mp_int *Y, int redmode); void bn_reverse(unsigned char *s, int len); extern const char *mp_s_rmap; /* Fancy macro to set an MPI from another type. * There are several things assumed: * x is the counter and unsigned * a is the pointer to the MPI * b is the original value that should be set in the MPI. */ #define MP_SET_XLONG(func_name, type) \ int func_name(mp_int * a, type b) \ { \ unsigned int x; \ int res; \ \ mp_zero(a); \ \ /* set four bits at a time */ \ for (x = 0; x < (sizeof(type) * 2u); x++) { \ /* shift the number up four bits */ \ if ((res = mp_mul_2d(a, 4, a)) != MP_OKAY) { \ return res; \ } \ \ /* OR in the top four bits of the source */ \ a->dp[0] |= (b >> ((sizeof(type) * 8u) - 4u)) & 15u; \ \ /* shift the source up to the next four bits */ \ b <<= 4; \ \ /* ensure that digits are not clamped off */ \ a->used += 1; \ } \ mp_clamp(a); \ return MP_OKAY; \ } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #define BN_FAST_MP_INVMOD_C #ifdef BN_FAST_MP_INVMOD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* computes the modular inverse via binary extended euclidean algorithm, * that is c = 1/a mod b * * Based on slow invmod except this is optimized for the case where b is * odd as per HAC Note 14.64 on pp. 610 */ int fast_mp_invmod(mp_int *a, mp_int *b, mp_int *c) { mp_int x, y, u, v, B, D; int res, neg; /* 2. [modified] b must be odd */ if (mp_iseven(b) == MP_YES) { return MP_VAL; } /* init all our temps */ if ((res = mp_init_multi(&x, &y, &u, &v, &B, &D, NULL)) != MP_OKAY) { return res; } /* x == modulus, y == value to invert */ if ((res = mp_copy(b, &x)) != MP_OKAY) { goto LBL_ERR; } /* we need y = |a| */ if ((res = mp_mod(a, b, &y)) != MP_OKAY) { goto LBL_ERR; } /* 3. u=x, v=y, A=1, B=0, C=0,D=1 */ if ((res = mp_copy(&x, &u)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_copy(&y, &v)) != MP_OKAY) { goto LBL_ERR; } mp_set(&D, 1); top: /* 4. while u is even do */ while (mp_iseven(&u) == MP_YES) { /* 4.1 u = u/2 */ if ((res = mp_div_2(&u, &u)) != MP_OKAY) { goto LBL_ERR; } /* 4.2 if B is odd then */ if (mp_isodd(&B) == MP_YES) { if ((res = mp_sub(&B, &x, &B)) != MP_OKAY) { goto LBL_ERR; } } /* B = B/2 */ if ((res = mp_div_2(&B, &B)) != MP_OKAY) { goto LBL_ERR; } } /* 5. while v is even do */ while (mp_iseven(&v) == MP_YES) { /* 5.1 v = v/2 */ if ((res = mp_div_2(&v, &v)) != MP_OKAY) { goto LBL_ERR; } /* 5.2 if D is odd then */ if (mp_isodd(&D) == MP_YES) { /* D = (D-x)/2 */ if ((res = mp_sub(&D, &x, &D)) != MP_OKAY) { goto LBL_ERR; } } /* D = D/2 */ if ((res = mp_div_2(&D, &D)) != MP_OKAY) { goto LBL_ERR; } } /* 6. if u >= v then */ if (mp_cmp(&u, &v) != MP_LT) { /* u = u - v, B = B - D */ if ((res = mp_sub(&u, &v, &u)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_sub(&B, &D, &B)) != MP_OKAY) { goto LBL_ERR; } } else { /* v - v - u, D = D - B */ if ((res = mp_sub(&v, &u, &v)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_sub(&D, &B, &D)) != MP_OKAY) { goto LBL_ERR; } } /* if not zero goto step 4 */ if (mp_iszero(&u) == MP_NO) { goto top; } /* now a = C, b = D, gcd == g*v */ /* if v != 1 then there is no inverse */ if (mp_cmp_d(&v, 1) != MP_EQ) { res = MP_VAL; goto LBL_ERR; } /* b is now the inverse */ neg = a->sign; while (D.sign == MP_NEG) { if ((res = mp_add(&D, b, &D)) != MP_OKAY) { goto LBL_ERR; } } mp_exch(&D, c); c->sign = neg; res = MP_OKAY; LBL_ERR: mp_clear_multi(&x, &y, &u, &v, &B, &D, NULL); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_FAST_MP_MONTGOMERY_REDUCE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* computes xR**-1 == x (mod N) via Montgomery Reduction * * This is an optimized implementation of montgomery_reduce * which uses the comba method to quickly calculate the columns of the * reduction. * * Based on Algorithm 14.32 on pp.601 of HAC. */ int fast_mp_montgomery_reduce(mp_int *x, mp_int *n, mp_digit rho) { int ix, res, olduse; mp_word W[MP_WARRAY]; /* get old used count */ olduse = x->used; /* grow a as required */ if (x->alloc < (n->used + 1)) { if ((res = mp_grow(x, n->used + 1)) != MP_OKAY) { return res; } } /* first we have to get the digits of the input into * an array of double precision words W[...] */ { mp_word *_W; mp_digit *tmpx; /* alias for the W[] array */ _W = W; /* alias for the digits of x*/ tmpx = x->dp; /* copy the digits of a into W[0..a->used-1] */ for (ix = 0; ix < x->used; ix++) { *_W++ = *tmpx++; } /* zero the high words of W[a->used..m->used*2] */ for ( ; ix < ((n->used * 2) + 1); ix++) { *_W++ = 0; } } /* now we proceed to zero successive digits * from the least significant upwards */ for (ix = 0; ix < n->used; ix++) { /* mu = ai * m' mod b * * We avoid a double precision multiplication (which isn't required) * by casting the value down to a mp_digit. Note this requires * that W[ix-1] have the carry cleared (see after the inner loop) */ mp_digit mu; mu = (mp_digit)(((W[ix] & MP_MASK) * rho) & MP_MASK); /* a = a + mu * m * b**i * * This is computed in place and on the fly. The multiplication * by b**i is handled by offseting which columns the results * are added to. * * Note the comba method normally doesn't handle carries in the * inner loop In this case we fix the carry from the previous * column since the Montgomery reduction requires digits of the * result (so far) [see above] to work. This is * handled by fixing up one carry after the inner loop. The * carry fixups are done in order so after these loops the * first m->used words of W[] have the carries fixed */ { int iy; mp_digit *tmpn; mp_word *_W; /* alias for the digits of the modulus */ tmpn = n->dp; /* Alias for the columns set by an offset of ix */ _W = W + ix; /* inner loop */ for (iy = 0; iy < n->used; iy++) { *_W++ += ((mp_word)mu) * ((mp_word) * tmpn++); } } /* now fix carry for next digit, W[ix+1] */ W[ix + 1] += W[ix] >> ((mp_word)DIGIT_BIT); } /* now we have to propagate the carries and * shift the words downward [all those least * significant digits we zeroed]. */ { mp_digit *tmpx; mp_word *_W, *_W1; /* nox fix rest of carries */ /* alias for current word */ _W1 = W + ix; /* alias for next word, where the carry goes */ _W = W + ++ix; for ( ; ix <= ((n->used * 2) + 1); ix++) { *_W++ += *_W1++ >> ((mp_word)DIGIT_BIT); } /* copy out, A = A/b**n * * The result is A/b**n but instead of converting from an * array of mp_word to mp_digit than calling mp_rshd * we just copy them in the right order */ /* alias for destination word */ tmpx = x->dp; /* alias for shifted double precision result */ _W = W + n->used; for (ix = 0; ix < (n->used + 1); ix++) { *tmpx++ = (mp_digit)(*_W++ & ((mp_word)MP_MASK)); } /* zero oldused digits, if the input a was larger than * m->used+1 we'll have to clear the digits */ for ( ; ix < olduse; ix++) { *tmpx++ = 0; } } /* set the max used and clamp */ x->used = n->used + 1; mp_clamp(x); /* if A >= m then A = A - m */ if (mp_cmp_mag(x, n) != MP_LT) { return s_mp_sub(x, n, x); } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_FAST_S_MP_MUL_DIGS_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* Fast (comba) multiplier * * This is the fast column-array [comba] multiplier. It is * designed to compute the columns of the product first * then handle the carries afterwards. This has the effect * of making the nested loops that compute the columns very * simple and schedulable on super-scalar processors. * * This has been modified to produce a variable number of * digits of output so if say only a half-product is required * you don't have to compute the upper half (a feature * required for fast Barrett reduction). * * Based on Algorithm 14.12 on pp.595 of HAC. * */ int fast_s_mp_mul_digs(mp_int *a, mp_int *b, mp_int *c, int digs) { int olduse, res, pa, ix, iz; mp_digit W[MP_WARRAY]; mp_word _W; /* grow the destination as required */ if (c->alloc < digs) { if ((res = mp_grow(c, digs)) != MP_OKAY) { return res; } } /* number of output digits to produce */ pa = MIN(digs, a->used + b->used); /* clear the carry */ _W = 0; for (ix = 0; ix < pa; ix++) { int tx, ty; int iy; mp_digit *tmpx, *tmpy; /* get offsets into the two bignums */ ty = MIN(b->used - 1, ix); tx = ix - ty; /* setup temp aliases */ tmpx = a->dp + tx; tmpy = b->dp + ty; /* this is the number of times the loop will iterrate, essentially while (tx++ < a->used && ty-- >= 0) { ... } */ iy = MIN(a->used - tx, ty + 1); /* execute loop */ for (iz = 0; iz < iy; ++iz) { _W += ((mp_word) * tmpx++) * ((mp_word) * tmpy--); } /* store term */ W[ix] = ((mp_digit)_W) & MP_MASK; /* make next carry */ _W = _W >> ((mp_word)DIGIT_BIT); } /* setup dest */ olduse = c->used; c->used = pa; { mp_digit *tmpc; tmpc = c->dp; for (ix = 0; ix < (pa + 1); ix++) { /* now extract the previous digit [below the carry] */ *tmpc++ = W[ix]; } /* clear unused digits [that existed in the old copy of c] */ for ( ; ix < olduse; ix++) { *tmpc++ = 0; } } mp_clamp(c); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_FAST_S_MP_MUL_HIGH_DIGS_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* this is a modified version of fast_s_mul_digs that only produces * output digits *above* digs. See the comments for fast_s_mul_digs * to see how it works. * * This is used in the Barrett reduction since for one of the multiplications * only the higher digits were needed. This essentially halves the work. * * Based on Algorithm 14.12 on pp.595 of HAC. */ int fast_s_mp_mul_high_digs(mp_int *a, mp_int *b, mp_int *c, int digs) { int olduse, res, pa, ix, iz; mp_digit W[MP_WARRAY]; mp_word _W; /* grow the destination as required */ pa = a->used + b->used; if (c->alloc < pa) { if ((res = mp_grow(c, pa)) != MP_OKAY) { return res; } } /* number of output digits to produce */ pa = a->used + b->used; _W = 0; for (ix = digs; ix < pa; ix++) { int tx, ty, iy; mp_digit *tmpx, *tmpy; /* get offsets into the two bignums */ ty = MIN(b->used - 1, ix); tx = ix - ty; /* setup temp aliases */ tmpx = a->dp + tx; tmpy = b->dp + ty; /* this is the number of times the loop will iterrate, essentially its while (tx++ < a->used && ty-- >= 0) { ... } */ iy = MIN(a->used - tx, ty + 1); /* execute loop */ for (iz = 0; iz < iy; iz++) { _W += ((mp_word) * tmpx++) * ((mp_word) * tmpy--); } /* store term */ W[ix] = ((mp_digit)_W) & MP_MASK; /* make next carry */ _W = _W >> ((mp_word)DIGIT_BIT); } /* setup dest */ olduse = c->used; c->used = pa; { mp_digit *tmpc; tmpc = c->dp + digs; for (ix = digs; ix < pa; ix++) { /* now extract the previous digit [below the carry] */ *tmpc++ = W[ix]; } /* clear unused digits [that existed in the old copy of c] */ for ( ; ix < olduse; ix++) { *tmpc++ = 0; } } mp_clamp(c); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_FAST_S_MP_SQR_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* the jist of squaring... * you do like mult except the offset of the tmpx [one that * starts closer to zero] can't equal the offset of tmpy. * So basically you set up iy like before then you min it with * (ty-tx) so that it never happens. You double all those * you add in the inner loop After that loop you do the squares and add them in. */ int fast_s_mp_sqr(mp_int *a, mp_int *b) { int olduse, res, pa, ix, iz; mp_digit W[MP_WARRAY], *tmpx; mp_word W1; /* grow the destination as required */ pa = a->used + a->used; if (b->alloc < pa) { if ((res = mp_grow(b, pa)) != MP_OKAY) { return res; } } /* number of output digits to produce */ W1 = 0; for (ix = 0; ix < pa; ix++) { int tx, ty, iy; mp_word _W; mp_digit *tmpy; /* clear counter */ _W = 0; /* get offsets into the two bignums */ ty = MIN(a->used - 1, ix); tx = ix - ty; /* setup temp aliases */ tmpx = a->dp + tx; tmpy = a->dp + ty; /* this is the number of times the loop will iterrate, essentially while (tx++ < a->used && ty-- >= 0) { ... } */ iy = MIN(a->used - tx, ty + 1); /* now for squaring tx can never equal ty * we halve the distance since they approach at a rate of 2x * and we have to round because odd cases need to be executed */ iy = MIN(iy, ((ty - tx) + 1) >> 1); /* execute loop */ for (iz = 0; iz < iy; iz++) { _W += ((mp_word) * tmpx++) * ((mp_word) * tmpy--); } /* double the inner product and add carry */ _W = _W + _W + W1; /* even columns have the square term in them */ if ((ix & 1) == 0) { _W += ((mp_word)a->dp[ix >> 1]) * ((mp_word)a->dp[ix >> 1]); } /* store it */ W[ix] = (mp_digit)(_W & MP_MASK); /* make next carry */ W1 = _W >> ((mp_word)DIGIT_BIT); } /* setup dest */ olduse = b->used; b->used = a->used + a->used; { mp_digit *tmpb; tmpb = b->dp; for (ix = 0; ix < pa; ix++) { *tmpb++ = W[ix] & MP_MASK; } /* clear unused digits [that existed in the old copy of c] */ for ( ; ix < olduse; ix++) { *tmpb++ = 0; } } mp_clamp(b); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_2EXPT_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* computes a = 2**b * * Simple algorithm which zeroes the int, grows it then just sets one bit * as required. */ int mp_2expt(mp_int *a, int b) { int res; /* zero a as per default */ mp_zero(a); /* grow a to accomodate the single bit */ if ((res = mp_grow(a, (b / DIGIT_BIT) + 1)) != MP_OKAY) { return res; } /* set the used count of where the bit will go */ a->used = (b / DIGIT_BIT) + 1; /* put the single bit in its place */ a->dp[b / DIGIT_BIT] = ((mp_digit)1) << (b % DIGIT_BIT); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_ABS_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* b = |a| * * Simple function copies the input and fixes the sign to positive */ int mp_abs(mp_int *a, mp_int *b) { int res; /* copy a to b */ if (a != b) { if ((res = mp_copy(a, b)) != MP_OKAY) { return res; } } /* force the sign of b to positive */ b->sign = MP_ZPOS; return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_ADD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* high level addition (handles signs) */ int mp_add(mp_int *a, mp_int *b, mp_int *c) { int sa, sb, res; /* get sign of both inputs */ sa = a->sign; sb = b->sign; /* handle two cases, not four */ if (sa == sb) { /* both positive or both negative */ /* add their magnitudes, copy the sign */ c->sign = sa; res = s_mp_add(a, b, c); } else { /* one positive, the other negative */ /* subtract the one with the greater magnitude from */ /* the one of the lesser magnitude. The result gets */ /* the sign of the one with the greater magnitude. */ if (mp_cmp_mag(a, b) == MP_LT) { c->sign = sb; res = s_mp_sub(b, a, c); } else { c->sign = sa; res = s_mp_sub(a, b, c); } } return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_ADD_D_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* single digit addition */ int mp_add_d(mp_int *a, mp_digit b, mp_int *c) { int res, ix, oldused; mp_digit *tmpa, *tmpc, mu; /* grow c as required */ if (c->alloc < (a->used + 1)) { if ((res = mp_grow(c, a->used + 1)) != MP_OKAY) { return res; } } /* if a is negative and |a| >= b, call c = |a| - b */ if ((a->sign == MP_NEG) && ((a->used > 1) || (a->dp[0] >= b))) { /* temporarily fix sign of a */ a->sign = MP_ZPOS; /* c = |a| - b */ res = mp_sub_d(a, b, c); /* fix sign */ a->sign = c->sign = MP_NEG; /* clamp */ mp_clamp(c); return res; } /* old number of used digits in c */ oldused = c->used; /* sign always positive */ c->sign = MP_ZPOS; /* source alias */ tmpa = a->dp; /* destination alias */ tmpc = c->dp; /* if a is positive */ if (a->sign == MP_ZPOS) { /* add digit, after this we're propagating * the carry. */ *tmpc = *tmpa++ + b; mu = *tmpc >> DIGIT_BIT; *tmpc++ &= MP_MASK; /* now handle rest of the digits */ for (ix = 1; ix < a->used; ix++) { *tmpc = *tmpa++ + mu; mu = *tmpc >> DIGIT_BIT; *tmpc++ &= MP_MASK; } /* set final carry */ ix++; *tmpc++ = mu; /* setup size */ c->used = a->used + 1; } else { /* a was negative and |a| < b */ c->used = 1; /* the result is a single digit */ if (a->used == 1) { *tmpc++ = b - a->dp[0]; } else { *tmpc++ = b; } /* setup count so the clearing of oldused * can fall through correctly */ ix = 1; } /* now zero to oldused */ while (ix++ < oldused) { *tmpc++ = 0; } mp_clamp(c); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_ADDMOD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* d = a + b (mod c) */ int mp_addmod(mp_int *a, mp_int *b, mp_int *c, mp_int *d) { int res; mp_int t; if ((res = mp_init(&t)) != MP_OKAY) { return res; } if ((res = mp_add(a, b, &t)) != MP_OKAY) { mp_clear(&t); return res; } res = mp_mod(&t, c, d); mp_clear(&t); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_AND_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* AND two ints together */ int mp_and(mp_int *a, mp_int *b, mp_int *c) { int res, ix, px; mp_int t, *x; if (a->used > b->used) { if ((res = mp_init_copy(&t, a)) != MP_OKAY) { return res; } px = b->used; x = b; } else { if ((res = mp_init_copy(&t, b)) != MP_OKAY) { return res; } px = a->used; x = a; } for (ix = 0; ix < px; ix++) { t.dp[ix] &= x->dp[ix]; } /* zero digits above the last from the smallest mp_int */ for ( ; ix < t.used; ix++) { t.dp[ix] = 0; } mp_clamp(&t); mp_exch(c, &t); mp_clear(&t); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_CLAMP_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* trim unused digits * * This is used to ensure that leading zero digits are * trimed and the leading "used" digit will be non-zero * Typically very fast. Also fixes the sign if there * are no more leading digits */ void mp_clamp(mp_int *a) { /* decrease used while the most significant digit is * zero. */ while ((a->used > 0) && (a->dp[a->used - 1] == 0)) { --(a->used); } /* reset the sign flag if used == 0 */ if (a->used == 0) { a->sign = MP_ZPOS; } } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_CLEAR_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* clear one (frees) */ void mp_clear(mp_int *a) { int i; /* only do anything if a hasn't been freed previously */ if (a->dp != NULL) { /* first zero the digits */ for (i = 0; i < a->used; i++) { a->dp[i] = 0; } /* free ram */ XFREE(a->dp); /* reset members to make debugging easier */ a->dp = NULL; a->alloc = a->used = 0; a->sign = MP_ZPOS; } } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_CLEAR_MULTI_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ #include void mp_clear_multi(mp_int *mp, ...) { mp_int *next_mp = mp; va_list args; va_start(args, mp); while (next_mp != NULL) { mp_clear(next_mp); next_mp = va_arg(args, mp_int *); } va_end(args); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_CMP_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* compare two ints (signed)*/ int mp_cmp(mp_int *a, mp_int *b) { /* compare based on sign */ if (a->sign != b->sign) { if (a->sign == MP_NEG) { return MP_LT; } else { return MP_GT; } } /* compare digits */ if (a->sign == MP_NEG) { /* if negative compare opposite direction */ return mp_cmp_mag(b, a); } else { return mp_cmp_mag(a, b); } } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_CMP_D_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* compare a digit */ int mp_cmp_d(mp_int *a, mp_digit b) { /* compare based on sign */ if (a->sign == MP_NEG) { return MP_LT; } /* compare based on magnitude */ if (a->used > 1) { return MP_GT; } /* compare the only digit of a to b */ if (a->dp[0] > b) { return MP_GT; } else if (a->dp[0] < b) { return MP_LT; } else { return MP_EQ; } } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_CMP_MAG_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* compare maginitude of two ints (unsigned) */ int mp_cmp_mag(mp_int *a, mp_int *b) { int n; mp_digit *tmpa, *tmpb; /* compare based on # of non-zero digits */ if (a->used > b->used) { return MP_GT; } if (a->used < b->used) { return MP_LT; } /* alias for a */ tmpa = a->dp + (a->used - 1); /* alias for b */ tmpb = b->dp + (a->used - 1); /* compare based on digits */ for (n = 0; n < a->used; ++n, --tmpa, --tmpb) { if (*tmpa > *tmpb) { return MP_GT; } if (*tmpa < *tmpb) { return MP_LT; } } return MP_EQ; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_CNT_LSB_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ static const int lnz[16] = { 4, 0, 1, 0, 2, 0, 1, 0, 3, 0, 1, 0, 2, 0, 1, 0 }; /* Counts the number of lsbs which are zero before the first zero bit */ int mp_cnt_lsb(mp_int *a) { int x; mp_digit q, qq; /* easy out */ if (mp_iszero(a) == MP_YES) { return 0; } /* scan lower digits until non-zero */ for (x = 0; (x < a->used) && (a->dp[x] == 0); x++) { } q = a->dp[x]; x *= DIGIT_BIT; /* now scan this digit until a 1 is found */ if ((q & 1) == 0) { do { qq = q & 15; x += lnz[qq]; q >>= 4; } while (qq == 0); } return x; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_COPY_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* copy, b = a */ int mp_copy(mp_int *a, mp_int *b) { int res, n; /* if dst == src do nothing */ if (a == b) { return MP_OKAY; } /* grow dest */ if (b->alloc < a->used) { if ((res = mp_grow(b, a->used)) != MP_OKAY) { return res; } } /* zero b and copy the parameters over */ { mp_digit *tmpa, *tmpb; /* pointer aliases */ /* source */ tmpa = a->dp; /* destination */ tmpb = b->dp; /* copy all the digits */ for (n = 0; n < a->used; n++) { *tmpb++ = *tmpa++; } /* clear high digits */ for ( ; n < b->used; n++) { *tmpb++ = 0; } } /* copy used count and sign */ b->used = a->used; b->sign = a->sign; return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_COUNT_BITS_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* returns the number of bits in an int */ int mp_count_bits(mp_int *a) { int r; mp_digit q; /* shortcut */ if (a->used == 0) { return 0; } /* get number of digits and add that */ r = (a->used - 1) * DIGIT_BIT; /* take the last digit and count the bits in it */ q = a->dp[a->used - 1]; while (q > ((mp_digit)0)) { ++r; q >>= ((mp_digit)1); } return r; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_DIV_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ #ifdef BN_MP_DIV_SMALL /* slower bit-bang division... also smaller */ int mp_div(mp_int *a, mp_int *b, mp_int *c, mp_int *d) { mp_int ta, tb, tq, q; int res, n, n2; /* is divisor zero ? */ if (mp_iszero(b) == MP_YES) { return MP_VAL; } /* if a < b then q=0, r = a */ if (mp_cmp_mag(a, b) == MP_LT) { if (d != NULL) { res = mp_copy(a, d); } else { res = MP_OKAY; } if (c != NULL) { mp_zero(c); } return res; } /* init our temps */ if ((res = mp_init_multi(&ta, &tb, &tq, &q, NULL)) != MP_OKAY) { return res; } mp_set(&tq, 1); n = mp_count_bits(a) - mp_count_bits(b); if (((res = mp_abs(a, &ta)) != MP_OKAY) || ((res = mp_abs(b, &tb)) != MP_OKAY) || ((res = mp_mul_2d(&tb, n, &tb)) != MP_OKAY) || ((res = mp_mul_2d(&tq, n, &tq)) != MP_OKAY)) { goto LBL_ERR; } while (n-- >= 0) { if (mp_cmp(&tb, &ta) != MP_GT) { if (((res = mp_sub(&ta, &tb, &ta)) != MP_OKAY) || ((res = mp_add(&q, &tq, &q)) != MP_OKAY)) { goto LBL_ERR; } } if (((res = mp_div_2d(&tb, 1, &tb, NULL)) != MP_OKAY) || ((res = mp_div_2d(&tq, 1, &tq, NULL)) != MP_OKAY)) { goto LBL_ERR; } } /* now q == quotient and ta == remainder */ n = a->sign; n2 = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; if (c != NULL) { mp_exch(c, &q); c->sign = (mp_iszero(c) == MP_YES) ? MP_ZPOS : n2; } if (d != NULL) { mp_exch(d, &ta); d->sign = (mp_iszero(d) == MP_YES) ? MP_ZPOS : n; } LBL_ERR: mp_clear_multi(&ta, &tb, &tq, &q, NULL); return res; } #else /* integer signed division. * c*b + d == a [e.g. a/b, c=quotient, d=remainder] * HAC pp.598 Algorithm 14.20 * * Note that the description in HAC is horribly * incomplete. For example, it doesn't consider * the case where digits are removed from 'x' in * the inner loop. It also doesn't consider the * case that y has fewer than three digits, etc.. * * The overall algorithm is as described as * 14.20 from HAC but fixed to treat these cases. */ int mp_div(mp_int *a, mp_int *b, mp_int *c, mp_int *d) { mp_int q, x, y, t1, t2; int res, n, t, i, norm, neg; /* is divisor zero ? */ if (mp_iszero(b) == MP_YES) { return MP_VAL; } /* if a < b then q=0, r = a */ if (mp_cmp_mag(a, b) == MP_LT) { if (d != NULL) { res = mp_copy(a, d); } else { res = MP_OKAY; } if (c != NULL) { mp_zero(c); } return res; } if ((res = mp_init_size(&q, a->used + 2)) != MP_OKAY) { return res; } q.used = a->used + 2; if ((res = mp_init(&t1)) != MP_OKAY) { goto LBL_Q; } if ((res = mp_init(&t2)) != MP_OKAY) { goto LBL_T1; } if ((res = mp_init_copy(&x, a)) != MP_OKAY) { goto LBL_T2; } if ((res = mp_init_copy(&y, b)) != MP_OKAY) { goto LBL_X; } /* fix the sign */ neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; x.sign = y.sign = MP_ZPOS; /* normalize both x and y, ensure that y >= b/2, [b == 2**DIGIT_BIT] */ norm = mp_count_bits(&y) % DIGIT_BIT; if (norm < (int)(DIGIT_BIT - 1)) { norm = (DIGIT_BIT - 1) - norm; if ((res = mp_mul_2d(&x, norm, &x)) != MP_OKAY) { goto LBL_Y; } if ((res = mp_mul_2d(&y, norm, &y)) != MP_OKAY) { goto LBL_Y; } } else { norm = 0; } /* note hac does 0 based, so if used==5 then its 0,1,2,3,4, e.g. use 4 */ n = x.used - 1; t = y.used - 1; /* while (x >= y*b**n-t) do { q[n-t] += 1; x -= y*b**{n-t} } */ if ((res = mp_lshd(&y, n - t)) != MP_OKAY) { /* y = y*b**{n-t} */ goto LBL_Y; } while (mp_cmp(&x, &y) != MP_LT) { ++(q.dp[n - t]); if ((res = mp_sub(&x, &y, &x)) != MP_OKAY) { goto LBL_Y; } } /* reset y by shifting it back down */ mp_rshd(&y, n - t); /* step 3. for i from n down to (t + 1) */ for (i = n; i >= (t + 1); i--) { if (i > x.used) { continue; } /* step 3.1 if xi == yt then set q{i-t-1} to b-1, * otherwise set q{i-t-1} to (xi*b + x{i-1})/yt */ if (x.dp[i] == y.dp[t]) { q.dp[(i - t) - 1] = ((((mp_digit)1) << DIGIT_BIT) - 1); } else { mp_word tmp; tmp = ((mp_word)x.dp[i]) << ((mp_word)DIGIT_BIT); tmp |= ((mp_word)x.dp[i - 1]); tmp /= ((mp_word)y.dp[t]); if (tmp > (mp_word)MP_MASK) { tmp = MP_MASK; } q.dp[(i - t) - 1] = (mp_digit)(tmp & (mp_word)(MP_MASK)); } /* while (q{i-t-1} * (yt * b + y{t-1})) > xi * b**2 + xi-1 * b + xi-2 do q{i-t-1} -= 1; */ q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] + 1) & MP_MASK; do { q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1) & MP_MASK; /* find left hand */ mp_zero(&t1); t1.dp[0] = ((t - 1) < 0) ? 0 : y.dp[t - 1]; t1.dp[1] = y.dp[t]; t1.used = 2; if ((res = mp_mul_d(&t1, q.dp[(i - t) - 1], &t1)) != MP_OKAY) { goto LBL_Y; } /* find right hand */ t2.dp[0] = ((i - 2) < 0) ? 0 : x.dp[i - 2]; t2.dp[1] = ((i - 1) < 0) ? 0 : x.dp[i - 1]; t2.dp[2] = x.dp[i]; t2.used = 3; } while (mp_cmp_mag(&t1, &t2) == MP_GT); /* step 3.3 x = x - q{i-t-1} * y * b**{i-t-1} */ if ((res = mp_mul_d(&y, q.dp[(i - t) - 1], &t1)) != MP_OKAY) { goto LBL_Y; } if ((res = mp_lshd(&t1, (i - t) - 1)) != MP_OKAY) { goto LBL_Y; } if ((res = mp_sub(&x, &t1, &x)) != MP_OKAY) { goto LBL_Y; } /* if x < 0 then { x = x + y*b**{i-t-1}; q{i-t-1} -= 1; } */ if (x.sign == MP_NEG) { if ((res = mp_copy(&y, &t1)) != MP_OKAY) { goto LBL_Y; } if ((res = mp_lshd(&t1, (i - t) - 1)) != MP_OKAY) { goto LBL_Y; } if ((res = mp_add(&x, &t1, &x)) != MP_OKAY) { goto LBL_Y; } q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1UL) & MP_MASK; } } /* now q is the quotient and x is the remainder * [which we have to normalize] */ /* get sign before writing to c */ x.sign = (x.used == 0) ? MP_ZPOS : a->sign; if (c != NULL) { mp_clamp(&q); mp_exch(&q, c); c->sign = neg; } if (d != NULL) { if ((res = mp_div_2d(&x, norm, &x, NULL)) != MP_OKAY) { goto LBL_Y; } mp_exch(&x, d); } res = MP_OKAY; LBL_Y: mp_clear(&y); LBL_X: mp_clear(&x); LBL_T2: mp_clear(&t2); LBL_T1: mp_clear(&t1); LBL_Q: mp_clear(&q); return res; } #endif #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_DIV_2_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* b = a/2 */ int mp_div_2(mp_int *a, mp_int *b) { int x, res, oldused; /* copy */ if (b->alloc < a->used) { if ((res = mp_grow(b, a->used)) != MP_OKAY) { return res; } } oldused = b->used; b->used = a->used; { mp_digit r, rr, *tmpa, *tmpb; /* source alias */ tmpa = a->dp + b->used - 1; /* dest alias */ tmpb = b->dp + b->used - 1; /* carry */ r = 0; for (x = b->used - 1; x >= 0; x--) { /* get the carry for the next iteration */ rr = *tmpa & 1; /* shift the current digit, add in carry and store */ *tmpb-- = (*tmpa-- >> 1) | (r << (DIGIT_BIT - 1)); /* forward carry to next iteration */ r = rr; } /* zero excess digits */ tmpb = b->dp + b->used; for (x = b->used; x < oldused; x++) { *tmpb++ = 0; } } b->sign = a->sign; mp_clamp(b); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_DIV_2D_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* shift right by a certain bit count (store quotient in c, optional remainder in d) */ int mp_div_2d(mp_int *a, int b, mp_int *c, mp_int *d) { mp_digit D, r, rr; int x, res; mp_int t; /* if the shift count is <= 0 then we do no work */ if (b <= 0) { res = mp_copy(a, c); if (d != NULL) { mp_zero(d); } return res; } if ((res = mp_init(&t)) != MP_OKAY) { return res; } /* get the remainder */ if (d != NULL) { if ((res = mp_mod_2d(a, b, &t)) != MP_OKAY) { mp_clear(&t); return res; } } /* copy */ if ((res = mp_copy(a, c)) != MP_OKAY) { mp_clear(&t); return res; } /* shift by as many digits in the bit count */ if (b >= (int)DIGIT_BIT) { mp_rshd(c, b / DIGIT_BIT); } /* shift any bit count < DIGIT_BIT */ D = (mp_digit)(b % DIGIT_BIT); if (D != 0) { mp_digit *tmpc, mask, shift; /* mask */ mask = (((mp_digit)1) << D) - 1; /* shift for lsb */ shift = DIGIT_BIT - D; /* alias */ tmpc = c->dp + (c->used - 1); /* carry */ r = 0; for (x = c->used - 1; x >= 0; x--) { /* get the lower bits of this word in a temp */ rr = *tmpc & mask; /* shift the current word and mix in the carry bits from the previous word */ *tmpc = (*tmpc >> D) | (r << shift); --tmpc; /* set the carry to the carry bits of the current word found above */ r = rr; } } mp_clamp(c); if (d != NULL) { mp_exch(&t, d); } mp_clear(&t); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_DIV_3_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* divide by three (based on routine from MPI and the GMP manual) */ int mp_div_3(mp_int *a, mp_int *c, mp_digit *d) { mp_int q; mp_word w, t; mp_digit b; int res, ix; /* b = 2**DIGIT_BIT / 3 */ b = (((mp_word)1) << ((mp_word)DIGIT_BIT)) / ((mp_word)3); if ((res = mp_init_size(&q, a->used)) != MP_OKAY) { return res; } q.used = a->used; q.sign = a->sign; w = 0; for (ix = a->used - 1; ix >= 0; ix--) { w = (w << ((mp_word)DIGIT_BIT)) | ((mp_word)a->dp[ix]); if (w >= 3) { /* multiply w by [1/3] */ t = (w * ((mp_word)b)) >> ((mp_word)DIGIT_BIT); /* now subtract 3 * [w/3] from w, to get the remainder */ w -= t + t + t; /* fixup the remainder as required since * the optimization is not exact. */ while (w >= 3) { t += 1; w -= 3; } } else { t = 0; } q.dp[ix] = (mp_digit)t; } /* [optional] store the remainder */ if (d != NULL) { *d = (mp_digit)w; } /* [optional] store the quotient */ if (c != NULL) { mp_clamp(&q); mp_exch(&q, c); } mp_clear(&q); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_DIV_D_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ static int s_is_power_of_two(mp_digit b, int *p) { int x; /* fast return if no power of two */ if ((b == 0) || ((b & (b - 1)) != 0)) { return 0; } for (x = 0; x < DIGIT_BIT; x++) { if (b == (((mp_digit)1) << x)) { *p = x; return 1; } } return 0; } /* single digit division (based on routine from MPI) */ int mp_div_d(mp_int *a, mp_digit b, mp_int *c, mp_digit *d) { mp_int q; mp_word w; mp_digit t; int res, ix; /* cannot divide by zero */ if (b == 0) { return MP_VAL; } /* quick outs */ if ((b == 1) || (mp_iszero(a) == MP_YES)) { if (d != NULL) { *d = 0; } if (c != NULL) { return mp_copy(a, c); } return MP_OKAY; } /* power of two ? */ if (s_is_power_of_two(b, &ix) == 1) { if (d != NULL) { *d = a->dp[0] & ((((mp_digit)1) << ix) - 1); } if (c != NULL) { return mp_div_2d(a, ix, c, NULL); } return MP_OKAY; } #ifdef BN_MP_DIV_3_C /* three? */ if (b == 3) { return mp_div_3(a, c, d); } #endif /* no easy answer [c'est la vie]. Just division */ if ((res = mp_init_size(&q, a->used)) != MP_OKAY) { return res; } q.used = a->used; q.sign = a->sign; w = 0; for (ix = a->used - 1; ix >= 0; ix--) { w = (w << ((mp_word)DIGIT_BIT)) | ((mp_word)a->dp[ix]); if (w >= b) { t = (mp_digit)(w / b); w -= ((mp_word)t) * ((mp_word)b); } else { t = 0; } q.dp[ix] = (mp_digit)t; } if (d != NULL) { *d = (mp_digit)w; } if (c != NULL) { mp_clamp(&q); mp_exch(&q, c); } mp_clear(&q); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_DR_IS_MODULUS_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* determines if a number is a valid DR modulus */ int mp_dr_is_modulus(mp_int *a) { int ix; /* must be at least two digits */ if (a->used < 2) { return 0; } /* must be of the form b**k - a [a <= b] so all * but the first digit must be equal to -1 (mod b). */ for (ix = 1; ix < a->used; ix++) { if (a->dp[ix] != MP_MASK) { return 0; } } return 1; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_DR_REDUCE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* reduce "x" in place modulo "n" using the Diminished Radix algorithm. * * Based on algorithm from the paper * * "Generating Efficient Primes for Discrete Log Cryptosystems" * Chae Hoon Lim, Pil Joong Lee, * POSTECH Information Research Laboratories * * The modulus must be of a special format [see manual] * * Has been modified to use algorithm 7.10 from the LTM book instead * * Input x must be in the range 0 <= x <= (n-1)**2 */ int mp_dr_reduce(mp_int *x, mp_int *n, mp_digit k) { int err, i, m; mp_word r; mp_digit mu, *tmpx1, *tmpx2; /* m = digits in modulus */ m = n->used; /* ensure that "x" has at least 2m digits */ if (x->alloc < (m + m)) { if ((err = mp_grow(x, m + m)) != MP_OKAY) { return err; } } /* top of loop, this is where the code resumes if * another reduction pass is required. */ top: /* aliases for digits */ /* alias for lower half of x */ tmpx1 = x->dp; /* alias for upper half of x, or x/B**m */ tmpx2 = x->dp + m; /* set carry to zero */ mu = 0; /* compute (x mod B**m) + k * [x/B**m] inline and inplace */ for (i = 0; i < m; i++) { r = (((mp_word) * tmpx2++) * (mp_word)k) + *tmpx1 + mu; *tmpx1++ = (mp_digit)(r & MP_MASK); mu = (mp_digit)(r >> ((mp_word)DIGIT_BIT)); } /* set final carry */ *tmpx1++ = mu; /* zero words above m */ for (i = m + 1; i < x->used; i++) { *tmpx1++ = 0; } /* clamp, sub and return */ mp_clamp(x); /* if x >= n then subtract and reduce again * Each successive "recursion" makes the input smaller and smaller. */ if (mp_cmp_mag(x, n) != MP_LT) { if ((err = s_mp_sub(x, n, x)) != MP_OKAY) { return err; } goto top; } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_DR_SETUP_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* determines the setup value */ void mp_dr_setup(mp_int *a, mp_digit *d) { /* the casts are required if DIGIT_BIT is one less than * the number of bits in a mp_digit [e.g. DIGIT_BIT==31] */ *d = (mp_digit)((((mp_word)1) << ((mp_word)DIGIT_BIT)) - ((mp_word)a->dp[0])); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_EXCH_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* swap the elements of two integers, for cases where you can't simply swap the * mp_int pointers around */ void mp_exch(mp_int *a, mp_int *b) { mp_int t; t = *a; *a = *b; *b = t; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_EXPORT_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* based on gmp's mpz_export. * see http://gmplib.org/manual/Integer-Import-and-Export.html */ int mp_export(void *rop, size_t *countp, int order, size_t size, int endian, size_t nails, mp_int *op) { int result; size_t odd_nails, nail_bytes, i, j, bits, count; unsigned char odd_nail_mask; mp_int t; if ((result = mp_init_copy(&t, op)) != MP_OKAY) { return result; } if (endian == 0) { union { unsigned int i; char c[4]; } lint; lint.i = 0x01020304; endian = (lint.c[0] == 4) ? -1 : 1; } odd_nails = (nails % 8); odd_nail_mask = 0xff; for (i = 0; i < odd_nails; ++i) { odd_nail_mask ^= (1 << (7 - i)); } nail_bytes = nails / 8; bits = mp_count_bits(&t); count = (bits / ((size * 8) - nails)) + (((bits % ((size * 8) - nails)) != 0) ? 1 : 0); for (i = 0; i < count; ++i) { for (j = 0; j < size; ++j) { unsigned char *byte = ( (unsigned char *)rop + (((order == -1) ? i : ((count - 1) - i)) * size) + ((endian == -1) ? j : ((size - 1) - j)) ); if (j >= (size - nail_bytes)) { *byte = 0; continue; } *byte = (unsigned char)((j == ((size - nail_bytes) - 1)) ? (t.dp[0] & odd_nail_mask) : (t.dp[0] & 0xFF)); if ((result = mp_div_2d(&t, ((j == ((size - nail_bytes) - 1)) ? (8 - odd_nails) : 8), &t, NULL)) != MP_OKAY) { mp_clear(&t); return result; } } } mp_clear(&t); if (countp != NULL) { *countp = count; } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_EXPT_D_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* wrapper function for mp_expt_d_ex() */ int mp_expt_d(mp_int *a, mp_digit b, mp_int *c) { return mp_expt_d_ex(a, b, c, 0); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_EXPT_D_EX_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* calculate c = a**b using a square-multiply algorithm */ int mp_expt_d_ex(mp_int *a, mp_digit b, mp_int *c, int fast) { int res; unsigned int x; mp_int g; if ((res = mp_init_copy(&g, a)) != MP_OKAY) { return res; } /* set initial result */ mp_set(c, 1); if (fast != 0) { while (b > 0) { /* if the bit is set multiply */ if ((b & 1) != 0) { if ((res = mp_mul(c, &g, c)) != MP_OKAY) { mp_clear(&g); return res; } } /* square */ if (b > 1) { if ((res = mp_sqr(&g, &g)) != MP_OKAY) { mp_clear(&g); return res; } } /* shift to next bit */ b >>= 1; } } else { for (x = 0; x < DIGIT_BIT; x++) { /* square */ if ((res = mp_sqr(c, c)) != MP_OKAY) { mp_clear(&g); return res; } /* if the bit is set multiply */ if ((b & (mp_digit)(((mp_digit)1) << (DIGIT_BIT - 1))) != 0) { if ((res = mp_mul(c, &g, c)) != MP_OKAY) { mp_clear(&g); return res; } } /* shift to next bit */ b <<= 1; } } /* if ... else */ mp_clear(&g); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_EXPTMOD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* this is a shell function that calls either the normal or Montgomery * exptmod functions. Originally the call to the montgomery code was * embedded in the normal function but that wasted alot of stack space * for nothing (since 99% of the time the Montgomery code would be called) */ int mp_exptmod(mp_int *G, mp_int *X, mp_int *P, mp_int *Y) { int dr; /* modulus P must be positive */ if (P->sign == MP_NEG) { return MP_VAL; } /* if exponent X is negative we have to recurse */ if (X->sign == MP_NEG) { #ifdef BN_MP_INVMOD_C mp_int tmpG, tmpX; int err; /* first compute 1/G mod P */ if ((err = mp_init(&tmpG)) != MP_OKAY) { return err; } if ((err = mp_invmod(G, P, &tmpG)) != MP_OKAY) { mp_clear(&tmpG); return err; } /* now get |X| */ if ((err = mp_init(&tmpX)) != MP_OKAY) { mp_clear(&tmpG); return err; } if ((err = mp_abs(X, &tmpX)) != MP_OKAY) { mp_clear_multi(&tmpG, &tmpX, NULL); return err; } /* and now compute (1/G)**|X| instead of G**X [X < 0] */ err = mp_exptmod(&tmpG, &tmpX, P, Y); mp_clear_multi(&tmpG, &tmpX, NULL); return err; #else /* no invmod */ return MP_VAL; #endif } /* modified diminished radix reduction */ #if defined(BN_MP_REDUCE_IS_2K_L_C) && defined(BN_MP_REDUCE_2K_L_C) && defined(BN_S_MP_EXPTMOD_C) if (mp_reduce_is_2k_l(P) == MP_YES) { return s_mp_exptmod(G, X, P, Y, 1); } #endif #ifdef BN_MP_DR_IS_MODULUS_C /* is it a DR modulus? */ dr = mp_dr_is_modulus(P); #else /* default to no */ dr = 0; #endif #ifdef BN_MP_REDUCE_IS_2K_C /* if not, is it a unrestricted DR modulus? */ if (dr == 0) { dr = mp_reduce_is_2k(P) << 1; } #endif /* if the modulus is odd or dr != 0 use the montgomery method */ #ifdef BN_MP_EXPTMOD_FAST_C if ((mp_isodd(P) == MP_YES) || (dr != 0)) { return mp_exptmod_fast(G, X, P, Y, dr); } else { #endif #ifdef BN_S_MP_EXPTMOD_C /* otherwise use the generic Barrett reduction technique */ return s_mp_exptmod(G, X, P, Y, 0); #else /* no exptmod for evens */ return MP_VAL; #endif #ifdef BN_MP_EXPTMOD_FAST_C } #endif } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_EXPTMOD_FAST_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* computes Y == G**X mod P, HAC pp.616, Algorithm 14.85 * * Uses a left-to-right k-ary sliding window to compute the modular exponentiation. * The value of k changes based on the size of the exponent. * * Uses Montgomery or Diminished Radix reduction [whichever appropriate] */ #ifdef MP_LOW_MEM #define TAB_SIZE 32 #else #define TAB_SIZE 256 #endif int mp_exptmod_fast(mp_int *G, mp_int *X, mp_int *P, mp_int *Y, int redmode) { mp_int M[TAB_SIZE], res; mp_digit buf, mp; int err, bitbuf, bitcpy, bitcnt, mode, digidx, x, y, winsize; /* use a pointer to the reduction algorithm. This allows us to use * one of many reduction algorithms without modding the guts of * the code with if statements everywhere. */ int (*redux)(mp_int *, mp_int *, mp_digit); /* find window size */ x = mp_count_bits(X); if (x <= 7) { winsize = 2; } else if (x <= 36) { winsize = 3; } else if (x <= 140) { winsize = 4; } else if (x <= 450) { winsize = 5; } else if (x <= 1303) { winsize = 6; } else if (x <= 3529) { winsize = 7; } else { winsize = 8; } #ifdef MP_LOW_MEM if (winsize > 5) { winsize = 5; } #endif /* init M array */ /* init first cell */ if ((err = mp_init(&M[1])) != MP_OKAY) { return err; } /* now init the second half of the array */ for (x = 1 << (winsize - 1); x < (1 << winsize); x++) { if ((err = mp_init(&M[x])) != MP_OKAY) { for (y = 1 << (winsize - 1); y < x; y++) { mp_clear(&M[y]); } mp_clear(&M[1]); return err; } } /* determine and setup reduction code */ if (redmode == 0) { #ifdef BN_MP_MONTGOMERY_SETUP_C /* now setup montgomery */ if ((err = mp_montgomery_setup(P, &mp)) != MP_OKAY) { goto LBL_M; } #else err = MP_VAL; goto LBL_M; #endif /* automatically pick the comba one if available (saves quite a few calls/ifs) */ #ifdef BN_FAST_MP_MONTGOMERY_REDUCE_C if ((((P->used * 2) + 1) < MP_WARRAY) && (P->used < (1 << ((CHAR_BIT * sizeof(mp_word)) - (2 * DIGIT_BIT))))) { redux = fast_mp_montgomery_reduce; } else #endif { #ifdef BN_MP_MONTGOMERY_REDUCE_C /* use slower baseline Montgomery method */ redux = mp_montgomery_reduce; #else err = MP_VAL; goto LBL_M; #endif } } else if (redmode == 1) { #if defined(BN_MP_DR_SETUP_C) && defined(BN_MP_DR_REDUCE_C) /* setup DR reduction for moduli of the form B**k - b */ mp_dr_setup(P, &mp); redux = mp_dr_reduce; #else err = MP_VAL; goto LBL_M; #endif } else { #if defined(BN_MP_REDUCE_2K_SETUP_C) && defined(BN_MP_REDUCE_2K_C) /* setup DR reduction for moduli of the form 2**k - b */ if ((err = mp_reduce_2k_setup(P, &mp)) != MP_OKAY) { goto LBL_M; } redux = mp_reduce_2k; #else err = MP_VAL; goto LBL_M; #endif } /* setup result */ if ((err = mp_init(&res)) != MP_OKAY) { goto LBL_M; } /* create M table * * * The first half of the table is not computed though accept for M[0] and M[1] */ if (redmode == 0) { #ifdef BN_MP_MONTGOMERY_CALC_NORMALIZATION_C /* now we need R mod m */ if ((err = mp_montgomery_calc_normalization(&res, P)) != MP_OKAY) { goto LBL_RES; } #else err = MP_VAL; goto LBL_RES; #endif /* now set M[1] to G * R mod m */ if ((err = mp_mulmod(G, &res, P, &M[1])) != MP_OKAY) { goto LBL_RES; } } else { mp_set(&res, 1); if ((err = mp_mod(G, P, &M[1])) != MP_OKAY) { goto LBL_RES; } } /* compute the value at M[1<<(winsize-1)] by squaring M[1] (winsize-1) times */ if ((err = mp_copy(&M[1], &M[1 << (winsize - 1)])) != MP_OKAY) { goto LBL_RES; } for (x = 0; x < (winsize - 1); x++) { if ((err = mp_sqr(&M[1 << (winsize - 1)], &M[1 << (winsize - 1)])) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&M[1 << (winsize - 1)], P, mp)) != MP_OKAY) { goto LBL_RES; } } /* create upper table */ for (x = (1 << (winsize - 1)) + 1; x < (1 << winsize); x++) { if ((err = mp_mul(&M[x - 1], &M[1], &M[x])) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&M[x], P, mp)) != MP_OKAY) { goto LBL_RES; } } /* set initial mode and bit cnt */ mode = 0; bitcnt = 1; buf = 0; digidx = X->used - 1; bitcpy = 0; bitbuf = 0; for ( ; ; ) { /* grab next digit as required */ if (--bitcnt == 0) { /* if digidx == -1 we are out of digits so break */ if (digidx == -1) { break; } /* read next digit and reset bitcnt */ buf = X->dp[digidx--]; bitcnt = (int)DIGIT_BIT; } /* grab the next msb from the exponent */ y = (mp_digit)(buf >> (DIGIT_BIT - 1)) & 1; buf <<= (mp_digit)1; /* if the bit is zero and mode == 0 then we ignore it * These represent the leading zero bits before the first 1 bit * in the exponent. Technically this opt is not required but it * does lower the # of trivial squaring/reductions used */ if ((mode == 0) && (y == 0)) { continue; } /* if the bit is zero and mode == 1 then we square */ if ((mode == 1) && (y == 0)) { if ((err = mp_sqr(&res, &res)) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&res, P, mp)) != MP_OKAY) { goto LBL_RES; } continue; } /* else we add it to the window */ bitbuf |= (y << (winsize - ++bitcpy)); mode = 2; if (bitcpy == winsize) { /* ok window is filled so square as required and multiply */ /* square first */ for (x = 0; x < winsize; x++) { if ((err = mp_sqr(&res, &res)) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&res, P, mp)) != MP_OKAY) { goto LBL_RES; } } /* then multiply */ if ((err = mp_mul(&res, &M[bitbuf], &res)) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&res, P, mp)) != MP_OKAY) { goto LBL_RES; } /* empty window and reset */ bitcpy = 0; bitbuf = 0; mode = 1; } } /* if bits remain then square/multiply */ if ((mode == 2) && (bitcpy > 0)) { /* square then multiply if the bit is set */ for (x = 0; x < bitcpy; x++) { if ((err = mp_sqr(&res, &res)) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&res, P, mp)) != MP_OKAY) { goto LBL_RES; } /* get next bit of the window */ bitbuf <<= 1; if ((bitbuf & (1 << winsize)) != 0) { /* then multiply */ if ((err = mp_mul(&res, &M[1], &res)) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&res, P, mp)) != MP_OKAY) { goto LBL_RES; } } } } if (redmode == 0) { /* fixup result if Montgomery reduction is used * recall that any value in a Montgomery system is * actually multiplied by R mod n. So we have * to reduce one more time to cancel out the factor * of R. */ if ((err = redux(&res, P, mp)) != MP_OKAY) { goto LBL_RES; } } /* swap res with Y */ mp_exch(&res, Y); err = MP_OKAY; LBL_RES: mp_clear(&res); LBL_M: mp_clear(&M[1]); for (x = 1 << (winsize - 1); x < (1 << winsize); x++) { mp_clear(&M[x]); } return err; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_EXTEUCLID_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* Extended euclidean algorithm of (a, b) produces a*u1 + b*u2 = u3 */ int mp_exteuclid(mp_int *a, mp_int *b, mp_int *U1, mp_int *U2, mp_int *U3) { mp_int u1, u2, u3, v1, v2, v3, t1, t2, t3, q, tmp; int err; if ((err = mp_init_multi(&u1, &u2, &u3, &v1, &v2, &v3, &t1, &t2, &t3, &q, &tmp, NULL)) != MP_OKAY) { return err; } /* initialize, (u1,u2,u3) = (1,0,a) */ mp_set(&u1, 1); if ((err = mp_copy(a, &u3)) != MP_OKAY) { goto _ERR; } /* initialize, (v1,v2,v3) = (0,1,b) */ mp_set(&v2, 1); if ((err = mp_copy(b, &v3)) != MP_OKAY) { goto _ERR; } /* loop while v3 != 0 */ while (mp_iszero(&v3) == MP_NO) { /* q = u3/v3 */ if ((err = mp_div(&u3, &v3, &q, NULL)) != MP_OKAY) { goto _ERR; } /* (t1,t2,t3) = (u1,u2,u3) - (v1,v2,v3)q */ if ((err = mp_mul(&v1, &q, &tmp)) != MP_OKAY) { goto _ERR; } if ((err = mp_sub(&u1, &tmp, &t1)) != MP_OKAY) { goto _ERR; } if ((err = mp_mul(&v2, &q, &tmp)) != MP_OKAY) { goto _ERR; } if ((err = mp_sub(&u2, &tmp, &t2)) != MP_OKAY) { goto _ERR; } if ((err = mp_mul(&v3, &q, &tmp)) != MP_OKAY) { goto _ERR; } if ((err = mp_sub(&u3, &tmp, &t3)) != MP_OKAY) { goto _ERR; } /* (u1,u2,u3) = (v1,v2,v3) */ if ((err = mp_copy(&v1, &u1)) != MP_OKAY) { goto _ERR; } if ((err = mp_copy(&v2, &u2)) != MP_OKAY) { goto _ERR; } if ((err = mp_copy(&v3, &u3)) != MP_OKAY) { goto _ERR; } /* (v1,v2,v3) = (t1,t2,t3) */ if ((err = mp_copy(&t1, &v1)) != MP_OKAY) { goto _ERR; } if ((err = mp_copy(&t2, &v2)) != MP_OKAY) { goto _ERR; } if ((err = mp_copy(&t3, &v3)) != MP_OKAY) { goto _ERR; } } /* make sure U3 >= 0 */ if (u3.sign == MP_NEG) { if ((err = mp_neg(&u1, &u1)) != MP_OKAY) { goto _ERR; } if ((err = mp_neg(&u2, &u2)) != MP_OKAY) { goto _ERR; } if ((err = mp_neg(&u3, &u3)) != MP_OKAY) { goto _ERR; } } /* copy result out */ if (U1 != NULL) { mp_exch(U1, &u1); } if (U2 != NULL) { mp_exch(U2, &u2); } if (U3 != NULL) { mp_exch(U3, &u3); } err = MP_OKAY; _ERR: mp_clear_multi(&u1, &u2, &u3, &v1, &v2, &v3, &t1, &t2, &t3, &q, &tmp, NULL); return err; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_FREAD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* read a bigint from a file stream in ASCII */ int mp_fread(mp_int *a, int radix, FILE *stream) { int err, ch, neg, y; /* clear a */ mp_zero(a); /* if first digit is - then set negative */ ch = fgetc(stream); if (ch == '-') { neg = MP_NEG; ch = fgetc(stream); } else { neg = MP_ZPOS; } for ( ; ; ) { /* find y in the radix map */ for (y = 0; y < radix; y++) { if (mp_s_rmap[y] == ch) { break; } } if (y == radix) { break; } /* shift up and add */ if ((err = mp_mul_d(a, radix, a)) != MP_OKAY) { return err; } if ((err = mp_add_d(a, y, a)) != MP_OKAY) { return err; } ch = fgetc(stream); } if (mp_cmp_d(a, 0) != MP_EQ) { a->sign = neg; } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_FWRITE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ int mp_fwrite(mp_int *a, int radix, FILE *stream) { char *buf; int err, len, x; if ((err = mp_radix_size(a, radix, &len)) != MP_OKAY) { return err; } buf = OPT_CAST(char) XMALLOC(len); if (buf == NULL) { return MP_MEM; } if ((err = mp_toradix(a, buf, radix)) != MP_OKAY) { XFREE(buf); return err; } for (x = 0; x < len; x++) { if (fputc(buf[x], stream) == EOF) { XFREE(buf); return MP_VAL; } } XFREE(buf); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_GCD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* Greatest Common Divisor using the binary method */ int mp_gcd(mp_int *a, mp_int *b, mp_int *c) { mp_int u, v; int k, u_lsb, v_lsb, res; /* either zero than gcd is the largest */ if (mp_iszero(a) == MP_YES) { return mp_abs(b, c); } if (mp_iszero(b) == MP_YES) { return mp_abs(a, c); } /* get copies of a and b we can modify */ if ((res = mp_init_copy(&u, a)) != MP_OKAY) { return res; } if ((res = mp_init_copy(&v, b)) != MP_OKAY) { goto LBL_U; } /* must be positive for the remainder of the algorithm */ u.sign = v.sign = MP_ZPOS; /* B1. Find the common power of two for u and v */ u_lsb = mp_cnt_lsb(&u); v_lsb = mp_cnt_lsb(&v); k = MIN(u_lsb, v_lsb); if (k > 0) { /* divide the power of two out */ if ((res = mp_div_2d(&u, k, &u, NULL)) != MP_OKAY) { goto LBL_V; } if ((res = mp_div_2d(&v, k, &v, NULL)) != MP_OKAY) { goto LBL_V; } } /* divide any remaining factors of two out */ if (u_lsb != k) { if ((res = mp_div_2d(&u, u_lsb - k, &u, NULL)) != MP_OKAY) { goto LBL_V; } } if (v_lsb != k) { if ((res = mp_div_2d(&v, v_lsb - k, &v, NULL)) != MP_OKAY) { goto LBL_V; } } while (mp_iszero(&v) == MP_NO) { /* make sure v is the largest */ if (mp_cmp_mag(&u, &v) == MP_GT) { /* swap u and v to make sure v is >= u */ mp_exch(&u, &v); } /* subtract smallest from largest */ if ((res = s_mp_sub(&v, &u, &v)) != MP_OKAY) { goto LBL_V; } /* Divide out all factors of two */ if ((res = mp_div_2d(&v, mp_cnt_lsb(&v), &v, NULL)) != MP_OKAY) { goto LBL_V; } } /* multiply by 2**k which we divided out at the beginning */ if ((res = mp_mul_2d(&u, k, c)) != MP_OKAY) { goto LBL_V; } c->sign = MP_ZPOS; res = MP_OKAY; LBL_V: mp_clear(&u); LBL_U: mp_clear(&v); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_GET_INT_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* get the lower 32-bits of an mp_int */ unsigned long mp_get_int(mp_int *a) { int i; mp_min_u32 res; if (a->used == 0) { return 0; } /* get number of digits of the lsb we have to read */ i = MIN(a->used, (int)(((sizeof(unsigned long) * CHAR_BIT) + DIGIT_BIT - 1) / DIGIT_BIT)) - 1; /* get most significant digit of result */ res = DIGIT(a, i); while (--i >= 0) { res = (res << DIGIT_BIT) | DIGIT(a, i); } /* force result to 32-bits always so it is consistent on non 32-bit platforms */ return res & 0xFFFFFFFFUL; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_GET_LONG_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* get the lower unsigned long of an mp_int, platform dependent */ unsigned long mp_get_long(mp_int *a) { int i; unsigned long res; if (a->used == 0) { return 0; } /* get number of digits of the lsb we have to read */ i = MIN(a->used, (int)(((sizeof(unsigned long) * CHAR_BIT) + DIGIT_BIT - 1) / DIGIT_BIT)) - 1; /* get most significant digit of result */ res = DIGIT(a, i); #if (ULONG_MAX != 0xffffffffuL) || (DIGIT_BIT < 32) while (--i >= 0) { res = (res << DIGIT_BIT) | DIGIT(a, i); } #endif return res; } #endif #ifdef BN_MP_GET_LONG_LONG_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* get the lower unsigned long long of an mp_int, platform dependent */ unsigned long long mp_get_long_long(mp_int *a) { int i; unsigned long long res; if (a->used == 0) { return 0; } /* get number of digits of the lsb we have to read */ i = MIN(a->used, (int)(((sizeof(unsigned long long) * CHAR_BIT) + DIGIT_BIT - 1) / DIGIT_BIT)) - 1; /* get most significant digit of result */ res = DIGIT(a, i); #if DIGIT_BIT < 64 while (--i >= 0) { res = (res << DIGIT_BIT) | DIGIT(a, i); } #endif return res; } #endif #ifdef BN_MP_GROW_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* grow as required */ int mp_grow(mp_int *a, int size) { int i; mp_digit *tmp; /* if the alloc size is smaller alloc more ram */ if (a->alloc < size) { /* ensure there are always at least MP_PREC digits extra on top */ size += (MP_PREC * 2) - (size % MP_PREC); /* reallocate the array a->dp * * We store the return in a temporary variable * in case the operation failed we don't want * to overwrite the dp member of a. */ tmp = OPT_CAST(mp_digit) XREALLOC(a->dp, sizeof(mp_digit) * size); if (tmp == NULL) { /* reallocation failed but "a" is still valid [can be freed] */ return MP_MEM; } /* reallocation succeeded so set a->dp */ a->dp = tmp; /* zero excess digits */ i = a->alloc; a->alloc = size; for ( ; i < a->alloc; i++) { a->dp[i] = 0; } } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_IMPORT_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* based on gmp's mpz_import. * see http://gmplib.org/manual/Integer-Import-and-Export.html */ int mp_import(mp_int *rop, size_t count, int order, size_t size, int endian, size_t nails, const void *op) { int result; size_t odd_nails, nail_bytes, i, j; unsigned char odd_nail_mask; mp_zero(rop); if (endian == 0) { union { unsigned int i; char c[4]; } lint; lint.i = 0x01020304; endian = (lint.c[0] == 4) ? -1 : 1; } odd_nails = (nails % 8); odd_nail_mask = 0xff; for (i = 0; i < odd_nails; ++i) { odd_nail_mask ^= (1 << (7 - i)); } nail_bytes = nails / 8; for (i = 0; i < count; ++i) { for (j = 0; j < (size - nail_bytes); ++j) { unsigned char byte = *( (unsigned char *)op + (((order == 1) ? i : ((count - 1) - i)) * size) + ((endian == 1) ? (j + nail_bytes) : (((size - 1) - j) - nail_bytes)) ); if ( (result = mp_mul_2d(rop, ((j == 0) ? (8 - odd_nails) : 8), rop)) != MP_OKAY) { return result; } rop->dp[0] |= (j == 0) ? (byte & odd_nail_mask) : byte; rop->used += 1; } } mp_clamp(rop); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_INIT_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* init a new mp_int */ int mp_init(mp_int *a) { int i; /* allocate memory required and clear it */ a->dp = OPT_CAST(mp_digit) XMALLOC(sizeof(mp_digit) * MP_PREC); if (a->dp == NULL) { return MP_MEM; } /* set the digits to zero */ for (i = 0; i < MP_PREC; i++) { a->dp[i] = 0; } /* set the used to zero, allocated digits to the default precision * and sign to positive */ a->used = 0; a->alloc = MP_PREC; a->sign = MP_ZPOS; return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_INIT_COPY_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* creates "a" then copies b into it */ int mp_init_copy(mp_int *a, mp_int *b) { int res; if ((res = mp_init_size(a, b->used)) != MP_OKAY) { return res; } return mp_copy(b, a); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_INIT_MULTI_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ #include int mp_init_multi(mp_int *mp, ...) { mp_err res = MP_OKAY; /* Assume ok until proven otherwise */ int n = 0; /* Number of ok inits */ mp_int *cur_arg = mp; va_list args; va_start(args, mp); /* init args to next argument from caller */ while (cur_arg != NULL) { if (mp_init(cur_arg) != MP_OKAY) { /* Oops - error! Back-track and mp_clear what we already succeeded in init-ing, then return error. */ va_list clean_args; /* end the current list */ va_end(args); /* now start cleaning up */ cur_arg = mp; va_start(clean_args, mp); while (n-- != 0) { mp_clear(cur_arg); cur_arg = va_arg(clean_args, mp_int *); } va_end(clean_args); res = MP_MEM; break; } n++; cur_arg = va_arg(args, mp_int *); } va_end(args); return res; /* Assumed ok, if error flagged above. */ } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_INIT_SET_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* initialize and set a digit */ int mp_init_set(mp_int *a, mp_digit b) { int err; if ((err = mp_init(a)) != MP_OKAY) { return err; } mp_set(a, b); return err; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_INIT_SET_INT_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* initialize and set a digit */ int mp_init_set_int(mp_int *a, unsigned long b) { int err; if ((err = mp_init(a)) != MP_OKAY) { return err; } return mp_set_int(a, b); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_INIT_SIZE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* init an mp_init for a given size */ int mp_init_size(mp_int *a, int size) { int x; /* pad size so there are always extra digits */ size += (MP_PREC * 2) - (size % MP_PREC); /* alloc mem */ a->dp = OPT_CAST(mp_digit) XMALLOC(sizeof(mp_digit) * size); if (a->dp == NULL) { return MP_MEM; } /* set the members */ a->used = 0; a->alloc = size; a->sign = MP_ZPOS; /* zero the digits */ for (x = 0; x < size; x++) { a->dp[x] = 0; } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_INVMOD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* hac 14.61, pp608 */ int mp_invmod(mp_int *a, mp_int *b, mp_int *c) { /* b cannot be negative */ if ((b->sign == MP_NEG) || (mp_iszero(b) == MP_YES)) { return MP_VAL; } #ifdef BN_FAST_MP_INVMOD_C /* if the modulus is odd we can use a faster routine instead */ if (mp_isodd(b) == MP_YES) { return fast_mp_invmod(a, b, c); } #endif #ifdef BN_MP_INVMOD_SLOW_C return mp_invmod_slow(a, b, c); #else return MP_VAL; #endif } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_INVMOD_SLOW_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* hac 14.61, pp608 */ int mp_invmod_slow(mp_int *a, mp_int *b, mp_int *c) { mp_int x, y, u, v, A, B, C, D; int res; /* b cannot be negative */ if ((b->sign == MP_NEG) || (mp_iszero(b) == MP_YES)) { return MP_VAL; } /* init temps */ if ((res = mp_init_multi(&x, &y, &u, &v, &A, &B, &C, &D, NULL)) != MP_OKAY) { return res; } /* x = a, y = b */ if ((res = mp_mod(a, b, &x)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_copy(b, &y)) != MP_OKAY) { goto LBL_ERR; } /* 2. [modified] if x,y are both even then return an error! */ if ((mp_iseven(&x) == MP_YES) && (mp_iseven(&y) == MP_YES)) { res = MP_VAL; goto LBL_ERR; } /* 3. u=x, v=y, A=1, B=0, C=0,D=1 */ if ((res = mp_copy(&x, &u)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_copy(&y, &v)) != MP_OKAY) { goto LBL_ERR; } mp_set(&A, 1); mp_set(&D, 1); top: /* 4. while u is even do */ while (mp_iseven(&u) == MP_YES) { /* 4.1 u = u/2 */ if ((res = mp_div_2(&u, &u)) != MP_OKAY) { goto LBL_ERR; } /* 4.2 if A or B is odd then */ if ((mp_isodd(&A) == MP_YES) || (mp_isodd(&B) == MP_YES)) { /* A = (A+y)/2, B = (B-x)/2 */ if ((res = mp_add(&A, &y, &A)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_sub(&B, &x, &B)) != MP_OKAY) { goto LBL_ERR; } } /* A = A/2, B = B/2 */ if ((res = mp_div_2(&A, &A)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_div_2(&B, &B)) != MP_OKAY) { goto LBL_ERR; } } /* 5. while v is even do */ while (mp_iseven(&v) == MP_YES) { /* 5.1 v = v/2 */ if ((res = mp_div_2(&v, &v)) != MP_OKAY) { goto LBL_ERR; } /* 5.2 if C or D is odd then */ if ((mp_isodd(&C) == MP_YES) || (mp_isodd(&D) == MP_YES)) { /* C = (C+y)/2, D = (D-x)/2 */ if ((res = mp_add(&C, &y, &C)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_sub(&D, &x, &D)) != MP_OKAY) { goto LBL_ERR; } } /* C = C/2, D = D/2 */ if ((res = mp_div_2(&C, &C)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_div_2(&D, &D)) != MP_OKAY) { goto LBL_ERR; } } /* 6. if u >= v then */ if (mp_cmp(&u, &v) != MP_LT) { /* u = u - v, A = A - C, B = B - D */ if ((res = mp_sub(&u, &v, &u)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_sub(&A, &C, &A)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_sub(&B, &D, &B)) != MP_OKAY) { goto LBL_ERR; } } else { /* v - v - u, C = C - A, D = D - B */ if ((res = mp_sub(&v, &u, &v)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_sub(&C, &A, &C)) != MP_OKAY) { goto LBL_ERR; } if ((res = mp_sub(&D, &B, &D)) != MP_OKAY) { goto LBL_ERR; } } /* if not zero goto step 4 */ if (mp_iszero(&u) == MP_NO) goto top; /* now a = C, b = D, gcd == g*v */ /* if v != 1 then there is no inverse */ if (mp_cmp_d(&v, 1) != MP_EQ) { res = MP_VAL; goto LBL_ERR; } /* if its too low */ while (mp_cmp_d(&C, 0) == MP_LT) { if ((res = mp_add(&C, b, &C)) != MP_OKAY) { goto LBL_ERR; } } /* too big */ while (mp_cmp_mag(&C, b) != MP_LT) { if ((res = mp_sub(&C, b, &C)) != MP_OKAY) { goto LBL_ERR; } } /* C is now the inverse */ mp_exch(&C, c); res = MP_OKAY; LBL_ERR: mp_clear_multi(&x, &y, &u, &v, &A, &B, &C, &D, NULL); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_IS_SQUARE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* Check if remainders are possible squares - fast exclude non-squares */ static const char rem_128[128] = { 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1 }; static const char rem_105[105] = { 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1 }; /* Store non-zero to ret if arg is square, and zero if not */ int mp_is_square(mp_int *arg, int *ret) { int res; mp_digit c; mp_int t; unsigned long r; /* Default to Non-square :) */ *ret = MP_NO; if (arg->sign == MP_NEG) { return MP_VAL; } /* digits used? (TSD) */ if (arg->used == 0) { return MP_OKAY; } /* First check mod 128 (suppose that DIGIT_BIT is at least 7) */ if (rem_128[127 & DIGIT(arg, 0)] == 1) { return MP_OKAY; } /* Next check mod 105 (3*5*7) */ if ((res = mp_mod_d(arg, 105, &c)) != MP_OKAY) { return res; } if (rem_105[c] == 1) { return MP_OKAY; } if ((res = mp_init_set_int(&t, 11L * 13L * 17L * 19L * 23L * 29L * 31L)) != MP_OKAY) { return res; } if ((res = mp_mod(arg, &t, &t)) != MP_OKAY) { goto ERR; } r = mp_get_int(&t); /* Check for other prime modules, note it's not an ERROR but we must * free "t" so the easiest way is to goto ERR. We know that res * is already equal to MP_OKAY from the mp_mod call */ if (((1L << (r % 11)) & 0x5C4L) != 0L) goto ERR; if (((1L << (r % 13)) & 0x9E4L) != 0L) goto ERR; if (((1L << (r % 17)) & 0x5CE8L) != 0L) goto ERR; if (((1L << (r % 19)) & 0x4F50CL) != 0L) goto ERR; if (((1L << (r % 23)) & 0x7ACCA0L) != 0L) goto ERR; if (((1L << (r % 29)) & 0xC2EDD0CL) != 0L) goto ERR; if (((1L << (r % 31)) & 0x6DE2B848L) != 0L) goto ERR; /* Final check - is sqr(sqrt(arg)) == arg ? */ if ((res = mp_sqrt(arg, &t)) != MP_OKAY) { goto ERR; } if ((res = mp_sqr(&t, &t)) != MP_OKAY) { goto ERR; } *ret = (mp_cmp_mag(&t, arg) == MP_EQ) ? MP_YES : MP_NO; ERR: mp_clear(&t); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_JACOBI_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* computes the jacobi c = (a | n) (or Legendre if n is prime) * HAC pp. 73 Algorithm 2.149 * HAC is wrong here, as the special case of (0 | 1) is not * handled correctly. */ int mp_jacobi(mp_int *a, mp_int *n, int *c) { mp_int a1, p1; int k, s, r, res; mp_digit residue; /* if n <= 0 return MP_VAL */ if (mp_cmp_d(n, 0) != MP_GT) { return MP_VAL; } /* step 1. handle case of a == 0 */ if (mp_iszero(a) == MP_YES) { /* special case of a == 0 and n == 1 */ if (mp_cmp_d(n, 1) == MP_EQ) { *c = 1; } else { *c = 0; } return MP_OKAY; } /* step 2. if a == 1, return 1 */ if (mp_cmp_d(a, 1) == MP_EQ) { *c = 1; return MP_OKAY; } /* default */ s = 0; /* step 3. write a = a1 * 2**k */ if ((res = mp_init_copy(&a1, a)) != MP_OKAY) { return res; } if ((res = mp_init(&p1)) != MP_OKAY) { goto LBL_A1; } /* divide out larger power of two */ k = mp_cnt_lsb(&a1); if ((res = mp_div_2d(&a1, k, &a1, NULL)) != MP_OKAY) { goto LBL_P1; } /* step 4. if e is even set s=1 */ if ((k & 1) == 0) { s = 1; } else { /* else set s=1 if p = 1/7 (mod 8) or s=-1 if p = 3/5 (mod 8) */ residue = n->dp[0] & 7; if ((residue == 1) || (residue == 7)) { s = 1; } else if ((residue == 3) || (residue == 5)) { s = -1; } } /* step 5. if p == 3 (mod 4) *and* a1 == 3 (mod 4) then s = -s */ if (((n->dp[0] & 3) == 3) && ((a1.dp[0] & 3) == 3)) { s = -s; } /* if a1 == 1 we're done */ if (mp_cmp_d(&a1, 1) == MP_EQ) { *c = s; } else { /* n1 = n mod a1 */ if ((res = mp_mod(n, &a1, &p1)) != MP_OKAY) { goto LBL_P1; } if ((res = mp_jacobi(&p1, &a1, &r)) != MP_OKAY) { goto LBL_P1; } *c = s * r; } /* done */ res = MP_OKAY; LBL_P1: mp_clear(&p1); LBL_A1: mp_clear(&a1); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_KARATSUBA_MUL_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* c = |a| * |b| using Karatsuba Multiplication using * three half size multiplications * * Let B represent the radix [e.g. 2**DIGIT_BIT] and * let n represent half of the number of digits in * the min(a,b) * * a = a1 * B**n + a0 * b = b1 * B**n + b0 * * Then, a * b => a1b1 * B**2n + ((a1 + a0)(b1 + b0) - (a0b0 + a1b1)) * B + a0b0 * * Note that a1b1 and a0b0 are used twice and only need to be * computed once. So in total three half size (half # of * digit) multiplications are performed, a0b0, a1b1 and * (a1+b1)(a0+b0) * * Note that a multiplication of half the digits requires * 1/4th the number of single precision multiplications so in * total after one call 25% of the single precision multiplications * are saved. Note also that the call to mp_mul can end up back * in this function if the a0, a1, b0, or b1 are above the threshold. * This is known as divide-and-conquer and leads to the famous * O(N**lg(3)) or O(N**1.584) work which is asymptopically lower than * the standard O(N**2) that the baseline/comba methods use. * Generally though the overhead of this method doesn't pay off * until a certain size (N ~ 80) is reached. */ int mp_karatsuba_mul(mp_int *a, mp_int *b, mp_int *c) { mp_int x0, x1, y0, y1, t1, x0y0, x1y1; int B, err; /* default the return code to an error */ err = MP_MEM; /* min # of digits */ B = MIN(a->used, b->used); /* now divide in two */ B = B >> 1; /* init copy all the temps */ if (mp_init_size(&x0, B) != MP_OKAY) goto ERR; if (mp_init_size(&x1, a->used - B) != MP_OKAY) goto X0; if (mp_init_size(&y0, B) != MP_OKAY) goto X1; if (mp_init_size(&y1, b->used - B) != MP_OKAY) goto Y0; /* init temps */ if (mp_init_size(&t1, B * 2) != MP_OKAY) goto Y1; if (mp_init_size(&x0y0, B * 2) != MP_OKAY) goto T1; if (mp_init_size(&x1y1, B * 2) != MP_OKAY) goto X0Y0; /* now shift the digits */ x0.used = y0.used = B; x1.used = a->used - B; y1.used = b->used - B; { int x; mp_digit *tmpa, *tmpb, *tmpx, *tmpy; /* we copy the digits directly instead of using higher level functions * since we also need to shift the digits */ tmpa = a->dp; tmpb = b->dp; tmpx = x0.dp; tmpy = y0.dp; for (x = 0; x < B; x++) { *tmpx++ = *tmpa++; *tmpy++ = *tmpb++; } tmpx = x1.dp; for (x = B; x < a->used; x++) { *tmpx++ = *tmpa++; } tmpy = y1.dp; for (x = B; x < b->used; x++) { *tmpy++ = *tmpb++; } } /* only need to clamp the lower words since by definition the * upper words x1/y1 must have a known number of digits */ mp_clamp(&x0); mp_clamp(&y0); /* now calc the products x0y0 and x1y1 */ /* after this x0 is no longer required, free temp [x0==t2]! */ if (mp_mul(&x0, &y0, &x0y0) != MP_OKAY) goto X1Y1; /* x0y0 = x0*y0 */ if (mp_mul(&x1, &y1, &x1y1) != MP_OKAY) goto X1Y1; /* x1y1 = x1*y1 */ /* now calc x1+x0 and y1+y0 */ if (s_mp_add(&x1, &x0, &t1) != MP_OKAY) goto X1Y1; /* t1 = x1 - x0 */ if (s_mp_add(&y1, &y0, &x0) != MP_OKAY) goto X1Y1; /* t2 = y1 - y0 */ if (mp_mul(&t1, &x0, &t1) != MP_OKAY) goto X1Y1; /* t1 = (x1 + x0) * (y1 + y0) */ /* add x0y0 */ if (mp_add(&x0y0, &x1y1, &x0) != MP_OKAY) goto X1Y1; /* t2 = x0y0 + x1y1 */ if (s_mp_sub(&t1, &x0, &t1) != MP_OKAY) goto X1Y1; /* t1 = (x1+x0)*(y1+y0) - (x1y1 + x0y0) */ /* shift by B */ if (mp_lshd(&t1, B) != MP_OKAY) goto X1Y1; /* t1 = (x0y0 + x1y1 - (x1-x0)*(y1-y0))<used; /* now divide in two */ B = B >> 1; /* init copy all the temps */ if (mp_init_size(&x0, B) != MP_OKAY) goto ERR; if (mp_init_size(&x1, a->used - B) != MP_OKAY) goto X0; /* init temps */ if (mp_init_size(&t1, a->used * 2) != MP_OKAY) goto X1; if (mp_init_size(&t2, a->used * 2) != MP_OKAY) goto T1; if (mp_init_size(&x0x0, B * 2) != MP_OKAY) goto T2; if (mp_init_size(&x1x1, (a->used - B) * 2) != MP_OKAY) goto X0X0; { int x; mp_digit *dst, *src; src = a->dp; /* now shift the digits */ dst = x0.dp; for (x = 0; x < B; x++) { *dst++ = *src++; } dst = x1.dp; for (x = B; x < a->used; x++) { *dst++ = *src++; } } x0.used = B; x1.used = a->used - B; mp_clamp(&x0); /* now calc the products x0*x0 and x1*x1 */ if (mp_sqr(&x0, &x0x0) != MP_OKAY) goto X1X1; /* x0x0 = x0*x0 */ if (mp_sqr(&x1, &x1x1) != MP_OKAY) goto X1X1; /* x1x1 = x1*x1 */ /* now calc (x1+x0)**2 */ if (s_mp_add(&x1, &x0, &t1) != MP_OKAY) goto X1X1; /* t1 = x1 - x0 */ if (mp_sqr(&t1, &t1) != MP_OKAY) goto X1X1; /* t1 = (x1 - x0) * (x1 - x0) */ /* add x0y0 */ if (s_mp_add(&x0x0, &x1x1, &t2) != MP_OKAY) goto X1X1; /* t2 = x0x0 + x1x1 */ if (s_mp_sub(&t1, &t2, &t1) != MP_OKAY) goto X1X1; /* t1 = (x1+x0)**2 - (x0x0 + x1x1) */ /* shift by B */ if (mp_lshd(&t1, B) != MP_OKAY) goto X1X1; /* t1 = (x0x0 + x1x1 - (x1-x0)*(x1-x0))<sign = MP_ZPOS; LBL_T: mp_clear_multi(&t1, &t2, NULL); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_LSHD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* shift left a certain amount of digits */ int mp_lshd(mp_int *a, int b) { int x, res; /* if its less than zero return */ if (b <= 0) { return MP_OKAY; } /* grow to fit the new digits */ if (a->alloc < (a->used + b)) { if ((res = mp_grow(a, a->used + b)) != MP_OKAY) { return res; } } { mp_digit *top, *bottom; /* increment the used by the shift amount then copy upwards */ a->used += b; /* top */ top = a->dp + a->used - 1; /* base */ bottom = (a->dp + a->used - 1) - b; /* much like mp_rshd this is implemented using a sliding window * except the window goes the otherway around. Copying from * the bottom to the top. see bn_mp_rshd.c for more info. */ for (x = a->used - 1; x >= b; x--) { *top-- = *bottom--; } /* zero the lower digits */ top = a->dp; for (x = 0; x < b; x++) { *top++ = 0; } } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_MOD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* c = a mod b, 0 <= c < b if b > 0, b < c <= 0 if b < 0 */ int mp_mod(mp_int *a, mp_int *b, mp_int *c) { mp_int t; int res; if ((res = mp_init(&t)) != MP_OKAY) { return res; } if ((res = mp_div(a, b, NULL, &t)) != MP_OKAY) { mp_clear(&t); return res; } if ((mp_iszero(&t) != MP_NO) || (t.sign == b->sign)) { res = MP_OKAY; mp_exch(&t, c); } else { res = mp_add(b, &t, c); } mp_clear(&t); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_MOD_2D_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* calc a value mod 2**b */ int mp_mod_2d(mp_int *a, int b, mp_int *c) { int x, res; /* if b is <= 0 then zero the int */ if (b <= 0) { mp_zero(c); return MP_OKAY; } /* if the modulus is larger than the value than return */ if (b >= (int)(a->used * DIGIT_BIT)) { res = mp_copy(a, c); return res; } /* copy */ if ((res = mp_copy(a, c)) != MP_OKAY) { return res; } /* zero digits above the last digit of the modulus */ for (x = (b / DIGIT_BIT) + (((b % DIGIT_BIT) == 0) ? 0 : 1); x < c->used; x++) { c->dp[x] = 0; } /* clear the digit that is not completely outside/inside the modulus */ c->dp[b / DIGIT_BIT] &= (mp_digit)((((mp_digit)1) << (((mp_digit)b) % DIGIT_BIT)) - ((mp_digit)1)); mp_clamp(c); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_MOD_D_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ int mp_mod_d(mp_int *a, mp_digit b, mp_digit *c) { return mp_div_d(a, b, NULL, c); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_MONTGOMERY_CALC_NORMALIZATION_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* * shifts with subtractions when the result is greater than b. * * The method is slightly modified to shift B unconditionally upto just under * the leading bit of b. This saves alot of multiple precision shifting. */ int mp_montgomery_calc_normalization(mp_int *a, mp_int *b) { int x, bits, res; /* how many bits of last digit does b use */ bits = mp_count_bits(b) % DIGIT_BIT; if (b->used > 1) { if ((res = mp_2expt(a, ((b->used - 1) * DIGIT_BIT) + bits - 1)) != MP_OKAY) { return res; } } else { mp_set(a, 1); bits = 1; } /* now compute C = A * B mod b */ for (x = bits - 1; x < (int)DIGIT_BIT; x++) { if ((res = mp_mul_2(a, a)) != MP_OKAY) { return res; } if (mp_cmp_mag(a, b) != MP_LT) { if ((res = s_mp_sub(a, b, a)) != MP_OKAY) { return res; } } } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_MONTGOMERY_REDUCE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* computes xR**-1 == x (mod N) via Montgomery Reduction */ int mp_montgomery_reduce(mp_int *x, mp_int *n, mp_digit rho) { int ix, res, digs; mp_digit mu; /* can the fast reduction [comba] method be used? * * Note that unlike in mul you're safely allowed *less* * than the available columns [255 per default] since carries * are fixed up in the inner loop. */ digs = (n->used * 2) + 1; if ((digs < MP_WARRAY) && (n->used < (1 << ((CHAR_BIT * sizeof(mp_word)) - (2 * DIGIT_BIT))))) { return fast_mp_montgomery_reduce(x, n, rho); } /* grow the input as required */ if (x->alloc < digs) { if ((res = mp_grow(x, digs)) != MP_OKAY) { return res; } } x->used = digs; for (ix = 0; ix < n->used; ix++) { /* mu = ai * rho mod b * * The value of rho must be precalculated via * montgomery_setup() such that * it equals -1/n0 mod b this allows the * following inner loop to reduce the * input one digit at a time */ mu = (mp_digit)(((mp_word)x->dp[ix] * (mp_word)rho) & MP_MASK); /* a = a + mu * m * b**i */ { int iy; mp_digit *tmpn, *tmpx, u; mp_word r; /* alias for digits of the modulus */ tmpn = n->dp; /* alias for the digits of x [the input] */ tmpx = x->dp + ix; /* set the carry to zero */ u = 0; /* Multiply and add in place */ for (iy = 0; iy < n->used; iy++) { /* compute product and sum */ r = ((mp_word)mu * (mp_word) * tmpn++) + (mp_word)u + (mp_word) * tmpx; /* get carry */ u = (mp_digit)(r >> ((mp_word)DIGIT_BIT)); /* fix digit */ *tmpx++ = (mp_digit)(r & ((mp_word)MP_MASK)); } /* At this point the ix'th digit of x should be zero */ /* propagate carries upwards as required*/ while (u != 0) { *tmpx += u; u = *tmpx >> DIGIT_BIT; *tmpx++ &= MP_MASK; } } } /* at this point the n.used'th least * significant digits of x are all zero * which means we can shift x to the * right by n.used digits and the * residue is unchanged. */ /* x = x/b**n.used */ mp_clamp(x); mp_rshd(x, n->used); /* if x >= n then x = x - n */ if (mp_cmp_mag(x, n) != MP_LT) { return s_mp_sub(x, n, x); } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_MONTGOMERY_SETUP_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* setups the montgomery reduction stuff */ int mp_montgomery_setup(mp_int *n, mp_digit *rho) { mp_digit x, b; /* fast inversion mod 2**k * * Based on the fact that * * XA = 1 (mod 2**n) => (X(2-XA)) A = 1 (mod 2**2n) * => 2*X*A - X*X*A*A = 1 * => 2*(1) - (1) = 1 */ b = n->dp[0]; if ((b & 1) == 0) { return MP_VAL; } x = (((b + 2) & 4) << 1) + b; /* here x*a==1 mod 2**4 */ x *= 2 - (b * x); /* here x*a==1 mod 2**8 */ #if !defined(MP_8BIT) x *= 2 - (b * x); /* here x*a==1 mod 2**16 */ #endif #if defined(MP_64BIT) || !(defined(MP_8BIT) || defined(MP_16BIT)) x *= 2 - (b * x); /* here x*a==1 mod 2**32 */ #endif #ifdef MP_64BIT x *= 2 - (b * x); /* here x*a==1 mod 2**64 */ #endif /* rho = -1/m mod b */ *rho = (mp_digit)(((mp_word)1 << ((mp_word)DIGIT_BIT)) - x) & MP_MASK; return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_MUL_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* high level multiplication (handles sign) */ int mp_mul(mp_int *a, mp_int *b, mp_int *c) { int res, neg; neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; /* use Toom-Cook? */ #ifdef BN_MP_TOOM_MUL_C if (MIN(a->used, b->used) >= TOOM_MUL_CUTOFF) { res = mp_toom_mul(a, b, c); } else #endif #ifdef BN_MP_KARATSUBA_MUL_C /* use Karatsuba? */ if (MIN(a->used, b->used) >= KARATSUBA_MUL_CUTOFF) { res = mp_karatsuba_mul(a, b, c); } else #endif { /* can we use the fast multiplier? * * The fast multiplier can be used if the output will * have less than MP_WARRAY digits and the number of * digits won't affect carry propagation */ int digs = a->used + b->used + 1; #ifdef BN_FAST_S_MP_MUL_DIGS_C if ((digs < MP_WARRAY) && (MIN(a->used, b->used) <= (1 << ((CHAR_BIT * sizeof(mp_word)) - (2 * DIGIT_BIT))))) { res = fast_s_mp_mul_digs(a, b, c, digs); } else #endif { #ifdef BN_S_MP_MUL_DIGS_C res = s_mp_mul(a, b, c); /* uses s_mp_mul_digs */ #else res = MP_VAL; #endif } } c->sign = (c->used > 0) ? neg : MP_ZPOS; return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_MUL_2_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* b = a*2 */ int mp_mul_2(mp_int *a, mp_int *b) { int x, res, oldused; /* grow to accomodate result */ if (b->alloc < (a->used + 1)) { if ((res = mp_grow(b, a->used + 1)) != MP_OKAY) { return res; } } oldused = b->used; b->used = a->used; { mp_digit r, rr, *tmpa, *tmpb; /* alias for source */ tmpa = a->dp; /* alias for dest */ tmpb = b->dp; /* carry */ r = 0; for (x = 0; x < a->used; x++) { /* get what will be the *next* carry bit from the * MSB of the current digit */ rr = *tmpa >> ((mp_digit)(DIGIT_BIT - 1)); /* now shift up this digit, add in the carry [from the previous] */ *tmpb++ = ((*tmpa++ << ((mp_digit)1)) | r) & MP_MASK; /* copy the carry that would be from the source * digit into the next iteration */ r = rr; } /* new leading digit? */ if (r != 0) { /* add a MSB which is always 1 at this point */ *tmpb = 1; ++(b->used); } /* now zero any excess digits on the destination * that we didn't write to */ tmpb = b->dp + b->used; for (x = b->used; x < oldused; x++) { *tmpb++ = 0; } } b->sign = a->sign; return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_MUL_2D_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* shift left by a certain bit count */ int mp_mul_2d(mp_int *a, int b, mp_int *c) { mp_digit d; int res; /* copy */ if (a != c) { if ((res = mp_copy(a, c)) != MP_OKAY) { return res; } } if (c->alloc < (int)(c->used + (b / DIGIT_BIT) + 1)) { if ((res = mp_grow(c, c->used + (b / DIGIT_BIT) + 1)) != MP_OKAY) { return res; } } /* shift by as many digits in the bit count */ if (b >= (int)DIGIT_BIT) { if ((res = mp_lshd(c, b / DIGIT_BIT)) != MP_OKAY) { return res; } } /* shift any bit count < DIGIT_BIT */ d = (mp_digit)(b % DIGIT_BIT); if (d != 0) { mp_digit *tmpc, shift, mask, r, rr; int x; /* bitmask for carries */ mask = (((mp_digit)1) << d) - 1; /* shift for msbs */ shift = DIGIT_BIT - d; /* alias */ tmpc = c->dp; /* carry */ r = 0; for (x = 0; x < c->used; x++) { /* get the higher bits of the current word */ rr = (*tmpc >> shift) & mask; /* shift the current word and OR in the carry */ *tmpc = ((*tmpc << d) | r) & MP_MASK; ++tmpc; /* set the carry to the carry bits of the current word */ r = rr; } /* set final carry */ if (r != 0) { c->dp[(c->used)++] = r; } } mp_clamp(c); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_MUL_D_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* multiply by a digit */ int mp_mul_d(mp_int *a, mp_digit b, mp_int *c) { mp_digit u, *tmpa, *tmpc; mp_word r; int ix, res, olduse; /* make sure c is big enough to hold a*b */ if (c->alloc < (a->used + 1)) { if ((res = mp_grow(c, a->used + 1)) != MP_OKAY) { return res; } } /* get the original destinations used count */ olduse = c->used; /* set the sign */ c->sign = a->sign; /* alias for a->dp [source] */ tmpa = a->dp; /* alias for c->dp [dest] */ tmpc = c->dp; /* zero carry */ u = 0; /* compute columns */ for (ix = 0; ix < a->used; ix++) { /* compute product and carry sum for this term */ r = (mp_word)u + ((mp_word) * tmpa++ *(mp_word)b); /* mask off higher bits to get a single digit */ *tmpc++ = (mp_digit)(r & ((mp_word)MP_MASK)); /* send carry into next iteration */ u = (mp_digit)(r >> ((mp_word)DIGIT_BIT)); } /* store final carry [if any] and increment ix offset */ *tmpc++ = u; ++ix; /* now zero digits above the top */ while (ix++ < olduse) { *tmpc++ = 0; } /* set used count */ c->used = a->used + 1; mp_clamp(c); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_MULMOD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* d = a * b (mod c) */ int mp_mulmod(mp_int *a, mp_int *b, mp_int *c, mp_int *d) { int res; mp_int t; if ((res = mp_init(&t)) != MP_OKAY) { return res; } if ((res = mp_mul(a, b, &t)) != MP_OKAY) { mp_clear(&t); return res; } res = mp_mod(&t, c, d); mp_clear(&t); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_N_ROOT_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* wrapper function for mp_n_root_ex() * computes c = (a)**(1/b) such that (c)**b <= a and (c+1)**b > a */ int mp_n_root(mp_int *a, mp_digit b, mp_int *c) { return mp_n_root_ex(a, b, c, 0); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_N_ROOT_EX_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* find the n'th root of an integer * * Result found such that (c)**b <= a and (c+1)**b > a * * This algorithm uses Newton's approximation * x[i+1] = x[i] - f(x[i])/f'(x[i]) * which will find the root in log(N) time where * each step involves a fair bit. This is not meant to * find huge roots [square and cube, etc]. */ int mp_n_root_ex(mp_int *a, mp_digit b, mp_int *c, int fast) { mp_int t1, t2, t3; int res, neg; /* input must be positive if b is even */ if (((b & 1) == 0) && (a->sign == MP_NEG)) { return MP_VAL; } if ((res = mp_init(&t1)) != MP_OKAY) { return res; } if ((res = mp_init(&t2)) != MP_OKAY) { goto LBL_T1; } if ((res = mp_init(&t3)) != MP_OKAY) { goto LBL_T2; } /* if a is negative fudge the sign but keep track */ neg = a->sign; a->sign = MP_ZPOS; /* t2 = 2 */ mp_set(&t2, 2); do { /* t1 = t2 */ if ((res = mp_copy(&t2, &t1)) != MP_OKAY) { goto LBL_T3; } /* t2 = t1 - ((t1**b - a) / (b * t1**(b-1))) */ /* t3 = t1**(b-1) */ if ((res = mp_expt_d_ex(&t1, b - 1, &t3, fast)) != MP_OKAY) { goto LBL_T3; } /* numerator */ /* t2 = t1**b */ if ((res = mp_mul(&t3, &t1, &t2)) != MP_OKAY) { goto LBL_T3; } /* t2 = t1**b - a */ if ((res = mp_sub(&t2, a, &t2)) != MP_OKAY) { goto LBL_T3; } /* denominator */ /* t3 = t1**(b-1) * b */ if ((res = mp_mul_d(&t3, b, &t3)) != MP_OKAY) { goto LBL_T3; } /* t3 = (t1**b - a)/(b * t1**(b-1)) */ if ((res = mp_div(&t2, &t3, &t3, NULL)) != MP_OKAY) { goto LBL_T3; } if ((res = mp_sub(&t1, &t3, &t2)) != MP_OKAY) { goto LBL_T3; } } while (mp_cmp(&t1, &t2) != MP_EQ); /* result can be off by a few so check */ for ( ; ; ) { if ((res = mp_expt_d_ex(&t1, b, &t2, fast)) != MP_OKAY) { goto LBL_T3; } if (mp_cmp(&t2, a) == MP_GT) { if ((res = mp_sub_d(&t1, 1, &t1)) != MP_OKAY) { goto LBL_T3; } } else { break; } } /* reset the sign of a first */ a->sign = neg; /* set the result */ mp_exch(&t1, c); /* set the sign of the result */ c->sign = neg; res = MP_OKAY; LBL_T3: mp_clear(&t3); LBL_T2: mp_clear(&t2); LBL_T1: mp_clear(&t1); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_NEG_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* b = -a */ int mp_neg(mp_int *a, mp_int *b) { int res; if (a != b) { if ((res = mp_copy(a, b)) != MP_OKAY) { return res; } } if (mp_iszero(b) != MP_YES) { b->sign = (a->sign == MP_ZPOS) ? MP_NEG : MP_ZPOS; } else { b->sign = MP_ZPOS; } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_OR_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* OR two ints together */ int mp_or(mp_int *a, mp_int *b, mp_int *c) { int res, ix, px; mp_int t, *x; if (a->used > b->used) { if ((res = mp_init_copy(&t, a)) != MP_OKAY) { return res; } px = b->used; x = b; } else { if ((res = mp_init_copy(&t, b)) != MP_OKAY) { return res; } px = a->used; x = a; } for (ix = 0; ix < px; ix++) { t.dp[ix] |= x->dp[ix]; } mp_clamp(&t); mp_exch(c, &t); mp_clear(&t); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_PRIME_FERMAT_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* performs one Fermat test. * * If "a" were prime then b**a == b (mod a) since the order of * the multiplicative sub-group would be phi(a) = a-1. That means * it would be the same as b**(a mod (a-1)) == b**1 == b (mod a). * * Sets result to 1 if the congruence holds, or zero otherwise. */ int mp_prime_fermat(mp_int *a, mp_int *b, int *result) { mp_int t; int err; /* default to composite */ *result = MP_NO; /* ensure b > 1 */ if (mp_cmp_d(b, 1) != MP_GT) { return MP_VAL; } /* init t */ if ((err = mp_init(&t)) != MP_OKAY) { return err; } /* compute t = b**a mod a */ if ((err = mp_exptmod(b, a, a, &t)) != MP_OKAY) { goto LBL_T; } /* is it equal to b? */ if (mp_cmp(&t, b) == MP_EQ) { *result = MP_YES; } err = MP_OKAY; LBL_T: mp_clear(&t); return err; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_PRIME_IS_DIVISIBLE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* determines if an integers is divisible by one * of the first PRIME_SIZE primes or not * * sets result to 0 if not, 1 if yes */ int mp_prime_is_divisible(mp_int *a, int *result) { int err, ix; mp_digit res; /* default to not */ *result = MP_NO; for (ix = 0; ix < PRIME_SIZE; ix++) { /* what is a mod LBL_prime_tab[ix] */ if ((err = mp_mod_d(a, ltm_prime_tab[ix], &res)) != MP_OKAY) { return err; } /* is the residue zero? */ if (res == 0) { *result = MP_YES; return MP_OKAY; } } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_PRIME_IS_PRIME_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* performs a variable number of rounds of Miller-Rabin * * Probability of error after t rounds is no more than * * Sets result to 1 if probably prime, 0 otherwise */ int mp_prime_is_prime(mp_int *a, int t, int *result) { mp_int b; int ix, err, res; /* default to no */ *result = MP_NO; /* valid value of t? */ if ((t <= 0) || (t > PRIME_SIZE)) { return MP_VAL; } /* is the input equal to one of the primes in the table? */ for (ix = 0; ix < PRIME_SIZE; ix++) { if (mp_cmp_d(a, ltm_prime_tab[ix]) == MP_EQ) { *result = 1; return MP_OKAY; } } /* first perform trial division */ if ((err = mp_prime_is_divisible(a, &res)) != MP_OKAY) { return err; } /* return if it was trivially divisible */ if (res == MP_YES) { return MP_OKAY; } /* now perform the miller-rabin rounds */ if ((err = mp_init(&b)) != MP_OKAY) { return err; } for (ix = 0; ix < t; ix++) { /* set the prime */ mp_set(&b, ltm_prime_tab[ix]); if ((err = mp_prime_miller_rabin(a, &b, &res)) != MP_OKAY) { goto LBL_B; } if (res == MP_NO) { goto LBL_B; } } /* passed the test */ *result = MP_YES; LBL_B: mp_clear(&b); return err; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_PRIME_MILLER_RABIN_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* Miller-Rabin test of "a" to the base of "b" as described in * HAC pp. 139 Algorithm 4.24 * * Sets result to 0 if definitely composite or 1 if probably prime. * Randomly the chance of error is no more than 1/4 and often * very much lower. */ int mp_prime_miller_rabin(mp_int *a, mp_int *b, int *result) { mp_int n1, y, r; int s, j, err; /* default */ *result = MP_NO; /* ensure b > 1 */ if (mp_cmp_d(b, 1) != MP_GT) { return MP_VAL; } /* get n1 = a - 1 */ if ((err = mp_init_copy(&n1, a)) != MP_OKAY) { return err; } if ((err = mp_sub_d(&n1, 1, &n1)) != MP_OKAY) { goto LBL_N1; } /* set 2**s * r = n1 */ if ((err = mp_init_copy(&r, &n1)) != MP_OKAY) { goto LBL_N1; } /* count the number of least significant bits * which are zero */ s = mp_cnt_lsb(&r); /* now divide n - 1 by 2**s */ if ((err = mp_div_2d(&r, s, &r, NULL)) != MP_OKAY) { goto LBL_R; } /* compute y = b**r mod a */ if ((err = mp_init(&y)) != MP_OKAY) { goto LBL_R; } if ((err = mp_exptmod(b, &r, a, &y)) != MP_OKAY) { goto LBL_Y; } /* if y != 1 and y != n1 do */ if ((mp_cmp_d(&y, 1) != MP_EQ) && (mp_cmp(&y, &n1) != MP_EQ)) { j = 1; /* while j <= s-1 and y != n1 */ while ((j <= (s - 1)) && (mp_cmp(&y, &n1) != MP_EQ)) { if ((err = mp_sqrmod(&y, a, &y)) != MP_OKAY) { goto LBL_Y; } /* if y == 1 then composite */ if (mp_cmp_d(&y, 1) == MP_EQ) { goto LBL_Y; } ++j; } /* if y != n1 then composite */ if (mp_cmp(&y, &n1) != MP_EQ) { goto LBL_Y; } } /* probably prime now */ *result = MP_YES; LBL_Y: mp_clear(&y); LBL_R: mp_clear(&r); LBL_N1: mp_clear(&n1); return err; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_PRIME_NEXT_PRIME_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* finds the next prime after the number "a" using "t" trials * of Miller-Rabin. * * bbs_style = 1 means the prime must be congruent to 3 mod 4 */ int mp_prime_next_prime(mp_int *a, int t, int bbs_style) { int err, res = MP_NO, x, y; mp_digit res_tab[PRIME_SIZE], step, kstep; mp_int b; /* ensure t is valid */ if ((t <= 0) || (t > PRIME_SIZE)) { return MP_VAL; } /* force positive */ a->sign = MP_ZPOS; /* simple algo if a is less than the largest prime in the table */ if (mp_cmp_d(a, ltm_prime_tab[PRIME_SIZE - 1]) == MP_LT) { /* find which prime it is bigger than */ for (x = PRIME_SIZE - 2; x >= 0; x--) { if (mp_cmp_d(a, ltm_prime_tab[x]) != MP_LT) { if (bbs_style == 1) { /* ok we found a prime smaller or * equal [so the next is larger] * * however, the prime must be * congruent to 3 mod 4 */ if ((ltm_prime_tab[x + 1] & 3) != 3) { /* scan upwards for a prime congruent to 3 mod 4 */ for (y = x + 1; y < PRIME_SIZE; y++) { if ((ltm_prime_tab[y] & 3) == 3) { mp_set(a, ltm_prime_tab[y]); return MP_OKAY; } } } } else { mp_set(a, ltm_prime_tab[x + 1]); return MP_OKAY; } } } /* at this point a maybe 1 */ if (mp_cmp_d(a, 1) == MP_EQ) { mp_set(a, 2); return MP_OKAY; } /* fall through to the sieve */ } /* generate a prime congruent to 3 mod 4 or 1/3 mod 4? */ if (bbs_style == 1) { kstep = 4; } else { kstep = 2; } /* at this point we will use a combination of a sieve and Miller-Rabin */ if (bbs_style == 1) { /* if a mod 4 != 3 subtract the correct value to make it so */ if ((a->dp[0] & 3) != 3) { if ((err = mp_sub_d(a, (a->dp[0] & 3) + 1, a)) != MP_OKAY) { return err; } } } else { if (mp_iseven(a) == MP_YES) { /* force odd */ if ((err = mp_sub_d(a, 1, a)) != MP_OKAY) { return err; } } } /* generate the restable */ for (x = 1; x < PRIME_SIZE; x++) { if ((err = mp_mod_d(a, ltm_prime_tab[x], res_tab + x)) != MP_OKAY) { return err; } } /* init temp used for Miller-Rabin Testing */ if ((err = mp_init(&b)) != MP_OKAY) { return err; } for ( ; ; ) { /* skip to the next non-trivially divisible candidate */ step = 0; do { /* y == 1 if any residue was zero [e.g. cannot be prime] */ y = 0; /* increase step to next candidate */ step += kstep; /* compute the new residue without using division */ for (x = 1; x < PRIME_SIZE; x++) { /* add the step to each residue */ res_tab[x] += kstep; /* subtract the modulus [instead of using division] */ if (res_tab[x] >= ltm_prime_tab[x]) { res_tab[x] -= ltm_prime_tab[x]; } /* set flag if zero */ if (res_tab[x] == 0) { y = 1; } } } while ((y == 1) && (step < ((((mp_digit)1) << DIGIT_BIT) - kstep))); /* add the step */ if ((err = mp_add_d(a, step, a)) != MP_OKAY) { goto LBL_ERR; } /* if didn't pass sieve and step == MAX then skip test */ if ((y == 1) && (step >= ((((mp_digit)1) << DIGIT_BIT) - kstep))) { continue; } /* is this prime? */ for (x = 0; x < t; x++) { mp_set(&b, ltm_prime_tab[x]); if ((err = mp_prime_miller_rabin(a, &b, &res)) != MP_OKAY) { goto LBL_ERR; } if (res == MP_NO) { break; } } if (res == MP_YES) { break; } } err = MP_OKAY; LBL_ERR: mp_clear(&b); return err; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_PRIME_RABIN_MILLER_TRIALS_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ static const struct { int k, t; } https_internal_sizes[] = { { 128, 28 }, { 256, 16 }, { 384, 10 }, { 512, 7 }, { 640, 6 }, { 768, 5 }, { 896, 4 }, { 1024, 4 } }; /* returns # of RM trials required for a given bit size */ int mp_prime_rabin_miller_trials(int size) { int x; for (x = 0; x < (int)(sizeof(https_internal_sizes) / (sizeof(https_internal_sizes[0]))); x++) { if (https_internal_sizes[x].k == size) { return https_internal_sizes[x].t; } else if (https_internal_sizes[x].k > size) { return (x == 0) ? https_internal_sizes[0].t : https_internal_sizes[x - 1].t; } } return https_internal_sizes[x - 1].t + 1; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_PRIME_RANDOM_EX_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* makes a truly random prime of a given size (bits), * * Flags are as follows: * * LTM_PRIME_BBS - make prime congruent to 3 mod 4 * LTM_PRIME_SAFE - make sure (p-1)/2 is prime as well (implies LTM_PRIME_BBS) * LTM_PRIME_2MSB_ON - make the 2nd highest bit one * * You have to supply a callback which fills in a buffer with random bytes. "dat" is a parameter you can * have passed to the callback (e.g. a state or something). This function doesn't use "dat" itself * so it can be NULL * */ /* This is possibly the mother of all prime generation functions, muahahahahaha! */ int mp_prime_random_ex(mp_int *a, int t, int size, int flags, ltm_prime_callback cb, void *dat) { unsigned char *tmp, maskAND, maskOR_msb, maskOR_lsb; int res, err, bsize, maskOR_msb_offset; /* sanity check the input */ if ((size <= 1) || (t <= 0)) { return MP_VAL; } /* LTM_PRIME_SAFE implies LTM_PRIME_BBS */ if ((flags & LTM_PRIME_SAFE) != 0) { flags |= LTM_PRIME_BBS; } /* calc the byte size */ bsize = (size >> 3) + ((size & 7) ? 1 : 0); /* we need a buffer of bsize bytes */ tmp = OPT_CAST(unsigned char) XMALLOC(bsize); if (tmp == NULL) { return MP_MEM; } /* calc the maskAND value for the MSbyte*/ maskAND = ((size & 7) == 0) ? 0xFF : (0xFF >> (8 - (size & 7))); /* calc the maskOR_msb */ maskOR_msb = 0; maskOR_msb_offset = ((size & 7) == 1) ? 1 : 0; if ((flags & LTM_PRIME_2MSB_ON) != 0) { maskOR_msb |= 0x80 >> ((9 - size) & 7); } /* get the maskOR_lsb */ maskOR_lsb = 1; if ((flags & LTM_PRIME_BBS) != 0) { maskOR_lsb |= 3; } do { /* read the bytes */ if (cb(tmp, bsize, dat) != bsize) { err = MP_VAL; goto error; } /* work over the MSbyte */ tmp[0] &= maskAND; tmp[0] |= 1 << ((size - 1) & 7); /* mix in the maskORs */ tmp[maskOR_msb_offset] |= maskOR_msb; tmp[bsize - 1] |= maskOR_lsb; /* read it in */ if ((err = mp_read_unsigned_bin(a, tmp, bsize)) != MP_OKAY) { goto error; } /* is it prime? */ if ((err = mp_prime_is_prime(a, t, &res)) != MP_OKAY) { goto error; } if (res == MP_NO) { continue; } if ((flags & LTM_PRIME_SAFE) != 0) { /* see if (a-1)/2 is prime */ if ((err = mp_sub_d(a, 1, a)) != MP_OKAY) { goto error; } if ((err = mp_div_2(a, a)) != MP_OKAY) { goto error; } /* is it prime? */ if ((err = mp_prime_is_prime(a, t, &res)) != MP_OKAY) { goto error; } } } while (res == MP_NO); if ((flags & LTM_PRIME_SAFE) != 0) { /* restore a to the original value */ if ((err = mp_mul_2(a, a)) != MP_OKAY) { goto error; } if ((err = mp_add_d(a, 1, a)) != MP_OKAY) { goto error; } } err = MP_OKAY; error: XFREE(tmp); return err; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_RADIX_SIZE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* returns size of ASCII reprensentation */ int mp_radix_size(mp_int *a, int radix, int *size) { int res, digs; mp_int t; mp_digit d; *size = 0; /* make sure the radix is in range */ if ((radix < 2) || (radix > 64)) { return MP_VAL; } if (mp_iszero(a) == MP_YES) { *size = 2; return MP_OKAY; } /* special case for binary */ if (radix == 2) { *size = mp_count_bits(a) + ((a->sign == MP_NEG) ? 1 : 0) + 1; return MP_OKAY; } /* digs is the digit count */ digs = 0; /* if it's negative add one for the sign */ if (a->sign == MP_NEG) { ++digs; } /* init a copy of the input */ if ((res = mp_init_copy(&t, a)) != MP_OKAY) { return res; } /* force temp to positive */ t.sign = MP_ZPOS; /* fetch out all of the digits */ while (mp_iszero(&t) == MP_NO) { if ((res = mp_div_d(&t, (mp_digit)radix, &t, &d)) != MP_OKAY) { mp_clear(&t); return res; } ++digs; } mp_clear(&t); /* return digs + 1, the 1 is for the NULL byte that would be required. */ *size = digs + 1; return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_RADIX_SMAP_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* chars used in radix conversions */ const char *mp_s_rmap = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz+/"; #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_RAND_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* makes a pseudo-random int of a given size */ int mp_rand(mp_int *a, int digits) { int res; mp_digit d; mp_zero(a); if (digits <= 0) { return MP_OKAY; } /* first place a random non-zero digit */ do { d = ((mp_digit)abs(MP_GEN_RANDOM())) & MP_MASK; } while (d == 0); if ((res = mp_add_d(a, d, a)) != MP_OKAY) { return res; } while (--digits > 0) { if ((res = mp_lshd(a, 1)) != MP_OKAY) { return res; } if ((res = mp_add_d(a, ((mp_digit)abs(MP_GEN_RANDOM())), a)) != MP_OKAY) { return res; } } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_READ_RADIX_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* read a string [ASCII] in a given radix */ int mp_read_radix(mp_int *a, const char *str, int radix) { int y, res, neg; char ch; /* zero the digit bignum */ mp_zero(a); /* make sure the radix is ok */ if ((radix < 2) || (radix > 64)) { return MP_VAL; } /* if the leading digit is a * minus set the sign to negative. */ if (*str == '-') { ++str; neg = MP_NEG; } else { neg = MP_ZPOS; } /* set the integer to the default of zero */ mp_zero(a); /* process each digit of the string */ while (*str != '\0') { /* if the radix <= 36 the conversion is case insensitive * this allows numbers like 1AB and 1ab to represent the same value * [e.g. in hex] */ ch = (radix <= 36) ? (char)toupper((int)*str) : *str; for (y = 0; y < 64; y++) { if (ch == mp_s_rmap[y]) { break; } } /* if the char was found in the map * and is less than the given radix add it * to the number, otherwise exit the loop. */ if (y < radix) { if ((res = mp_mul_d(a, (mp_digit)radix, a)) != MP_OKAY) { return res; } if ((res = mp_add_d(a, (mp_digit)y, a)) != MP_OKAY) { return res; } } else { break; } ++str; } /* set the sign only if a != 0 */ if (mp_iszero(a) != MP_YES) { a->sign = neg; } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_READ_SIGNED_BIN_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* read signed bin, big endian, first byte is 0==positive or 1==negative */ int mp_read_signed_bin(mp_int *a, const unsigned char *b, int c) { int res; /* read magnitude */ if ((res = mp_read_unsigned_bin(a, b + 1, c - 1)) != MP_OKAY) { return res; } /* first byte is 0 for positive, non-zero for negative */ if (b[0] == 0) { a->sign = MP_ZPOS; } else { a->sign = MP_NEG; } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_READ_UNSIGNED_BIN_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* reads a unsigned char array, assumes the msb is stored first [big endian] */ int mp_read_unsigned_bin(mp_int *a, const unsigned char *b, int c) { int res; /* make sure there are at least two digits */ if (a->alloc < 2) { if ((res = mp_grow(a, 2)) != MP_OKAY) { return res; } } /* zero the int */ mp_zero(a); /* read the bytes in */ while (c-- > 0) { if ((res = mp_mul_2d(a, 8, a)) != MP_OKAY) { return res; } #ifndef MP_8BIT a->dp[0] |= *b++; a->used += 1; #else a->dp[0] = (*b & MP_MASK); a->dp[1] |= ((*b++ >> 7U) & 1); a->used += 2; #endif } mp_clamp(a); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_REDUCE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* reduces x mod m, assumes 0 < x < m**2, mu is * precomputed via mp_reduce_setup. * From HAC pp.604 Algorithm 14.42 */ int mp_reduce(mp_int *x, mp_int *m, mp_int *mu) { mp_int q; int res, um = m->used; /* q = x */ if ((res = mp_init_copy(&q, x)) != MP_OKAY) { return res; } /* q1 = x / b**(k-1) */ mp_rshd(&q, um - 1); /* according to HAC this optimization is ok */ if (((mp_digit)um) > (((mp_digit)1) << (DIGIT_BIT - 1))) { if ((res = mp_mul(&q, mu, &q)) != MP_OKAY) { goto CLEANUP; } } else { #ifdef BN_S_MP_MUL_HIGH_DIGS_C if ((res = s_mp_mul_high_digs(&q, mu, &q, um)) != MP_OKAY) { goto CLEANUP; } #elif defined(BN_FAST_S_MP_MUL_HIGH_DIGS_C) if ((res = fast_s_mp_mul_high_digs(&q, mu, &q, um)) != MP_OKAY) { goto CLEANUP; } #else { res = MP_VAL; goto CLEANUP; } #endif } /* q3 = q2 / b**(k+1) */ mp_rshd(&q, um + 1); /* x = x mod b**(k+1), quick (no division) */ if ((res = mp_mod_2d(x, DIGIT_BIT * (um + 1), x)) != MP_OKAY) { goto CLEANUP; } /* q = q * m mod b**(k+1), quick (no division) */ if ((res = s_mp_mul_digs(&q, m, &q, um + 1)) != MP_OKAY) { goto CLEANUP; } /* x = x - q */ if ((res = mp_sub(x, &q, x)) != MP_OKAY) { goto CLEANUP; } /* If x < 0, add b**(k+1) to it */ if (mp_cmp_d(x, 0) == MP_LT) { mp_set(&q, 1); if ((res = mp_lshd(&q, um + 1)) != MP_OKAY) goto CLEANUP; if ((res = mp_add(x, &q, x)) != MP_OKAY) goto CLEANUP; } /* Back off if it's too big */ while (mp_cmp(x, m) != MP_LT) { if ((res = s_mp_sub(x, m, x)) != MP_OKAY) { goto CLEANUP; } } CLEANUP: mp_clear(&q); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_REDUCE_2K_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* reduces a modulo n where n is of the form 2**p - d */ int mp_reduce_2k(mp_int *a, mp_int *n, mp_digit d) { mp_int q; int p, res; if ((res = mp_init(&q)) != MP_OKAY) { return res; } p = mp_count_bits(n); top: /* q = a/2**p, a = a mod 2**p */ if ((res = mp_div_2d(a, p, &q, a)) != MP_OKAY) { goto ERR; } if (d != 1) { /* q = q * d */ if ((res = mp_mul_d(&q, d, &q)) != MP_OKAY) { goto ERR; } } /* a = a + q */ if ((res = s_mp_add(a, &q, a)) != MP_OKAY) { goto ERR; } if (mp_cmp_mag(a, n) != MP_LT) { if ((res = s_mp_sub(a, n, a)) != MP_OKAY) { goto ERR; } goto top; } ERR: mp_clear(&q); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_REDUCE_2K_L_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* reduces a modulo n where n is of the form 2**p - d This differs from reduce_2k since "d" can be larger than a single digit. */ int mp_reduce_2k_l(mp_int *a, mp_int *n, mp_int *d) { mp_int q; int p, res; if ((res = mp_init(&q)) != MP_OKAY) { return res; } p = mp_count_bits(n); top: /* q = a/2**p, a = a mod 2**p */ if ((res = mp_div_2d(a, p, &q, a)) != MP_OKAY) { goto ERR; } /* q = q * d */ if ((res = mp_mul(&q, d, &q)) != MP_OKAY) { goto ERR; } /* a = a + q */ if ((res = s_mp_add(a, &q, a)) != MP_OKAY) { goto ERR; } if (mp_cmp_mag(a, n) != MP_LT) { if ((res = s_mp_sub(a, n, a)) != MP_OKAY) { goto ERR; } goto top; } ERR: mp_clear(&q); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_REDUCE_2K_SETUP_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* determines the setup value */ int mp_reduce_2k_setup(mp_int *a, mp_digit *d) { int res, p; mp_int tmp; if ((res = mp_init(&tmp)) != MP_OKAY) { return res; } p = mp_count_bits(a); if ((res = mp_2expt(&tmp, p)) != MP_OKAY) { mp_clear(&tmp); return res; } if ((res = s_mp_sub(&tmp, a, &tmp)) != MP_OKAY) { mp_clear(&tmp); return res; } *d = tmp.dp[0]; mp_clear(&tmp); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_REDUCE_2K_SETUP_L_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* determines the setup value */ int mp_reduce_2k_setup_l(mp_int *a, mp_int *d) { int res; mp_int tmp; if ((res = mp_init(&tmp)) != MP_OKAY) { return res; } if ((res = mp_2expt(&tmp, mp_count_bits(a))) != MP_OKAY) { goto ERR; } if ((res = s_mp_sub(&tmp, a, d)) != MP_OKAY) { goto ERR; } ERR: mp_clear(&tmp); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_REDUCE_IS_2K_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* determines if mp_reduce_2k can be used */ int mp_reduce_is_2k(mp_int *a) { int ix, iy, iw; mp_digit iz; if (a->used == 0) { return MP_NO; } else if (a->used == 1) { return MP_YES; } else if (a->used > 1) { iy = mp_count_bits(a); iz = 1; iw = 1; /* Test every bit from the second digit up, must be 1 */ for (ix = DIGIT_BIT; ix < iy; ix++) { if ((a->dp[iw] & iz) == 0) { return MP_NO; } iz <<= 1; if (iz > (mp_digit)MP_MASK) { ++iw; iz = 1; } } } return MP_YES; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_REDUCE_IS_2K_L_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* determines if reduce_2k_l can be used */ int mp_reduce_is_2k_l(mp_int *a) { int ix, iy; if (a->used == 0) { return MP_NO; } else if (a->used == 1) { return MP_YES; } else if (a->used > 1) { /* if more than half of the digits are -1 we're sold */ for (iy = ix = 0; ix < a->used; ix++) { if (a->dp[ix] == MP_MASK) { ++iy; } } return (iy >= (a->used / 2)) ? MP_YES : MP_NO; } return MP_NO; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_REDUCE_SETUP_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* pre-calculate the value required for Barrett reduction * For a given modulus "b" it calulates the value required in "a" */ int mp_reduce_setup(mp_int *a, mp_int *b) { int res; if ((res = mp_2expt(a, b->used * 2 * DIGIT_BIT)) != MP_OKAY) { return res; } return mp_div(a, b, a, NULL); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_RSHD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* shift right a certain amount of digits */ void mp_rshd(mp_int *a, int b) { int x; /* if b <= 0 then ignore it */ if (b <= 0) { return; } /* if b > used then simply zero it and return */ if (a->used <= b) { mp_zero(a); return; } { mp_digit *bottom, *top; /* shift the digits down */ /* bottom */ bottom = a->dp; /* top [offset into digits] */ top = a->dp + b; /* this is implemented as a sliding window where * the window is b-digits long and digits from * the top of the window are copied to the bottom * * e.g. b-2 | b-1 | b0 | b1 | b2 | ... | bb | ----> /\ | ----> **\-------------------/ ----> */ for (x = 0; x < (a->used - b); x++) { *bottom++ = *top++; } /* zero the top digits */ for ( ; x < a->used; x++) { *bottom++ = 0; } } /* remove excess digits */ a->used -= b; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SET_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* set to a digit */ void mp_set(mp_int *a, mp_digit b) { mp_zero(a); a->dp[0] = b & MP_MASK; a->used = (a->dp[0] != 0) ? 1 : 0; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SET_INT_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* set a 32-bit const */ int mp_set_int(mp_int *a, unsigned long b) { int x, res; mp_zero(a); /* set four bits at a time */ for (x = 0; x < 8; x++) { /* shift the number up four bits */ if ((res = mp_mul_2d(a, 4, a)) != MP_OKAY) { return res; } /* OR in the top four bits of the source */ a->dp[0] |= (b >> 28) & 15; /* shift the source up to the next four bits */ b <<= 4; /* ensure that digits are not clamped off */ a->used += 1; } mp_clamp(a); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SET_LONG_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* set a platform dependent unsigned long int */ MP_SET_XLONG(mp_set_long, unsigned long) #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SET_LONG_LONG_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* set a platform dependent unsigned long long int */ MP_SET_XLONG(mp_set_long_long, unsigned long long) #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SHRINK_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* shrink a bignum */ int mp_shrink(mp_int *a) { mp_digit *tmp; int used = 1; if (a->used > 0) { used = a->used; } if (a->alloc != used) { if ((tmp = OPT_CAST(mp_digit) XREALLOC(a->dp, sizeof(mp_digit) * used)) == NULL) { return MP_MEM; } a->dp = tmp; a->alloc = used; } return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SIGNED_BIN_SIZE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* get the size for an signed equivalent */ int mp_signed_bin_size(mp_int *a) { return 1 + mp_unsigned_bin_size(a); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SQR_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* computes b = a*a */ int mp_sqr(mp_int *a, mp_int *b) { int res; #ifdef BN_MP_TOOM_SQR_C /* use Toom-Cook? */ if (a->used >= TOOM_SQR_CUTOFF) { res = mp_toom_sqr(a, b); /* Karatsuba? */ } else #endif #ifdef BN_MP_KARATSUBA_SQR_C if (a->used >= KARATSUBA_SQR_CUTOFF) { res = mp_karatsuba_sqr(a, b); } else #endif { #ifdef BN_FAST_S_MP_SQR_C /* can we use the fast comba multiplier? */ if ((((a->used * 2) + 1) < MP_WARRAY) && (a->used < (1 << (((sizeof(mp_word) * CHAR_BIT) - (2 * DIGIT_BIT)) - 1)))) { res = fast_s_mp_sqr(a, b); } else #endif { #ifdef BN_S_MP_SQR_C res = s_mp_sqr(a, b); #else res = MP_VAL; #endif } } b->sign = MP_ZPOS; return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SQRMOD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* c = a * a (mod b) */ int mp_sqrmod(mp_int *a, mp_int *b, mp_int *c) { int res; mp_int t; if ((res = mp_init(&t)) != MP_OKAY) { return res; } if ((res = mp_sqr(a, &t)) != MP_OKAY) { mp_clear(&t); return res; } res = mp_mod(&t, b, c); mp_clear(&t); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SQRT_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* this function is less generic than mp_n_root, simpler and faster */ int mp_sqrt(mp_int *arg, mp_int *ret) { int res; mp_int t1, t2; /* must be positive */ if (arg->sign == MP_NEG) { return MP_VAL; } /* easy out */ if (mp_iszero(arg) == MP_YES) { mp_zero(ret); return MP_OKAY; } if ((res = mp_init_copy(&t1, arg)) != MP_OKAY) { return res; } if ((res = mp_init(&t2)) != MP_OKAY) { goto E2; } /* First approx. (not very bad for large arg) */ mp_rshd(&t1, t1.used / 2); /* t1 > 0 */ if ((res = mp_div(arg, &t1, &t2, NULL)) != MP_OKAY) { goto E1; } if ((res = mp_add(&t1, &t2, &t1)) != MP_OKAY) { goto E1; } if ((res = mp_div_2(&t1, &t1)) != MP_OKAY) { goto E1; } /* And now t1 > sqrt(arg) */ do { if ((res = mp_div(arg, &t1, &t2, NULL)) != MP_OKAY) { goto E1; } if ((res = mp_add(&t1, &t2, &t1)) != MP_OKAY) { goto E1; } if ((res = mp_div_2(&t1, &t1)) != MP_OKAY) { goto E1; } /* t1 >= sqrt(arg) >= t2 at this point */ } while (mp_cmp_mag(&t1, &t2) == MP_GT); mp_exch(&t1, ret); E1: mp_clear(&t2); E2: mp_clear(&t1); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SQRTMOD_PRIME_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library is free for all purposes without any express * guarantee it works. */ /* Tonelli-Shanks algorithm * https://en.wikipedia.org/wiki/Tonelli%E2%80%93Shanks_algorithm * https://gmplib.org/list-archives/gmp-discuss/2013-April/005300.html * */ int mp_sqrtmod_prime(mp_int *n, mp_int *prime, mp_int *ret) { int res, legendre; mp_int t1, C, Q, S, Z, M, T, R, two; mp_digit i; /* first handle the simple cases */ if (mp_cmp_d(n, 0) == MP_EQ) { mp_zero(ret); return MP_OKAY; } if (mp_cmp_d(prime, 2) == MP_EQ) return MP_VAL; /* prime must be odd */ if ((res = mp_jacobi(n, prime, &legendre)) != MP_OKAY) return res; if (legendre == -1) return MP_VAL; /* quadratic non-residue mod prime */ if ((res = mp_init_multi(&t1, &C, &Q, &S, &Z, &M, &T, &R, &two, NULL)) != MP_OKAY) { return res; } /* SPECIAL CASE: if prime mod 4 == 3 * compute directly: res = n^(prime+1)/4 mod prime * Handbook of Applied Cryptography algorithm 3.36 */ if ((res = mp_mod_d(prime, 4, &i)) != MP_OKAY) goto cleanup; if (i == 3) { if ((res = mp_add_d(prime, 1, &t1)) != MP_OKAY) goto cleanup; if ((res = mp_div_2(&t1, &t1)) != MP_OKAY) goto cleanup; if ((res = mp_div_2(&t1, &t1)) != MP_OKAY) goto cleanup; if ((res = mp_exptmod(n, &t1, prime, ret)) != MP_OKAY) goto cleanup; res = MP_OKAY; goto cleanup; } /* NOW: Tonelli-Shanks algorithm */ /* factor out powers of 2 from prime-1, defining Q and S as: prime-1 = Q*2^S */ if ((res = mp_copy(prime, &Q)) != MP_OKAY) goto cleanup; if ((res = mp_sub_d(&Q, 1, &Q)) != MP_OKAY) goto cleanup; /* Q = prime - 1 */ mp_zero(&S); /* S = 0 */ while (mp_iseven(&Q) != MP_NO) { if ((res = mp_div_2(&Q, &Q)) != MP_OKAY) goto cleanup; /* Q = Q / 2 */ if ((res = mp_add_d(&S, 1, &S)) != MP_OKAY) goto cleanup; /* S = S + 1 */ } /* find a Z such that the Legendre symbol (Z|prime) == -1 */ if ((res = mp_set_int(&Z, 2)) != MP_OKAY) goto cleanup; /* Z = 2 */ while (1) { if ((res = mp_jacobi(&Z, prime, &legendre)) != MP_OKAY) goto cleanup; if (legendre == -1) break; if ((res = mp_add_d(&Z, 1, &Z)) != MP_OKAY) goto cleanup; /* Z = Z + 1 */ } if ((res = mp_exptmod(&Z, &Q, prime, &C)) != MP_OKAY) goto cleanup; /* C = Z ^ Q mod prime */ if ((res = mp_add_d(&Q, 1, &t1)) != MP_OKAY) goto cleanup; if ((res = mp_div_2(&t1, &t1)) != MP_OKAY) goto cleanup; /* t1 = (Q + 1) / 2 */ if ((res = mp_exptmod(n, &t1, prime, &R)) != MP_OKAY) goto cleanup; /* R = n ^ ((Q + 1) / 2) mod prime */ if ((res = mp_exptmod(n, &Q, prime, &T)) != MP_OKAY) goto cleanup; /* T = n ^ Q mod prime */ if ((res = mp_copy(&S, &M)) != MP_OKAY) goto cleanup; /* M = S */ if ((res = mp_set_int(&two, 2)) != MP_OKAY) goto cleanup; res = MP_VAL; while (1) { if ((res = mp_copy(&T, &t1)) != MP_OKAY) goto cleanup; i = 0; while (1) { if (mp_cmp_d(&t1, 1) == MP_EQ) break; if ((res = mp_exptmod(&t1, &two, prime, &t1)) != MP_OKAY) goto cleanup; i++; } if (i == 0) { if ((res = mp_copy(&R, ret)) != MP_OKAY) goto cleanup; res = MP_OKAY; goto cleanup; } if ((res = mp_sub_d(&M, i, &t1)) != MP_OKAY) goto cleanup; if ((res = mp_sub_d(&t1, 1, &t1)) != MP_OKAY) goto cleanup; if ((res = mp_exptmod(&two, &t1, prime, &t1)) != MP_OKAY) goto cleanup; /* t1 = 2 ^ (M - i - 1) */ if ((res = mp_exptmod(&C, &t1, prime, &t1)) != MP_OKAY) goto cleanup; /* t1 = C ^ (2 ^ (M - i - 1)) mod prime */ if ((res = mp_sqrmod(&t1, prime, &C)) != MP_OKAY) goto cleanup; /* C = (t1 * t1) mod prime */ if ((res = mp_mulmod(&R, &t1, prime, &R)) != MP_OKAY) goto cleanup; /* R = (R * t1) mod prime */ if ((res = mp_mulmod(&T, &C, prime, &T)) != MP_OKAY) goto cleanup; /* T = (T * C) mod prime */ mp_set(&M, i); /* M = i */ } cleanup: mp_clear_multi(&t1, &C, &Q, &S, &Z, &M, &T, &R, &two, NULL); return res; } #endif #ifdef BN_MP_SUB_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* high level subtraction (handles signs) */ int mp_sub(mp_int *a, mp_int *b, mp_int *c) { int sa, sb, res; sa = a->sign; sb = b->sign; if (sa != sb) { /* subtract a negative from a positive, OR */ /* subtract a positive from a negative. */ /* In either case, ADD their magnitudes, */ /* and use the sign of the first number. */ c->sign = sa; res = s_mp_add(a, b, c); } else { /* subtract a positive from a positive, OR */ /* subtract a negative from a negative. */ /* First, take the difference between their */ /* magnitudes, then... */ if (mp_cmp_mag(a, b) != MP_LT) { /* Copy the sign from the first */ c->sign = sa; /* The first has a larger or equal magnitude */ res = s_mp_sub(a, b, c); } else { /* The result has the *opposite* sign from */ /* the first number. */ c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; /* The second has a larger magnitude */ res = s_mp_sub(b, a, c); } } return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SUB_D_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* single digit subtraction */ int mp_sub_d(mp_int *a, mp_digit b, mp_int *c) { mp_digit *tmpa, *tmpc, mu; int res, ix, oldused; /* grow c as required */ if (c->alloc < (a->used + 1)) { if ((res = mp_grow(c, a->used + 1)) != MP_OKAY) { return res; } } /* if a is negative just do an unsigned * addition [with fudged signs] */ if (a->sign == MP_NEG) { a->sign = MP_ZPOS; res = mp_add_d(a, b, c); a->sign = c->sign = MP_NEG; /* clamp */ mp_clamp(c); return res; } /* setup regs */ oldused = c->used; tmpa = a->dp; tmpc = c->dp; /* if a <= b simply fix the single digit */ if (((a->used == 1) && (a->dp[0] <= b)) || (a->used == 0)) { if (a->used == 1) { *tmpc++ = b - *tmpa; } else { *tmpc++ = b; } ix = 1; /* negative/1digit */ c->sign = MP_NEG; c->used = 1; } else { /* positive/size */ c->sign = MP_ZPOS; c->used = a->used; /* subtract first digit */ *tmpc = *tmpa++ - b; mu = *tmpc >> ((sizeof(mp_digit) * CHAR_BIT) - 1); *tmpc++ &= MP_MASK; /* handle rest of the digits */ for (ix = 1; ix < a->used; ix++) { *tmpc = *tmpa++ - mu; mu = *tmpc >> ((sizeof(mp_digit) * CHAR_BIT) - 1); *tmpc++ &= MP_MASK; } } /* zero excess digits */ while (ix++ < oldused) { *tmpc++ = 0; } mp_clamp(c); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_SUBMOD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* d = a - b (mod c) */ int mp_submod(mp_int *a, mp_int *b, mp_int *c, mp_int *d) { int res; mp_int t; if ((res = mp_init(&t)) != MP_OKAY) { return res; } if ((res = mp_sub(a, b, &t)) != MP_OKAY) { mp_clear(&t); return res; } res = mp_mod(&t, c, d); mp_clear(&t); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_TO_SIGNED_BIN_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* store in signed [big endian] format */ int mp_to_signed_bin(mp_int *a, unsigned char *b) { int res; if ((res = mp_to_unsigned_bin(a, b + 1)) != MP_OKAY) { return res; } b[0] = (a->sign == MP_ZPOS) ? (unsigned char)0 : (unsigned char)1; return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_TO_SIGNED_BIN_N_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* store in signed [big endian] format */ int mp_to_signed_bin_n(mp_int *a, unsigned char *b, unsigned long *outlen) { if (*outlen < (unsigned long)mp_signed_bin_size(a)) { return MP_VAL; } *outlen = mp_signed_bin_size(a); return mp_to_signed_bin(a, b); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_TO_UNSIGNED_BIN_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* store in unsigned [big endian] format */ int mp_to_unsigned_bin(mp_int *a, unsigned char *b) { int x, res; mp_int t; if ((res = mp_init_copy(&t, a)) != MP_OKAY) { return res; } x = 0; while (mp_iszero(&t) == MP_NO) { #ifndef MP_8BIT b[x++] = (unsigned char)(t.dp[0] & 255); #else b[x++] = (unsigned char)(t.dp[0] | ((t.dp[1] & 0x01) << 7)); #endif if ((res = mp_div_2d(&t, 8, &t, NULL)) != MP_OKAY) { mp_clear(&t); return res; } } bn_reverse(b, x); mp_clear(&t); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_TOOM_MUL_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* multiplication using the Toom-Cook 3-way algorithm * * Much more complicated than Karatsuba but has a lower * asymptotic running time of O(N**1.464). This algorithm is * only particularly useful on VERY large inputs * (we're talking 1000s of digits here...). */ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c) { mp_int w0, w1, w2, w3, w4, tmp1, tmp2, a0, a1, a2, b0, b1, b2; int res, B; /* init temps */ if ((res = mp_init_multi(&w0, &w1, &w2, &w3, &w4, &a0, &a1, &a2, &b0, &b1, &b2, &tmp1, &tmp2, NULL)) != MP_OKAY) { return res; } /* B */ B = MIN(a->used, b->used) / 3; /* a = a2 * B**2 + a1 * B + a0 */ if ((res = mp_mod_2d(a, DIGIT_BIT * B, &a0)) != MP_OKAY) { goto ERR; } if ((res = mp_copy(a, &a1)) != MP_OKAY) { goto ERR; } mp_rshd(&a1, B); if ((res = mp_mod_2d(&a1, DIGIT_BIT * B, &a1)) != MP_OKAY) { goto ERR; } if ((res = mp_copy(a, &a2)) != MP_OKAY) { goto ERR; } mp_rshd(&a2, B * 2); /* b = b2 * B**2 + b1 * B + b0 */ if ((res = mp_mod_2d(b, DIGIT_BIT * B, &b0)) != MP_OKAY) { goto ERR; } if ((res = mp_copy(b, &b1)) != MP_OKAY) { goto ERR; } mp_rshd(&b1, B); (void)mp_mod_2d(&b1, DIGIT_BIT * B, &b1); if ((res = mp_copy(b, &b2)) != MP_OKAY) { goto ERR; } mp_rshd(&b2, B * 2); /* w0 = a0*b0 */ if ((res = mp_mul(&a0, &b0, &w0)) != MP_OKAY) { goto ERR; } /* w4 = a2 * b2 */ if ((res = mp_mul(&a2, &b2, &w4)) != MP_OKAY) { goto ERR; } /* w1 = (a2 + 2(a1 + 2a0))(b2 + 2(b1 + 2b0)) */ if ((res = mp_mul_2(&a0, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, &a1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_mul_2(&tmp1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, &a2, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_mul_2(&b0, &tmp2)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp2, &b1, &tmp2)) != MP_OKAY) { goto ERR; } if ((res = mp_mul_2(&tmp2, &tmp2)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp2, &b2, &tmp2)) != MP_OKAY) { goto ERR; } if ((res = mp_mul(&tmp1, &tmp2, &w1)) != MP_OKAY) { goto ERR; } /* w3 = (a0 + 2(a1 + 2a2))(b0 + 2(b1 + 2b2)) */ if ((res = mp_mul_2(&a2, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, &a1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_mul_2(&tmp1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, &a0, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_mul_2(&b2, &tmp2)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp2, &b1, &tmp2)) != MP_OKAY) { goto ERR; } if ((res = mp_mul_2(&tmp2, &tmp2)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp2, &b0, &tmp2)) != MP_OKAY) { goto ERR; } if ((res = mp_mul(&tmp1, &tmp2, &w3)) != MP_OKAY) { goto ERR; } /* w2 = (a2 + a1 + a0)(b2 + b1 + b0) */ if ((res = mp_add(&a2, &a1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, &a0, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&b2, &b1, &tmp2)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp2, &b0, &tmp2)) != MP_OKAY) { goto ERR; } if ((res = mp_mul(&tmp1, &tmp2, &w2)) != MP_OKAY) { goto ERR; } /* now solve the matrix 0 0 0 0 1 1 2 4 8 16 1 1 1 1 1 16 8 4 2 1 1 0 0 0 0 using 12 subtractions, 4 shifts, 2 small divisions and 1 small multiplication */ /* r1 - r4 */ if ((res = mp_sub(&w1, &w4, &w1)) != MP_OKAY) { goto ERR; } /* r3 - r0 */ if ((res = mp_sub(&w3, &w0, &w3)) != MP_OKAY) { goto ERR; } /* r1/2 */ if ((res = mp_div_2(&w1, &w1)) != MP_OKAY) { goto ERR; } /* r3/2 */ if ((res = mp_div_2(&w3, &w3)) != MP_OKAY) { goto ERR; } /* r2 - r0 - r4 */ if ((res = mp_sub(&w2, &w0, &w2)) != MP_OKAY) { goto ERR; } if ((res = mp_sub(&w2, &w4, &w2)) != MP_OKAY) { goto ERR; } /* r1 - r2 */ if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) { goto ERR; } /* r3 - r2 */ if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) { goto ERR; } /* r1 - 8r0 */ if ((res = mp_mul_2d(&w0, 3, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_sub(&w1, &tmp1, &w1)) != MP_OKAY) { goto ERR; } /* r3 - 8r4 */ if ((res = mp_mul_2d(&w4, 3, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_sub(&w3, &tmp1, &w3)) != MP_OKAY) { goto ERR; } /* 3r2 - r1 - r3 */ if ((res = mp_mul_d(&w2, 3, &w2)) != MP_OKAY) { goto ERR; } if ((res = mp_sub(&w2, &w1, &w2)) != MP_OKAY) { goto ERR; } if ((res = mp_sub(&w2, &w3, &w2)) != MP_OKAY) { goto ERR; } /* r1 - r2 */ if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) { goto ERR; } /* r3 - r2 */ if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) { goto ERR; } /* r1/3 */ if ((res = mp_div_3(&w1, &w1, NULL)) != MP_OKAY) { goto ERR; } /* r3/3 */ if ((res = mp_div_3(&w3, &w3, NULL)) != MP_OKAY) { goto ERR; } /* at this point shift W[n] by B*n */ if ((res = mp_lshd(&w1, 1 * B)) != MP_OKAY) { goto ERR; } if ((res = mp_lshd(&w2, 2 * B)) != MP_OKAY) { goto ERR; } if ((res = mp_lshd(&w3, 3 * B)) != MP_OKAY) { goto ERR; } if ((res = mp_lshd(&w4, 4 * B)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&w0, &w1, c)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&w2, &w3, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&w4, &tmp1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, c, c)) != MP_OKAY) { goto ERR; } ERR: mp_clear_multi(&w0, &w1, &w2, &w3, &w4, &a0, &a1, &a2, &b0, &b1, &b2, &tmp1, &tmp2, NULL); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_TOOM_SQR_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* squaring using Toom-Cook 3-way algorithm */ int mp_toom_sqr(mp_int *a, mp_int *b) { mp_int w0, w1, w2, w3, w4, tmp1, a0, a1, a2; int res, B; /* init temps */ if ((res = mp_init_multi(&w0, &w1, &w2, &w3, &w4, &a0, &a1, &a2, &tmp1, NULL)) != MP_OKAY) { return res; } /* B */ B = a->used / 3; /* a = a2 * B**2 + a1 * B + a0 */ if ((res = mp_mod_2d(a, DIGIT_BIT * B, &a0)) != MP_OKAY) { goto ERR; } if ((res = mp_copy(a, &a1)) != MP_OKAY) { goto ERR; } mp_rshd(&a1, B); if ((res = mp_mod_2d(&a1, DIGIT_BIT * B, &a1)) != MP_OKAY) { goto ERR; } if ((res = mp_copy(a, &a2)) != MP_OKAY) { goto ERR; } mp_rshd(&a2, B * 2); /* w0 = a0*a0 */ if ((res = mp_sqr(&a0, &w0)) != MP_OKAY) { goto ERR; } /* w4 = a2 * a2 */ if ((res = mp_sqr(&a2, &w4)) != MP_OKAY) { goto ERR; } /* w1 = (a2 + 2(a1 + 2a0))**2 */ if ((res = mp_mul_2(&a0, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, &a1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_mul_2(&tmp1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, &a2, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_sqr(&tmp1, &w1)) != MP_OKAY) { goto ERR; } /* w3 = (a0 + 2(a1 + 2a2))**2 */ if ((res = mp_mul_2(&a2, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, &a1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_mul_2(&tmp1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, &a0, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_sqr(&tmp1, &w3)) != MP_OKAY) { goto ERR; } /* w2 = (a2 + a1 + a0)**2 */ if ((res = mp_add(&a2, &a1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, &a0, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_sqr(&tmp1, &w2)) != MP_OKAY) { goto ERR; } /* now solve the matrix 0 0 0 0 1 1 2 4 8 16 1 1 1 1 1 16 8 4 2 1 1 0 0 0 0 using 12 subtractions, 4 shifts, 2 small divisions and 1 small multiplication. */ /* r1 - r4 */ if ((res = mp_sub(&w1, &w4, &w1)) != MP_OKAY) { goto ERR; } /* r3 - r0 */ if ((res = mp_sub(&w3, &w0, &w3)) != MP_OKAY) { goto ERR; } /* r1/2 */ if ((res = mp_div_2(&w1, &w1)) != MP_OKAY) { goto ERR; } /* r3/2 */ if ((res = mp_div_2(&w3, &w3)) != MP_OKAY) { goto ERR; } /* r2 - r0 - r4 */ if ((res = mp_sub(&w2, &w0, &w2)) != MP_OKAY) { goto ERR; } if ((res = mp_sub(&w2, &w4, &w2)) != MP_OKAY) { goto ERR; } /* r1 - r2 */ if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) { goto ERR; } /* r3 - r2 */ if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) { goto ERR; } /* r1 - 8r0 */ if ((res = mp_mul_2d(&w0, 3, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_sub(&w1, &tmp1, &w1)) != MP_OKAY) { goto ERR; } /* r3 - 8r4 */ if ((res = mp_mul_2d(&w4, 3, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_sub(&w3, &tmp1, &w3)) != MP_OKAY) { goto ERR; } /* 3r2 - r1 - r3 */ if ((res = mp_mul_d(&w2, 3, &w2)) != MP_OKAY) { goto ERR; } if ((res = mp_sub(&w2, &w1, &w2)) != MP_OKAY) { goto ERR; } if ((res = mp_sub(&w2, &w3, &w2)) != MP_OKAY) { goto ERR; } /* r1 - r2 */ if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) { goto ERR; } /* r3 - r2 */ if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) { goto ERR; } /* r1/3 */ if ((res = mp_div_3(&w1, &w1, NULL)) != MP_OKAY) { goto ERR; } /* r3/3 */ if ((res = mp_div_3(&w3, &w3, NULL)) != MP_OKAY) { goto ERR; } /* at this point shift W[n] by B*n */ if ((res = mp_lshd(&w1, 1 * B)) != MP_OKAY) { goto ERR; } if ((res = mp_lshd(&w2, 2 * B)) != MP_OKAY) { goto ERR; } if ((res = mp_lshd(&w3, 3 * B)) != MP_OKAY) { goto ERR; } if ((res = mp_lshd(&w4, 4 * B)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&w0, &w1, b)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&w2, &w3, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&w4, &tmp1, &tmp1)) != MP_OKAY) { goto ERR; } if ((res = mp_add(&tmp1, b, b)) != MP_OKAY) { goto ERR; } ERR: mp_clear_multi(&w0, &w1, &w2, &w3, &w4, &a0, &a1, &a2, &tmp1, NULL); return res; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_TORADIX_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* stores a bignum as a ASCII string in a given radix (2..64) */ int mp_toradix(mp_int *a, char *str, int radix) { int res, digs; mp_int t; mp_digit d; char *_s = str; /* check range of the radix */ if ((radix < 2) || (radix > 64)) { return MP_VAL; } /* quick out if its zero */ if (mp_iszero(a) == MP_YES) { *str++ = '0'; *str = '\0'; return MP_OKAY; } if ((res = mp_init_copy(&t, a)) != MP_OKAY) { return res; } /* if it is negative output a - */ if (t.sign == MP_NEG) { ++_s; *str++ = '-'; t.sign = MP_ZPOS; } digs = 0; while (mp_iszero(&t) == MP_NO) { if ((res = mp_div_d(&t, (mp_digit)radix, &t, &d)) != MP_OKAY) { mp_clear(&t); return res; } *str++ = mp_s_rmap[d]; ++digs; } /* reverse the digits of the string. In this case _s points * to the first digit [exluding the sign] of the number] */ bn_reverse((unsigned char *)_s, digs); /* append a NULL so the string is properly terminated */ *str = '\0'; mp_clear(&t); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_UNSIGNED_BIN_SIZE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* get the size for an unsigned equivalent */ int mp_unsigned_bin_size(mp_int *a) { int size = mp_count_bits(a); return (size / 8) + (((size & 7) != 0) ? 1 : 0); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_XOR_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* XOR two ints together */ int mp_xor(mp_int *a, mp_int *b, mp_int *c) { int res, ix, px; mp_int t, *x; if (a->used > b->used) { if ((res = mp_init_copy(&t, a)) != MP_OKAY) { return res; } px = b->used; x = b; } else { if ((res = mp_init_copy(&t, b)) != MP_OKAY) { return res; } px = a->used; x = a; } for (ix = 0; ix < px; ix++) { t.dp[ix] ^= x->dp[ix]; } mp_clamp(&t); mp_exch(c, &t); mp_clear(&t); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_MP_ZERO_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* set to zero */ void mp_zero(mp_int *a) { int n; mp_digit *tmp; a->sign = MP_ZPOS; a->used = 0; tmp = a->dp; for (n = 0; n < a->alloc; n++) { *tmp++ = 0; } } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_PRIME_TAB_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ const mp_digit ltm_prime_tab[] = { 0x0002, 0x0003, 0x0005, 0x0007, 0x000B, 0x000D, 0x0011, 0x0013, 0x0017, 0x001D, 0x001F, 0x0025, 0x0029, 0x002B, 0x002F, 0x0035, 0x003B, 0x003D, 0x0043, 0x0047, 0x0049, 0x004F, 0x0053, 0x0059, 0x0061, 0x0065, 0x0067, 0x006B, 0x006D, 0x0071, 0x007F, #ifndef MP_8BIT 0x0083, 0x0089, 0x008B, 0x0095, 0x0097, 0x009D, 0x00A3, 0x00A7, 0x00AD, 0x00B3, 0x00B5, 0x00BF, 0x00C1, 0x00C5, 0x00C7, 0x00D3, 0x00DF, 0x00E3, 0x00E5, 0x00E9, 0x00EF, 0x00F1, 0x00FB, 0x0101, 0x0107, 0x010D, 0x010F, 0x0115, 0x0119, 0x011B, 0x0125, 0x0133, 0x0137, 0x0139, 0x013D, 0x014B, 0x0151, 0x015B, 0x015D, 0x0161, 0x0167, 0x016F, 0x0175, 0x017B, 0x017F, 0x0185, 0x018D, 0x0191, 0x0199, 0x01A3, 0x01A5, 0x01AF, 0x01B1, 0x01B7, 0x01BB, 0x01C1, 0x01C9, 0x01CD, 0x01CF, 0x01D3, 0x01DF, 0x01E7, 0x01EB, 0x01F3, 0x01F7, 0x01FD, 0x0209, 0x020B, 0x021D, 0x0223, 0x022D, 0x0233, 0x0239, 0x023B, 0x0241, 0x024B, 0x0251, 0x0257, 0x0259, 0x025F, 0x0265, 0x0269, 0x026B, 0x0277, 0x0281, 0x0283, 0x0287, 0x028D, 0x0293, 0x0295, 0x02A1, 0x02A5, 0x02AB, 0x02B3, 0x02BD, 0x02C5, 0x02CF, 0x02D7, 0x02DD, 0x02E3, 0x02E7, 0x02EF, 0x02F5, 0x02F9, 0x0301, 0x0305, 0x0313, 0x031D, 0x0329, 0x032B, 0x0335, 0x0337, 0x033B, 0x033D, 0x0347, 0x0355, 0x0359, 0x035B, 0x035F, 0x036D, 0x0371, 0x0373, 0x0377, 0x038B, 0x038F, 0x0397, 0x03A1, 0x03A9, 0x03AD, 0x03B3, 0x03B9, 0x03C7, 0x03CB, 0x03D1, 0x03D7, 0x03DF, 0x03E5, 0x03F1, 0x03F5, 0x03FB, 0x03FD, 0x0407, 0x0409, 0x040F, 0x0419, 0x041B, 0x0425, 0x0427, 0x042D, 0x043F, 0x0443, 0x0445, 0x0449, 0x044F, 0x0455, 0x045D, 0x0463, 0x0469, 0x047F, 0x0481, 0x048B, 0x0493, 0x049D, 0x04A3, 0x04A9, 0x04B1, 0x04BD, 0x04C1, 0x04C7, 0x04CD, 0x04CF, 0x04D5, 0x04E1, 0x04EB, 0x04FD, 0x04FF, 0x0503, 0x0509, 0x050B, 0x0511, 0x0515, 0x0517, 0x051B, 0x0527, 0x0529, 0x052F, 0x0551, 0x0557, 0x055D, 0x0565, 0x0577, 0x0581, 0x058F, 0x0593, 0x0595, 0x0599, 0x059F, 0x05A7, 0x05AB, 0x05AD, 0x05B3, 0x05BF, 0x05C9, 0x05CB, 0x05CF, 0x05D1, 0x05D5, 0x05DB, 0x05E7, 0x05F3, 0x05FB, 0x0607, 0x060D, 0x0611, 0x0617, 0x061F, 0x0623, 0x062B, 0x062F, 0x063D, 0x0641, 0x0647, 0x0649, 0x064D, 0x0653 #endif }; #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_REVERSE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* reverse an array, used for radix code */ void bn_reverse(unsigned char *s, int len) { int ix, iy; unsigned char t; ix = 0; iy = len - 1; while (ix < iy) { t = s[ix]; s[ix] = s[iy]; s[iy] = t; ++ix; --iy; } } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_S_MP_ADD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* low level addition, based on HAC pp.594, Algorithm 14.7 */ int s_mp_add(mp_int *a, mp_int *b, mp_int *c) { mp_int *x; int olduse, res, min, max; /* find sizes, we let |a| <= |b| which means we have to sort * them. "x" will point to the input with the most digits */ if (a->used > b->used) { min = b->used; max = a->used; x = a; } else { min = a->used; max = b->used; x = b; } /* init result */ if (c->alloc < (max + 1)) { if ((res = mp_grow(c, max + 1)) != MP_OKAY) { return res; } } /* get old used digit count and set new one */ olduse = c->used; c->used = max + 1; { mp_digit u, *tmpa, *tmpb, *tmpc; int i; /* alias for digit pointers */ /* first input */ tmpa = a->dp; /* second input */ tmpb = b->dp; /* destination */ tmpc = c->dp; /* zero the carry */ u = 0; for (i = 0; i < min; i++) { /* Compute the sum at one digit, T[i] = A[i] + B[i] + U */ *tmpc = *tmpa++ + *tmpb++ + u; /* U = carry bit of T[i] */ u = *tmpc >> ((mp_digit)DIGIT_BIT); /* take away carry bit from T[i] */ *tmpc++ &= MP_MASK; } /* now copy higher words if any, that is in A+B * if A or B has more digits add those in */ if (min != max) { for ( ; i < max; i++) { /* T[i] = X[i] + U */ *tmpc = x->dp[i] + u; /* U = carry bit of T[i] */ u = *tmpc >> ((mp_digit)DIGIT_BIT); /* take away carry bit from T[i] */ *tmpc++ &= MP_MASK; } } /* add carry */ *tmpc++ = u; /* clear digits above oldused */ for (i = c->used; i < olduse; i++) { *tmpc++ = 0; } } mp_clamp(c); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_S_MP_EXPTMOD_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ int s_mp_exptmod(mp_int *G, mp_int *X, mp_int *P, mp_int *Y, int redmode) { mp_int M[TAB_SIZE], res, mu; mp_digit buf; int err, bitbuf, bitcpy, bitcnt, mode, digidx, x, y, winsize; int (*redux)(mp_int *, mp_int *, mp_int *); /* find window size */ x = mp_count_bits(X); if (x <= 7) { winsize = 2; } else if (x <= 36) { winsize = 3; } else if (x <= 140) { winsize = 4; } else if (x <= 450) { winsize = 5; } else if (x <= 1303) { winsize = 6; } else if (x <= 3529) { winsize = 7; } else { winsize = 8; } #ifdef MP_LOW_MEM if (winsize > 5) { winsize = 5; } #endif /* init M array */ /* init first cell */ if ((err = mp_init(&M[1])) != MP_OKAY) { return err; } /* now init the second half of the array */ for (x = 1 << (winsize - 1); x < (1 << winsize); x++) { if ((err = mp_init(&M[x])) != MP_OKAY) { for (y = 1 << (winsize - 1); y < x; y++) { mp_clear(&M[y]); } mp_clear(&M[1]); return err; } } /* create mu, used for Barrett reduction */ if ((err = mp_init(&mu)) != MP_OKAY) { goto LBL_M; } if (redmode == 0) { if ((err = mp_reduce_setup(&mu, P)) != MP_OKAY) { goto LBL_MU; } redux = mp_reduce; } else { if ((err = mp_reduce_2k_setup_l(P, &mu)) != MP_OKAY) { goto LBL_MU; } redux = mp_reduce_2k_l; } /* create M table * * The M table contains powers of the base, * e.g. M[x] = G**x mod P * * The first half of the table is not * computed though accept for M[0] and M[1] */ if ((err = mp_mod(G, P, &M[1])) != MP_OKAY) { goto LBL_MU; } /* compute the value at M[1<<(winsize-1)] by squaring * M[1] (winsize-1) times */ if ((err = mp_copy(&M[1], &M[1 << (winsize - 1)])) != MP_OKAY) { goto LBL_MU; } for (x = 0; x < (winsize - 1); x++) { /* square it */ if ((err = mp_sqr(&M[1 << (winsize - 1)], &M[1 << (winsize - 1)])) != MP_OKAY) { goto LBL_MU; } /* reduce modulo P */ if ((err = redux(&M[1 << (winsize - 1)], P, &mu)) != MP_OKAY) { goto LBL_MU; } } /* create upper table, that is M[x] = M[x-1] * M[1] (mod P) * for x = (2**(winsize - 1) + 1) to (2**winsize - 1) */ for (x = (1 << (winsize - 1)) + 1; x < (1 << winsize); x++) { if ((err = mp_mul(&M[x - 1], &M[1], &M[x])) != MP_OKAY) { goto LBL_MU; } if ((err = redux(&M[x], P, &mu)) != MP_OKAY) { goto LBL_MU; } } /* setup result */ if ((err = mp_init(&res)) != MP_OKAY) { goto LBL_MU; } mp_set(&res, 1); /* set initial mode and bit cnt */ mode = 0; bitcnt = 1; buf = 0; digidx = X->used - 1; bitcpy = 0; bitbuf = 0; for ( ; ; ) { /* grab next digit as required */ if (--bitcnt == 0) { /* if digidx == -1 we are out of digits */ if (digidx == -1) { break; } /* read next digit and reset the bitcnt */ buf = X->dp[digidx--]; bitcnt = (int)DIGIT_BIT; } /* grab the next msb from the exponent */ y = (buf >> (mp_digit)(DIGIT_BIT - 1)) & 1; buf <<= (mp_digit)1; /* if the bit is zero and mode == 0 then we ignore it * These represent the leading zero bits before the first 1 bit * in the exponent. Technically this opt is not required but it * does lower the # of trivial squaring/reductions used */ if ((mode == 0) && (y == 0)) { continue; } /* if the bit is zero and mode == 1 then we square */ if ((mode == 1) && (y == 0)) { if ((err = mp_sqr(&res, &res)) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&res, P, &mu)) != MP_OKAY) { goto LBL_RES; } continue; } /* else we add it to the window */ bitbuf |= (y << (winsize - ++bitcpy)); mode = 2; if (bitcpy == winsize) { /* ok window is filled so square as required and multiply */ /* square first */ for (x = 0; x < winsize; x++) { if ((err = mp_sqr(&res, &res)) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&res, P, &mu)) != MP_OKAY) { goto LBL_RES; } } /* then multiply */ if ((err = mp_mul(&res, &M[bitbuf], &res)) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&res, P, &mu)) != MP_OKAY) { goto LBL_RES; } /* empty window and reset */ bitcpy = 0; bitbuf = 0; mode = 1; } } /* if bits remain then square/multiply */ if ((mode == 2) && (bitcpy > 0)) { /* square then multiply if the bit is set */ for (x = 0; x < bitcpy; x++) { if ((err = mp_sqr(&res, &res)) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&res, P, &mu)) != MP_OKAY) { goto LBL_RES; } bitbuf <<= 1; if ((bitbuf & (1 << winsize)) != 0) { /* then multiply */ if ((err = mp_mul(&res, &M[1], &res)) != MP_OKAY) { goto LBL_RES; } if ((err = redux(&res, P, &mu)) != MP_OKAY) { goto LBL_RES; } } } } mp_exch(&res, Y); err = MP_OKAY; LBL_RES: mp_clear(&res); LBL_MU: mp_clear(&mu); LBL_M: mp_clear(&M[1]); for (x = 1 << (winsize - 1); x < (1 << winsize); x++) { mp_clear(&M[x]); } return err; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_S_MP_MUL_DIGS_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* multiplies |a| * |b| and only computes upto digs digits of result * HAC pp. 595, Algorithm 14.12 Modified so you can control how * many digits of output are created. */ int s_mp_mul_digs(mp_int *a, mp_int *b, mp_int *c, int digs) { mp_int t; int res, pa, pb, ix, iy; mp_digit u; mp_word r; mp_digit tmpx, *tmpt, *tmpy; /* can we use the fast multiplier? */ if (((digs) < MP_WARRAY) && (MIN(a->used, b->used) < (1 << ((CHAR_BIT * sizeof(mp_word)) - (2 * DIGIT_BIT))))) { return fast_s_mp_mul_digs(a, b, c, digs); } if ((res = mp_init_size(&t, digs)) != MP_OKAY) { return res; } t.used = digs; /* compute the digits of the product directly */ pa = a->used; for (ix = 0; ix < pa; ix++) { /* set the carry to zero */ u = 0; /* limit ourselves to making digs digits of output */ pb = MIN(b->used, digs - ix); /* setup some aliases */ /* copy of the digit from a used within the nested loop */ tmpx = a->dp[ix]; /* an alias for the destination shifted ix places */ tmpt = t.dp + ix; /* an alias for the digits of b */ tmpy = b->dp; /* compute the columns of the output and propagate the carry */ for (iy = 0; iy < pb; iy++) { /* compute the column as a mp_word */ r = (mp_word) * tmpt + ((mp_word)tmpx * (mp_word) * tmpy++) + (mp_word)u; /* the new column is the lower part of the result */ *tmpt++ = (mp_digit)(r & ((mp_word)MP_MASK)); /* get the carry word from the result */ u = (mp_digit)(r >> ((mp_word)DIGIT_BIT)); } /* set carry if it is placed below digs */ if ((ix + iy) < digs) { *tmpt = u; } } mp_clamp(&t); mp_exch(&t, c); mp_clear(&t); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_S_MP_MUL_HIGH_DIGS_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* multiplies |a| * |b| and does not compute the lower digs digits * [meant to get the higher part of the product] */ int s_mp_mul_high_digs(mp_int *a, mp_int *b, mp_int *c, int digs) { mp_int t; int res, pa, pb, ix, iy; mp_digit u; mp_word r; mp_digit tmpx, *tmpt, *tmpy; /* can we use the fast multiplier? */ #ifdef BN_FAST_S_MP_MUL_HIGH_DIGS_C if (((a->used + b->used + 1) < MP_WARRAY) && (MIN(a->used, b->used) < (1 << ((CHAR_BIT * sizeof(mp_word)) - (2 * DIGIT_BIT))))) { return fast_s_mp_mul_high_digs(a, b, c, digs); } #endif if ((res = mp_init_size(&t, a->used + b->used + 1)) != MP_OKAY) { return res; } t.used = a->used + b->used + 1; pa = a->used; pb = b->used; for (ix = 0; ix < pa; ix++) { /* clear the carry */ u = 0; /* left hand side of A[ix] * B[iy] */ tmpx = a->dp[ix]; /* alias to the address of where the digits will be stored */ tmpt = &(t.dp[digs]); /* alias for where to read the right hand side from */ tmpy = b->dp + (digs - ix); for (iy = digs - ix; iy < pb; iy++) { /* calculate the double precision result */ r = (mp_word) * tmpt + ((mp_word)tmpx * (mp_word) * tmpy++) + (mp_word)u; /* get the lower part */ *tmpt++ = (mp_digit)(r & ((mp_word)MP_MASK)); /* carry the carry */ u = (mp_digit)(r >> ((mp_word)DIGIT_BIT)); } *tmpt = u; } mp_clamp(&t); mp_exch(&t, c); mp_clear(&t); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_S_MP_SQR_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* low level squaring, b = a*a, HAC pp.596-597, Algorithm 14.16 */ int s_mp_sqr(mp_int *a, mp_int *b) { mp_int t; int res, ix, iy, pa; mp_word r; mp_digit u, tmpx, *tmpt; pa = a->used; if ((res = mp_init_size(&t, (2 * pa) + 1)) != MP_OKAY) { return res; } /* default used is maximum possible size */ t.used = (2 * pa) + 1; for (ix = 0; ix < pa; ix++) { /* first calculate the digit at 2*ix */ /* calculate double precision result */ r = (mp_word)t.dp[2 * ix] + ((mp_word)a->dp[ix] * (mp_word)a->dp[ix]); /* store lower part in result */ t.dp[ix + ix] = (mp_digit)(r & ((mp_word)MP_MASK)); /* get the carry */ u = (mp_digit)(r >> ((mp_word)DIGIT_BIT)); /* left hand side of A[ix] * A[iy] */ tmpx = a->dp[ix]; /* alias for where to store the results */ tmpt = t.dp + ((2 * ix) + 1); for (iy = ix + 1; iy < pa; iy++) { /* first calculate the product */ r = ((mp_word)tmpx) * ((mp_word)a->dp[iy]); /* now calculate the double precision result, note we use * addition instead of *2 since it's easier to optimize */ r = ((mp_word) * tmpt) + r + r + ((mp_word)u); /* store lower part */ *tmpt++ = (mp_digit)(r & ((mp_word)MP_MASK)); /* get carry */ u = (mp_digit)(r >> ((mp_word)DIGIT_BIT)); } /* propagate upwards */ while (u != ((mp_digit)0)) { r = ((mp_word) * tmpt) + ((mp_word)u); *tmpt++ = (mp_digit)(r & ((mp_word)MP_MASK)); u = (mp_digit)(r >> ((mp_word)DIGIT_BIT)); } } mp_clamp(&t); mp_exch(&t, b); mp_clear(&t); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BN_S_MP_SUB_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* low level subtraction (assumes |a| > |b|), HAC pp.595 Algorithm 14.9 */ int s_mp_sub(mp_int *a, mp_int *b, mp_int *c) { int olduse, res, min, max; /* find sizes */ min = b->used; max = a->used; /* init result */ if (c->alloc < max) { if ((res = mp_grow(c, max)) != MP_OKAY) { return res; } } olduse = c->used; c->used = max; { mp_digit u, *tmpa, *tmpb, *tmpc; int i; /* alias for digit pointers */ tmpa = a->dp; tmpb = b->dp; tmpc = c->dp; /* set carry to zero */ u = 0; for (i = 0; i < min; i++) { /* T[i] = A[i] - B[i] - U */ *tmpc = (*tmpa++ - *tmpb++) - u; /* U = carry bit of T[i] * Note this saves performing an AND operation since * if a carry does occur it will propagate all the way to the * MSB. As a result a single shift is enough to get the carry */ u = *tmpc >> ((mp_digit)((CHAR_BIT * sizeof(mp_digit)) - 1)); /* Clear carry from T[i] */ *tmpc++ &= MP_MASK; } /* now copy higher words if any, e.g. if A has more digits than B */ for ( ; i < max; i++) { /* T[i] = A[i] - U */ *tmpc = *tmpa++ - u; /* U = carry bit of T[i] */ u = *tmpc >> ((mp_digit)((CHAR_BIT * sizeof(mp_digit)) - 1)); /* Clear carry from T[i] */ *tmpc++ &= MP_MASK; } /* clear digits above used (since we may not have grown result above) */ for (i = c->used; i < olduse; i++) { *tmpc++ = 0; } } mp_clamp(c); return MP_OKAY; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #ifdef BNCORE_C /* LibTomMath, multiple-precision integer library -- Tom St Denis * * LibTomMath is a library that provides multiple-precision * integer arithmetic as well as number theoretic functionality. * * The library was designed directly after the MPI library by * Michael Fromberger but has been written from scratch with * additional optimizations in place. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tstdenis82@gmail.com, http://libtom.org */ /* Known optimal configurations CPU /Compiler /MUL CUTOFF/SQR CUTOFF ------------------------------------------------------------- Intel P4 Northwood /GCC v3.4.1 / 88/ 128/LTM 0.32 ;-) AMD Athlon64 /GCC v3.4.4 / 80/ 120/LTM 0.35 */ int KARATSUBA_MUL_CUTOFF = 80, /* Min. number of digits before Karatsuba multiplication is used. */ KARATSUBA_SQR_CUTOFF = 120, /* Min. number of digits before Karatsuba squaring is used. */ TOOM_MUL_CUTOFF = 350, /* no optimal values of these are known yet so set em high */ TOOM_SQR_CUTOFF = 400; #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt.c Build strings, Tom St Denis */ const char *crypt_build_settings = "LibTomCrypt ""1.17"" (Tom St Denis, tomstdenis@gmail.com)\n" "LibTomCrypt is public domain software.\n" "Built on " __DATE__ " at " __TIME__ "\n\n\n" "Endianess: " #if defined(ENDIAN_NEUTRAL) "neutral\n" #elif defined(ENDIAN_LITTLE) "little" #if defined(ENDIAN_32BITWORD) " (32-bit words)\n" #else " (64-bit words)\n" #endif #elif defined(ENDIAN_BIG) "big" #if defined(ENDIAN_32BITWORD) " (32-bit words)\n" #else " (64-bit words)\n" #endif #endif "Clean stack: " #if defined(LTC_CLEAN_STACK) "enabled\n" #else "disabled\n" #endif "Ciphers built-in:\n" #if defined(LTC_BLOWFISH) " Blowfish\n" #endif #if defined(LTC_RC2) " LTC_RC2\n" #endif #if defined(LTC_RC5) " LTC_RC5\n" #endif #if defined(LTC_RC6) " LTC_RC6\n" #endif #if defined(LTC_SAFERP) " Safer+\n" #endif #if defined(LTC_SAFER) " Safer\n" #endif #if defined(LTC_RIJNDAEL) " Rijndael\n" #endif #if defined(LTC_XTEA) " LTC_XTEA\n" #endif #if defined(LTC_TWOFISH) " Twofish " #if defined(LTC_TWOFISH_SMALL) && defined(LTC_TWOFISH_TABLES) && defined(LTC_TWOFISH_ALL_TABLES) "(small, tables, all_tables)\n" #elif defined(LTC_TWOFISH_SMALL) && defined(LTC_TWOFISH_TABLES) "(small, tables)\n" #elif defined(LTC_TWOFISH_SMALL) && defined(LTC_TWOFISH_ALL_TABLES) "(small, all_tables)\n" #elif defined(LTC_TWOFISH_TABLES) && defined(LTC_TWOFISH_ALL_TABLES) "(tables, all_tables)\n" #elif defined(LTC_TWOFISH_SMALL) "(small)\n" #elif defined(LTC_TWOFISH_TABLES) "(tables)\n" #elif defined(LTC_TWOFISH_ALL_TABLES) "(all_tables)\n" #else "\n" #endif #endif #if defined(LTC_DES) " LTC_DES\n" #endif #if defined(LTC_CAST5) " LTC_CAST5\n" #endif #if defined(LTC_NOEKEON) " Noekeon\n" #endif #if defined(LTC_SKIPJACK) " Skipjack\n" #endif #if defined(LTC_KHAZAD) " Khazad\n" #endif #if defined(LTC_ANUBIS) " Anubis " #endif #if defined(LTC_ANUBIS_TWEAK) " (tweaked)" #endif "\n" #if defined(LTC_KSEED) " LTC_KSEED\n" #endif #if defined(LTC_KASUMI) " KASUMI\n" #endif "\nHashes built-in:\n" #if defined(LTC_SHA512) " LTC_SHA-512\n" #endif #if defined(LTC_SHA384) " LTC_SHA-384\n" #endif #if defined(LTC_SHA256) " LTC_SHA-256\n" #endif #if defined(LTC_SHA224) " LTC_SHA-224\n" #endif #if defined(LTC_TIGER) " LTC_TIGER\n" #endif #if defined(LTC_SHA1) " LTC_SHA1\n" #endif #if defined(LTC_MD5) " LTC_MD5\n" #endif #if defined(LTC_MD4) " LTC_MD4\n" #endif #if defined(LTC_MD2) " LTC_MD2\n" #endif #if defined(LTC_RIPEMD128) " LTC_RIPEMD128\n" #endif #if defined(LTC_RIPEMD160) " LTC_RIPEMD160\n" #endif #if defined(LTC_RIPEMD256) " LTC_RIPEMD256\n" #endif #if defined(LTC_RIPEMD320) " LTC_RIPEMD320\n" #endif #if defined(LTC_WHIRLPOOL) " LTC_WHIRLPOOL\n" #endif #if defined(LTC_CHC_HASH) " LTC_CHC_HASH \n" #endif "\nBlock Chaining Modes:\n" #if defined(LTC_CFB_MODE) " CFB\n" #endif #if defined(LTC_OFB_MODE) " OFB\n" #endif #if defined(LTC_ECB_MODE) " ECB\n" #endif #if defined(LTC_CBC_MODE) " CBC\n" #endif #if defined(LTC_CTR_MODE) " CTR " #endif #if defined(LTC_CTR_OLD) " (CTR_OLD) " #endif "\n" #if defined(LRW_MODE) " LRW_MODE" #if defined(LRW_TABLES) " (LRW_TABLES) " #endif "\n" #endif #if defined(LTC_F8_MODE) " F8 MODE\n" #endif #if defined(LTC_XTS_MODE) " LTC_XTS_MODE\n" #endif "\nMACs:\n" #if defined(LTC_HMAC) " LTC_HMAC\n" #endif #if defined(LTC_OMAC) " LTC_OMAC\n" #endif #if defined(LTC_PMAC) " PMAC\n" #endif #if defined(LTC_PELICAN) " LTC_PELICAN\n" #endif #if defined(LTC_XCBC) " XCBC-MAC\n" #endif #if defined(LTC_F9_MODE) " F9-MAC\n" #endif "\nENC + AUTH modes:\n" #if defined(LTC_EAX_MODE) " LTC_EAX_MODE\n" #endif #if defined(LTC_OCB_MODE) " LTC_OCB_MODE\n" #endif #if defined(LTC_CCM_MODE) " LTC_CCM_MODE\n" #endif #if defined(LTC_GCM_MODE) " LTC_GCM_MODE " #endif #if defined(LTC_GCM_TABLES) " (LTC_GCM_TABLES) " #endif "\n" "\nPRNG:\n" #if defined(LTC_YARROW) " Yarrow\n" #endif #if defined(LTC_SPRNG) " LTC_SPRNG\n" #endif #if defined(LTC_RC4) " LTC_RC4\n" #endif #if defined(LTC_FORTUNA) " Fortuna\n" #endif #if defined(LTC_SOBER128) " LTC_SOBER128\n" #endif "\nPK Algs:\n" #if defined(LTC_MRSA) " RSA \n" #endif #if defined(LTC_MECC) " ECC\n" #endif #if defined(LTC_MDSA) " DSA\n" #endif #if defined(MKAT) " Katja\n" #endif "\nCompiler:\n" #if defined(WIN32) " WIN32 platform detected.\n" #endif #if defined(__CYGWIN__) " CYGWIN Detected.\n" #endif #if defined(__DJGPP__) " DJGPP Detected.\n" #endif #if defined(_MSC_VER) " MSVC compiler detected.\n" #endif #if defined(__GNUC__) " GCC compiler detected.\n" #endif #if defined(INTEL_CC) " Intel C Compiler detected.\n" #endif #if defined(__x86_64__) " x86-64 detected.\n" #endif #if defined(LTC_PPC32) " LTC_PPC32 defined \n" #endif "\nVarious others: " #if defined(LTC_BASE64) " LTC_BASE64 " #endif #if defined(MPI) " MPI " #endif #if defined(TRY_UNRANDOM_FIRST) " TRY_UNRANDOM_FIRST " #endif #if defined(LTC_TEST) " LTC_TEST " #endif #if defined(LTC_PKCS_1) " LTC_PKCS#1 " #endif #if defined(LTC_PKCS_5) " LTC_PKCS#5 " #endif #if defined(LTC_SMALL_CODE) " LTC_SMALL_CODE " #endif #if defined(LTC_NO_FILE) " LTC_NO_FILE " #endif #if defined(LTC_DER) " LTC_DER " #endif #if defined(LTC_FAST) " LTC_FAST " #endif #if defined(LTC_NO_FAST) " LTC_NO_FAST " #endif #if defined(LTC_NO_BSWAP) " LTC_NO_BSWAP " #endif #if defined(LTC_NO_ASM) " LTC_NO_ASM " #endif #if defined(LTC_NO_TEST) " LTC_NO_TEST " #endif #if defined(LTC_NO_TABLES) " LTC_NO_TABLES " #endif #if defined(LTC_PTHREAD) " LTC_PTHREAD " #endif #if defined(LTM_LTC_DESC) " LTM_DESC " #endif #if defined(TFM_LTC_DESC) " TFM_DESC " #endif #if defined(LTC_MECC_ACCEL) " LTC_MECC_ACCEL " #endif #if defined(GMP_LTC_DESC) " GMP_DESC " #endif #if defined(LTC_EASY) " (easy) " #endif #if defined(LTC_MECC_FP) " LTC_MECC_FP " #endif #if defined(LTC_ECC_SHAMIR) " LTC_ECC_SHAMIR " #endif "\n" "\n\n\n" ; /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt.c,v $ */ /* $Revision: 1.36 $ */ /* $Date: 2007/05/12 14:46:12 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include /** @file crypt_argchk.c Perform argument checking, Tom St Denis */ #if (ARGTYPE == 0) void crypt_argchk(char *v, char *s, int d) { fprintf(stderr, "LTC_ARGCHK '%s' failure on line %d of file %s\n", v, d, s); (void)raise(SIGABRT); } #endif #ifndef TOMCRYPT_H_ #define TOMCRYPT_H_ #define USE_LTM #define LTM_DESC #define LTC_SHA1 //#include #include #include #include #include #include #include /* use configuration data */ #ifndef TOMCRYPT_CUSTOM_H_ #define TOMCRYPT_CUSTOM_H_ /* macros for various libc functions you can change for embedded targets */ #ifndef XMALLOC #ifdef malloc #define LTC_NO_PROTOTYPES #endif #define XMALLOC malloc #endif #ifndef XREALLOC #ifdef realloc #define LTC_NO_PROTOTYPES #endif #define XREALLOC realloc #endif #ifndef XCALLOC #ifdef calloc #define LTC_NO_PROTOTYPES #endif #define XCALLOC calloc #endif #ifndef XFREE #ifdef free #define LTC_NO_PROTOTYPES #endif #define XFREE free #endif #ifndef XMEMSET #ifdef memset #define LTC_NO_PROTOTYPES #endif #define XMEMSET memset #endif #ifndef XMEMCPY #ifdef memcpy #define LTC_NO_PROTOTYPES #endif #define XMEMCPY memcpy #endif #ifndef XMEMCMP #ifdef memcmp #define LTC_NO_PROTOTYPES #endif #define XMEMCMP memcmp #endif #ifndef XSTRCMP #ifdef strcmp #define LTC_NO_PROTOTYPES #endif #define XSTRCMP strcmp #endif #ifndef XCLOCK #define XCLOCK clock #endif #ifndef XCLOCKS_PER_SEC #define XCLOCKS_PER_SEC CLOCKS_PER_SEC #endif #ifndef XQSORT #ifdef qsort #define LTC_NO_PROTOTYPES #endif #define XQSORT qsort #endif /* Easy button? */ #ifdef LTC_EASY #define LTC_NO_CIPHERS #define LTC_RIJNDAEL #define LTC_BLOWFISH #define LTC_DES #define LTC_CAST5 #define LTC_NO_MODES #define LTC_ECB_MODE #define LTC_CBC_MODE #define LTC_CTR_MODE #define LTC_NO_HASHES #define LTC_SHA1 #define LTC_SHA512 #define LTC_SHA384 #define LTC_SHA256 #define LTC_SHA224 #define LTC_NO_MACS #define LTC_HMAC #define LTC_OMAC #define LTC_CCM_MODE #define LTC_NO_PRNGS #define LTC_SPRNG #define LTC_YARROW #define LTC_DEVRANDOM #define TRY_URANDOM_FIRST #define LTC_NO_PK #define LTC_MRSA #define LTC_MECC #endif /* Use small code where possible */ /* #define LTC_SMALL_CODE */ /* Enable self-test test vector checking */ #ifndef LTC_NO_TEST #define LTC_TEST #endif /* clean the stack of functions which put private information on stack */ /* #define LTC_CLEAN_STACK */ /* disable all file related functions */ /* #define LTC_NO_FILE */ /* disable all forms of ASM */ /* #define LTC_NO_ASM */ /* disable FAST mode */ /* #define LTC_NO_FAST */ /* disable BSWAP on x86 */ /* #define LTC_NO_BSWAP */ /* ---> Symmetric Block Ciphers <--- */ #ifndef LTC_NO_CIPHERS #define LTC_BLOWFISH #define LTC_RC2 #define LTC_RC5 #define LTC_RC6 #define LTC_SAFERP #define LTC_RIJNDAEL #define LTC_XTEA /* _TABLES tells it to use tables during setup, _SMALL means to use the smaller scheduled key format * (saves 4KB of ram), _ALL_TABLES enables all tables during setup */ #define LTC_TWOFISH #ifndef LTC_NO_TABLES #define LTC_TWOFISH_TABLES /* #define LTC_TWOFISH_ALL_TABLES */ #else #define LTC_TWOFISH_SMALL #endif /* #define LTC_TWOFISH_SMALL */ /* LTC_DES includes EDE triple-LTC_DES */ #define LTC_DES #define LTC_CAST5 #define LTC_NOEKEON #define LTC_SKIPJACK #define LTC_SAFER #define LTC_KHAZAD #define LTC_ANUBIS #define LTC_ANUBIS_TWEAK #define LTC_KSEED #define LTC_KASUMI #endif /* LTC_NO_CIPHERS */ /* ---> Block Cipher Modes of Operation <--- */ #ifndef LTC_NO_MODES #define LTC_CFB_MODE #define LTC_OFB_MODE #define LTC_ECB_MODE #define LTC_CBC_MODE #define LTC_CTR_MODE /* F8 chaining mode */ #define LTC_F8_MODE /* LRW mode */ #define LTC_LRW_MODE #ifndef LTC_NO_TABLES /* like GCM mode this will enable 16 8x128 tables [64KB] that make * seeking very fast. */ #define LRW_TABLES #endif /* XTS mode */ #define LTC_XTS_MODE #endif /* LTC_NO_MODES */ /* ---> One-Way Hash Functions <--- */ #ifndef LTC_NO_HASHES #define LTC_CHC_HASH #define LTC_WHIRLPOOL #define LTC_SHA512 #define LTC_SHA384 #define LTC_SHA256 #define LTC_SHA224 #define LTC_TIGER #define LTC_SHA1 #define LTC_MD5 #define LTC_MD4 #define LTC_MD2 #define LTC_RIPEMD128 #define LTC_RIPEMD160 #define LTC_RIPEMD256 #define LTC_RIPEMD320 #endif /* LTC_NO_HASHES */ /* ---> MAC functions <--- */ #ifndef LTC_NO_MACS #define LTC_HMAC #define LTC_OMAC #define LTC_PMAC #define LTC_XCBC #define LTC_F9_MODE #define LTC_PELICAN #if defined(LTC_PELICAN) && !defined(LTC_RIJNDAEL) #error Pelican-MAC requires LTC_RIJNDAEL #endif /* ---> Encrypt + Authenticate Modes <--- */ #define LTC_EAX_MODE #if defined(LTC_EAX_MODE) && !(defined(LTC_CTR_MODE) && defined(LTC_OMAC)) #error LTC_EAX_MODE requires CTR and LTC_OMAC mode #endif #define LTC_OCB_MODE #define LTC_CCM_MODE #define LTC_GCM_MODE /* Use 64KiB tables */ #ifndef LTC_NO_TABLES #define LTC_GCM_TABLES #endif /* USE SSE2? requires GCC works on x86_32 and x86_64*/ #ifdef LTC_GCM_TABLES /* #define LTC_GCM_TABLES_SSE2 */ #endif #endif /* LTC_NO_MACS */ /* Various tidbits of modern neatoness */ #define LTC_BASE64 /* --> Pseudo Random Number Generators <--- */ #ifndef LTC_NO_PRNGS /* Yarrow */ #define LTC_YARROW /* which descriptor of AES to use? */ /* 0 = rijndael_enc 1 = aes_enc, 2 = rijndael [full], 3 = aes [full] */ #define LTC_YARROW_AES 0 #if defined(LTC_YARROW) && !defined(LTC_CTR_MODE) #error LTC_YARROW requires LTC_CTR_MODE chaining mode to be defined! #endif /* a PRNG that simply reads from an available system source */ #define LTC_SPRNG /* The LTC_RC4 stream cipher */ #define LTC_RC4 /* Fortuna PRNG */ #define LTC_FORTUNA /* reseed every N calls to the read function */ #define LTC_FORTUNA_WD 10 /* number of pools (4..32) can save a bit of ram by lowering the count */ #define LTC_FORTUNA_POOLS 32 /* Greg's LTC_SOBER128 PRNG ;-0 */ #define LTC_SOBER128 /* the *nix style /dev/random device */ #define LTC_DEVRANDOM /* try /dev/urandom before trying /dev/random */ #define TRY_URANDOM_FIRST #endif /* LTC_NO_PRNGS */ /* ---> math provider? <--- */ #ifndef LTC_NO_MATH /* LibTomMath */ /* #define LTM_LTC_DESC */ /* TomsFastMath */ /* #define TFM_LTC_DESC */ #endif /* LTC_NO_MATH */ /* ---> Public Key Crypto <--- */ #ifndef LTC_NO_PK /* Include RSA support */ #define LTC_MRSA /* Include Katja (a Rabin variant like RSA) */ /* #define MKAT */ /* Digital Signature Algorithm */ #define LTC_MDSA /* ECC */ #define LTC_MECC /* use Shamir's trick for point mul (speeds up signature verification) */ #define LTC_ECC_SHAMIR #if defined(TFM_LTC_DESC) && defined(LTC_MECC) #define LTC_MECC_ACCEL #endif /* do we want fixed point ECC */ /* #define LTC_MECC_FP */ /* Timing Resistant? */ /* #define LTC_ECC_TIMING_RESISTANT */ #endif /* LTC_NO_PK */ /* LTC_PKCS #1 (RSA) and #5 (Password Handling) stuff */ #ifndef LTC_NO_PKCS #define LTC_PKCS_1 #define LTC_PKCS_5 /* Include ASN.1 DER (required by DSA/RSA) */ #define LTC_DER #endif /* LTC_NO_PKCS */ /* cleanup */ #ifdef LTC_MECC /* Supported ECC Key Sizes */ #ifndef LTC_NO_CURVES #define ECC112 #define ECC128 #define ECC160 #define ECC192 #define ECC224 #define ECC256 #define ECC384 #define ECC521 #endif #endif #if defined(LTC_MECC) || defined(LTC_MRSA) || defined(LTC_MDSA) || defined(MKATJA) /* Include the MPI functionality? (required by the PK algorithms) */ #define MPI #endif #ifdef LTC_MRSA #define LTC_PKCS_1 #endif #if defined(LTC_DER) && !defined(MPI) #error ASN.1 DER requires MPI functionality #endif #if (defined(LTC_MDSA) || defined(LTC_MRSA) || defined(LTC_MECC) || defined(MKATJA)) && !defined(LTC_DER) #error PK requires ASN.1 DER functionality, make sure LTC_DER is enabled #endif /* THREAD management */ #ifdef LTC_PTHREAD #include #define LTC_MUTEX_GLOBAL(x) pthread_mutex_t x = PTHREAD_MUTEX_INITIALIZER; #define LTC_MUTEX_PROTO(x) extern pthread_mutex_t x; #define LTC_MUTEX_TYPE(x) pthread_mutex_t x; #define LTC_MUTEX_INIT(x) pthread_mutex_init(x, NULL); #define LTC_MUTEX_LOCK(x) pthread_mutex_lock(x); #define LTC_MUTEX_UNLOCK(x) pthread_mutex_unlock(x); #else /* default no functions */ #define LTC_MUTEX_GLOBAL(x) #define LTC_MUTEX_PROTO(x) #define LTC_MUTEX_TYPE(x) #define LTC_MUTEX_INIT(x) #define LTC_MUTEX_LOCK(x) #define LTC_MUTEX_UNLOCK(x) #endif /* Debuggers */ /* define this if you use Valgrind, note: it CHANGES the way SOBER-128 and LTC_RC4 work (see the code) */ /* #define LTC_VALGRIND */ #endif /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_custom.h,v $ */ /* $Revision: 1.73 $ */ /* $Date: 2007/05/12 14:37:41 $ */ /* version */ #define CRYPT 0x0117 #define SCRYPT "1.17" /* max size of either a cipher/hash block or symmetric key [largest of the two] */ #define MAXBLOCKSIZE 128 /* descriptor table size */ /* error codes [will be expanded in future releases] */ enum { CRYPT_OK=0, /* Result OK */ CRYPT_ERROR, /* Generic Error */ CRYPT_NOP, /* Not a failure but no operation was performed */ CRYPT_INVALID_KEYSIZE, /* Invalid key size given */ CRYPT_INVALID_ROUNDS, /* Invalid number of rounds */ CRYPT_FAIL_TESTVECTOR, /* Algorithm failed test vectors */ CRYPT_BUFFER_OVERFLOW, /* Not enough space for output */ CRYPT_INVALID_PACKET, /* Invalid input packet given */ CRYPT_INVALID_PRNGSIZE, /* Invalid number of bits for a PRNG */ CRYPT_ERROR_READPRNG, /* Could not read enough from PRNG */ CRYPT_INVALID_CIPHER, /* Invalid cipher specified */ CRYPT_INVALID_HASH, /* Invalid hash specified */ CRYPT_INVALID_PRNG, /* Invalid PRNG specified */ CRYPT_MEM, /* Out of memory */ CRYPT_PK_TYPE_MISMATCH, /* Not equivalent types of PK keys */ CRYPT_PK_NOT_PRIVATE, /* Requires a private PK key */ CRYPT_INVALID_ARG, /* Generic invalid argument */ CRYPT_FILE_NOTFOUND, /* File Not Found */ CRYPT_PK_INVALID_TYPE, /* Invalid type of PK key */ CRYPT_PK_INVALID_SYSTEM, /* Invalid PK system specified */ CRYPT_PK_DUP, /* Duplicate key already in key ring */ CRYPT_PK_NOT_FOUND, /* Key not found in keyring */ CRYPT_PK_INVALID_SIZE, /* Invalid size input for PK parameters */ CRYPT_INVALID_PRIME_SIZE, /* Invalid size of prime requested */ CRYPT_PK_INVALID_PADDING /* Invalid padding on input */ }; /* This is the build config file. * * With this you can setup what to inlcude/exclude automatically during any build. Just comment * out the line that #define's the word for the thing you want to remove. phew! */ #ifndef TOMCRYPT_CFG_H #define TOMCRYPT_CFG_H #if defined(_WIN32) || defined(_MSC_VER) #define LTC_CALL __cdecl #else #ifndef LTC_CALL #define LTC_CALL #endif #endif #ifndef LTC_EXPORT #define LTC_EXPORT #endif /* certain platforms use macros for these, making the prototypes broken */ #ifndef LTC_NO_PROTOTYPES /* you can change how memory allocation works ... */ LTC_EXPORT void *LTC_CALL XMALLOC(size_t n); LTC_EXPORT void *LTC_CALL XREALLOC(void *p, size_t n); LTC_EXPORT void *LTC_CALL XCALLOC(size_t n, size_t s); LTC_EXPORT void LTC_CALL XFREE(void *p); LTC_EXPORT void LTC_CALL XQSORT(void *base, size_t nmemb, size_t size, int (*compar)(const void *, const void *)); /* change the clock function too */ LTC_EXPORT clock_t LTC_CALL XCLOCK(void); /* various other functions */ LTC_EXPORT void *LTC_CALL XMEMCPY(void *dest, const void *src, size_t n); LTC_EXPORT int LTC_CALL XMEMCMP(const void *s1, const void *s2, size_t n); LTC_EXPORT void *LTC_CALL XMEMSET(void *s, int c, size_t n); LTC_EXPORT int LTC_CALL XSTRCMP(const char *s1, const char *s2); #endif /* type of argument checking, 0=default, 1=fatal and 2=error+continue, 3=nothing */ #ifndef ARGTYPE #define ARGTYPE 0 #endif /* Controls endianess and size of registers. Leave uncommented to get platform neutral [slower] code * * Note: in order to use the optimized macros your platform must support unaligned 32 and 64 bit read/writes. * The x86 platforms allow this but some others [ARM for instance] do not. On those platforms you **MUST** * use the portable [slower] macros. */ /* detect x86-32 machines somewhat */ #if !defined(__STRICT_ANSI__) && (defined(INTEL_CC) || (defined(_MSC_VER) && defined(WIN32)) || (defined(__GNUC__) && (defined(__DJGPP__) || defined(__CYGWIN__) || defined(__MINGW32__) || defined(__i386__)))) #define ENDIAN_LITTLE #define ENDIAN_32BITWORD #define LTC_FAST #define LTC_FAST_TYPE unsigned long #endif /* detects MIPS R5900 processors (PS2) */ #if (defined(__R5900) || defined(R5900) || defined(__R5900__)) && (defined(_mips) || defined(__mips__) || defined(mips)) #define ENDIAN_LITTLE #define ENDIAN_64BITWORD #endif /* detect amd64 */ #if !defined(__STRICT_ANSI__) && defined(__x86_64__) #define ENDIAN_LITTLE #define ENDIAN_64BITWORD #define LTC_FAST #define LTC_FAST_TYPE unsigned long #endif /* detect PPC32 */ #if !defined(__STRICT_ANSI__) && defined(LTC_PPC32) #define ENDIAN_BIG #define ENDIAN_32BITWORD #define LTC_FAST #define LTC_FAST_TYPE unsigned long #endif /* detect sparc and sparc64 */ #if defined(__sparc__) #define ENDIAN_BIG #if defined(__arch64__) #define ENDIAN_64BITWORD #else #define ENDIAN_32BITWORD #endif #endif #ifdef LTC_NO_FAST #ifdef LTC_FAST #undef LTC_FAST #endif #endif /* No asm is a quick way to disable anything "not portable" */ #ifdef LTC_NO_ASM #undef ENDIAN_LITTLE #undef ENDIAN_BIG #undef ENDIAN_32BITWORD #undef ENDIAN_64BITWORD #undef LTC_FAST #undef LTC_FAST_TYPE #define LTC_NO_ROLC #define LTC_NO_BSWAP #endif /* #define ENDIAN_LITTLE */ /* #define ENDIAN_BIG */ /* #define ENDIAN_32BITWORD */ /* #define ENDIAN_64BITWORD */ #if (defined(ENDIAN_BIG) || defined(ENDIAN_LITTLE)) && !(defined(ENDIAN_32BITWORD) || defined(ENDIAN_64BITWORD)) #error You must specify a word size as well as endianess in tomcrypt_cfg.h #endif #if !(defined(ENDIAN_BIG) || defined(ENDIAN_LITTLE)) #define ENDIAN_NEUTRAL #endif #endif /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_cfg.h,v $ */ /* $Revision: 1.19 $ */ /* $Date: 2006/12/04 02:19:48 $ */ /* fix for MSVC ...evil! */ #ifdef _MSC_VER #define CONST64(n) n ## ui64 typedef unsigned __int64 ulong64; #else #define CONST64(n) n ## ULL typedef unsigned long long ulong64; #endif /* this is the "32-bit at least" data type * Re-define it to suit your platform but it must be at least 32-bits */ #if defined(__x86_64__) || (defined(__sparc__) && defined(__arch64__)) typedef unsigned ulong32; #else typedef unsigned long ulong32; #endif /* ---- HELPER MACROS ---- */ #ifdef ENDIAN_NEUTRAL #define STORE32L(x, y) \ { (y)[3] = (unsigned char)(((x) >> 24) & 255); (y)[2] = (unsigned char)(((x) >> 16) & 255); \ (y)[1] = (unsigned char)(((x) >> 8) & 255); (y)[0] = (unsigned char)((x) & 255); } #define LOAD32L(x, y) \ { x = ((unsigned long)((y)[3] & 255) << 24) | \ ((unsigned long)((y)[2] & 255) << 16) | \ ((unsigned long)((y)[1] & 255) << 8) | \ ((unsigned long)((y)[0] & 255)); } #define STORE64L(x, y) \ { (y)[7] = (unsigned char)(((x) >> 56) & 255); (y)[6] = (unsigned char)(((x) >> 48) & 255); \ (y)[5] = (unsigned char)(((x) >> 40) & 255); (y)[4] = (unsigned char)(((x) >> 32) & 255); \ (y)[3] = (unsigned char)(((x) >> 24) & 255); (y)[2] = (unsigned char)(((x) >> 16) & 255); \ (y)[1] = (unsigned char)(((x) >> 8) & 255); (y)[0] = (unsigned char)((x) & 255); } #define LOAD64L(x, y) \ { x = (((ulong64)((y)[7] & 255)) << 56) | (((ulong64)((y)[6] & 255)) << 48) | \ (((ulong64)((y)[5] & 255)) << 40) | (((ulong64)((y)[4] & 255)) << 32) | \ (((ulong64)((y)[3] & 255)) << 24) | (((ulong64)((y)[2] & 255)) << 16) | \ (((ulong64)((y)[1] & 255)) << 8) | (((ulong64)((y)[0] & 255))); } #define STORE32H(x, y) \ { (y)[0] = (unsigned char)(((x) >> 24) & 255); (y)[1] = (unsigned char)(((x) >> 16) & 255); \ (y)[2] = (unsigned char)(((x) >> 8) & 255); (y)[3] = (unsigned char)((x) & 255); } #define LOAD32H(x, y) \ { x = ((unsigned long)((y)[0] & 255) << 24) | \ ((unsigned long)((y)[1] & 255) << 16) | \ ((unsigned long)((y)[2] & 255) << 8) | \ ((unsigned long)((y)[3] & 255)); } #define STORE64H(x, y) \ { (y)[0] = (unsigned char)(((x) >> 56) & 255); (y)[1] = (unsigned char)(((x) >> 48) & 255); \ (y)[2] = (unsigned char)(((x) >> 40) & 255); (y)[3] = (unsigned char)(((x) >> 32) & 255); \ (y)[4] = (unsigned char)(((x) >> 24) & 255); (y)[5] = (unsigned char)(((x) >> 16) & 255); \ (y)[6] = (unsigned char)(((x) >> 8) & 255); (y)[7] = (unsigned char)((x) & 255); } #define LOAD64H(x, y) \ { x = (((ulong64)((y)[0] & 255)) << 56) | (((ulong64)((y)[1] & 255)) << 48) | \ (((ulong64)((y)[2] & 255)) << 40) | (((ulong64)((y)[3] & 255)) << 32) | \ (((ulong64)((y)[4] & 255)) << 24) | (((ulong64)((y)[5] & 255)) << 16) | \ (((ulong64)((y)[6] & 255)) << 8) | (((ulong64)((y)[7] & 255))); } #endif /* ENDIAN_NEUTRAL */ #ifdef ENDIAN_LITTLE #if !defined(LTC_NO_BSWAP) && (defined(INTEL_CC) || (defined(__GNUC__) && (defined(__DJGPP__) || defined(__CYGWIN__) || defined(__MINGW32__) || defined(__i386__) || defined(__x86_64__)))) #define STORE32H(x, y) \ asm __volatile__ ( \ "bswapl %0 \n\t" \ "movl %0,(%1)\n\t" \ "bswapl %0 \n\t" \ ::"r" (x), "r" (y)); #define LOAD32H(x, y) \ asm __volatile__ ( \ "movl (%1),%0\n\t" \ "bswapl %0\n\t" \ : "=r" (x) : "r" (y)); #else #define STORE32H(x, y) \ { (y)[0] = (unsigned char)(((x) >> 24) & 255); (y)[1] = (unsigned char)(((x) >> 16) & 255); \ (y)[2] = (unsigned char)(((x) >> 8) & 255); (y)[3] = (unsigned char)((x) & 255); } #define LOAD32H(x, y) \ { x = ((unsigned long)((y)[0] & 255) << 24) | \ ((unsigned long)((y)[1] & 255) << 16) | \ ((unsigned long)((y)[2] & 255) << 8) | \ ((unsigned long)((y)[3] & 255)); } #endif /* x86_64 processor */ #if !defined(LTC_NO_BSWAP) && (defined(__GNUC__) && defined(__x86_64__)) #define STORE64H(x, y) \ asm __volatile__ ( \ "bswapq %0 \n\t" \ "movq %0,(%1)\n\t" \ "bswapq %0 \n\t" \ ::"r" (x), "r" (y)); #define LOAD64H(x, y) \ asm __volatile__ ( \ "movq (%1),%0\n\t" \ "bswapq %0\n\t" \ : "=r" (x) : "r" (y)); #else #define STORE64H(x, y) \ { (y)[0] = (unsigned char)(((x) >> 56) & 255); (y)[1] = (unsigned char)(((x) >> 48) & 255); \ (y)[2] = (unsigned char)(((x) >> 40) & 255); (y)[3] = (unsigned char)(((x) >> 32) & 255); \ (y)[4] = (unsigned char)(((x) >> 24) & 255); (y)[5] = (unsigned char)(((x) >> 16) & 255); \ (y)[6] = (unsigned char)(((x) >> 8) & 255); (y)[7] = (unsigned char)((x) & 255); } #define LOAD64H(x, y) \ { x = (((ulong64)((y)[0] & 255)) << 56) | (((ulong64)((y)[1] & 255)) << 48) | \ (((ulong64)((y)[2] & 255)) << 40) | (((ulong64)((y)[3] & 255)) << 32) | \ (((ulong64)((y)[4] & 255)) << 24) | (((ulong64)((y)[5] & 255)) << 16) | \ (((ulong64)((y)[6] & 255)) << 8) | (((ulong64)((y)[7] & 255))); } #endif #ifdef ENDIAN_32BITWORD #define STORE32L(x, y) \ { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } #define LOAD32L(x, y) \ XMEMCPY(&(x), y, 4); #define STORE64L(x, y) \ { (y)[7] = (unsigned char)(((x) >> 56) & 255); (y)[6] = (unsigned char)(((x) >> 48) & 255); \ (y)[5] = (unsigned char)(((x) >> 40) & 255); (y)[4] = (unsigned char)(((x) >> 32) & 255); \ (y)[3] = (unsigned char)(((x) >> 24) & 255); (y)[2] = (unsigned char)(((x) >> 16) & 255); \ (y)[1] = (unsigned char)(((x) >> 8) & 255); (y)[0] = (unsigned char)((x) & 255); } #define LOAD64L(x, y) \ { x = (((ulong64)((y)[7] & 255)) << 56) | (((ulong64)((y)[6] & 255)) << 48) | \ (((ulong64)((y)[5] & 255)) << 40) | (((ulong64)((y)[4] & 255)) << 32) | \ (((ulong64)((y)[3] & 255)) << 24) | (((ulong64)((y)[2] & 255)) << 16) | \ (((ulong64)((y)[1] & 255)) << 8) | (((ulong64)((y)[0] & 255))); } #else /* 64-bit words then */ #define STORE32L(x, y) \ { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } #define LOAD32L(x, y) \ { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } #define STORE64L(x, y) \ { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } #define LOAD64L(x, y) \ { XMEMCPY(&(x), y, 8); } #endif /* ENDIAN_64BITWORD */ #endif /* ENDIAN_LITTLE */ #ifdef ENDIAN_BIG #define STORE32L(x, y) \ { (y)[3] = (unsigned char)(((x) >> 24) & 255); (y)[2] = (unsigned char)(((x) >> 16) & 255); \ (y)[1] = (unsigned char)(((x) >> 8) & 255); (y)[0] = (unsigned char)((x) & 255); } #define LOAD32L(x, y) \ { x = ((unsigned long)((y)[3] & 255) << 24) | \ ((unsigned long)((y)[2] & 255) << 16) | \ ((unsigned long)((y)[1] & 255) << 8) | \ ((unsigned long)((y)[0] & 255)); } #define STORE64L(x, y) \ { (y)[7] = (unsigned char)(((x) >> 56) & 255); (y)[6] = (unsigned char)(((x) >> 48) & 255); \ (y)[5] = (unsigned char)(((x) >> 40) & 255); (y)[4] = (unsigned char)(((x) >> 32) & 255); \ (y)[3] = (unsigned char)(((x) >> 24) & 255); (y)[2] = (unsigned char)(((x) >> 16) & 255); \ (y)[1] = (unsigned char)(((x) >> 8) & 255); (y)[0] = (unsigned char)((x) & 255); } #define LOAD64L(x, y) \ { x = (((ulong64)((y)[7] & 255)) << 56) | (((ulong64)((y)[6] & 255)) << 48) | \ (((ulong64)((y)[5] & 255)) << 40) | (((ulong64)((y)[4] & 255)) << 32) | \ (((ulong64)((y)[3] & 255)) << 24) | (((ulong64)((y)[2] & 255)) << 16) | \ (((ulong64)((y)[1] & 255)) << 8) | (((ulong64)((y)[0] & 255))); } #ifdef ENDIAN_32BITWORD #define STORE32H(x, y) \ { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } #define LOAD32H(x, y) \ XMEMCPY(&(x), y, 4); #define STORE64H(x, y) \ { (y)[0] = (unsigned char)(((x) >> 56) & 255); (y)[1] = (unsigned char)(((x) >> 48) & 255); \ (y)[2] = (unsigned char)(((x) >> 40) & 255); (y)[3] = (unsigned char)(((x) >> 32) & 255); \ (y)[4] = (unsigned char)(((x) >> 24) & 255); (y)[5] = (unsigned char)(((x) >> 16) & 255); \ (y)[6] = (unsigned char)(((x) >> 8) & 255); (y)[7] = (unsigned char)((x) & 255); } #define LOAD64H(x, y) \ { x = (((ulong64)((y)[0] & 255)) << 56) | (((ulong64)((y)[1] & 255)) << 48) | \ (((ulong64)((y)[2] & 255)) << 40) | (((ulong64)((y)[3] & 255)) << 32) | \ (((ulong64)((y)[4] & 255)) << 24) | (((ulong64)((y)[5] & 255)) << 16) | \ (((ulong64)((y)[6] & 255)) << 8) | (((ulong64)((y)[7] & 255))); } #else /* 64-bit words then */ #define STORE32H(x, y) \ { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } #define LOAD32H(x, y) \ { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } #define STORE64H(x, y) \ { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } #define LOAD64H(x, y) \ { XMEMCPY(&(x), y, 8); } #endif /* ENDIAN_64BITWORD */ #endif /* ENDIAN_BIG */ #define BSWAP(x) \ (((x >> 24) & 0x000000FFUL) | ((x << 24) & 0xFF000000UL) | \ ((x >> 8) & 0x0000FF00UL) | ((x << 8) & 0x00FF0000UL)) /* 32-bit Rotates */ #if defined(_MSC_VER) /* instrinsic rotate */ #include #pragma intrinsic(_lrotr,_lrotl) #define ROR(x, n) _lrotr(x, n) #define ROL(x, n) _lrotl(x, n) #define RORc(x, n) _lrotr(x, n) #define ROLc(x, n) _lrotl(x, n) #elif !defined(__STRICT_ANSI__) && defined(__GNUC__) && (defined(__i386__) || defined(__x86_64__)) && !defined(INTEL_CC) && !defined(LTC_NO_ASM) static inline unsigned ROL(unsigned word, int i) { asm ("roll %%cl,%0" : "=r" (word) : "0" (word), "c" (i)); return word; } static inline unsigned ROR(unsigned word, int i) { asm ("rorl %%cl,%0" : "=r" (word) : "0" (word), "c" (i)); return word; } #ifndef LTC_NO_ROLC static inline unsigned ROLc(unsigned word, const int i) { asm ("roll %2,%0" : "=r" (word) : "0" (word), "I" (i)); return word; } static inline unsigned RORc(unsigned word, const int i) { asm ("rorl %2,%0" : "=r" (word) : "0" (word), "I" (i)); return word; } #else #define ROLc ROL #define RORc ROR #endif #elif !defined(__STRICT_ANSI__) && defined(LTC_PPC32) static inline unsigned ROL(unsigned word, int i) { asm ("rotlw %0,%0,%2" : "=r" (word) : "0" (word), "r" (i)); return word; } static inline unsigned ROR(unsigned word, int i) { asm ("rotlw %0,%0,%2" : "=r" (word) : "0" (word), "r" (32 - i)); return word; } #ifndef LTC_NO_ROLC static inline unsigned ROLc(unsigned word, const int i) { asm ("rotlwi %0,%0,%2" : "=r" (word) : "0" (word), "I" (i)); return word; } static inline unsigned RORc(unsigned word, const int i) { asm ("rotrwi %0,%0,%2" : "=r" (word) : "0" (word), "I" (i)); return word; } #else #define ROLc ROL #define RORc ROR #endif #else /* rotates the hard way */ #define ROL(x, y) ((((unsigned long)(x) << (unsigned long)((y) & 31)) | (((unsigned long)(x) & 0xFFFFFFFFUL) >> (unsigned long)(32 - ((y) & 31)))) & 0xFFFFFFFFUL) #define ROR(x, y) (((((unsigned long)(x) & 0xFFFFFFFFUL) >> (unsigned long)((y) & 31)) | ((unsigned long)(x) << (unsigned long)(32 - ((y) & 31)))) & 0xFFFFFFFFUL) #define ROLc(x, y) ((((unsigned long)(x) << (unsigned long)((y) & 31)) | (((unsigned long)(x) & 0xFFFFFFFFUL) >> (unsigned long)(32 - ((y) & 31)))) & 0xFFFFFFFFUL) #define RORc(x, y) (((((unsigned long)(x) & 0xFFFFFFFFUL) >> (unsigned long)((y) & 31)) | ((unsigned long)(x) << (unsigned long)(32 - ((y) & 31)))) & 0xFFFFFFFFUL) #endif /* 64-bit Rotates */ #if !defined(__STRICT_ANSI__) && defined(__GNUC__) && defined(__x86_64__) && !defined(LTC_NO_ASM) static inline unsigned long ROL64(unsigned long word, int i) { asm ("rolq %%cl,%0" : "=r" (word) : "0" (word), "c" (i)); return word; } static inline unsigned long ROR64(unsigned long word, int i) { asm ("rorq %%cl,%0" : "=r" (word) : "0" (word), "c" (i)); return word; } #ifndef LTC_NO_ROLC static inline unsigned long ROL64c(unsigned long word, const int i) { asm ("rolq %2,%0" : "=r" (word) : "0" (word), "J" (i)); return word; } static inline unsigned long ROR64c(unsigned long word, const int i) { asm ("rorq %2,%0" : "=r" (word) : "0" (word), "J" (i)); return word; } #else /* LTC_NO_ROLC */ #define ROL64c ROL64 #define ROR64c ROR64 #endif #else /* Not x86_64 */ #define ROL64(x, y) \ ((((x) << ((ulong64)(y) & 63)) | \ (((x) & CONST64(0xFFFFFFFFFFFFFFFF)) >> ((ulong64)64 - ((y) & 63)))) & CONST64(0xFFFFFFFFFFFFFFFF)) #define ROR64(x, y) \ (((((x) & CONST64(0xFFFFFFFFFFFFFFFF)) >> ((ulong64)(y) & CONST64(63))) | \ ((x) << ((ulong64)(64 - ((y) & CONST64(63)))))) & CONST64(0xFFFFFFFFFFFFFFFF)) #define ROL64c(x, y) \ ((((x) << ((ulong64)(y) & 63)) | \ (((x) & CONST64(0xFFFFFFFFFFFFFFFF)) >> ((ulong64)64 - ((y) & 63)))) & CONST64(0xFFFFFFFFFFFFFFFF)) #define ROR64c(x, y) \ (((((x) & CONST64(0xFFFFFFFFFFFFFFFF)) >> ((ulong64)(y) & CONST64(63))) | \ ((x) << ((ulong64)(64 - ((y) & CONST64(63)))))) & CONST64(0xFFFFFFFFFFFFFFFF)) #endif #ifndef MAX #define MAX(x, y) (((x) > (y)) ? (x) : (y)) #endif #ifndef MIN #define MIN(x, y) (((x) < (y)) ? (x) : (y)) #endif /* extract a byte portably */ #ifdef _MSC_VER #define byte(x, n) ((unsigned char)((x) >> (8 * (n)))) #else #define byte(x, n) (((x) >> (8 * (n))) & 255) #endif /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_macros.h,v $ */ /* $Revision: 1.15 $ */ /* $Date: 2006/11/29 23:43:57 $ */ /* ---- SYMMETRIC KEY STUFF ----- * * We put each of the ciphers scheduled keys in their own structs then we put all of * the key formats in one union. This makes the function prototypes easier to use. */ #ifdef LTC_BLOWFISH struct blowfish_key { ulong32 S[4][256]; ulong32 K[18]; }; #endif #ifdef LTC_RC5 struct rc5_key { int rounds; ulong32 K[50]; }; #endif #ifdef LTC_RC6 struct rc6_key { ulong32 K[44]; }; #endif #ifdef LTC_SAFERP struct saferp_key { unsigned char K[33][16]; long rounds; }; #endif #ifdef LTC_RIJNDAEL struct rijndael_key { ulong32 eK[60], dK[60]; int Nr; }; #endif #ifdef LTC_KSEED struct kseed_key { ulong32 K[32], dK[32]; }; #endif #ifdef LTC_KASUMI struct kasumi_key { ulong32 KLi1[8], KLi2[8], KOi1[8], KOi2[8], KOi3[8], KIi1[8], KIi2[8], KIi3[8]; }; #endif #ifdef LTC_XTEA struct xtea_key { unsigned long A[32], B[32]; }; #endif #ifdef LTC_TWOFISH #ifndef LTC_TWOFISH_SMALL struct twofish_key { ulong32 S[4][256], K[40]; }; #else struct twofish_key { ulong32 K[40]; unsigned char S[32], start; }; #endif #endif #ifdef LTC_SAFER #define LTC_SAFER_K64_DEFAULT_NOF_ROUNDS 6 #define LTC_SAFER_K128_DEFAULT_NOF_ROUNDS 10 #define LTC_SAFER_SK64_DEFAULT_NOF_ROUNDS 8 #define LTC_SAFER_SK128_DEFAULT_NOF_ROUNDS 10 #define LTC_SAFER_MAX_NOF_ROUNDS 13 #define LTC_SAFER_BLOCK_LEN 8 #define LTC_SAFER_KEY_LEN (1 + LTC_SAFER_BLOCK_LEN * (1 + 2 * LTC_SAFER_MAX_NOF_ROUNDS)) typedef unsigned char safer_block_t[LTC_SAFER_BLOCK_LEN]; typedef unsigned char safer_key_t[LTC_SAFER_KEY_LEN]; struct safer_key { safer_key_t key; }; #endif #ifdef LTC_RC2 struct rc2_key { unsigned xkey[64]; }; #endif #ifdef LTC_DES struct des_key { ulong32 ek[32], dk[32]; }; struct des3_key { ulong32 ek[3][32], dk[3][32]; }; #endif #ifdef LTC_CAST5 struct cast5_key { ulong32 K[32], keylen; }; #endif #ifdef LTC_NOEKEON struct noekeon_key { ulong32 K[4], dK[4]; }; #endif #ifdef LTC_SKIPJACK struct skipjack_key { unsigned char key[10]; }; #endif #ifdef LTC_KHAZAD struct khazad_key { ulong64 roundKeyEnc[8 + 1]; ulong64 roundKeyDec[8 + 1]; }; #endif #ifdef LTC_ANUBIS struct anubis_key { int keyBits; int R; ulong32 roundKeyEnc[18 + 1][4]; ulong32 roundKeyDec[18 + 1][4]; }; #endif #ifdef LTC_MULTI2 struct multi2_key { int N; ulong32 uk[8]; }; #endif typedef union Symmetric_key { #ifdef LTC_DES struct des_key des; struct des3_key des3; #endif #ifdef LTC_RC2 struct rc2_key rc2; #endif #ifdef LTC_SAFER struct safer_key safer; #endif #ifdef LTC_TWOFISH struct twofish_key twofish; #endif #ifdef LTC_BLOWFISH struct blowfish_key blowfish; #endif #ifdef LTC_RC5 struct rc5_key rc5; #endif #ifdef LTC_RC6 struct rc6_key rc6; #endif #ifdef LTC_SAFERP struct saferp_key saferp; #endif #ifdef LTC_RIJNDAEL struct rijndael_key rijndael; #endif #ifdef LTC_XTEA struct xtea_key xtea; #endif #ifdef LTC_CAST5 struct cast5_key cast5; #endif #ifdef LTC_NOEKEON struct noekeon_key noekeon; #endif #ifdef LTC_SKIPJACK struct skipjack_key skipjack; #endif #ifdef LTC_KHAZAD struct khazad_key khazad; #endif #ifdef LTC_ANUBIS struct anubis_key anubis; #endif #ifdef LTC_KSEED struct kseed_key kseed; #endif #ifdef LTC_KASUMI struct kasumi_key kasumi; #endif #ifdef LTC_MULTI2 struct multi2_key multi2; #endif void *data; } symmetric_key; #ifdef LTC_ECB_MODE /** A block cipher ECB structure */ typedef struct { /** The index of the cipher chosen */ int cipher, /** The block size of the given cipher */ blocklen; /** The scheduled key */ symmetric_key key; } symmetric_ECB; #endif #ifdef LTC_CFB_MODE /** A block cipher CFB structure */ typedef struct { /** The index of the cipher chosen */ int cipher, /** The block size of the given cipher */ blocklen, /** The padding offset */ padlen; /** The current IV */ unsigned char IV[MAXBLOCKSIZE], /** The pad used to encrypt/decrypt */ pad[MAXBLOCKSIZE]; /** The scheduled key */ symmetric_key key; } symmetric_CFB; #endif #ifdef LTC_OFB_MODE /** A block cipher OFB structure */ typedef struct { /** The index of the cipher chosen */ int cipher, /** The block size of the given cipher */ blocklen, /** The padding offset */ padlen; /** The current IV */ unsigned char IV[MAXBLOCKSIZE]; /** The scheduled key */ symmetric_key key; } symmetric_OFB; #endif #ifdef LTC_CBC_MODE /** A block cipher CBC structure */ typedef struct { /** The index of the cipher chosen */ int cipher, /** The block size of the given cipher */ blocklen; /** The current IV */ unsigned char IV[MAXBLOCKSIZE]; /** The scheduled key */ symmetric_key key; } symmetric_CBC; #endif #ifdef LTC_CTR_MODE /** A block cipher CTR structure */ typedef struct { /** The index of the cipher chosen */ int cipher, /** The block size of the given cipher */ blocklen, /** The padding offset */ padlen, /** The mode (endianess) of the CTR, 0==little, 1==big */ mode, /** counter width */ ctrlen; /** The counter */ unsigned char ctr[MAXBLOCKSIZE], /** The pad used to encrypt/decrypt */ pad[MAXBLOCKSIZE]; /** The scheduled key */ symmetric_key key; } symmetric_CTR; #endif #ifdef LTC_LRW_MODE /** A LRW structure */ typedef struct { /** The index of the cipher chosen (must be a 128-bit block cipher) */ int cipher; /** The current IV */ unsigned char IV[16], /** the tweak key */ tweak[16], /** The current pad, it's the product of the first 15 bytes against the tweak key */ pad[16]; /** The scheduled symmetric key */ symmetric_key key; #ifdef LRW_TABLES /** The pre-computed multiplication table */ unsigned char PC[16][256][16]; #endif } symmetric_LRW; #endif #ifdef LTC_F8_MODE /** A block cipher F8 structure */ typedef struct { /** The index of the cipher chosen */ int cipher, /** The block size of the given cipher */ blocklen, /** The padding offset */ padlen; /** The current IV */ unsigned char IV[MAXBLOCKSIZE], MIV[MAXBLOCKSIZE]; /** Current block count */ ulong32 blockcnt; /** The scheduled key */ symmetric_key key; } symmetric_F8; #endif /** cipher descriptor table, last entry has "name == NULL" to mark the end of table */ extern struct ltc_cipher_descriptor { /** name of cipher */ char *name; /** internal ID */ unsigned char ID; /** min keysize (octets) */ int min_key_length, /** max keysize (octets) */ max_key_length, /** block size (octets) */ block_length, /** default number of rounds */ default_rounds; /** Setup the cipher @param key The input symmetric key @param keylen The length of the input key (octets) @param num_rounds The requested number of rounds (0==default) @param skey [out] The destination of the scheduled key @return CRYPT_OK if successful */ int (*setup)(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); /** Encrypt a block @param pt The plaintext @param ct [out] The ciphertext @param skey The scheduled key @return CRYPT_OK if successful */ int (*ecb_encrypt)(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); /** Decrypt a block @param ct The ciphertext @param pt [out] The plaintext @param skey The scheduled key @return CRYPT_OK if successful */ int (*ecb_decrypt)(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); /** Test the block cipher @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled */ int (*test)(void); /** Terminate the context @param skey The scheduled key */ void (*done)(symmetric_key *skey); /** Determine a key size @param keysize [in/out] The size of the key desired and the suggested size @return CRYPT_OK if successful */ int (*keysize)(int *keysize); /** Accelerators **/ /** Accelerated ECB encryption @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @param skey The scheduled key context @return CRYPT_OK if successful */ int (*accel_ecb_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, symmetric_key *skey); /** Accelerated ECB decryption @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @param skey The scheduled key context @return CRYPT_OK if successful */ int (*accel_ecb_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, symmetric_key *skey); /** Accelerated CBC encryption @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @param IV The initial value (input/output) @param skey The scheduled key context @return CRYPT_OK if successful */ int (*accel_cbc_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, symmetric_key *skey); /** Accelerated CBC decryption @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @param IV The initial value (input/output) @param skey The scheduled key context @return CRYPT_OK if successful */ int (*accel_cbc_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, unsigned char *IV, symmetric_key *skey); /** Accelerated CTR encryption @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @param IV The initial value (input/output) @param mode little or big endian counter (mode=0 or mode=1) @param skey The scheduled key context @return CRYPT_OK if successful */ int (*accel_ctr_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, int mode, symmetric_key *skey); /** Accelerated LRW @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @param IV The initial value (input/output) @param tweak The LRW tweak @param skey The scheduled key context @return CRYPT_OK if successful */ int (*accel_lrw_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, const unsigned char *tweak, symmetric_key *skey); /** Accelerated LRW @param ct Ciphertext @param pt Plaintext @param blocks The number of complete blocks to process @param IV The initial value (input/output) @param tweak The LRW tweak @param skey The scheduled key context @return CRYPT_OK if successful */ int (*accel_lrw_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, unsigned char *IV, const unsigned char *tweak, symmetric_key *skey); /** Accelerated CCM packet (one-shot) @param key The secret key to use @param keylen The length of the secret key (octets) @param uskey A previously scheduled key [optional can be NULL] @param nonce The session nonce [use once] @param noncelen The length of the nonce @param header The header for the session @param headerlen The length of the header (octets) @param pt [out] The plaintext @param ptlen The length of the plaintext (octets) @param ct [out] The ciphertext @param tag [out] The destination tag @param taglen [in/out] The max size and resulting size of the authentication tag @param direction Encrypt or Decrypt direction (0 or 1) @return CRYPT_OK if successful */ int (*accel_ccm_memory)( const unsigned char *key, unsigned long keylen, symmetric_key *uskey, const unsigned char *nonce, unsigned long noncelen, const unsigned char *header, unsigned long headerlen, unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tag, unsigned long *taglen, int direction); /** Accelerated GCM packet (one shot) @param key The secret key @param keylen The length of the secret key @param IV The initial vector @param IVlen The length of the initial vector @param adata The additional authentication data (header) @param adatalen The length of the adata @param pt The plaintext @param ptlen The length of the plaintext (ciphertext length is the same) @param ct The ciphertext @param tag [out] The MAC tag @param taglen [in/out] The MAC tag length @param direction Encrypt or Decrypt mode (GCM_ENCRYPT or GCM_DECRYPT) @return CRYPT_OK on success */ int (*accel_gcm_memory)( const unsigned char *key, unsigned long keylen, const unsigned char *IV, unsigned long IVlen, const unsigned char *adata, unsigned long adatalen, unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tag, unsigned long *taglen, int direction); /** Accelerated one shot LTC_OMAC @param key The secret key @param keylen The key length (octets) @param in The message @param inlen Length of message (octets) @param out [out] Destination for tag @param outlen [in/out] Initial and final size of out @return CRYPT_OK on success */ int (*omac_memory)( const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); /** Accelerated one shot XCBC @param key The secret key @param keylen The key length (octets) @param in The message @param inlen Length of message (octets) @param out [out] Destination for tag @param outlen [in/out] Initial and final size of out @return CRYPT_OK on success */ int (*xcbc_memory)( const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); /** Accelerated one shot F9 @param key The secret key @param keylen The key length (octets) @param in The message @param inlen Length of message (octets) @param out [out] Destination for tag @param outlen [in/out] Initial and final size of out @return CRYPT_OK on success @remark Requires manual padding */ int (*f9_memory)( const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); } cipher_descriptor[]; #ifdef LTC_BLOWFISH int blowfish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int blowfish_test(void); void blowfish_done(symmetric_key *skey); int blowfish_keysize(int *keysize); extern const struct ltc_cipher_descriptor blowfish_desc; #endif #ifdef LTC_RC5 int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int rc5_test(void); void rc5_done(symmetric_key *skey); int rc5_keysize(int *keysize); extern const struct ltc_cipher_descriptor rc5_desc; #endif #ifdef LTC_RC6 int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int rc6_test(void); void rc6_done(symmetric_key *skey); int rc6_keysize(int *keysize); extern const struct ltc_cipher_descriptor rc6_desc; #endif #ifdef LTC_RC2 int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int rc2_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int rc2_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int rc2_test(void); void rc2_done(symmetric_key *skey); int rc2_keysize(int *keysize); extern const struct ltc_cipher_descriptor rc2_desc; #endif #ifdef LTC_SAFERP int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int saferp_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int saferp_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int saferp_test(void); void saferp_done(symmetric_key *skey); int saferp_keysize(int *keysize); extern const struct ltc_cipher_descriptor saferp_desc; #endif #ifdef LTC_SAFER int safer_k64_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int safer_sk64_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int safer_k128_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int safer_sk128_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int safer_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *key); int safer_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *key); int safer_k64_test(void); int safer_sk64_test(void); int safer_sk128_test(void); void safer_done(symmetric_key *skey); int safer_64_keysize(int *keysize); int safer_128_keysize(int *keysize); extern const struct ltc_cipher_descriptor safer_k64_desc, safer_k128_desc, safer_sk64_desc, safer_sk128_desc; #endif #ifdef LTC_RIJNDAEL /* make aes an alias */ #define aes_setup rijndael_setup #define aes_ecb_encrypt rijndael_ecb_encrypt #define aes_ecb_decrypt rijndael_ecb_decrypt #define aes_test rijndael_test #define aes_done rijndael_done #define aes_keysize rijndael_keysize #define aes_enc_setup rijndael_enc_setup #define aes_enc_ecb_encrypt rijndael_enc_ecb_encrypt #define aes_enc_keysize rijndael_enc_keysize int rijndael_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int rijndael_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int rijndael_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int rijndael_test(void); void rijndael_done(symmetric_key *skey); int rijndael_keysize(int *keysize); int rijndael_enc_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int rijndael_enc_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); void rijndael_enc_done(symmetric_key *skey); int rijndael_enc_keysize(int *keysize); extern const struct ltc_cipher_descriptor rijndael_desc, aes_desc; extern const struct ltc_cipher_descriptor rijndael_enc_desc, aes_enc_desc; #endif #ifdef LTC_XTEA int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int xtea_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int xtea_test(void); void xtea_done(symmetric_key *skey); int xtea_keysize(int *keysize); extern const struct ltc_cipher_descriptor xtea_desc; #endif #ifdef LTC_TWOFISH int twofish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int twofish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int twofish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int twofish_test(void); void twofish_done(symmetric_key *skey); int twofish_keysize(int *keysize); extern const struct ltc_cipher_descriptor twofish_desc; #endif #ifdef LTC_DES int des_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int des_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int des_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int des_test(void); void des_done(symmetric_key *skey); int des_keysize(int *keysize); int des3_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int des3_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int des3_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int des3_test(void); void des3_done(symmetric_key *skey); int des3_keysize(int *keysize); extern const struct ltc_cipher_descriptor des_desc, des3_desc; #endif #ifdef LTC_CAST5 int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int cast5_test(void); void cast5_done(symmetric_key *skey); int cast5_keysize(int *keysize); extern const struct ltc_cipher_descriptor cast5_desc; #endif #ifdef LTC_NOEKEON int noekeon_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int noekeon_test(void); void noekeon_done(symmetric_key *skey); int noekeon_keysize(int *keysize); extern const struct ltc_cipher_descriptor noekeon_desc; #endif #ifdef LTC_SKIPJACK int skipjack_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int skipjack_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int skipjack_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int skipjack_test(void); void skipjack_done(symmetric_key *skey); int skipjack_keysize(int *keysize); extern const struct ltc_cipher_descriptor skipjack_desc; #endif #ifdef LTC_KHAZAD int khazad_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int khazad_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int khazad_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int khazad_test(void); void khazad_done(symmetric_key *skey); int khazad_keysize(int *keysize); extern const struct ltc_cipher_descriptor khazad_desc; #endif #ifdef LTC_ANUBIS int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int anubis_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int anubis_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int anubis_test(void); void anubis_done(symmetric_key *skey); int anubis_keysize(int *keysize); extern const struct ltc_cipher_descriptor anubis_desc; #endif #ifdef LTC_KSEED int kseed_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int kseed_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int kseed_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int kseed_test(void); void kseed_done(symmetric_key *skey); int kseed_keysize(int *keysize); extern const struct ltc_cipher_descriptor kseed_desc; #endif #ifdef LTC_KASUMI int kasumi_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int kasumi_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int kasumi_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int kasumi_test(void); void kasumi_done(symmetric_key *skey); int kasumi_keysize(int *keysize); extern const struct ltc_cipher_descriptor kasumi_desc; #endif #ifdef LTC_MULTI2 int multi2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); int multi2_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int multi2_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int multi2_test(void); void multi2_done(symmetric_key *skey); int multi2_keysize(int *keysize); extern const struct ltc_cipher_descriptor multi2_desc; #endif #ifdef LTC_ECB_MODE int ecb_start(int cipher, const unsigned char *key, int keylen, int num_rounds, symmetric_ECB *ecb); int ecb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_ECB *ecb); int ecb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_ECB *ecb); int ecb_done(symmetric_ECB *ecb); #endif #ifdef LTC_CFB_MODE int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_CFB *cfb); int cfb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CFB *cfb); int cfb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CFB *cfb); int cfb_getiv(unsigned char *IV, unsigned long *len, symmetric_CFB *cfb); int cfb_setiv(const unsigned char *IV, unsigned long len, symmetric_CFB *cfb); int cfb_done(symmetric_CFB *cfb); #endif #ifdef LTC_OFB_MODE int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_OFB *ofb); int ofb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_OFB *ofb); int ofb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_OFB *ofb); int ofb_getiv(unsigned char *IV, unsigned long *len, symmetric_OFB *ofb); int ofb_setiv(const unsigned char *IV, unsigned long len, symmetric_OFB *ofb); int ofb_done(symmetric_OFB *ofb); #endif #ifdef LTC_CBC_MODE int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_CBC *cbc); int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CBC *cbc); int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CBC *cbc); int cbc_getiv(unsigned char *IV, unsigned long *len, symmetric_CBC *cbc); int cbc_setiv(const unsigned char *IV, unsigned long len, symmetric_CBC *cbc); int cbc_done(symmetric_CBC *cbc); #endif #ifdef LTC_CTR_MODE #define CTR_COUNTER_LITTLE_ENDIAN 0x0000 #define CTR_COUNTER_BIG_ENDIAN 0x1000 #define LTC_CTR_RFC3686 0x2000 int ctr_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, int ctr_mode, symmetric_CTR *ctr); int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CTR *ctr); int ctr_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CTR *ctr); int ctr_getiv(unsigned char *IV, unsigned long *len, symmetric_CTR *ctr); int ctr_setiv(const unsigned char *IV, unsigned long len, symmetric_CTR *ctr); int ctr_done(symmetric_CTR *ctr); int ctr_test(void); #endif #ifdef LTC_LRW_MODE #define LRW_ENCRYPT 0 #define LRW_DECRYPT 1 int lrw_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, const unsigned char *tweak, int num_rounds, symmetric_LRW *lrw); int lrw_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_LRW *lrw); int lrw_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_LRW *lrw); int lrw_getiv(unsigned char *IV, unsigned long *len, symmetric_LRW *lrw); int lrw_setiv(const unsigned char *IV, unsigned long len, symmetric_LRW *lrw); int lrw_done(symmetric_LRW *lrw); int lrw_test(void); /* don't call */ int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, int mode, symmetric_LRW *lrw); #endif #ifdef LTC_F8_MODE int f8_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, const unsigned char *salt_key, int skeylen, int num_rounds, symmetric_F8 *f8); int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_F8 *f8); int f8_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_F8 *f8); int f8_getiv(unsigned char *IV, unsigned long *len, symmetric_F8 *f8); int f8_setiv(const unsigned char *IV, unsigned long len, symmetric_F8 *f8); int f8_done(symmetric_F8 *f8); int f8_test_mode(void); #endif #ifdef LTC_XTS_MODE typedef struct { symmetric_key key1, key2; int cipher; } symmetric_xts; int xts_start(int cipher, const unsigned char *key1, const unsigned char *key2, unsigned long keylen, int num_rounds, symmetric_xts *xts); int xts_encrypt( const unsigned char *pt, unsigned long ptlen, unsigned char *ct, const unsigned char *tweak, symmetric_xts *xts); int xts_decrypt( const unsigned char *ct, unsigned long ptlen, unsigned char *pt, const unsigned char *tweak, symmetric_xts *xts); void xts_done(symmetric_xts *xts); int xts_test(void); void xts_mult_x(unsigned char *I); #endif int find_cipher(const char *name); int find_cipher_any(const char *name, int blocklen, int keylen); int find_cipher_id(unsigned char ID); int register_cipher(const struct ltc_cipher_descriptor *cipher); int unregister_cipher(const struct ltc_cipher_descriptor *cipher); int cipher_is_valid(int idx); LTC_MUTEX_PROTO(ltc_cipher_mutex) /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_cipher.h,v $ */ /* $Revision: 1.54 $ */ /* $Date: 2007/05/12 14:37:41 $ */ #define LTC_SHA1 /* ---- HASH FUNCTIONS ---- */ #ifdef LTC_SHA512 struct sha512_state { ulong64 length, state[8]; unsigned long curlen; unsigned char buf[128]; }; #endif #ifdef LTC_SHA256 struct sha256_state { ulong64 length; ulong32 state[8], curlen; unsigned char buf[64]; }; #endif #ifdef LTC_SHA1 struct sha1_state { ulong64 length; ulong32 state[5], curlen; unsigned char buf[64]; }; #endif #ifdef LTC_MD5 struct md5_state { ulong64 length; ulong32 state[4], curlen; unsigned char buf[64]; }; #endif #ifdef LTC_MD4 struct md4_state { ulong64 length; ulong32 state[4], curlen; unsigned char buf[64]; }; #endif #ifdef LTC_TIGER struct tiger_state { ulong64 state[3], length; unsigned long curlen; unsigned char buf[64]; }; #endif #ifdef LTC_MD2 struct md2_state { unsigned char chksum[16], X[48], buf[16]; unsigned long curlen; }; #endif #ifdef LTC_RIPEMD128 struct rmd128_state { ulong64 length; unsigned char buf[64]; ulong32 curlen, state[4]; }; #endif #ifdef LTC_RIPEMD160 struct rmd160_state { ulong64 length; unsigned char buf[64]; ulong32 curlen, state[5]; }; #endif #ifdef LTC_RIPEMD256 struct rmd256_state { ulong64 length; unsigned char buf[64]; ulong32 curlen, state[8]; }; #endif #ifdef LTC_RIPEMD320 struct rmd320_state { ulong64 length; unsigned char buf[64]; ulong32 curlen, state[10]; }; #endif #ifdef LTC_WHIRLPOOL struct whirlpool_state { ulong64 length, state[8]; unsigned char buf[64]; ulong32 curlen; }; #endif #ifdef LTC_CHC_HASH struct chc_state { ulong64 length; unsigned char state[MAXBLOCKSIZE], buf[MAXBLOCKSIZE]; ulong32 curlen; }; #endif typedef union Hash_state { char dummy[1]; #ifdef LTC_CHC_HASH struct chc_state chc; #endif #ifdef LTC_WHIRLPOOL struct whirlpool_state whirlpool; #endif #ifdef LTC_SHA512 struct sha512_state sha512; #endif #ifdef LTC_SHA256 struct sha256_state sha256; #endif #ifdef LTC_SHA1 struct sha1_state sha1; #endif #ifdef LTC_MD5 struct md5_state md5; #endif #ifdef LTC_MD4 struct md4_state md4; #endif #ifdef LTC_MD2 struct md2_state md2; #endif #ifdef LTC_TIGER struct tiger_state tiger; #endif #ifdef LTC_RIPEMD128 struct rmd128_state rmd128; #endif #ifdef LTC_RIPEMD160 struct rmd160_state rmd160; #endif #ifdef LTC_RIPEMD256 struct rmd256_state rmd256; #endif #ifdef LTC_RIPEMD320 struct rmd320_state rmd320; #endif void *data; } hash_state; /** hash descriptor */ extern struct ltc_hash_descriptor { /** name of hash */ char *name; /** internal ID */ unsigned char ID; /** Size of digest in octets */ unsigned long hashsize; /** Input block size in octets */ unsigned long blocksize; /** ASN.1 OID */ unsigned long OID[16]; /** Length of DER encoding */ unsigned long OIDlen; /** Init a hash state @param hash The hash to initialize @return CRYPT_OK if successful */ int (*init)(hash_state *hash); /** Process a block of data @param hash The hash state @param in The data to hash @param inlen The length of the data (octets) @return CRYPT_OK if successful */ int (*process)(hash_state *hash, const unsigned char *in, unsigned long inlen); /** Produce the digest and store it @param hash The hash state @param out [out] The destination of the digest @return CRYPT_OK if successful */ int (*done)(hash_state *hash, unsigned char *out); /** Self-test @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled */ int (*test)(void); /* accelerated hmac callback: if you need to-do multiple packets just use the generic hmac_memory and provide a hash callback */ int (*hmac_block)(const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); } hash_descriptor[]; #ifdef LTC_CHC_HASH int chc_register(int cipher); int chc_init(hash_state *md); int chc_process(hash_state *md, const unsigned char *in, unsigned long inlen); int chc_done(hash_state *md, unsigned char *hash); int chc_test(void); extern const struct ltc_hash_descriptor chc_desc; #endif #ifdef LTC_WHIRLPOOL int whirlpool_init(hash_state *md); int whirlpool_process(hash_state *md, const unsigned char *in, unsigned long inlen); int whirlpool_done(hash_state *md, unsigned char *hash); int whirlpool_test(void); extern const struct ltc_hash_descriptor whirlpool_desc; #endif #ifdef LTC_SHA512 int sha512_init(hash_state *md); int sha512_process(hash_state *md, const unsigned char *in, unsigned long inlen); int sha512_done(hash_state *md, unsigned char *hash); int sha512_test(void); extern const struct ltc_hash_descriptor sha512_desc; #endif #ifdef LTC_SHA384 #ifndef LTC_SHA512 #error LTC_SHA512 is required for LTC_SHA384 #endif int sha384_init(hash_state *md); #define sha384_process sha512_process int sha384_done(hash_state *md, unsigned char *hash); int sha384_test(void); extern const struct ltc_hash_descriptor sha384_desc; #endif #ifdef LTC_SHA256 int sha256_init(hash_state *md); int sha256_process(hash_state *md, const unsigned char *in, unsigned long inlen); int sha256_done(hash_state *md, unsigned char *hash); int sha256_test(void); extern const struct ltc_hash_descriptor sha256_desc; #ifdef LTC_SHA224 #ifndef LTC_SHA256 #error LTC_SHA256 is required for LTC_SHA224 #endif int sha224_init(hash_state *md); #define sha224_process sha256_process int sha224_done(hash_state *md, unsigned char *hash); int sha224_test(void); extern const struct ltc_hash_descriptor sha224_desc; #endif #endif #ifdef LTC_SHA1 int sha1_init(hash_state *md); int sha1_process(hash_state *md, const unsigned char *in, unsigned long inlen); int sha1_done(hash_state *md, unsigned char *hash); int sha1_test(void); extern const struct ltc_hash_descriptor sha1_desc; #endif #ifdef LTC_MD5 int md5_init(hash_state *md); int md5_process(hash_state *md, const unsigned char *in, unsigned long inlen); int md5_done(hash_state *md, unsigned char *hash); int md5_test(void); extern const struct ltc_hash_descriptor md5_desc; #endif #ifdef LTC_MD4 int md4_init(hash_state *md); int md4_process(hash_state *md, const unsigned char *in, unsigned long inlen); int md4_done(hash_state *md, unsigned char *hash); int md4_test(void); extern const struct ltc_hash_descriptor md4_desc; #endif #ifdef LTC_MD2 int md2_init(hash_state *md); int md2_process(hash_state *md, const unsigned char *in, unsigned long inlen); int md2_done(hash_state *md, unsigned char *hash); int md2_test(void); extern const struct ltc_hash_descriptor md2_desc; #endif #ifdef LTC_TIGER int tiger_init(hash_state *md); int tiger_process(hash_state *md, const unsigned char *in, unsigned long inlen); int tiger_done(hash_state *md, unsigned char *hash); int tiger_test(void); extern const struct ltc_hash_descriptor tiger_desc; #endif #ifdef LTC_RIPEMD128 int rmd128_init(hash_state *md); int rmd128_process(hash_state *md, const unsigned char *in, unsigned long inlen); int rmd128_done(hash_state *md, unsigned char *hash); int rmd128_test(void); extern const struct ltc_hash_descriptor rmd128_desc; #endif #ifdef LTC_RIPEMD160 int rmd160_init(hash_state *md); int rmd160_process(hash_state *md, const unsigned char *in, unsigned long inlen); int rmd160_done(hash_state *md, unsigned char *hash); int rmd160_test(void); extern const struct ltc_hash_descriptor rmd160_desc; #endif #ifdef LTC_RIPEMD256 int rmd256_init(hash_state *md); int rmd256_process(hash_state *md, const unsigned char *in, unsigned long inlen); int rmd256_done(hash_state *md, unsigned char *hash); int rmd256_test(void); extern const struct ltc_hash_descriptor rmd256_desc; #endif #ifdef LTC_RIPEMD320 int rmd320_init(hash_state *md); int rmd320_process(hash_state *md, const unsigned char *in, unsigned long inlen); int rmd320_done(hash_state *md, unsigned char *hash); int rmd320_test(void); extern const struct ltc_hash_descriptor rmd320_desc; #endif int find_hash(const char *name); int find_hash_id(unsigned char ID); int find_hash_oid(const unsigned long *ID, unsigned long IDlen); int find_hash_any(const char *name, int digestlen); int register_hash(const struct ltc_hash_descriptor *hash); int unregister_hash(const struct ltc_hash_descriptor *hash); int hash_is_valid(int idx); LTC_MUTEX_PROTO(ltc_hash_mutex) int hash_memory(int hash, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen); int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *outlen); /* a simple macro for making hash "process" functions */ #define HASH_PROCESS(func_name, compress_name, state_var, block_size) \ int func_name(hash_state * md, const unsigned char *in, unsigned long inlen) \ { \ unsigned long n; \ int err; \ LTC_ARGCHK(md != NULL); \ LTC_ARGCHK(in != NULL); \ if (md->state_var.curlen > sizeof(md->state_var.buf)) { \ return CRYPT_INVALID_ARG; \ } \ while (inlen > 0) { \ if (md->state_var.curlen == 0 && inlen >= block_size) { \ if ((err = compress_name(md, (unsigned char *)in)) != CRYPT_OK) { \ return err; \ } \ md->state_var.length += block_size * 8; \ in += block_size; \ inlen -= block_size; \ } else { \ n = MIN(inlen, (block_size - md->state_var.curlen)); \ memcpy(md->state_var.buf + md->state_var.curlen, in, (size_t)n); \ md->state_var.curlen += n; \ in += n; \ inlen -= n; \ if (md->state_var.curlen == block_size) { \ if ((err = compress_name(md, md->state_var.buf)) != CRYPT_OK) { \ return err; \ } \ md->state_var.length += 8 * block_size; \ md->state_var.curlen = 0; \ } \ } \ } \ return CRYPT_OK; \ } /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_hash.h,v $ */ /* $Revision: 1.22 $ */ /* $Date: 2007/05/12 14:32:35 $ */ #ifdef LTC_HMAC typedef struct Hmac_state { hash_state md; int hash; hash_state hashstate; unsigned char *key; } hmac_state; int hmac_init(hmac_state *hmac, int hash, const unsigned char *key, unsigned long keylen); int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen); int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen); int hmac_test(void); int hmac_memory(int hash, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int hmac_memory_multi(int hash, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); int hmac_file(int hash, const char *fname, const unsigned char *key, unsigned long keylen, unsigned char *dst, unsigned long *dstlen); #endif #ifdef LTC_OMAC typedef struct { int cipher_idx, buflen, blklen; unsigned char block[MAXBLOCKSIZE], prev[MAXBLOCKSIZE], Lu[2][MAXBLOCKSIZE]; symmetric_key key; } omac_state; int omac_init(omac_state *omac, int cipher, const unsigned char *key, unsigned long keylen); int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen); int omac_done(omac_state *omac, unsigned char *out, unsigned long *outlen); int omac_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int omac_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); int omac_file(int cipher, const unsigned char *key, unsigned long keylen, const char *filename, unsigned char *out, unsigned long *outlen); int omac_test(void); #endif /* LTC_OMAC */ #ifdef LTC_PMAC typedef struct { unsigned char Ls[32][MAXBLOCKSIZE], /* L shifted by i bits to the left */ Li[MAXBLOCKSIZE], /* value of Li [current value, we calc from previous recall] */ Lr[MAXBLOCKSIZE], /* L * x^-1 */ block[MAXBLOCKSIZE], /* currently accumulated block */ checksum[MAXBLOCKSIZE]; /* current checksum */ symmetric_key key; /* scheduled key for cipher */ unsigned long block_index; /* index # for current block */ int cipher_idx, /* cipher idx */ block_len, /* length of block */ buflen; /* number of bytes in the buffer */ } pmac_state; int pmac_init(pmac_state *pmac, int cipher, const unsigned char *key, unsigned long keylen); int pmac_process(pmac_state *pmac, const unsigned char *in, unsigned long inlen); int pmac_done(pmac_state *pmac, unsigned char *out, unsigned long *outlen); int pmac_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *msg, unsigned long msglen, unsigned char *out, unsigned long *outlen); int pmac_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); int pmac_file(int cipher, const unsigned char *key, unsigned long keylen, const char *filename, unsigned char *out, unsigned long *outlen); int pmac_test(void); /* internal functions */ int pmac_ntz(unsigned long x); void pmac_shift_xor(pmac_state *pmac); #endif /* PMAC */ #ifdef LTC_EAX_MODE #if !(defined(LTC_OMAC) && defined(LTC_CTR_MODE)) #error LTC_EAX_MODE requires LTC_OMAC and CTR #endif typedef struct { unsigned char N[MAXBLOCKSIZE]; symmetric_CTR ctr; omac_state headeromac, ctomac; } eax_state; int eax_init(eax_state *eax, int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *nonce, unsigned long noncelen, const unsigned char *header, unsigned long headerlen); int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct, unsigned long length); int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt, unsigned long length); int eax_addheader(eax_state *eax, const unsigned char *header, unsigned long length); int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen); int eax_encrypt_authenticate_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *nonce, unsigned long noncelen, const unsigned char *header, unsigned long headerlen, const unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tag, unsigned long *taglen); int eax_decrypt_verify_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *nonce, unsigned long noncelen, const unsigned char *header, unsigned long headerlen, const unsigned char *ct, unsigned long ctlen, unsigned char *pt, unsigned char *tag, unsigned long taglen, int *stat); int eax_test(void); #endif /* EAX MODE */ #ifdef LTC_OCB_MODE typedef struct { unsigned char L[MAXBLOCKSIZE], /* L value */ Ls[32][MAXBLOCKSIZE], /* L shifted by i bits to the left */ Li[MAXBLOCKSIZE], /* value of Li [current value, we calc from previous recall] */ Lr[MAXBLOCKSIZE], /* L * x^-1 */ R[MAXBLOCKSIZE], /* R value */ checksum[MAXBLOCKSIZE]; /* current checksum */ symmetric_key key; /* scheduled key for cipher */ unsigned long block_index; /* index # for current block */ int cipher, /* cipher idx */ block_len; /* length of block */ } ocb_state; int ocb_init(ocb_state *ocb, int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *nonce); int ocb_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned char *ct); int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt); int ocb_done_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tag, unsigned long *taglen); int ocb_done_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned long ctlen, unsigned char *pt, const unsigned char *tag, unsigned long taglen, int *stat); int ocb_encrypt_authenticate_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *nonce, const unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tag, unsigned long *taglen); int ocb_decrypt_verify_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *nonce, const unsigned char *ct, unsigned long ctlen, unsigned char *pt, const unsigned char *tag, unsigned long taglen, int *stat); int ocb_test(void); /* internal functions */ void ocb_shift_xor(ocb_state *ocb, unsigned char *Z); int ocb_ntz(unsigned long x); int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tag, unsigned long *taglen, int mode); #endif /* LTC_OCB_MODE */ #ifdef LTC_CCM_MODE #define CCM_ENCRYPT 0 #define CCM_DECRYPT 1 int ccm_memory(int cipher, const unsigned char *key, unsigned long keylen, symmetric_key *uskey, const unsigned char *nonce, unsigned long noncelen, const unsigned char *header, unsigned long headerlen, unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tag, unsigned long *taglen, int direction); int ccm_test(void); #endif /* LTC_CCM_MODE */ #if defined(LRW_MODE) || defined(LTC_GCM_MODE) void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c); #endif /* table shared between GCM and LRW */ #if defined(LTC_GCM_TABLES) || defined(LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST)) extern const unsigned char gcm_shift_table[]; #endif #ifdef LTC_GCM_MODE #define GCM_ENCRYPT 0 #define GCM_DECRYPT 1 #define LTC_GCM_MODE_IV 0 #define LTC_GCM_MODE_AAD 1 #define LTC_GCM_MODE_TEXT 2 typedef struct { symmetric_key K; unsigned char H[16], /* multiplier */ X[16], /* accumulator */ Y[16], /* counter */ Y_0[16], /* initial counter */ buf[16]; /* buffer for stuff */ int cipher, /* which cipher */ ivmode, /* Which mode is the IV in? */ mode, /* mode the GCM code is in */ buflen; /* length of data in buf */ ulong64 totlen, /* 64-bit counter used for IV and AAD */ pttotlen; /* 64-bit counter for the PT */ #ifdef LTC_GCM_TABLES unsigned char PC[16][256][16] /* 16 tables of 8x128 */ #ifdef LTC_GCM_TABLES_SSE2 __attribute__ ((aligned(16))) #endif ; #endif } gcm_state; void gcm_mult_h(gcm_state *gcm, unsigned char *I); int gcm_init(gcm_state *gcm, int cipher, const unsigned char *key, int keylen); int gcm_reset(gcm_state *gcm); int gcm_add_iv(gcm_state *gcm, const unsigned char *IV, unsigned long IVlen); int gcm_add_aad(gcm_state *gcm, const unsigned char *adata, unsigned long adatalen); int gcm_process(gcm_state *gcm, unsigned char *pt, unsigned long ptlen, unsigned char *ct, int direction); int gcm_done(gcm_state *gcm, unsigned char *tag, unsigned long *taglen); int gcm_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *IV, unsigned long IVlen, const unsigned char *adata, unsigned long adatalen, unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tag, unsigned long *taglen, int direction); int gcm_test(void); #endif /* LTC_GCM_MODE */ #ifdef LTC_PELICAN typedef struct pelican_state { symmetric_key K; unsigned char state[16]; int buflen; } pelican_state; int pelican_init(pelican_state *pelmac, const unsigned char *key, unsigned long keylen); int pelican_process(pelican_state *pelmac, const unsigned char *in, unsigned long inlen); int pelican_done(pelican_state *pelmac, unsigned char *out); int pelican_test(void); int pelican_memory(const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out); #endif #ifdef LTC_XCBC /* add this to "keylen" to xcbc_init to use a pure three-key XCBC MAC */ #define LTC_XCBC_PURE 0x8000UL typedef struct { unsigned char K[3][MAXBLOCKSIZE], IV[MAXBLOCKSIZE]; symmetric_key key; int cipher, buflen, blocksize; } xcbc_state; int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned long keylen); int xcbc_process(xcbc_state *xcbc, const unsigned char *in, unsigned long inlen); int xcbc_done(xcbc_state *xcbc, unsigned char *out, unsigned long *outlen); int xcbc_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int xcbc_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); int xcbc_file(int cipher, const unsigned char *key, unsigned long keylen, const char *filename, unsigned char *out, unsigned long *outlen); int xcbc_test(void); #endif #ifdef LTC_F9_MODE typedef struct { unsigned char akey[MAXBLOCKSIZE], ACC[MAXBLOCKSIZE], IV[MAXBLOCKSIZE]; symmetric_key key; int cipher, buflen, keylen, blocksize; } f9_state; int f9_init(f9_state *f9, int cipher, const unsigned char *key, unsigned long keylen); int f9_process(f9_state *f9, const unsigned char *in, unsigned long inlen); int f9_done(f9_state *f9, unsigned char *out, unsigned long *outlen); int f9_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int f9_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); int f9_file(int cipher, const unsigned char *key, unsigned long keylen, const char *filename, unsigned char *out, unsigned long *outlen); int f9_test(void); #endif /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_mac.h,v $ */ /* $Revision: 1.23 $ */ /* $Date: 2007/05/12 14:37:41 $ */ /* ---- PRNG Stuff ---- */ #ifdef LTC_YARROW struct yarrow_prng { int cipher, hash; unsigned char pool[MAXBLOCKSIZE]; symmetric_CTR ctr; LTC_MUTEX_TYPE(prng_lock) }; #endif #ifdef LTC_RC4 struct rc4_prng { int x, y; unsigned char buf[256]; }; #endif #ifdef LTC_FORTUNA struct fortuna_prng { hash_state pool[LTC_FORTUNA_POOLS]; /* the pools */ symmetric_key skey; unsigned char K[32], /* the current key */ IV[16]; /* IV for CTR mode */ unsigned long pool_idx, /* current pool we will add to */ pool0_len, /* length of 0'th pool */ wd; ulong64 reset_cnt; /* number of times we have reset */ LTC_MUTEX_TYPE(prng_lock) }; #endif #ifdef LTC_SOBER128 struct sober128_prng { ulong32 R[17], /* Working storage for the shift register */ initR[17], /* saved register contents */ konst, /* key dependent constant */ sbuf; /* partial word encryption buffer */ int nbuf, /* number of part-word stream bits buffered */ flag, /* first add_entropy call or not? */ set; /* did we call add_entropy to set key? */ }; #endif typedef union Prng_state { char dummy[1]; #ifdef LTC_YARROW struct yarrow_prng yarrow; #endif #ifdef LTC_RC4 struct rc4_prng rc4; #endif #ifdef LTC_FORTUNA struct fortuna_prng fortuna; #endif #ifdef LTC_SOBER128 struct sober128_prng sober128; #endif } prng_state; /** PRNG descriptor */ extern struct ltc_prng_descriptor { /** Name of the PRNG */ char *name; /** size in bytes of exported state */ int export_size; /** Start a PRNG state @param prng [out] The state to initialize @return CRYPT_OK if successful */ int (*start)(prng_state *prng); /** Add entropy to the PRNG @param in The entropy @param inlen Length of the entropy (octets)\ @param prng The PRNG state @return CRYPT_OK if successful */ int (*add_entropy)(const unsigned char *in, unsigned long inlen, prng_state *prng); /** Ready a PRNG state to read from @param prng The PRNG state to ready @return CRYPT_OK if successful */ int (*ready)(prng_state *prng); /** Read from the PRNG @param out [out] Where to store the data @param outlen Length of data desired (octets) @param prng The PRNG state to read from @return Number of octets read */ unsigned long (*read)(unsigned char *out, unsigned long outlen, prng_state *prng); /** Terminate a PRNG state @param prng The PRNG state to terminate @return CRYPT_OK if successful */ int (*done)(prng_state *prng); /** Export a PRNG state @param out [out] The destination for the state @param outlen [in/out] The max size and resulting size of the PRNG state @param prng The PRNG to export @return CRYPT_OK if successful */ int (*pexport)(unsigned char *out, unsigned long *outlen, prng_state *prng); /** Import a PRNG state @param in The data to import @param inlen The length of the data to import (octets) @param prng The PRNG to initialize/import @return CRYPT_OK if successful */ int (*pimport)(const unsigned char *in, unsigned long inlen, prng_state *prng); /** Self-test the PRNG @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled */ int (*test)(void); } prng_descriptor[]; #ifdef LTC_YARROW int yarrow_start(prng_state *prng); int yarrow_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); int yarrow_ready(prng_state *prng); unsigned long yarrow_read(unsigned char *out, unsigned long outlen, prng_state *prng); int yarrow_done(prng_state *prng); int yarrow_export(unsigned char *out, unsigned long *outlen, prng_state *prng); int yarrow_import(const unsigned char *in, unsigned long inlen, prng_state *prng); int yarrow_test(void); extern const struct ltc_prng_descriptor yarrow_desc; #endif #ifdef LTC_FORTUNA int fortuna_start(prng_state *prng); int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); int fortuna_ready(prng_state *prng); unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state *prng); int fortuna_done(prng_state *prng); int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng); int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prng); int fortuna_test(void); extern const struct ltc_prng_descriptor fortuna_desc; #endif #ifdef LTC_RC4 int rc4_start(prng_state *prng); int rc4_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); int rc4_ready(prng_state *prng); unsigned long rc4_read(unsigned char *out, unsigned long outlen, prng_state *prng); int rc4_done(prng_state *prng); int rc4_export(unsigned char *out, unsigned long *outlen, prng_state *prng); int rc4_import(const unsigned char *in, unsigned long inlen, prng_state *prng); int rc4_test(void); extern const struct ltc_prng_descriptor rc4_desc; #endif #ifdef LTC_SPRNG int sprng_start(prng_state *prng); int sprng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); int sprng_ready(prng_state *prng); unsigned long sprng_read(unsigned char *out, unsigned long outlen, prng_state *prng); int sprng_done(prng_state *prng); int sprng_export(unsigned char *out, unsigned long *outlen, prng_state *prng); int sprng_import(const unsigned char *in, unsigned long inlen, prng_state *prng); int sprng_test(void); extern const struct ltc_prng_descriptor sprng_desc; #endif #ifdef LTC_SOBER128 int sober128_start(prng_state *prng); int sober128_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); int sober128_ready(prng_state *prng); unsigned long sober128_read(unsigned char *out, unsigned long outlen, prng_state *prng); int sober128_done(prng_state *prng); int sober128_export(unsigned char *out, unsigned long *outlen, prng_state *prng); int sober128_import(const unsigned char *in, unsigned long inlen, prng_state *prng); int sober128_test(void); extern const struct ltc_prng_descriptor sober128_desc; #endif int find_prng(const char *name); int register_prng(const struct ltc_prng_descriptor *prng); int unregister_prng(const struct ltc_prng_descriptor *prng); int prng_is_valid(int idx); LTC_MUTEX_PROTO(ltc_prng_mutex) /* Slow RNG you **might** be able to use to seed a PRNG with. Be careful as this * might not work on all platforms as planned */ unsigned long rng_get_bytes(unsigned char *out, unsigned long outlen, void ( *callback)(void)); int rng_make_prng(int bits, int wprng, prng_state *prng, void (*callback)(void)); /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_prng.h,v $ */ /* $Revision: 1.9 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* ---- NUMBER THEORY ---- */ enum { PK_PUBLIC =0, PK_PRIVATE=1 }; int rand_prime(void *N, long len, prng_state *prng, int wprng); /* ---- RSA ---- */ #ifdef LTC_MRSA /* Min and Max RSA key sizes (in bits) */ #define MIN_RSA_SIZE 1024 #define MAX_RSA_SIZE 4096 /** RSA LTC_PKCS style key */ typedef struct Rsa_key { /** Type of key, PK_PRIVATE or PK_PUBLIC */ int type; /** The public exponent */ void *e; /** The private exponent */ void *d; /** The modulus */ void *N; /** The p factor of N */ void *p; /** The q factor of N */ void *q; /** The 1/q mod p CRT param */ void *qP; /** The d mod (p - 1) CRT param */ void *dP; /** The d mod (q - 1) CRT param */ void *dQ; } rsa_key; int rsa_make_key(prng_state *prng, int wprng, int size, long e, rsa_key *key); int rsa_exptmod(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, int which, rsa_key *key); void rsa_free(rsa_key *key); /* These use LTC_PKCS #1 v2.0 padding */ #define rsa_encrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, _key) \ rsa_encrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, LTC_LTC_PKCS_1_OAEP, _key) #define rsa_decrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, _stat, _key) \ rsa_decrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, LTC_LTC_PKCS_1_OAEP, _stat, _key) #define rsa_sign_hash(_in, _inlen, _out, _outlen, _prng, _prng_idx, _hash_idx, _saltlen, _key) \ rsa_sign_hash_ex(_in, _inlen, _out, _outlen, LTC_LTC_PKCS_1_PSS, _prng, _prng_idx, _hash_idx, _saltlen, _key) #define rsa_verify_hash(_sig, _siglen, _hash, _hashlen, _hash_idx, _saltlen, _stat, _key) \ rsa_verify_hash_ex(_sig, _siglen, _hash, _hashlen, LTC_LTC_PKCS_1_PSS, _hash_idx, _saltlen, _stat, _key) /* These can be switched between LTC_PKCS #1 v2.x and LTC_PKCS #1 v1.5 paddings */ int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, const unsigned char *lparam, unsigned long lparamlen, prng_state *prng, int prng_idx, int hash_idx, int padding, rsa_key *key); int rsa_decrypt_key_ex(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, const unsigned char *lparam, unsigned long lparamlen, int hash_idx, int padding, int *stat, rsa_key *key); int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, int padding, prng_state *prng, int prng_idx, int hash_idx, unsigned long saltlen, rsa_key *key); int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen, const unsigned char *hash, unsigned long hashlen, int padding, int hash_idx, unsigned long saltlen, int *stat, rsa_key *key); /* LTC_PKCS #1 import/export */ int rsa_export(unsigned char *out, unsigned long *outlen, int type, rsa_key *key); int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key); #endif /* ---- Katja ---- */ #ifdef MKAT /* Min and Max KAT key sizes (in bits) */ #define MIN_KAT_SIZE 1024 #define MAX_KAT_SIZE 4096 /** Katja LTC_PKCS style key */ typedef struct KAT_key { /** Type of key, PK_PRIVATE or PK_PUBLIC */ int type; /** The private exponent */ void *d; /** The modulus */ void *N; /** The p factor of N */ void *p; /** The q factor of N */ void *q; /** The 1/q mod p CRT param */ void *qP; /** The d mod (p - 1) CRT param */ void *dP; /** The d mod (q - 1) CRT param */ void *dQ; /** The pq param */ void *pq; } katja_key; int katja_make_key(prng_state *prng, int wprng, int size, katja_key *key); int katja_exptmod(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, int which, katja_key *key); void katja_free(katja_key *key); /* These use LTC_PKCS #1 v2.0 padding */ int katja_encrypt_key(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, const unsigned char *lparam, unsigned long lparamlen, prng_state *prng, int prng_idx, int hash_idx, katja_key *key); int katja_decrypt_key(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, const unsigned char *lparam, unsigned long lparamlen, int hash_idx, int *stat, katja_key *key); /* LTC_PKCS #1 import/export */ int katja_export(unsigned char *out, unsigned long *outlen, int type, katja_key *key); int katja_import(const unsigned char *in, unsigned long inlen, katja_key *key); #endif /* ---- ECC Routines ---- */ #ifdef LTC_MECC /* size of our temp buffers for exported keys */ #define ECC_BUF_SIZE 256 /* max private key size */ #define ECC_MAXSIZE 66 /** Structure defines a NIST GF(p) curve */ typedef struct { /** The size of the curve in octets */ int size; /** name of curve */ char *name; /** The prime that defines the field the curve is in (encoded in hex) */ char *prime; /** The fields B param (hex) */ char *B; /** The order of the curve (hex) */ char *order; /** The x co-ordinate of the base point on the curve (hex) */ char *Gx; /** The y co-ordinate of the base point on the curve (hex) */ char *Gy; } ltc_ecc_set_type; /** A point on a ECC curve, stored in Jacbobian format such that (x,y,z) => (x/z^2, y/z^3, 1) when interpretted as affine */ typedef struct { /** The x co-ordinate */ void *x; /** The y co-ordinate */ void *y; /** The z co-ordinate */ void *z; } ecc_point; /** An ECC key */ typedef struct { /** Type of key, PK_PRIVATE or PK_PUBLIC */ int type; /** Index into the ltc_ecc_sets[] for the parameters of this curve; if -1, then this key is using user supplied curve in dp */ int idx; /** pointer to domain parameters; either points to NIST curves (identified by idx >= 0) or user supplied curve */ const ltc_ecc_set_type *dp; /** The public key */ ecc_point pubkey; /** The private key */ void *k; } ecc_key; /** the ECC params provided */ extern const ltc_ecc_set_type ltc_ecc_sets[]; int ecc_test(void); void ecc_sizes(int *low, int *high); int ecc_get_size(ecc_key *key); int ecc_make_key(prng_state *prng, int wprng, int keysize, ecc_key *key); int ecc_make_key_ex(prng_state *prng, int wprng, ecc_key *key, const ltc_ecc_set_type *dp); void ecc_free(ecc_key *key); int ecc_export(unsigned char *out, unsigned long *outlen, int type, ecc_key *key); int ecc_import(const unsigned char *in, unsigned long inlen, ecc_key *key); int ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, const ltc_ecc_set_type *dp); int ecc_ansi_x963_export(ecc_key *key, unsigned char *out, unsigned long *outlen); int ecc_ansi_x963_import(const unsigned char *in, unsigned long inlen, ecc_key *key); int ecc_ansi_x963_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, ltc_ecc_set_type *dp); int ecc_shared_secret(ecc_key *private_key, ecc_key *public_key, unsigned char *out, unsigned long *outlen); int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, prng_state *prng, int wprng, int hash, ecc_key *key); int ecc_decrypt_key(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, ecc_key *key); int ecc_sign_hash(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, prng_state *prng, int wprng, ecc_key *key); int ecc_verify_hash(const unsigned char *sig, unsigned long siglen, const unsigned char *hash, unsigned long hashlen, int *stat, ecc_key *key); /* low level functions */ ecc_point *ltc_ecc_new_point(void); void ltc_ecc_del_point(ecc_point *p); int ltc_ecc_is_valid_idx(int n); /* point ops (mp == montgomery digit) */ #if !defined(LTC_MECC_ACCEL) || defined(LTM_LTC_DESC) || defined(GMP_LTC_DESC) /* R = 2P */ int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void *mp); /* R = P + Q */ int ltc_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *mp); #endif #if defined(LTC_MECC_FP) /* optimized point multiplication using fixed point cache (HAC algorithm 14.117) */ int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map); /* functions for saving/loading/freeing/adding to fixed point cache */ int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen); int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen); void ltc_ecc_fp_free(void); int ltc_ecc_fp_add_point(ecc_point *g, void *modulus, int lock); /* lock/unlock all points currently in fixed point cache */ void ltc_ecc_fp_tablelock(int lock); #endif /* R = kG */ int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map); #ifdef LTC_ECC_SHAMIR /* kA*A + kB*B = C */ int ltc_ecc_mul2add(ecc_point *A, void *kA, ecc_point *B, void *kB, ecc_point *C, void *modulus); #ifdef LTC_MECC_FP /* Shamir's trick with optimized point multiplication using fixed point cache */ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, ecc_point *B, void *kB, ecc_point *C, void *modulus); #endif #endif /* map P to affine from projective */ int ltc_ecc_map(ecc_point *P, void *modulus, void *mp); #endif #ifdef LTC_MDSA /* Max diff between group and modulus size in bytes */ #define LTC_MDSA_DELTA 512 /* Max DSA group size in bytes (default allows 4k-bit groups) */ #define LTC_MDSA_MAX_GROUP 512 /** DSA key structure */ typedef struct { /** The key type, PK_PRIVATE or PK_PUBLIC */ int type; /** The order of the sub-group used in octets */ int qord; /** The generator */ void *g; /** The prime used to generate the sub-group */ void *q; /** The large prime that generats the field the contains the sub-group */ void *p; /** The private key */ void *x; /** The public key */ void *y; } dsa_key; int dsa_make_key(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key); void dsa_free(dsa_key *key); int dsa_sign_hash_raw(const unsigned char *in, unsigned long inlen, void *r, void *s, prng_state *prng, int wprng, dsa_key *key); int dsa_sign_hash(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, prng_state *prng, int wprng, dsa_key *key); int dsa_verify_hash_raw(void *r, void *s, const unsigned char *hash, unsigned long hashlen, int *stat, dsa_key *key); int dsa_verify_hash(const unsigned char *sig, unsigned long siglen, const unsigned char *hash, unsigned long hashlen, int *stat, dsa_key *key); int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, prng_state *prng, int wprng, int hash, dsa_key *key); int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, dsa_key *key); int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key); int dsa_export(unsigned char *out, unsigned long *outlen, int type, dsa_key *key); int dsa_verify_key(dsa_key *key, int *stat); int dsa_shared_secret(void *private_key, void *base, dsa_key *public_key, unsigned char *out, unsigned long *outlen); #endif #ifdef LTC_DER /* DER handling */ enum { LTC_ASN1_EOL, LTC_ASN1_BOOLEAN, LTC_ASN1_INTEGER, LTC_ASN1_SHORT_INTEGER, LTC_ASN1_BIT_STRING, LTC_ASN1_OCTET_STRING, LTC_ASN1_NULL, LTC_ASN1_OBJECT_IDENTIFIER, LTC_ASN1_IA5_STRING, LTC_ASN1_PRINTABLE_STRING, LTC_ASN1_UTF8_STRING, LTC_ASN1_UTCTIME, LTC_ASN1_CHOICE, LTC_ASN1_SEQUENCE, LTC_ASN1_SET, LTC_ASN1_SETOF }; /** A LTC ASN.1 list type */ typedef struct ltc_asn1_list_ { /** The LTC ASN.1 enumerated type identifier */ int type; /** The data to encode or place for decoding */ void *data; /** The size of the input or resulting output */ unsigned long size; /** The used flag, this is used by the CHOICE ASN.1 type to indicate which choice was made */ int used; /** prev/next entry in the list */ struct ltc_asn1_list_ *prev, *next, *child, *parent; } ltc_asn1_list; #define LTC_SET_ASN1(list, index, Type, Data, Size) \ do { \ int LTC_MACRO_temp = (index); \ ltc_asn1_list *LTC_MACRO_list = (list); \ LTC_MACRO_list[LTC_MACRO_temp].type = (Type); \ LTC_MACRO_list[LTC_MACRO_temp].data = (void *)(Data); \ LTC_MACRO_list[LTC_MACRO_temp].size = (Size); \ LTC_MACRO_list[LTC_MACRO_temp].used = 0; \ } while (0); /* SEQUENCE */ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, unsigned char *out, unsigned long *outlen, int type_of); #define der_encode_sequence(list, inlen, out, outlen) der_encode_sequence_ex(list, inlen, out, outlen, LTC_ASN1_SEQUENCE) int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, ltc_asn1_list *list, unsigned long outlen, int ordered); #define der_decode_sequence(in, inlen, list, outlen) der_decode_sequence_ex(in, inlen, list, outlen, 1) int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, unsigned long *outlen); /* SET */ #define der_decode_set(in, inlen, list, outlen) der_decode_sequence_ex(in, inlen, list, outlen, 0) #define der_length_set der_length_sequence int der_encode_set(ltc_asn1_list *list, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_encode_setof(ltc_asn1_list *list, unsigned long inlen, unsigned char *out, unsigned long *outlen); /* VA list handy helpers with triplets of */ int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...); int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...); /* FLEXI DECODER handle unknown list decoder */ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc_asn1_list **out); void der_free_sequence_flexi(ltc_asn1_list *list); void der_sequence_free(ltc_asn1_list *in); /* BOOLEAN */ int der_length_boolean(unsigned long *outlen); int der_encode_boolean(int in, unsigned char *out, unsigned long *outlen); int der_decode_boolean(const unsigned char *in, unsigned long inlen, int *out); /* INTEGER */ int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen); int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num); int der_length_integer(void *num, unsigned long *len); /* INTEGER -- handy for 0..2^32-1 values */ int der_decode_short_integer(const unsigned char *in, unsigned long inlen, unsigned long *num); int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned long *outlen); int der_length_short_integer(unsigned long num, unsigned long *outlen); /* BIT STRING */ int der_encode_bit_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_decode_bit_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_length_bit_string(unsigned long nbits, unsigned long *outlen); /* OCTET STRING */ int der_encode_octet_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_decode_octet_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_length_octet_string(unsigned long noctets, unsigned long *outlen); /* OBJECT IDENTIFIER */ int der_encode_object_identifier(unsigned long *words, unsigned long nwords, unsigned char *out, unsigned long *outlen); int der_decode_object_identifier(const unsigned char *in, unsigned long inlen, unsigned long *words, unsigned long *outlen); int der_length_object_identifier(unsigned long *words, unsigned long nwords, unsigned long *outlen); unsigned long der_object_identifier_bits(unsigned long x); /* IA5 STRING */ int der_encode_ia5_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_decode_ia5_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_length_ia5_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen); int der_ia5_char_encode(int c); int der_ia5_value_decode(int v); /* Printable STRING */ int der_encode_printable_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_decode_printable_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_length_printable_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen); int der_printable_char_encode(int c); int der_printable_value_decode(int v); /* UTF-8 */ #if (defined(SIZE_MAX) || __STDC_VERSION__ >= 199901L || defined(WCHAR_MAX) || defined(_WCHAR_T) || defined(_WCHAR_T_DEFINED) || defined (__WCHAR_TYPE__)) && !defined(LTC_NO_WCHAR) #include #else typedef ulong32 wchar_t; #endif int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, wchar_t *out, unsigned long *outlen); unsigned long der_utf8_charsize(const wchar_t c); int der_length_utf8_string(const wchar_t *in, unsigned long noctets, unsigned long *outlen); /* CHOICE */ int der_decode_choice(const unsigned char *in, unsigned long *inlen, ltc_asn1_list *list, unsigned long outlen); /* UTCTime */ typedef struct { unsigned YY, /* year */ MM, /* month */ DD, /* day */ hh, /* hour */ mm, /* minute */ ss, /* second */ off_dir, /* timezone offset direction 0 == +, 1 == - */ off_hh, /* timezone offset hours */ off_mm; /* timezone offset minutes */ } ltc_utctime; int der_encode_utctime(ltc_utctime *utctime, unsigned char *out, unsigned long *outlen); int der_decode_utctime(const unsigned char *in, unsigned long *inlen, ltc_utctime *out); int der_length_utctime(ltc_utctime *utctime, unsigned long *outlen); #endif /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_pk.h,v $ */ /* $Revision: 1.81 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /** math functions **/ #define LTC_SOURCE #define LTC_MP_LT -1 #define LTC_MP_EQ 0 #define LTC_MP_GT 1 #define LTC_MP_NO 0 #define LTC_MP_YES 1 #ifndef LTC_MECC typedef void ecc_point; #endif #ifndef LTC_MRSA typedef void rsa_key; #endif /** math descriptor */ typedef struct { /** Name of the math provider */ char *name; /** Bits per digit, amount of bits must fit in an unsigned long */ int bits_per_digit; /* ---- init/deinit functions ---- */ /** initialize a bignum @param a The number to initialize @return CRYPT_OK on success */ int (*init)(void **a); /** init copy @param dst The number to initialize and write to @param src The number to copy from @return CRYPT_OK on success */ int (*init_copy)(void **dst, void *src); /** deinit @param a The number to free @return CRYPT_OK on success */ void (*deinit)(void *a); /* ---- data movement ---- */ /** negate @param src The number to negate @param dst The destination @return CRYPT_OK on success */ int (*neg)(void *src, void *dst); /** copy @param src The number to copy from @param dst The number to write to @return CRYPT_OK on success */ int (*copy)(void *src, void *dst); /* ---- trivial low level functions ---- */ /** set small constant @param a Number to write to @param n Source upto bits_per_digit (actually meant for very small constants) @return CRYPT_OK on succcess */ int (*set_int)(void *a, unsigned long n); /** get small constant @param a Number to read, only fetches upto bits_per_digit from the number @return The lower bits_per_digit of the integer (unsigned) */ unsigned long (*get_int)(void *a); /** get digit n @param a The number to read from @param n The number of the digit to fetch @return The bits_per_digit sized n'th digit of a */ unsigned long (*get_digit)(void *a, int n); /** Get the number of digits that represent the number @param a The number to count @return The number of digits used to represent the number */ int (*get_digit_count)(void *a); /** compare two integers @param a The left side integer @param b The right side integer @return LTC_MP_LT if a < b, LTC_MP_GT if a > b and LTC_MP_EQ otherwise. (signed comparison) */ int (*compare)(void *a, void *b); /** compare against int @param a The left side integer @param b The right side integer (upto bits_per_digit) @return LTC_MP_LT if a < b, LTC_MP_GT if a > b and LTC_MP_EQ otherwise. (signed comparison) */ int (*compare_d)(void *a, unsigned long n); /** Count the number of bits used to represent the integer @param a The integer to count @return The number of bits required to represent the integer */ int (*count_bits)(void *a); /** Count the number of LSB bits which are zero @param a The integer to count @return The number of contiguous zero LSB bits */ int (*count_lsb_bits)(void *a); /** Compute a power of two @param a The integer to store the power in @param n The power of two you want to store (a = 2^n) @return CRYPT_OK on success */ int (*twoexpt)(void *a, int n); /* ---- radix conversions ---- */ /** read ascii string @param a The integer to store into @param str The string to read @param radix The radix the integer has been represented in (2-64) @return CRYPT_OK on success */ int (*read_radix)(void *a, const char *str, int radix); /** write number to string @param a The integer to store @param str The destination for the string @param radix The radix the integer is to be represented in (2-64) @return CRYPT_OK on success */ int (*write_radix)(void *a, char *str, int radix); /** get size as unsigned char string @param a The integer to get the size (when stored in array of octets) @return The length of the integer */ unsigned long (*unsigned_size)(void *a); /** store an integer as an array of octets @param src The integer to store @param dst The buffer to store the integer in @return CRYPT_OK on success */ int (*unsigned_write)(void *src, unsigned char *dst); /** read an array of octets and store as integer @param dst The integer to load @param src The array of octets @param len The number of octets @return CRYPT_OK on success */ int (*unsigned_read)(void *dst, unsigned char *src, unsigned long len); /* ---- basic math ---- */ /** add two integers @param a The first source integer @param b The second source integer @param c The destination of "a + b" @return CRYPT_OK on success */ int (*add)(void *a, void *b, void *c); /** add two integers @param a The first source integer @param b The second source integer (single digit of upto bits_per_digit in length) @param c The destination of "a + b" @return CRYPT_OK on success */ int (*addi)(void *a, unsigned long b, void *c); /** subtract two integers @param a The first source integer @param b The second source integer @param c The destination of "a - b" @return CRYPT_OK on success */ int (*sub)(void *a, void *b, void *c); /** subtract two integers @param a The first source integer @param b The second source integer (single digit of upto bits_per_digit in length) @param c The destination of "a - b" @return CRYPT_OK on success */ int (*subi)(void *a, unsigned long b, void *c); /** multiply two integers @param a The first source integer @param b The second source integer (single digit of upto bits_per_digit in length) @param c The destination of "a * b" @return CRYPT_OK on success */ int (*mul)(void *a, void *b, void *c); /** multiply two integers @param a The first source integer @param b The second source integer (single digit of upto bits_per_digit in length) @param c The destination of "a * b" @return CRYPT_OK on success */ int (*muli)(void *a, unsigned long b, void *c); /** Square an integer @param a The integer to square @param b The destination @return CRYPT_OK on success */ int (*sqr)(void *a, void *b); /** Divide an integer @param a The dividend @param b The divisor @param c The quotient (can be NULL to signify don't care) @param d The remainder (can be NULL to signify don't care) @return CRYPT_OK on success */ int (*mpdiv)(void *a, void *b, void *c, void *d); /** divide by two @param a The integer to divide (shift right) @param b The destination @return CRYPT_OK on success */ int (*div_2)(void *a, void *b); /** Get remainder (small value) @param a The integer to reduce @param b The modulus (upto bits_per_digit in length) @param c The destination for the residue @return CRYPT_OK on success */ int (*modi)(void *a, unsigned long b, unsigned long *c); /** gcd @param a The first integer @param b The second integer @param c The destination for (a, b) @return CRYPT_OK on success */ int (*gcd)(void *a, void *b, void *c); /** lcm @param a The first integer @param b The second integer @param c The destination for [a, b] @return CRYPT_OK on success */ int (*lcm)(void *a, void *b, void *c); /** Modular multiplication @param a The first source @param b The second source @param c The modulus @param d The destination (a*b mod c) @return CRYPT_OK on success */ int (*mulmod)(void *a, void *b, void *c, void *d); /** Modular squaring @param a The first source @param b The modulus @param c The destination (a*a mod b) @return CRYPT_OK on success */ int (*sqrmod)(void *a, void *b, void *c); /** Modular inversion @param a The value to invert @param b The modulus @param c The destination (1/a mod b) @return CRYPT_OK on success */ int (*invmod)(void *, void *, void *); /* ---- reduction ---- */ /** setup montgomery @param a The modulus @param b The destination for the reduction digit @return CRYPT_OK on success */ int (*montgomery_setup)(void *a, void **b); /** get normalization value @param a The destination for the normalization value @param b The modulus @return CRYPT_OK on success */ int (*montgomery_normalization)(void *a, void *b); /** reduce a number @param a The number [and dest] to reduce @param b The modulus @param c The value "b" from montgomery_setup() @return CRYPT_OK on success */ int (*montgomery_reduce)(void *a, void *b, void *c); /** clean up (frees memory) @param a The value "b" from montgomery_setup() @return CRYPT_OK on success */ void (*montgomery_deinit)(void *a); /* ---- exponentiation ---- */ /** Modular exponentiation @param a The base integer @param b The power (can be negative) integer @param c The modulus integer @param d The destination @return CRYPT_OK on success */ int (*exptmod)(void *a, void *b, void *c, void *d); /** Primality testing @param a The integer to test @param b The destination of the result (FP_YES if prime) @return CRYPT_OK on success */ int (*isprime)(void *a, int *b); /* ---- (optional) ecc point math ---- */ /** ECC GF(p) point multiplication (from the NIST curves) @param k The integer to multiply the point by @param G The point to multiply @param R The destination for kG @param modulus The modulus for the field @param map Boolean indicated whether to map back to affine or not (can be ignored if you work in affine only) @return CRYPT_OK on success */ int (*ecc_ptmul)(void *k, ecc_point *G, ecc_point *R, void *modulus, int map); /** ECC GF(p) point addition @param P The first point @param Q The second point @param R The destination of P + Q @param modulus The modulus @param mp The "b" value from montgomery_setup() @return CRYPT_OK on success */ int (*ecc_ptadd)(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *mp); /** ECC GF(p) point double @param P The first point @param R The destination of 2P @param modulus The modulus @param mp The "b" value from montgomery_setup() @return CRYPT_OK on success */ int (*ecc_ptdbl)(ecc_point *P, ecc_point *R, void *modulus, void *mp); /** ECC mapping from projective to affine, currently uses (x,y,z) => (x/z^2, y/z^3, 1) @param P The point to map @param modulus The modulus @param mp The "b" value from montgomery_setup() @return CRYPT_OK on success @remark The mapping can be different but keep in mind a ecc_point only has three integers (x,y,z) so if you use a different mapping you have to make it fit. */ int (*ecc_map)(ecc_point *P, void *modulus, void *mp); /** Computes kA*A + kB*B = C using Shamir's Trick @param A First point to multiply @param kA What to multiple A by @param B Second point to multiply @param kB What to multiple B by @param C [out] Destination point (can overlap with A or B @param modulus Modulus for curve @return CRYPT_OK on success */ int (*ecc_mul2add)(ecc_point *A, void *kA, ecc_point *B, void *kB, ecc_point *C, void *modulus); /* ---- (optional) rsa optimized math (for internal CRT) ---- */ /** RSA Key Generation @param prng An active PRNG state @param wprng The index of the PRNG desired @param size The size of the modulus (key size) desired (octets) @param e The "e" value (public key). e==65537 is a good choice @param key [out] Destination of a newly created private key pair @return CRYPT_OK if successful, upon error all allocated ram is freed */ int (*rsa_keygen)(prng_state *prng, int wprng, int size, long e, rsa_key *key); /** RSA exponentiation @param in The octet array representing the base @param inlen The length of the input @param out The destination (to be stored in an octet array format) @param outlen The length of the output buffer and the resulting size (zero padded to the size of the modulus) @param which PK_PUBLIC for public RSA and PK_PRIVATE for private RSA @param key The RSA key to use @return CRYPT_OK on success */ int (*rsa_me)(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, int which, rsa_key *key); } ltc_math_descriptor; extern ltc_math_descriptor ltc_mp; int ltc_init_multi(void **a, ...); void ltc_deinit_multi(void *a, ...); #ifdef LTM_DESC extern const ltc_math_descriptor ltm_desc; #endif #ifdef TFM_DESC extern const ltc_math_descriptor tfm_desc; #endif #ifdef GMP_DESC extern const ltc_math_descriptor gmp_desc; #endif #if !defined(DESC_DEF_ONLY) && defined(LTC_SOURCE) #undef MP_DIGIT_BIT #undef mp_iszero #undef mp_isodd #undef mp_tohex #define MP_DIGIT_BIT ltc_mp.bits_per_digit /* some handy macros */ #define mp_init(a) ltc_mp.init(a) #define mp_init_multi ltc_init_multi #define mp_clear(a) ltc_mp.deinit(a) #define mp_clear_multi ltc_deinit_multi #define mp_init_copy(a, b) ltc_mp.init_copy(a, b) #define mp_neg(a, b) ltc_mp.neg(a, b) #define mp_copy(a, b) ltc_mp.copy(a, b) #define mp_set(a, b) ltc_mp.set_int(a, b) #define mp_set_int(a, b) ltc_mp.set_int(a, b) #define mp_get_int(a) ltc_mp.get_int(a) #define mp_get_digit(a, n) ltc_mp.get_digit(a, n) #define mp_get_digit_count(a) ltc_mp.get_digit_count(a) #define mp_cmp(a, b) ltc_mp.compare(a, b) #define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) #define mp_count_bits(a) ltc_mp.count_bits(a) #define mp_cnt_lsb(a) ltc_mp.count_lsb_bits(a) #define mp_2expt(a, b) ltc_mp.twoexpt(a, b) #define mp_read_radix(a, b, c) ltc_mp.read_radix(a, b, c) #define mp_toradix(a, b, c) ltc_mp.write_radix(a, b, c) #define mp_unsigned_bin_size(a) ltc_mp.unsigned_size(a) #define mp_to_unsigned_bin(a, b) ltc_mp.unsigned_write(a, b) #define mp_read_unsigned_bin(a, b, c) ltc_mp.unsigned_read(a, b, c) #define mp_add(a, b, c) ltc_mp.add(a, b, c) #define mp_add_d(a, b, c) ltc_mp.addi(a, b, c) #define mp_sub(a, b, c) ltc_mp.sub(a, b, c) #define mp_sub_d(a, b, c) ltc_mp.subi(a, b, c) #define mp_mul(a, b, c) ltc_mp.mul(a, b, c) #define mp_mul_d(a, b, c) ltc_mp.muli(a, b, c) #define mp_sqr(a, b) ltc_mp.sqr(a, b) #define mp_div(a, b, c, d) ltc_mp.mpdiv(a, b, c, d) #define mp_div_2(a, b) ltc_mp.div_2(a, b) #define mp_mod(a, b, c) ltc_mp.mpdiv(a, b, NULL, c) #define mp_mod_d(a, b, c) ltc_mp.modi(a, b, c) #define mp_gcd(a, b, c) ltc_mp.gcd(a, b, c) #define mp_lcm(a, b, c) ltc_mp.lcm(a, b, c) #define mp_mulmod(a, b, c, d) ltc_mp.mulmod(a, b, c, d) #define mp_sqrmod(a, b, c) ltc_mp.sqrmod(a, b, c) #define mp_invmod(a, b, c) ltc_mp.invmod(a, b, c) #define mp_montgomery_setup(a, b) ltc_mp.montgomery_setup(a, b) #define mp_montgomery_normalization(a, b) ltc_mp.montgomery_normalization(a, b) #define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) #define mp_montgomery_free(a) ltc_mp.montgomery_deinit(a) #define mp_exptmod(a, b, c, d) ltc_mp.exptmod(a, b, c, d) #define mp_prime_is_prime(a, b, c) ltc_mp.isprime(a, c) #define mp_iszero(a) (mp_cmp_d(a, 0) == LTC_MP_EQ ? LTC_MP_YES : LTC_MP_NO) #define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) #define mp_exch(a, b) do { void *ABC__tmp = a; a = b; b = ABC__tmp; } while (0); #define mp_tohex(a, b) mp_toradix(a, b, 16) #endif /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_math.h,v $ */ /* $Revision: 1.44 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* ---- LTC_BASE64 Routines ---- */ #ifdef LTC_BASE64 int base64_encode(const unsigned char *in, unsigned long len, unsigned char *out, unsigned long *outlen); int base64_decode(const unsigned char *in, unsigned long len, unsigned char *out, unsigned long *outlen); #endif /* ---- MEM routines ---- */ void zeromem(void *dst, size_t len); void burn_stack(unsigned long len); const char *error_to_string(int err); extern const char *crypt_build_settings; /* ---- HMM ---- */ int crypt_fsa(void *mp, ...); /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_misc.h,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* Defines the LTC_ARGCHK macro used within the library */ /* ARGTYPE is defined in mycrypt_cfg.h */ #if ARGTYPE == 0 #include /* this is the default LibTomCrypt macro */ void crypt_argchk(char *v, char *s, int d); #define LTC_ARGCHK(x) if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } #define LTC_ARGCHKVD(x) LTC_ARGCHK(x) #elif ARGTYPE == 1 /* fatal type of error */ #define LTC_ARGCHK(x) HTTPS_ASSERT((x, "LibTomCrypt LTC_ARGCHK error")) #define LTC_ARGCHKVD(x) LTC_ARGCHK(x) #elif ARGTYPE == 2 #define LTC_ARGCHK(x) if (!(x)) { fprintf(stderr, "\nwarning: ARGCHK failed at %s:%d\n", __FILE__, __LINE__); } #define LTC_ARGCHKVD(x) LTC_ARGCHK(x) #elif ARGTYPE == 3 #define LTC_ARGCHK(x) #define LTC_ARGCHKVD(x) LTC_ARGCHK(x) #elif ARGTYPE == 4 #define LTC_ARGCHK(x) if (!(x)) return CRYPT_INVALID_ARG; #define LTC_ARGCHKVD(x) if (!(x)) return; #endif /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_argchk.h,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/08/27 20:50:21 $ */ /* LTC_PKCS Header Info */ /* ===> LTC_PKCS #1 -- RSA Cryptography <=== */ #ifdef LTC_PKCS_1 enum ltc_pkcs_1_v1_5_blocks { LTC_LTC_PKCS_1_EMSA = 1, /* Block type 1 (LTC_PKCS #1 v1.5 signature padding) */ LTC_LTC_PKCS_1_EME = 2 /* Block type 2 (LTC_PKCS #1 v1.5 encryption padding) */ }; enum ltc_pkcs_1_paddings { LTC_LTC_PKCS_1_V1_5 = 1, /* LTC_PKCS #1 v1.5 padding (\sa ltc_pkcs_1_v1_5_blocks) */ LTC_LTC_PKCS_1_OAEP = 2, /* LTC_PKCS #1 v2.0 encryption padding */ LTC_LTC_PKCS_1_PSS = 3 /* LTC_PKCS #1 v2.1 signature padding */ }; int pkcs_1_mgf1(int hash_idx, const unsigned char *seed, unsigned long seedlen, unsigned char *mask, unsigned long masklen); int pkcs_1_i2osp(void *n, unsigned long modulus_len, unsigned char *out); int pkcs_1_os2ip(void *n, unsigned char *in, unsigned long inlen); /* *** v1.5 padding */ int pkcs_1_v1_5_encode(const unsigned char *msg, unsigned long msglen, int block_type, unsigned long modulus_bitlen, prng_state *prng, int prng_idx, unsigned char *out, unsigned long *outlen); int pkcs_1_v1_5_decode(const unsigned char *msg, unsigned long msglen, int block_type, unsigned long modulus_bitlen, unsigned char *out, unsigned long *outlen, int *is_valid); /* *** v2.1 padding */ int pkcs_1_oaep_encode(const unsigned char *msg, unsigned long msglen, const unsigned char *lparam, unsigned long lparamlen, unsigned long modulus_bitlen, prng_state *prng, int prng_idx, int hash_idx, unsigned char *out, unsigned long *outlen); int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, const unsigned char *lparam, unsigned long lparamlen, unsigned long modulus_bitlen, int hash_idx, unsigned char *out, unsigned long *outlen, int *res); int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen, unsigned long saltlen, prng_state *prng, int prng_idx, int hash_idx, unsigned long modulus_bitlen, unsigned char *out, unsigned long *outlen); int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen, const unsigned char *sig, unsigned long siglen, unsigned long saltlen, int hash_idx, unsigned long modulus_bitlen, int *res); #endif /* LTC_PKCS_1 */ /* ===> LTC_PKCS #5 -- Password Based Cryptography <=== */ #ifdef LTC_PKCS_5 /* Algorithm #1 (old) */ int pkcs_5_alg1(const unsigned char *password, unsigned long password_len, const unsigned char *salt, int iteration_count, int hash_idx, unsigned char *out, unsigned long *outlen); /* Algorithm #2 (new) */ int pkcs_5_alg2(const unsigned char *password, unsigned long password_len, const unsigned char *salt, unsigned long salt_len, int iteration_count, int hash_idx, unsigned char *out, unsigned long *outlen); #endif /* LTC_PKCS_5 */ /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_pkcs.h,v $ */ /* $Revision: 1.8 $ */ /* $Date: 2007/05/12 14:32:35 $ */ #endif /* TOMCRYPT_H_ */ /* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt.h,v $ */ /* $Revision: 1.21 $ */ /* $Date: 2006/12/16 19:34:05 $ */ /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_argchk.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_cipher_descriptor.c Stores the cipher descriptor table, Tom St Denis */ struct ltc_cipher_descriptor cipher_descriptor[TAB_SIZE] = { { NULL, 0, 0, 0, 0, 0, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL } }; LTC_MUTEX_GLOBAL(ltc_cipher_mutex) /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c,v $ */ /* $Revision: 1.13 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_cipher_is_valid.c Determine if cipher is valid, Tom St Denis */ /* Test if a cipher index is valid @param idx The index of the cipher to search for @return CRYPT_OK if valid */ int cipher_is_valid(int idx) { LTC_MUTEX_LOCK(<c_cipher_mutex); if ((idx < 0) || (idx >= TAB_SIZE) || (cipher_descriptor[idx].name == NULL)) { LTC_MUTEX_UNLOCK(<c_cipher_mutex); return CRYPT_INVALID_CIPHER; } LTC_MUTEX_UNLOCK(<c_cipher_mutex); return CRYPT_OK; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_find_cipher.c Find a cipher in the descriptor tables, Tom St Denis */ /** Find a registered cipher by name @param name The name of the cipher to look for @return >= 0 if found, -1 if not present */ int find_cipher(const char *name) { int x; LTC_ARGCHK(name != NULL); LTC_MUTEX_LOCK(<c_cipher_mutex); for (x = 0; x < TAB_SIZE; x++) { if ((cipher_descriptor[x].name != NULL) && !XSTRCMP(cipher_descriptor[x].name, name)) { LTC_MUTEX_UNLOCK(<c_cipher_mutex); return x; } } LTC_MUTEX_UNLOCK(<c_cipher_mutex); return -1; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_find_cipher_any.c Find a cipher in the descriptor tables, Tom St Denis */ /** Find a cipher flexibly. First by name then if not present by block and key size @param name The name of the cipher desired @param blocklen The minimum length of the block cipher desired (octets) @param keylen The minimum length of the key size desired (octets) @return >= 0 if found, -1 if not present */ int find_cipher_any(const char *name, int blocklen, int keylen) { int x; LTC_ARGCHK(name != NULL); x = find_cipher(name); if (x != -1) return x; LTC_MUTEX_LOCK(<c_cipher_mutex); for (x = 0; x < TAB_SIZE; x++) { if (cipher_descriptor[x].name == NULL) { continue; } if ((blocklen <= (int)cipher_descriptor[x].block_length) && (keylen <= (int)cipher_descriptor[x].max_key_length)) { LTC_MUTEX_UNLOCK(<c_cipher_mutex); return x; } } LTC_MUTEX_UNLOCK(<c_cipher_mutex); return -1; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_find_cipher_id.c Find cipher by ID, Tom St Denis */ /** Find a cipher by ID number @param ID The ID (not same as index) of the cipher to find @return >= 0 if found, -1 if not present */ int find_cipher_id(unsigned char ID) { int x; LTC_MUTEX_LOCK(<c_cipher_mutex); for (x = 0; x < TAB_SIZE; x++) { if (cipher_descriptor[x].ID == ID) { x = (cipher_descriptor[x].name == NULL) ? -1 : x; LTC_MUTEX_UNLOCK(<c_cipher_mutex); return x; } } LTC_MUTEX_UNLOCK(<c_cipher_mutex); return -1; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_find_hash.c Find a hash, Tom St Denis */ /** Find a registered hash by name @param name The name of the hash to look for @return >= 0 if found, -1 if not present */ int find_hash(const char *name) { int x; LTC_ARGCHK(name != NULL); LTC_MUTEX_LOCK(<c_hash_mutex); for (x = 0; x < TAB_SIZE; x++) { if ((hash_descriptor[x].name != NULL) && (XSTRCMP(hash_descriptor[x].name, name) == 0)) { LTC_MUTEX_UNLOCK(<c_hash_mutex); return x; } } LTC_MUTEX_UNLOCK(<c_hash_mutex); return -1; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_find_hash_any.c Find a hash, Tom St Denis */ /** Find a hash flexibly. First by name then if not present by digest size @param name The name of the hash desired @param digestlen The minimum length of the digest size (octets) @return >= 0 if found, -1 if not present */int find_hash_any(const char *name, int digestlen) { int x, y, z; LTC_ARGCHK(name != NULL); x = find_hash(name); if (x != -1) return x; LTC_MUTEX_LOCK(<c_hash_mutex); y = MAXBLOCKSIZE + 1; z = -1; for (x = 0; x < TAB_SIZE; x++) { if (hash_descriptor[x].name == NULL) { continue; } if (((int)hash_descriptor[x].hashsize >= digestlen) && ((int)hash_descriptor[x].hashsize < y)) { z = x; y = hash_descriptor[x].hashsize; } } LTC_MUTEX_UNLOCK(<c_hash_mutex); return z; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_find_hash_id.c Find hash by ID, Tom St Denis */ /** Find a hash by ID number @param ID The ID (not same as index) of the hash to find @return >= 0 if found, -1 if not present */ int find_hash_id(unsigned char ID) { int x; LTC_MUTEX_LOCK(<c_hash_mutex); for (x = 0; x < TAB_SIZE; x++) { if (hash_descriptor[x].ID == ID) { x = (hash_descriptor[x].name == NULL) ? -1 : x; LTC_MUTEX_UNLOCK(<c_hash_mutex); return x; } } LTC_MUTEX_UNLOCK(<c_hash_mutex); return -1; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_find_hash_oid.c Find a hash, Tom St Denis */ int find_hash_oid(const unsigned long *ID, unsigned long IDlen) { int x; LTC_ARGCHK(ID != NULL); LTC_MUTEX_LOCK(<c_hash_mutex); for (x = 0; x < TAB_SIZE; x++) { if ((hash_descriptor[x].name != NULL) && (hash_descriptor[x].OIDlen == IDlen) && !XMEMCMP(hash_descriptor[x].OID, ID, sizeof(unsigned long) * IDlen)) { LTC_MUTEX_UNLOCK(<c_hash_mutex); return x; } } LTC_MUTEX_UNLOCK(<c_hash_mutex); return -1; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_find_prng.c Find a PRNG, Tom St Denis */ /** Find a registered PRNG by name @param name The name of the PRNG to look for @return >= 0 if found, -1 if not present */ int find_prng(const char *name) { int x; LTC_ARGCHK(name != NULL); LTC_MUTEX_LOCK(<c_prng_mutex); for (x = 0; x < TAB_SIZE; x++) { if ((prng_descriptor[x].name != NULL) && (XSTRCMP(prng_descriptor[x].name, name) == 0)) { LTC_MUTEX_UNLOCK(<c_prng_mutex); return x; } } LTC_MUTEX_UNLOCK(<c_prng_mutex); return -1; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_prng.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include /** @file crypt_fsa.c LibTomCrypt FULL SPEED AHEAD!, Tom St Denis */ /* format is ltc_mp, cipher_desc, [cipher_desc], NULL, hash_desc, [hash_desc], NULL, prng_desc, [prng_desc], NULL */ int crypt_fsa(void *mp, ...) { int err; va_list args; void *p; va_start(args, mp); if (mp != NULL) { XMEMCPY(<c_mp, mp, sizeof(ltc_mp)); } while ((p = va_arg(args, void *)) != NULL) { if ((err = register_cipher(AUTO_CAST(p))) != CRYPT_OK) { va_end(args); return err; } } while ((p = va_arg(args, void *)) != NULL) { if ((err = register_hash(AUTO_CAST(p))) != CRYPT_OK) { va_end(args); return err; } } while ((p = va_arg(args, void *)) != NULL) { if ((err = register_prng(AUTO_CAST(p))) != CRYPT_OK) { va_end(args); return err; } } va_end(args); return CRYPT_OK; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_fsa.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_hash_descriptor.c Stores the hash descriptor table, Tom St Denis */ struct ltc_hash_descriptor hash_descriptor[TAB_SIZE] = { { NULL, 0, 0, 0, { 0 }, 0, NULL, NULL, NULL, NULL, NULL } }; LTC_MUTEX_GLOBAL(ltc_hash_mutex) /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c,v $ */ /* $Revision: 1.10 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_hash_is_valid.c Determine if hash is valid, Tom St Denis */ /* Test if a hash index is valid @param idx The index of the hash to search for @return CRYPT_OK if valid */ int hash_is_valid(int idx) { LTC_MUTEX_LOCK(<c_hash_mutex); if ((idx < 0) || (idx >= TAB_SIZE) || (hash_descriptor[idx].name == NULL)) { LTC_MUTEX_UNLOCK(<c_hash_mutex); return CRYPT_INVALID_HASH; } LTC_MUTEX_UNLOCK(<c_hash_mutex); return CRYPT_OK; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ ltc_math_descriptor ltc_mp; /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_prng_descriptor.c Stores the PRNG descriptors, Tom St Denis */ struct ltc_prng_descriptor prng_descriptor[TAB_SIZE] = { { NULL, 0, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL } }; LTC_MUTEX_GLOBAL(ltc_prng_mutex) /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c,v $ */ /* $Revision: 1.8 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_prng_is_valid.c Determine if PRNG is valid, Tom St Denis */ /* Test if a PRNG index is valid @param idx The index of the PRNG to search for @return CRYPT_OK if valid */ int prng_is_valid(int idx) { LTC_MUTEX_LOCK(<c_prng_mutex); if ((idx < 0) || (idx >= TAB_SIZE) || (prng_descriptor[idx].name == NULL)) { LTC_MUTEX_UNLOCK(<c_prng_mutex); return CRYPT_INVALID_PRNG; } LTC_MUTEX_UNLOCK(<c_prng_mutex); return CRYPT_OK; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_register_cipher.c Register a cipher, Tom St Denis */ /** Register a cipher with the descriptor table @param cipher The cipher you wish to register @return value >= 0 if successfully added (or already present), -1 if unsuccessful */ int register_cipher(const struct ltc_cipher_descriptor *cipher) { int x; LTC_ARGCHK(cipher != NULL); /* is it already registered? */ LTC_MUTEX_LOCK(<c_cipher_mutex); for (x = 0; x < TAB_SIZE; x++) { if ((cipher_descriptor[x].name != NULL) && (cipher_descriptor[x].ID == cipher->ID)) { LTC_MUTEX_UNLOCK(<c_cipher_mutex); return x; } } /* find a blank spot */ for (x = 0; x < TAB_SIZE; x++) { if (cipher_descriptor[x].name == NULL) { XMEMCPY(&cipher_descriptor[x], cipher, sizeof(struct ltc_cipher_descriptor)); LTC_MUTEX_UNLOCK(<c_cipher_mutex); return x; } } /* no spot */ LTC_MUTEX_UNLOCK(<c_cipher_mutex); return -1; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_cipher.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_register_hash.c Register a HASH, Tom St Denis */ /** Register a hash with the descriptor table @param hash The hash you wish to register @return value >= 0 if successfully added (or already present), -1 if unsuccessful */ int register_hash(const struct ltc_hash_descriptor *hash) { int x; LTC_ARGCHK(hash != NULL); /* is it already registered? */ LTC_MUTEX_LOCK(<c_hash_mutex); for (x = 0; x < TAB_SIZE; x++) { if (XMEMCMP(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)) == 0) { LTC_MUTEX_UNLOCK(<c_hash_mutex); return x; } } /* find a blank spot */ for (x = 0; x < TAB_SIZE; x++) { if (hash_descriptor[x].name == NULL) { XMEMCPY(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)); LTC_MUTEX_UNLOCK(<c_hash_mutex); return x; } } /* no spot */ LTC_MUTEX_UNLOCK(<c_hash_mutex); return -1; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_hash.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_register_prng.c Register a PRNG, Tom St Denis */ /** Register a PRNG with the descriptor table @param prng The PRNG you wish to register @return value >= 0 if successfully added (or already present), -1 if unsuccessful */ int register_prng(const struct ltc_prng_descriptor *prng) { int x; LTC_ARGCHK(prng != NULL); /* is it already registered? */ LTC_MUTEX_LOCK(<c_prng_mutex); for (x = 0; x < TAB_SIZE; x++) { if (XMEMCMP(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)) == 0) { LTC_MUTEX_UNLOCK(<c_prng_mutex); return x; } } /* find a blank spot */ for (x = 0; x < TAB_SIZE; x++) { if (prng_descriptor[x].name == NULL) { XMEMCPY(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)); LTC_MUTEX_UNLOCK(<c_prng_mutex); return x; } } /* no spot */ LTC_MUTEX_UNLOCK(<c_prng_mutex); return -1; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_prng.c,v $ */ /* $Revision: 1.8 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_unregister_cipher.c Unregister a cipher, Tom St Denis */ /** Unregister a cipher from the descriptor table @param cipher The cipher descriptor to remove @return CRYPT_OK on success */ int unregister_cipher(const struct ltc_cipher_descriptor *cipher) { int x; LTC_ARGCHK(cipher != NULL); /* is it already registered? */ LTC_MUTEX_LOCK(<c_cipher_mutex); for (x = 0; x < TAB_SIZE; x++) { if (XMEMCMP(&cipher_descriptor[x], cipher, sizeof(struct ltc_cipher_descriptor)) == 0) { cipher_descriptor[x].name = NULL; cipher_descriptor[x].ID = 255; LTC_MUTEX_UNLOCK(<c_cipher_mutex); return CRYPT_OK; } } LTC_MUTEX_UNLOCK(<c_cipher_mutex); return CRYPT_ERROR; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_unregister_hash.c Unregister a hash, Tom St Denis */ /** Unregister a hash from the descriptor table @param hash The hash descriptor to remove @return CRYPT_OK on success */ int unregister_hash(const struct ltc_hash_descriptor *hash) { int x; LTC_ARGCHK(hash != NULL); /* is it already registered? */ LTC_MUTEX_LOCK(<c_hash_mutex); for (x = 0; x < TAB_SIZE; x++) { if (XMEMCMP(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)) == 0) { hash_descriptor[x].name = NULL; LTC_MUTEX_UNLOCK(<c_hash_mutex); return CRYPT_OK; } } LTC_MUTEX_UNLOCK(<c_hash_mutex); return CRYPT_ERROR; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file crypt_unregister_prng.c Unregister a PRNG, Tom St Denis */ /** Unregister a PRNG from the descriptor table @param prng The PRNG descriptor to remove @return CRYPT_OK on success */ int unregister_prng(const struct ltc_prng_descriptor *prng) { int x; LTC_ARGCHK(prng != NULL); /* is it already registered? */ LTC_MUTEX_LOCK(<c_prng_mutex); for (x = 0; x < TAB_SIZE; x++) { if (XMEMCMP(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)) != 0) { prng_descriptor[x].name = NULL; LTC_MUTEX_UNLOCK(<c_prng_mutex); return CRYPT_OK; } } LTC_MUTEX_UNLOCK(<c_prng_mutex); return CRYPT_ERROR; } /* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_bit_string.c ASN.1 DER, encode a BIT STRING, Tom St Denis */ #ifdef LTC_DER /** Store a BIT STRING @param in The DER encoded BIT STRING @param inlen The size of the DER BIT STRING @param out [out] The array of bits stored (one per char) @param outlen [in/out] The number of bits stored @return CRYPT_OK if successful */ int der_decode_bit_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { unsigned long dlen, blen, x, y; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* packet must be at least 4 bytes */ if (inlen < 4) { return CRYPT_INVALID_ARG; } /* check for 0x03 */ if ((in[0] & 0x1F) != 0x03) { return CRYPT_INVALID_PACKET; } /* offset in the data */ x = 1; /* get the length of the data */ if (in[x] & 0x80) { /* long format get number of length bytes */ y = in[x++] & 0x7F; /* invalid if 0 or > 2 */ if ((y == 0) || (y > 2)) { return CRYPT_INVALID_PACKET; } /* read the data len */ dlen = 0; while (y--) { dlen = (dlen << 8) | (unsigned long)in[x++]; } } else { /* short format */ dlen = in[x++] & 0x7F; } /* is the data len too long or too short? */ if ((dlen == 0) || (dlen + x > inlen)) { return CRYPT_INVALID_PACKET; } /* get padding count */ blen = ((dlen - 1) << 3) - (in[x++] & 7); /* too many bits? */ if (blen > *outlen) { *outlen = blen; return CRYPT_BUFFER_OVERFLOW; } /* decode/store the bits */ for (y = 0; y < blen; y++) { out[y] = (in[x] & (1 << (7 - (y & 7)))) ? 1 : 0; if ((y & 7) == 7) { ++x; } } /* we done */ *outlen = blen; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_boolean.c ASN.1 DER, decode a BOOLEAN, Tom St Denis */ #ifdef LTC_DER /** Read a BOOLEAN @param in The destination for the DER encoded BOOLEAN @param inlen The size of the DER BOOLEAN @param out [out] The boolean to decode @return CRYPT_OK if successful */ int der_decode_boolean(const unsigned char *in, unsigned long inlen, int *out) { LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); if ((inlen != 3) || (in[0] != 0x01) || (in[1] != 0x01) || ((in[2] != 0x00) && (in[2] != 0xFF))) { return CRYPT_INVALID_ARG; } *out = (in[2] == 0xFF) ? 1 : 0; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c,v $ */ /* $Revision: 1.2 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_choice.c ASN.1 DER, decode a CHOICE, Tom St Denis */ #ifdef LTC_DER /** Decode a CHOICE @param in The DER encoded input @param inlen [in/out] The size of the input and resulting size of read type @param list The list of items to decode @param outlen The number of items in the list @return CRYPT_OK on success */ int der_decode_choice(const unsigned char *in, unsigned long *inlen, ltc_asn1_list *list, unsigned long outlen) { unsigned long size, x, z; void *data; LTC_ARGCHK(in != NULL); LTC_ARGCHK(inlen != NULL); LTC_ARGCHK(list != NULL); /* get blk size */ if (*inlen < 2) { return CRYPT_INVALID_PACKET; } /* set all of the "used" flags to zero */ for (x = 0; x < outlen; x++) { list[x].used = 0; } /* now scan until we have a winner */ for (x = 0; x < outlen; x++) { size = list[x].size; data = list[x].data; switch (list[x].type) { case LTC_ASN1_INTEGER: if (der_decode_integer(in, *inlen, data) == CRYPT_OK) { if (der_length_integer(data, &z) == CRYPT_OK) { list[x].used = 1; *inlen = z; return CRYPT_OK; } } break; case LTC_ASN1_SHORT_INTEGER: if (der_decode_short_integer(in, *inlen, (unsigned long *)data) == CRYPT_OK) { if (der_length_short_integer(size, &z) == CRYPT_OK) { list[x].used = 1; *inlen = z; return CRYPT_OK; } } break; case LTC_ASN1_BIT_STRING: if (der_decode_bit_string(in, *inlen, (unsigned char *)data, &size) == CRYPT_OK) { if (der_length_bit_string(size, &z) == CRYPT_OK) { list[x].used = 1; list[x].size = size; *inlen = z; return CRYPT_OK; } } break; case LTC_ASN1_OCTET_STRING: if (der_decode_octet_string(in, *inlen, AUTO_CAST(data), &size) == CRYPT_OK) { if (der_length_octet_string(size, &z) == CRYPT_OK) { list[x].used = 1; list[x].size = size; *inlen = z; return CRYPT_OK; } } break; case LTC_ASN1_NULL: if ((*inlen == 2) && (in[x] == 0x05) && (in[x + 1] == 0x00)) { *inlen = 2; list[x].used = 1; return CRYPT_OK; } break; case LTC_ASN1_OBJECT_IDENTIFIER: if (der_decode_object_identifier(in, *inlen, AUTO_CAST(data), &size) == CRYPT_OK) { if (der_length_object_identifier(AUTO_CAST(data), size, &z) == CRYPT_OK) { list[x].used = 1; list[x].size = size; *inlen = z; return CRYPT_OK; } } break; case LTC_ASN1_IA5_STRING: if (der_decode_ia5_string(in, *inlen, AUTO_CAST(data), &size) == CRYPT_OK) { if (der_length_ia5_string(AUTO_CAST(data), size, &z) == CRYPT_OK) { list[x].used = 1; list[x].size = size; *inlen = z; return CRYPT_OK; } } break; case LTC_ASN1_PRINTABLE_STRING: if (der_decode_printable_string(in, *inlen, AUTO_CAST(data), &size) == CRYPT_OK) { if (der_length_printable_string(AUTO_CAST(data), size, &z) == CRYPT_OK) { list[x].used = 1; list[x].size = size; *inlen = z; return CRYPT_OK; } } break; case LTC_ASN1_UTF8_STRING: if (der_decode_utf8_string(in, *inlen, AUTO_CAST(data), &size) == CRYPT_OK) { if (der_length_utf8_string(AUTO_CAST(data), size, &z) == CRYPT_OK) { list[x].used = 1; list[x].size = size; *inlen = z; return CRYPT_OK; } } break; case LTC_ASN1_UTCTIME: z = *inlen; if (der_decode_utctime(in, &z, AUTO_CAST(data)) == CRYPT_OK) { list[x].used = 1; *inlen = z; return CRYPT_OK; } break; case LTC_ASN1_SET: case LTC_ASN1_SETOF: case LTC_ASN1_SEQUENCE: if (der_decode_sequence(in, *inlen, AUTO_CAST(data), size) == CRYPT_OK) { if (der_length_sequence(AUTO_CAST(data), size, &z) == CRYPT_OK) { list[x].used = 1; *inlen = z; return CRYPT_OK; } } break; default: return CRYPT_INVALID_ARG; } } return CRYPT_INVALID_PACKET; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c,v $ */ /* $Revision: 1.9 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_ia5_string.c ASN.1 DER, encode a IA5 STRING, Tom St Denis */ #ifdef LTC_DER /** Store a IA5 STRING @param in The DER encoded IA5 STRING @param inlen The size of the DER IA5 STRING @param out [out] The array of octets stored (one per char) @param outlen [in/out] The number of octets stored @return CRYPT_OK if successful */ int der_decode_ia5_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { unsigned long x, y, len; int t; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* must have header at least */ if (inlen < 2) { return CRYPT_INVALID_PACKET; } /* check for 0x16 */ if ((in[0] & 0x1F) != 0x16) { return CRYPT_INVALID_PACKET; } x = 1; /* decode the length */ if (in[x] & 0x80) { /* valid # of bytes in length are 1,2,3 */ y = in[x] & 0x7F; if ((y == 0) || (y > 3) || ((x + y) > inlen)) { return CRYPT_INVALID_PACKET; } /* read the length in */ len = 0; ++x; while (y--) { len = (len << 8) | in[x++]; } } else { len = in[x++] & 0x7F; } /* is it too long? */ if (len > *outlen) { *outlen = len; return CRYPT_BUFFER_OVERFLOW; } if (len + x > inlen) { return CRYPT_INVALID_PACKET; } /* read the data */ for (y = 0; y < len; y++) { t = der_ia5_value_decode(in[x++]); if (t == -1) { return CRYPT_INVALID_ARG; } out[y] = t; } *outlen = y; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c,v $ */ /* $Revision: 1.4 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_integer.c ASN.1 DER, decode an integer, Tom St Denis */ #ifdef LTC_DER /** Read a mp_int integer @param in The DER encoded data @param inlen Size of DER encoded data @param num The first mp_int to decode @return CRYPT_OK if successful */ int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num) { unsigned long x, y, z; int err; LTC_ARGCHK(num != NULL); LTC_ARGCHK(in != NULL); /* min DER INTEGER is 0x02 01 00 == 0 */ if (inlen < (1 + 1 + 1)) { return CRYPT_INVALID_PACKET; } /* ok expect 0x02 when we AND with 0001 1111 [1F] */ x = 0; if ((in[x++] & 0x1F) != 0x02) { return CRYPT_INVALID_PACKET; } /* now decode the len stuff */ z = in[x++]; if ((z & 0x80) == 0x00) { /* short form */ /* will it overflow? */ if (x + z > inlen) { return CRYPT_INVALID_PACKET; } /* no so read it */ if ((err = mp_read_unsigned_bin(num, (unsigned char *)in + x, z)) != CRYPT_OK) { return err; } } else { /* long form */ z &= 0x7F; /* will number of length bytes overflow? (or > 4) */ if (((x + z) > inlen) || (z > 4) || (z == 0)) { return CRYPT_INVALID_PACKET; } /* now read it in */ y = 0; while (z--) { y = ((unsigned long)(in[x++])) | (y << 8); } /* now will reading y bytes overrun? */ if ((x + y) > inlen) { return CRYPT_INVALID_PACKET; } /* no so read it */ if ((err = mp_read_unsigned_bin(num, (unsigned char *)in + x, y)) != CRYPT_OK) { return err; } } /* see if it's negative */ if (in[x] & 0x80) { void *tmp; if (mp_init(&tmp) != CRYPT_OK) { return CRYPT_MEM; } if ((mp_2expt(tmp, mp_count_bits(num)) != CRYPT_OK) || (mp_sub(num, tmp, num) != CRYPT_OK)) { mp_clear(tmp); return CRYPT_MEM; } mp_clear(tmp); } return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_object_identifier.c ASN.1 DER, Decode Object Identifier, Tom St Denis */ #ifdef LTC_DER /** Decode OID data and store the array of integers in words @param in The OID DER encoded data @param inlen The length of the OID data @param words [out] The destination of the OID words @param outlen [in/out] The number of OID words @return CRYPT_OK if successful */ int der_decode_object_identifier(const unsigned char *in, unsigned long inlen, unsigned long *words, unsigned long *outlen) { unsigned long x, y, t, len; LTC_ARGCHK(in != NULL); LTC_ARGCHK(words != NULL); LTC_ARGCHK(outlen != NULL); /* header is at least 3 bytes */ if (inlen < 3) { return CRYPT_INVALID_PACKET; } /* must be room for at least two words */ if (*outlen < 2) { return CRYPT_BUFFER_OVERFLOW; } /* decode the packet header */ x = 0; if ((in[x++] & 0x1F) != 0x06) { return CRYPT_INVALID_PACKET; } /* get the length */ if (in[x] < 128) { len = in[x++]; } else { if ((in[x] < 0x81) || (in[x] > 0x82)) { return CRYPT_INVALID_PACKET; } y = in[x++] & 0x7F; len = 0; while (y--) { len = (len << 8) | (unsigned long)in[x++]; } } if ((len < 1) || ((len + x) > inlen)) { return CRYPT_INVALID_PACKET; } /* decode words */ y = 0; t = 0; while (len--) { t = (t << 7) | (in[x] & 0x7F); if (!(in[x++] & 0x80)) { /* store t */ if (y >= *outlen) { return CRYPT_BUFFER_OVERFLOW; } if (y == 0) { words[0] = t / 40; words[1] = t % 40; y = 2; } else { words[y++] = t; } t = 0; } } *outlen = y; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_octet_string.c ASN.1 DER, encode a OCTET STRING, Tom St Denis */ #ifdef LTC_DER /** Store a OCTET STRING @param in The DER encoded OCTET STRING @param inlen The size of the DER OCTET STRING @param out [out] The array of octets stored (one per char) @param outlen [in/out] The number of octets stored @return CRYPT_OK if successful */ int der_decode_octet_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { unsigned long x, y, len; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* must have header at least */ if (inlen < 2) { return CRYPT_INVALID_PACKET; } /* check for 0x04 */ if ((in[0] & 0x1F) != 0x04) { return CRYPT_INVALID_PACKET; } x = 1; /* decode the length */ if (in[x] & 0x80) { /* valid # of bytes in length are 1,2,3 */ y = in[x] & 0x7F; if ((y == 0) || (y > 3) || ((x + y) > inlen)) { return CRYPT_INVALID_PACKET; } /* read the length in */ len = 0; ++x; while (y--) { len = (len << 8) | in[x++]; } } else { len = in[x++] & 0x7F; } /* is it too long? */ if (len > *outlen) { *outlen = len; return CRYPT_BUFFER_OVERFLOW; } if (len + x > inlen) { return CRYPT_INVALID_PACKET; } /* read the data */ for (y = 0; y < len; y++) { out[y] = in[x++]; } *outlen = y; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c,v $ */ /* $Revision: 1.4 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_printable_string.c ASN.1 DER, encode a printable STRING, Tom St Denis */ #ifdef LTC_DER /** Store a printable STRING @param in The DER encoded printable STRING @param inlen The size of the DER printable STRING @param out [out] The array of octets stored (one per char) @param outlen [in/out] The number of octets stored @return CRYPT_OK if successful */ int der_decode_printable_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { unsigned long x, y, len; int t; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* must have header at least */ if (inlen < 2) { return CRYPT_INVALID_PACKET; } /* check for 0x13 */ if ((in[0] & 0x1F) != 0x13) { return CRYPT_INVALID_PACKET; } x = 1; /* decode the length */ if (in[x] & 0x80) { /* valid # of bytes in length are 1,2,3 */ y = in[x] & 0x7F; if ((y == 0) || (y > 3) || ((x + y) > inlen)) { return CRYPT_INVALID_PACKET; } /* read the length in */ len = 0; ++x; while (y--) { len = (len << 8) | in[x++]; } } else { len = in[x++] & 0x7F; } /* is it too long? */ if (len > *outlen) { *outlen = len; return CRYPT_BUFFER_OVERFLOW; } if (len + x > inlen) { return CRYPT_INVALID_PACKET; } /* read the data */ for (y = 0; y < len; y++) { t = der_printable_value_decode(in[x++]); if (t == -1) { return CRYPT_INVALID_ARG; } out[y] = t; } *outlen = y; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c,v $ */ /* $Revision: 1.4 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include /** @file der_decode_sequence_ex.c ASN.1 DER, decode a SEQUENCE, Tom St Denis */ #ifdef LTC_DER /** Decode a SEQUENCE @param in The DER encoded input @param inlen The size of the input @param list The list of items to decode @param outlen The number of items in the list @param ordered Search an unordeded or ordered list @return CRYPT_OK on success */ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, ltc_asn1_list *list, unsigned long outlen, int ordered) { int err, type; unsigned long size, x, y, z, i, blksize; void *data; LTC_ARGCHK(in != NULL); LTC_ARGCHK(list != NULL); /* get blk size */ if (inlen < 2) { return CRYPT_INVALID_PACKET; } blksize = 0; /* sequence type? We allow 0x30 SEQUENCE and 0x31 SET since fundamentally they're the same structure */ x = 0; if ((in[x] != 0x30) && (in[x] != 0x31)) { return CRYPT_INVALID_PACKET; } ++x; if (in[x] < 128) { blksize = in[x++]; } else if (in[x] & 0x80) { if ((in[x] < 0x81) || (in[x] > 0x83)) { return CRYPT_INVALID_PACKET; } y = in[x++] & 0x7F; /* would reading the len bytes overrun? */ if (x + y > inlen) { return CRYPT_INVALID_PACKET; } /* read len */ blksize = 0; while (y--) { blksize = (blksize << 8) | (unsigned long)in[x++]; } } /* would this blksize overflow? */ if (x + blksize > inlen) { return CRYPT_INVALID_PACKET; } /* mark all as unused */ for (i = 0; i < outlen; i++) { list[i].used = 0; } /* ok read data */ inlen = blksize; for (i = 0; i < outlen; i++) { z = 0; type = list[i].type; size = list[i].size; data = list[i].data; if (!ordered && (list[i].used == 1)) { continue; } if (type == LTC_ASN1_EOL) { break; } switch (type) { case LTC_ASN1_BOOLEAN: z = inlen; if ((err = der_decode_boolean(in + x, z, ((int *)data))) != CRYPT_OK) { goto LBL_ERR; } if ((err = der_length_boolean(&z)) != CRYPT_OK) { goto LBL_ERR; } break; case LTC_ASN1_INTEGER: z = inlen; if ((err = der_decode_integer(in + x, z, data)) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } if ((err = der_length_integer(data, &z)) != CRYPT_OK) { goto LBL_ERR; } break; case LTC_ASN1_SHORT_INTEGER: z = inlen; if ((err = der_decode_short_integer(in + x, z, AUTO_CAST(data))) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } if ((err = der_length_short_integer(((unsigned long *)data)[0], &z)) != CRYPT_OK) { goto LBL_ERR; } break; case LTC_ASN1_BIT_STRING: z = inlen; if ((err = der_decode_bit_string(in + x, z, AUTO_CAST(data), &size)) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } list[i].size = size; if ((err = der_length_bit_string(size, &z)) != CRYPT_OK) { goto LBL_ERR; } break; case LTC_ASN1_OCTET_STRING: z = inlen; if ((err = der_decode_octet_string(in + x, z, AUTO_CAST(data), &size)) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } list[i].size = size; if ((err = der_length_octet_string(size, &z)) != CRYPT_OK) { goto LBL_ERR; } break; case LTC_ASN1_NULL: if ((inlen < 2) || (in[x] != 0x05) || (in[x + 1] != 0x00)) { if (!ordered) { continue; } err = CRYPT_INVALID_PACKET; goto LBL_ERR; } z = 2; break; case LTC_ASN1_OBJECT_IDENTIFIER: z = inlen; if ((err = der_decode_object_identifier(in + x, z, AUTO_CAST(data), &size)) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } list[i].size = size; if ((err = der_length_object_identifier(AUTO_CAST(data), size, &z)) != CRYPT_OK) { goto LBL_ERR; } break; case LTC_ASN1_IA5_STRING: z = inlen; if ((err = der_decode_ia5_string(in + x, z, AUTO_CAST(data), &size)) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } list[i].size = size; if ((err = der_length_ia5_string(AUTO_CAST(data), size, &z)) != CRYPT_OK) { goto LBL_ERR; } break; case LTC_ASN1_PRINTABLE_STRING: z = inlen; if ((err = der_decode_printable_string(in + x, z, AUTO_CAST(data), &size)) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } list[i].size = size; if ((err = der_length_printable_string(AUTO_CAST(data), size, &z)) != CRYPT_OK) { goto LBL_ERR; } break; case LTC_ASN1_UTF8_STRING: z = inlen; if ((err = der_decode_utf8_string(in + x, z, AUTO_CAST(data), &size)) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } list[i].size = size; if ((err = der_length_utf8_string(AUTO_CAST(data), size, &z)) != CRYPT_OK) { goto LBL_ERR; } break; case LTC_ASN1_UTCTIME: z = inlen; if ((err = der_decode_utctime(in + x, &z, AUTO_CAST(data))) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } break; case LTC_ASN1_SET: z = inlen; if ((err = der_decode_set(in + x, z, AUTO_CAST(data), size)) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } if ((err = der_length_sequence(AUTO_CAST(data), size, &z)) != CRYPT_OK) { goto LBL_ERR; } break; case LTC_ASN1_SETOF: case LTC_ASN1_SEQUENCE: /* detect if we have the right type */ if (((type == LTC_ASN1_SETOF) && ((in[x] & 0x3F) != 0x31)) || ((type == LTC_ASN1_SEQUENCE) && ((in[x] & 0x3F) != 0x30))) { err = CRYPT_INVALID_PACKET; goto LBL_ERR; } z = inlen; if ((err = der_decode_sequence(in + x, z, AUTO_CAST(data), size)) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } if ((err = der_length_sequence(AUTO_CAST(data), size, &z)) != CRYPT_OK) { goto LBL_ERR; } break; case LTC_ASN1_CHOICE: z = inlen; if ((err = der_decode_choice(in + x, &z, AUTO_CAST(data), size)) != CRYPT_OK) { if (!ordered) { continue; } goto LBL_ERR; } break; default: err = CRYPT_INVALID_ARG; goto LBL_ERR; } x += z; inlen -= z; list[i].used = 1; if (!ordered) { /* restart the decoder */ i = -1; } } for (i = 0; i < outlen; i++) { if (list[i].used == 0) { err = CRYPT_INVALID_PACKET; goto LBL_ERR; } } err = CRYPT_OK; LBL_ERR: return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c,v $ */ /* $Revision: 1.16 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_sequence_flexi.c ASN.1 DER, decode an array of ASN.1 types with a flexi parser, Tom St Denis */ #ifdef LTC_DER static unsigned long fetch_length(const unsigned char *in, unsigned long inlen) { unsigned long x, y, z; y = 0; /* skip type and read len */ if (inlen < 2) { return 0xFFFFFFFF; } ++in; ++y; /* read len */ x = *in++; ++y; /* <128 means literal */ if (x < 128) { return x + y; } x &= 0x7F; /* the lower 7 bits are the length of the length */ inlen -= 2; /* len means len of len! */ if ((x == 0) || (x > 4) || (x > inlen)) { return 0xFFFFFFFF; } y += x; z = 0; while (x--) { z = (z << 8) | ((unsigned long)*in); ++in; } return z + y; } /** ASN.1 DER Flexi(ble) decoder will decode arbitrary DER packets and create a linked list of the decoded elements. @param in The input buffer @param inlen [in/out] The length of the input buffer and on output the amount of decoded data @param out [out] A pointer to the linked list @return CRYPT_OK on success. */ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc_asn1_list **out) { ltc_asn1_list *l; unsigned long err, type, len, totlen, x, y; void *realloc_tmp; LTC_ARGCHK(in != NULL); LTC_ARGCHK(inlen != NULL); LTC_ARGCHK(out != NULL); l = NULL; totlen = 0; /* scan the input and and get lengths and what not */ while (*inlen) { /* read the type byte */ type = *in; /* fetch length */ len = fetch_length(in, *inlen); if (len > *inlen) { err = CRYPT_INVALID_PACKET; goto error; } /* alloc new link */ if (l == NULL) { l = AUTO_CAST(XCALLOC(1, sizeof(*l))); if (l == NULL) { err = CRYPT_MEM; goto error; } } else { l->next = AUTO_CAST(XCALLOC(1, sizeof(*l))); if (l->next == NULL) { err = CRYPT_MEM; goto error; } l->next->prev = l; l = l->next; } /* now switch on type */ switch (type) { case 0x01: /* BOOLEAN */ l->type = LTC_ASN1_BOOLEAN; l->size = 1; l->data = XCALLOC(1, sizeof(int)); if ((err = der_decode_boolean(in, *inlen, AUTO_CAST(l->data))) != CRYPT_OK) { goto error; } if ((err = der_length_boolean(&len)) != CRYPT_OK) { goto error; } break; case 0x02: /* INTEGER */ /* init field */ l->type = LTC_ASN1_INTEGER; l->size = 1; if ((err = mp_init(&l->data)) != CRYPT_OK) { goto error; } /* decode field */ if ((err = der_decode_integer(in, *inlen, l->data)) != CRYPT_OK) { goto error; } /* calc length of object */ if ((err = der_length_integer(l->data, &len)) != CRYPT_OK) { goto error; } break; case 0x03: /* BIT */ /* init field */ l->type = LTC_ASN1_BIT_STRING; l->size = len * 8; /* *8 because we store decoded bits one per char and they are encoded 8 per char. */ if ((l->data = XCALLOC(1, l->size)) == NULL) { err = CRYPT_MEM; goto error; } if ((err = der_decode_bit_string(in, *inlen, AUTO_CAST(l->data), &l->size)) != CRYPT_OK) { goto error; } if ((err = der_length_bit_string(l->size, &len)) != CRYPT_OK) { goto error; } break; case 0x04: /* OCTET */ /* init field */ l->type = LTC_ASN1_OCTET_STRING; l->size = len; if ((l->data = XCALLOC(1, l->size)) == NULL) { err = CRYPT_MEM; goto error; } if ((err = der_decode_octet_string(in, *inlen, AUTO_CAST(l->data), &l->size)) != CRYPT_OK) { goto error; } if ((err = der_length_octet_string(l->size, &len)) != CRYPT_OK) { goto error; } break; case 0x05: /* NULL */ /* valid NULL is 0x05 0x00 */ if ((in[0] != 0x05) || (in[1] != 0x00)) { err = CRYPT_INVALID_PACKET; goto error; } /* simple to store ;-) */ l->type = LTC_ASN1_NULL; l->data = NULL; l->size = 0; len = 2; break; case 0x06: /* OID */ /* init field */ l->type = LTC_ASN1_OBJECT_IDENTIFIER; l->size = len; if ((l->data = XCALLOC(len, sizeof(unsigned long))) == NULL) { err = CRYPT_MEM; goto error; } if ((err = der_decode_object_identifier(in, *inlen, AUTO_CAST(l->data), &l->size)) != CRYPT_OK) { goto error; } if ((err = der_length_object_identifier(AUTO_CAST(l->data), l->size, &len)) != CRYPT_OK) { goto error; } /* resize it to save a bunch of mem */ if ((realloc_tmp = XREALLOC(l->data, l->size * sizeof(unsigned long))) == NULL) { /* out of heap but this is not an error */ break; } l->data = realloc_tmp; break; case 0x0C: /* UTF8 */ /* init field */ l->type = LTC_ASN1_UTF8_STRING; l->size = len; if ((l->data = XCALLOC(sizeof(wchar_t), l->size)) == NULL) { err = CRYPT_MEM; goto error; } if ((err = der_decode_utf8_string(in, *inlen, AUTO_CAST(l->data), &l->size)) != CRYPT_OK) { goto error; } if ((err = der_length_utf8_string(AUTO_CAST(l->data), l->size, &len)) != CRYPT_OK) { goto error; } break; case 0x13: /* PRINTABLE */ /* init field */ l->type = LTC_ASN1_PRINTABLE_STRING; l->size = len; if ((l->data = XCALLOC(1, l->size)) == NULL) { err = CRYPT_MEM; goto error; } if ((err = der_decode_printable_string(in, *inlen, AUTO_CAST(l->data), &l->size)) != CRYPT_OK) { goto error; } if ((err = der_length_printable_string(AUTO_CAST(l->data), l->size, &len)) != CRYPT_OK) { goto error; } break; case 0x16: /* IA5 */ /* init field */ l->type = LTC_ASN1_IA5_STRING; l->size = len; if ((l->data = XCALLOC(1, l->size)) == NULL) { err = CRYPT_MEM; goto error; } if ((err = der_decode_ia5_string(in, *inlen, AUTO_CAST(l->data), &l->size)) != CRYPT_OK) { goto error; } if ((err = der_length_ia5_string(AUTO_CAST(l->data), l->size, &len)) != CRYPT_OK) { goto error; } break; case 0x17: /* UTC TIME */ /* init field */ l->type = LTC_ASN1_UTCTIME; l->size = 1; if ((l->data = XCALLOC(1, sizeof(ltc_utctime))) == NULL) { err = CRYPT_MEM; goto error; } len = *inlen; if ((err = der_decode_utctime(in, &len, AUTO_CAST(l->data))) != CRYPT_OK) { goto error; } if ((err = der_length_utctime(AUTO_CAST(l->data), &len)) != CRYPT_OK) { goto error; } break; case 0x30: /* SEQUENCE */ case 0x31: /* SET */ /* init field */ l->type = (type == 0x30) ? LTC_ASN1_SEQUENCE : LTC_ASN1_SET; /* we have to decode the SEQUENCE header and get it's length */ /* move past type */ ++in; --(*inlen); /* read length byte */ x = *in++; --(*inlen); /* smallest SEQUENCE/SET header */ y = 2; /* now if it's > 127 the next bytes are the length of the length */ if (x > 128) { x &= 0x7F; in += x; *inlen -= x; /* update sequence header len */ y += x; } /* Sequence elements go as child */ len = len - y; if ((err = der_decode_sequence_flexi(in, &len, &(l->child))) != CRYPT_OK) { goto error; } /* len update */ totlen += y; /* link them up y0 */ l->child->parent = l; break; default: /* invalid byte ... this is a soft error */ /* remove link */ l = l->prev; XFREE(l->next); l->next = NULL; goto outside; } /* advance pointers */ totlen += len; in += len; *inlen -= len; } outside: /* rewind l please */ while (l->prev != NULL || l->parent != NULL) { if (l->parent != NULL) { l = l->parent; } else { l = l->prev; } } /* return */ *out = l; *inlen = totlen; return CRYPT_OK; error: /* free list */ der_sequence_free(l); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c,v $ */ /* $Revision: 1.26 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include /** @file der_decode_sequence_multi.c ASN.1 DER, decode a SEQUENCE, Tom St Denis */ #ifdef LTC_DER /** Decode a SEQUENCE type using a VA list @param in Input buffer @param inlen Length of input in octets @remark <...> is of the form (int, unsigned long, void*) @return CRYPT_OK on success */ int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...) { int err, type; unsigned long size, x; void *data; va_list args; ltc_asn1_list *list; LTC_ARGCHK(in != NULL); /* get size of output that will be required */ va_start(args, inlen); x = 0; for ( ; ; ) { type = va_arg(args, int); size = va_arg(args, unsigned long); data = va_arg(args, void *); if (type == LTC_ASN1_EOL) { break; } switch (type) { case LTC_ASN1_BOOLEAN: case LTC_ASN1_INTEGER: case LTC_ASN1_SHORT_INTEGER: case LTC_ASN1_BIT_STRING: case LTC_ASN1_OCTET_STRING: case LTC_ASN1_NULL: case LTC_ASN1_OBJECT_IDENTIFIER: case LTC_ASN1_IA5_STRING: case LTC_ASN1_PRINTABLE_STRING: case LTC_ASN1_UTF8_STRING: case LTC_ASN1_UTCTIME: case LTC_ASN1_SET: case LTC_ASN1_SETOF: case LTC_ASN1_SEQUENCE: case LTC_ASN1_CHOICE: ++x; break; default: va_end(args); return CRYPT_INVALID_ARG; } } va_end(args); /* allocate structure for x elements */ if (x == 0) { return CRYPT_NOP; } list = AUTO_CAST(XCALLOC(sizeof(*list), x)); if (list == NULL) { return CRYPT_MEM; } /* fill in the structure */ va_start(args, inlen); x = 0; for ( ; ; ) { type = va_arg(args, int); size = va_arg(args, unsigned long); data = va_arg(args, void *); if (type == LTC_ASN1_EOL) { break; } switch (type) { case LTC_ASN1_BOOLEAN: case LTC_ASN1_INTEGER: case LTC_ASN1_SHORT_INTEGER: case LTC_ASN1_BIT_STRING: case LTC_ASN1_OCTET_STRING: case LTC_ASN1_NULL: case LTC_ASN1_OBJECT_IDENTIFIER: case LTC_ASN1_IA5_STRING: case LTC_ASN1_PRINTABLE_STRING: case LTC_ASN1_UTF8_STRING: case LTC_ASN1_UTCTIME: case LTC_ASN1_SEQUENCE: case LTC_ASN1_SET: case LTC_ASN1_SETOF: case LTC_ASN1_CHOICE: list[x].type = type; list[x].size = size; list[x++].data = data; break; default: va_end(args); err = CRYPT_INVALID_ARG; goto LBL_ERR; } } va_end(args); err = der_decode_sequence(in, inlen, list, x); LBL_ERR: XFREE(list); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c,v $ */ /* $Revision: 1.13 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_short_integer.c ASN.1 DER, decode an integer, Tom St Denis */ #ifdef LTC_DER /** Read a short integer @param in The DER encoded data @param inlen Size of data @param num [out] The integer to decode @return CRYPT_OK if successful */ int der_decode_short_integer(const unsigned char *in, unsigned long inlen, unsigned long *num) { unsigned long len, x, y; LTC_ARGCHK(num != NULL); LTC_ARGCHK(in != NULL); /* check length */ if (inlen < 2) { return CRYPT_INVALID_PACKET; } /* check header */ x = 0; if ((in[x++] & 0x1F) != 0x02) { return CRYPT_INVALID_PACKET; } /* get the packet len */ len = in[x++]; if (x + len > inlen) { return CRYPT_INVALID_PACKET; } /* read number */ y = 0; while (len--) { y = (y << 8) | (unsigned long)in[x++]; } *num = y; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_utctime.c ASN.1 DER, decode a UTCTIME, Tom St Denis */ #ifdef LTC_DER static int char_to_int(unsigned char x) { switch (x) { case '0': return 0; case '1': return 1; case '2': return 2; case '3': return 3; case '4': return 4; case '5': return 5; case '6': return 6; case '7': return 7; case '8': return 8; case '9': return 9; } return 100; } #define DECODE_V(y, max) \ y = char_to_int(buf[x]) * 10 + char_to_int(buf[x + 1]); \ if (y >= max) return CRYPT_INVALID_PACKET; \ x += 2; /** Decodes a UTC time structure in DER format (reads all 6 valid encoding formats) @param in Input buffer @param inlen Length of input buffer in octets @param out [out] Destination of UTC time structure @return CRYPT_OK if successful */ int der_decode_utctime(const unsigned char *in, unsigned long *inlen, ltc_utctime *out) { unsigned char buf[32]; unsigned long x; int y; LTC_ARGCHK(in != NULL); LTC_ARGCHK(inlen != NULL); LTC_ARGCHK(out != NULL); /* check header */ if ((*inlen < 2UL) || (in[1] >= sizeof(buf)) || ((in[1] + 2UL) > *inlen)) { return CRYPT_INVALID_PACKET; } /* decode the string */ for (x = 0; x < in[1]; x++) { y = der_ia5_value_decode(in[x + 2]); if (y == -1) { return CRYPT_INVALID_PACKET; } buf[x] = y; } *inlen = 2 + x; /* possible encodings are YYMMDDhhmmZ YYMMDDhhmm+hh'mm' YYMMDDhhmm-hh'mm' YYMMDDhhmmssZ YYMMDDhhmmss+hh'mm' YYMMDDhhmmss-hh'mm' So let's do a trivial decode upto [including] mm */ x = 0; DECODE_V(out->YY, 100); DECODE_V(out->MM, 13); DECODE_V(out->DD, 32); DECODE_V(out->hh, 24); DECODE_V(out->mm, 60); /* clear timezone and seconds info */ out->off_dir = out->off_hh = out->off_mm = out->ss = 0; /* now is it Z, +, - or 0-9 */ if (buf[x] == 'Z') { return CRYPT_OK; } else if ((buf[x] == '+') || (buf[x] == '-')) { out->off_dir = (buf[x++] == '+') ? 0 : 1; DECODE_V(out->off_hh, 24); DECODE_V(out->off_mm, 60); return CRYPT_OK; } /* decode seconds */ DECODE_V(out->ss, 60); /* now is it Z, +, - */ if (buf[x] == 'Z') { return CRYPT_OK; } else if ((buf[x] == '+') || (buf[x] == '-')) { out->off_dir = (buf[x++] == '+') ? 0 : 1; DECODE_V(out->off_hh, 24); DECODE_V(out->off_mm, 60); return CRYPT_OK; } else { return CRYPT_INVALID_PACKET; } } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c,v $ */ /* $Revision: 1.9 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_decode_utf8_string.c ASN.1 DER, encode a UTF8 STRING, Tom St Denis */ #ifdef LTC_DER /** Store a UTF8 STRING @param in The DER encoded UTF8 STRING @param inlen The size of the DER UTF8 STRING @param out [out] The array of utf8s stored (one per char) @param outlen [in/out] The number of utf8s stored @return CRYPT_OK if successful */ int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, wchar_t *out, unsigned long *outlen) { wchar_t tmp; unsigned long x, y, z, len; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* must have header at least */ if (inlen < 2) { return CRYPT_INVALID_PACKET; } /* check for 0x0C */ if ((in[0] & 0x1F) != 0x0C) { return CRYPT_INVALID_PACKET; } x = 1; /* decode the length */ if (in[x] & 0x80) { /* valid # of bytes in length are 1,2,3 */ y = in[x] & 0x7F; if ((y == 0) || (y > 3) || ((x + y) > inlen)) { return CRYPT_INVALID_PACKET; } /* read the length in */ len = 0; ++x; while (y--) { len = (len << 8) | in[x++]; } } else { len = in[x++] & 0x7F; } if (len + x > inlen) { return CRYPT_INVALID_PACKET; } /* proceed to decode */ for (y = 0; x < inlen; ) { /* get first byte */ tmp = in[x++]; /* count number of bytes */ for (z = 0; (tmp & 0x80) && (z <= 4); z++, tmp = (tmp << 1) & 0xFF); if ((z > 4) || (x + (z - 1) > inlen)) { return CRYPT_INVALID_PACKET; } /* decode, grab upper bits */ tmp >>= z; /* grab remaining bytes */ if (z > 1) { --z; } while (z-- != 0) { if ((in[x] & 0xC0) != 0x80) { return CRYPT_INVALID_PACKET; } tmp = (tmp << 6) | ((wchar_t)in[x++] & 0x3F); } if (y > *outlen) { *outlen = y; return CRYPT_BUFFER_OVERFLOW; } out[y++] = tmp; } *outlen = y; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c,v $ */ /* $Revision: 1.8 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_bit_string.c ASN.1 DER, encode a BIT STRING, Tom St Denis */ #ifdef LTC_DER /** Store a BIT STRING @param in The array of bits to store (one per char) @param inlen The number of bits tostore @param out [out] The destination for the DER encoded BIT STRING @param outlen [in/out] The max size and resulting size of the DER BIT STRING @return CRYPT_OK if successful */ int der_encode_bit_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { unsigned long len, x, y; unsigned char buf; int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* avoid overflows */ if ((err = der_length_bit_string(inlen, &len)) != CRYPT_OK) { return err; } if (len > *outlen) { *outlen = len; return CRYPT_BUFFER_OVERFLOW; } /* store header (include bit padding count in length) */ x = 0; y = (inlen >> 3) + ((inlen & 7) ? 1 : 0) + 1; out[x++] = 0x03; if (y < 128) { out[x++] = (unsigned char)y; } else if (y < 256) { out[x++] = 0x81; out[x++] = (unsigned char)y; } else if (y < 65536) { out[x++] = 0x82; out[x++] = (unsigned char)((y >> 8) & 255); out[x++] = (unsigned char)(y & 255); } /* store number of zero padding bits */ out[x++] = (unsigned char)((8 - inlen) & 7); /* store the bits in big endian format */ for (y = buf = 0; y < inlen; y++) { buf |= (in[y] ? 1 : 0) << (7 - (y & 7)); if ((y & 7) == 7) { out[x++] = buf; buf = 0; } } /* store last byte */ if (inlen & 7) { out[x++] = buf; } *outlen = x; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_boolean.c ASN.1 DER, encode a BOOLEAN, Tom St Denis */ #ifdef LTC_DER /** Store a BOOLEAN @param in The boolean to encode @param out [out] The destination for the DER encoded BOOLEAN @param outlen [in/out] The max size and resulting size of the DER BOOLEAN @return CRYPT_OK if successful */ int der_encode_boolean(int in, unsigned char *out, unsigned long *outlen) { LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(out != NULL); if (*outlen < 3) { *outlen = 3; return CRYPT_BUFFER_OVERFLOW; } *outlen = 3; out[0] = 0x01; out[1] = 0x01; out[2] = in ? 0xFF : 0x00; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c,v $ */ /* $Revision: 1.4 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_ia5_string.c ASN.1 DER, encode a IA5 STRING, Tom St Denis */ #ifdef LTC_DER /** Store an IA5 STRING @param in The array of IA5 to store (one per char) @param inlen The number of IA5 to store @param out [out] The destination for the DER encoded IA5 STRING @param outlen [in/out] The max size and resulting size of the DER IA5 STRING @return CRYPT_OK if successful */ int der_encode_ia5_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { unsigned long x, y, len; int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* get the size */ if ((err = der_length_ia5_string(in, inlen, &len)) != CRYPT_OK) { return err; } /* too big? */ if (len > *outlen) { *outlen = len; return CRYPT_BUFFER_OVERFLOW; } /* encode the header+len */ x = 0; out[x++] = 0x16; if (inlen < 128) { out[x++] = (unsigned char)inlen; } else if (inlen < 256) { out[x++] = 0x81; out[x++] = (unsigned char)inlen; } else if (inlen < 65536UL) { out[x++] = 0x82; out[x++] = (unsigned char)((inlen >> 8) & 255); out[x++] = (unsigned char)(inlen & 255); } else if (inlen < 16777216UL) { out[x++] = 0x83; out[x++] = (unsigned char)((inlen >> 16) & 255); out[x++] = (unsigned char)((inlen >> 8) & 255); out[x++] = (unsigned char)(inlen & 255); } else { return CRYPT_INVALID_ARG; } /* store octets */ for (y = 0; y < inlen; y++) { out[x++] = der_ia5_char_encode(in[y]); } /* retun length */ *outlen = x; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_integer.c ASN.1 DER, encode an integer, Tom St Denis */ #ifdef LTC_DER /* Exports a positive bignum as DER format (upto 2^32 bytes in size) */ /** Store a mp_int integer @param num The first mp_int to encode @param out [out] The destination for the DER encoded integers @param outlen [in/out] The max size and resulting size of the DER encoded integers @return CRYPT_OK if successful */ int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen) { unsigned long tmplen, y; int err, leading_zero; LTC_ARGCHK(num != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* find out how big this will be */ if ((err = der_length_integer(num, &tmplen)) != CRYPT_OK) { return err; } if (*outlen < tmplen) { *outlen = tmplen; return CRYPT_BUFFER_OVERFLOW; } if (mp_cmp_d(num, 0) != LTC_MP_LT) { /* we only need a leading zero if the msb of the first byte is one */ if (((mp_count_bits(num) & 7) == 0) || (mp_iszero(num) == LTC_MP_YES)) { leading_zero = 1; } else { leading_zero = 0; } /* get length of num in bytes (plus 1 since we force the msbyte to zero) */ y = mp_unsigned_bin_size(num) + leading_zero; } else { leading_zero = 0; y = mp_count_bits(num); y = y + (8 - (y & 7)); y = y >> 3; if (((mp_cnt_lsb(num) + 1) == mp_count_bits(num)) && ((mp_count_bits(num) & 7) == 0)) --y; } /* now store initial data */ *out++ = 0x02; if (y < 128) { /* short form */ *out++ = (unsigned char)y; } else if (y < 256) { *out++ = 0x81; *out++ = (unsigned char)y; } else if (y < 65536UL) { *out++ = 0x82; *out++ = (unsigned char)((y >> 8) & 255); *out++ = (unsigned char)y; } else if (y < 16777216UL) { *out++ = 0x83; *out++ = (unsigned char)((y >> 16) & 255); *out++ = (unsigned char)((y >> 8) & 255); *out++ = (unsigned char)y; } else { return CRYPT_INVALID_ARG; } /* now store msbyte of zero if num is non-zero */ if (leading_zero) { *out++ = 0x00; } /* if it's not zero store it as big endian */ if (mp_cmp_d(num, 0) == LTC_MP_GT) { /* now store the mpint */ if ((err = mp_to_unsigned_bin(num, out)) != CRYPT_OK) { return err; } } else if (mp_iszero(num) != LTC_MP_YES) { void *tmp; /* negative */ if (mp_init(&tmp) != CRYPT_OK) { return CRYPT_MEM; } /* 2^roundup and subtract */ y = mp_count_bits(num); y = y + (8 - (y & 7)); if (((mp_cnt_lsb(num) + 1) == mp_count_bits(num)) && ((mp_count_bits(num) & 7) == 0)) y -= 8; if ((mp_2expt(tmp, y) != CRYPT_OK) || (mp_add(tmp, num, tmp) != CRYPT_OK)) { mp_clear(tmp); return CRYPT_MEM; } if ((err = mp_to_unsigned_bin(tmp, out)) != CRYPT_OK) { mp_clear(tmp); return err; } mp_clear(tmp); } /* we good */ *outlen = tmplen; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c,v $ */ /* $Revision: 1.9 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_object_identifier.c ASN.1 DER, Encode Object Identifier, Tom St Denis */ #ifdef LTC_DER /** Encode an OID @param words The words to encode (upto 32-bits each) @param nwords The number of words in the OID @param out [out] Destination of OID data @param outlen [in/out] The max and resulting size of the OID @return CRYPT_OK if successful */ int der_encode_object_identifier(unsigned long *words, unsigned long nwords, unsigned char *out, unsigned long *outlen) { unsigned long i, x, y, z, t, mask, wordbuf; int err; LTC_ARGCHK(words != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* check length */ if ((err = der_length_object_identifier(words, nwords, &x)) != CRYPT_OK) { return err; } if (x > *outlen) { *outlen = x; return CRYPT_BUFFER_OVERFLOW; } /* compute length to store OID data */ z = 0; wordbuf = words[0] * 40 + words[1]; for (y = 1; y < nwords; y++) { t = der_object_identifier_bits(wordbuf); z += t / 7 + ((t % 7) ? 1 : 0) + (wordbuf == 0 ? 1 : 0); if (y < nwords - 1) { wordbuf = words[y + 1]; } } /* store header + length */ x = 0; out[x++] = 0x06; if (z < 128) { out[x++] = (unsigned char)z; } else if (z < 256) { out[x++] = 0x81; out[x++] = (unsigned char)z; } else if (z < 65536UL) { out[x++] = 0x82; out[x++] = (unsigned char)((z >> 8) & 255); out[x++] = (unsigned char)(z & 255); } else { return CRYPT_INVALID_ARG; } /* store first byte */ wordbuf = words[0] * 40 + words[1]; for (i = 1; i < nwords; i++) { /* store 7 bit words in little endian */ t = wordbuf & 0xFFFFFFFF; if (t) { y = x; mask = 0; while (t) { out[x++] = (unsigned char)((t & 0x7F) | mask); t >>= 7; mask |= 0x80; /* upper bit is set on all but the last byte */ } /* now swap bytes y...x-1 */ z = x - 1; while (y < z) { t = out[y]; out[y] = out[z]; out[z] = (unsigned char)t; ++y; --z; } } else { /* zero word */ out[x++] = 0x00; } if (i < nwords - 1) { wordbuf = words[i + 1]; } } *outlen = x; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_octet_string.c ASN.1 DER, encode a OCTET STRING, Tom St Denis */ #ifdef LTC_DER /** Store an OCTET STRING @param in The array of OCTETS to store (one per char) @param inlen The number of OCTETS to store @param out [out] The destination for the DER encoded OCTET STRING @param outlen [in/out] The max size and resulting size of the DER OCTET STRING @return CRYPT_OK if successful */ int der_encode_octet_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { unsigned long x, y, len; int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* get the size */ if ((err = der_length_octet_string(inlen, &len)) != CRYPT_OK) { return err; } /* too big? */ if (len > *outlen) { *outlen = len; return CRYPT_BUFFER_OVERFLOW; } /* encode the header+len */ x = 0; out[x++] = 0x04; if (inlen < 128) { out[x++] = (unsigned char)inlen; } else if (inlen < 256) { out[x++] = 0x81; out[x++] = (unsigned char)inlen; } else if (inlen < 65536UL) { out[x++] = 0x82; out[x++] = (unsigned char)((inlen >> 8) & 255); out[x++] = (unsigned char)(inlen & 255); } else if (inlen < 16777216UL) { out[x++] = 0x83; out[x++] = (unsigned char)((inlen >> 16) & 255); out[x++] = (unsigned char)((inlen >> 8) & 255); out[x++] = (unsigned char)(inlen & 255); } else { return CRYPT_INVALID_ARG; } /* store octets */ for (y = 0; y < inlen; y++) { out[x++] = in[y]; } /* retun length */ *outlen = x; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_printable_string.c ASN.1 DER, encode a printable STRING, Tom St Denis */ #ifdef LTC_DER /** Store an printable STRING @param in The array of printable to store (one per char) @param inlen The number of printable to store @param out [out] The destination for the DER encoded printable STRING @param outlen [in/out] The max size and resulting size of the DER printable STRING @return CRYPT_OK if successful */ int der_encode_printable_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { unsigned long x, y, len; int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* get the size */ if ((err = der_length_printable_string(in, inlen, &len)) != CRYPT_OK) { return err; } /* too big? */ if (len > *outlen) { *outlen = len; return CRYPT_BUFFER_OVERFLOW; } /* encode the header+len */ x = 0; out[x++] = 0x13; if (inlen < 128) { out[x++] = (unsigned char)inlen; } else if (inlen < 256) { out[x++] = 0x81; out[x++] = (unsigned char)inlen; } else if (inlen < 65536UL) { out[x++] = 0x82; out[x++] = (unsigned char)((inlen >> 8) & 255); out[x++] = (unsigned char)(inlen & 255); } else if (inlen < 16777216UL) { out[x++] = 0x83; out[x++] = (unsigned char)((inlen >> 16) & 255); out[x++] = (unsigned char)((inlen >> 8) & 255); out[x++] = (unsigned char)(inlen & 255); } else { return CRYPT_INVALID_ARG; } /* store octets */ for (y = 0; y < inlen; y++) { out[x++] = der_printable_char_encode(in[y]); } /* retun length */ *outlen = x; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include /** @file der_encode_sequence_ex.c ASN.1 DER, encode a SEQUENCE, Tom St Denis */ #ifdef LTC_DER /** Encode a SEQUENCE @param list The list of items to encode @param inlen The number of items in the list @param out [out] The destination @param outlen [in/out] The size of the output @param type_of LTC_ASN1_SEQUENCE or LTC_ASN1_SET/LTC_ASN1_SETOF @return CRYPT_OK on success */ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, unsigned char *out, unsigned long *outlen, int type_of) { int err, type; unsigned long size, x, y, z, i; void *data; LTC_ARGCHK(list != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* get size of output that will be required */ y = 0; for (i = 0; i < inlen; i++) { type = list[i].type; size = list[i].size; data = list[i].data; if (type == LTC_ASN1_EOL) { break; } switch (type) { case LTC_ASN1_BOOLEAN: if ((err = der_length_boolean(&x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_INTEGER: if ((err = der_length_integer(data, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_SHORT_INTEGER: if ((err = der_length_short_integer(*((unsigned long *)data), &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_BIT_STRING: if ((err = der_length_bit_string(size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_OCTET_STRING: if ((err = der_length_octet_string(size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_NULL: y += 2; break; case LTC_ASN1_OBJECT_IDENTIFIER: if ((err = der_length_object_identifier(AUTO_CAST(data), size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_IA5_STRING: if ((err = der_length_ia5_string(AUTO_CAST(data), size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_PRINTABLE_STRING: if ((err = der_length_printable_string(AUTO_CAST(data), size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_UTF8_STRING: if ((err = der_length_utf8_string(AUTO_CAST(data), size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_UTCTIME: if ((err = der_length_utctime(AUTO_CAST(data), &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_SET: case LTC_ASN1_SETOF: case LTC_ASN1_SEQUENCE: if ((err = der_length_sequence(AUTO_CAST(data), size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; default: err = CRYPT_INVALID_ARG; goto LBL_ERR; } } /* calc header size */ z = y; if (y < 128) { y += 2; } else if (y < 256) { /* 0x30 0x81 LL */ y += 3; } else if (y < 65536UL) { /* 0x30 0x82 LL LL */ y += 4; } else if (y < 16777216UL) { /* 0x30 0x83 LL LL LL */ y += 5; } else { err = CRYPT_INVALID_ARG; goto LBL_ERR; } /* too big ? */ if (*outlen < y) { *outlen = y; err = CRYPT_BUFFER_OVERFLOW; goto LBL_ERR; } /* store header */ x = 0; out[x++] = (type_of == LTC_ASN1_SEQUENCE) ? 0x30 : 0x31; if (z < 128) { out[x++] = (unsigned char)z; } else if (z < 256) { out[x++] = 0x81; out[x++] = (unsigned char)z; } else if (z < 65536UL) { out[x++] = 0x82; out[x++] = (unsigned char)((z >> 8UL) & 255); out[x++] = (unsigned char)(z & 255); } else if (z < 16777216UL) { out[x++] = 0x83; out[x++] = (unsigned char)((z >> 16UL) & 255); out[x++] = (unsigned char)((z >> 8UL) & 255); out[x++] = (unsigned char)(z & 255); } /* store data */ *outlen -= x; for (i = 0; i < inlen; i++) { type = list[i].type; size = list[i].size; data = list[i].data; if (type == LTC_ASN1_EOL) { break; } switch (type) { case LTC_ASN1_BOOLEAN: z = *outlen; if ((err = der_encode_boolean(*((int *)data), out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_INTEGER: z = *outlen; if ((err = der_encode_integer(data, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_SHORT_INTEGER: z = *outlen; if ((err = der_encode_short_integer(*((unsigned long *)data), out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_BIT_STRING: z = *outlen; if ((err = der_encode_bit_string(AUTO_CAST(data), size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_OCTET_STRING: z = *outlen; if ((err = der_encode_octet_string(AUTO_CAST(data), size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_NULL: out[x++] = 0x05; out[x++] = 0x00; *outlen -= 2; break; case LTC_ASN1_OBJECT_IDENTIFIER: z = *outlen; if ((err = der_encode_object_identifier(AUTO_CAST(data), size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_IA5_STRING: z = *outlen; if ((err = der_encode_ia5_string(AUTO_CAST(data), size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_PRINTABLE_STRING: z = *outlen; if ((err = der_encode_printable_string(AUTO_CAST(data), size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_UTF8_STRING: z = *outlen; if ((err = der_encode_utf8_string(AUTO_CAST(data), size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_UTCTIME: z = *outlen; if ((err = der_encode_utctime(AUTO_CAST(data), out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_SET: z = *outlen; if ((err = der_encode_set(AUTO_CAST(data), size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_SETOF: z = *outlen; if ((err = der_encode_setof(AUTO_CAST(data), size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; case LTC_ASN1_SEQUENCE: z = *outlen; if ((err = der_encode_sequence_ex(AUTO_CAST(data), size, out + x, &z, type)) != CRYPT_OK) { goto LBL_ERR; } x += z; *outlen -= z; break; default: err = CRYPT_INVALID_ARG; goto LBL_ERR; } } *outlen = x; err = CRYPT_OK; LBL_ERR: return err; } #endif /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include /** @file der_encode_sequence_multi.c ASN.1 DER, encode a SEQUENCE, Tom St Denis */ #ifdef LTC_DER /** Encode a SEQUENCE type using a VA list @param out [out] Destination for data @param outlen [in/out] Length of buffer and resulting length of output @remark <...> is of the form (int, unsigned long, void*) @return CRYPT_OK on success */ int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...) { int err, type; unsigned long size, x; void *data; va_list args; ltc_asn1_list *list; LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* get size of output that will be required */ va_start(args, outlen); x = 0; for ( ; ; ) { type = va_arg(args, int); size = va_arg(args, unsigned long); data = va_arg(args, void *); if (type == LTC_ASN1_EOL) { break; } switch (type) { case LTC_ASN1_BOOLEAN: case LTC_ASN1_INTEGER: case LTC_ASN1_SHORT_INTEGER: case LTC_ASN1_BIT_STRING: case LTC_ASN1_OCTET_STRING: case LTC_ASN1_NULL: case LTC_ASN1_OBJECT_IDENTIFIER: case LTC_ASN1_IA5_STRING: case LTC_ASN1_PRINTABLE_STRING: case LTC_ASN1_UTF8_STRING: case LTC_ASN1_UTCTIME: case LTC_ASN1_SEQUENCE: case LTC_ASN1_SET: case LTC_ASN1_SETOF: ++x; break; default: va_end(args); return CRYPT_INVALID_ARG; } } va_end(args); /* allocate structure for x elements */ if (x == 0) { return CRYPT_NOP; } list = AUTO_CAST(XCALLOC(sizeof(*list), x)); if (list == NULL) { return CRYPT_MEM; } /* fill in the structure */ va_start(args, outlen); x = 0; for ( ; ; ) { type = va_arg(args, int); size = va_arg(args, unsigned long); data = va_arg(args, void *); if (type == LTC_ASN1_EOL) { break; } switch (type) { case LTC_ASN1_BOOLEAN: case LTC_ASN1_INTEGER: case LTC_ASN1_SHORT_INTEGER: case LTC_ASN1_BIT_STRING: case LTC_ASN1_OCTET_STRING: case LTC_ASN1_NULL: case LTC_ASN1_OBJECT_IDENTIFIER: case LTC_ASN1_IA5_STRING: case LTC_ASN1_PRINTABLE_STRING: case LTC_ASN1_UTF8_STRING: case LTC_ASN1_UTCTIME: case LTC_ASN1_SEQUENCE: case LTC_ASN1_SET: case LTC_ASN1_SETOF: list[x].type = type; list[x].size = size; list[x++].data = data; break; default: va_end(args); err = CRYPT_INVALID_ARG; goto LBL_ERR; } } va_end(args); err = der_encode_sequence(list, x, out, outlen); LBL_ERR: XFREE(list); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c,v $ */ /* $Revision: 1.12 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_set.c ASN.1 DER, Encode a SET, Tom St Denis */ #ifdef LTC_DER /* LTC define to ASN.1 TAG */ static int ltc_to_asn1(int v) { switch (v) { case LTC_ASN1_BOOLEAN: return 0x01; case LTC_ASN1_INTEGER: case LTC_ASN1_SHORT_INTEGER: return 0x02; case LTC_ASN1_BIT_STRING: return 0x03; case LTC_ASN1_OCTET_STRING: return 0x04; case LTC_ASN1_NULL: return 0x05; case LTC_ASN1_OBJECT_IDENTIFIER: return 0x06; case LTC_ASN1_UTF8_STRING: return 0x0C; case LTC_ASN1_PRINTABLE_STRING: return 0x13; case LTC_ASN1_IA5_STRING: return 0x16; case LTC_ASN1_UTCTIME: return 0x17; case LTC_ASN1_SEQUENCE: return 0x30; case LTC_ASN1_SET: case LTC_ASN1_SETOF: return 0x31; default: return -1; } } static int qsort_helper_set(const void *a, const void *b) { ltc_asn1_list *A = (ltc_asn1_list *)a, *B = (ltc_asn1_list *)b; int r; r = ltc_to_asn1(A->type) - ltc_to_asn1(B->type); /* for QSORT the order is UNDEFINED if they are "equal" which means it is NOT DETERMINISTIC. So we force it to be :-) */ if (r == 0) { /* their order in the original list now determines the position */ return A->used - B->used; } else { return r; } } /* Encode a SET type @param list The list of items to encode @param inlen The number of items in the list @param out [out] The destination @param outlen [in/out] The size of the output @return CRYPT_OK on success */ int der_encode_set(ltc_asn1_list *list, unsigned long inlen, unsigned char *out, unsigned long *outlen) { ltc_asn1_list *copy; unsigned long x; int err; /* make copy of list */ copy = AUTO_CAST(XCALLOC(inlen, sizeof(*copy))); if (copy == NULL) { return CRYPT_MEM; } /* fill in used member with index so we can fully sort it */ for (x = 0; x < inlen; x++) { copy[x] = list[x]; copy[x].used = x; } /* sort it by the "type" field */ XQSORT(copy, inlen, sizeof(*copy), &qsort_helper_set); /* call der_encode_sequence_ex() */ err = der_encode_sequence_ex(copy, inlen, out, outlen, LTC_ASN1_SET); /* free list */ XFREE(copy); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c,v $ */ /* $Revision: 1.12 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_setof.c ASN.1 DER, Encode SET OF, Tom St Denis */ #ifdef LTC_DER struct edge { unsigned char *start; unsigned long size; }; static int qsort_helper(const void *a, const void *b) { struct edge *A = (struct edge *)a, *B = (struct edge *)b; int r; unsigned long x; /* compare min length */ r = XMEMCMP(A->start, B->start, MIN(A->size, B->size)); if ((r == 0) && (A->size != B->size)) { if (A->size > B->size) { for (x = B->size; x < A->size; x++) { if (A->start[x]) { return 1; } } } else { for (x = A->size; x < B->size; x++) { if (B->start[x]) { return -1; } } } } return r; } /** Encode a SETOF stucture @param list The list of items to encode @param inlen The number of items in the list @param out [out] The destination @param outlen [in/out] The size of the output @return CRYPT_OK on success */ int der_encode_setof(ltc_asn1_list *list, unsigned long inlen, unsigned char *out, unsigned long *outlen) { unsigned long x, y, z, hdrlen; int err; struct edge *edges; unsigned char *ptr, *buf; /* check that they're all the same type */ for (x = 1; x < inlen; x++) { if (list[x].type != list[x - 1].type) { return CRYPT_INVALID_ARG; } } /* alloc buffer to store copy of output */ buf = AUTO_CAST(XCALLOC(1, *outlen)); if (buf == NULL) { return CRYPT_MEM; } /* encode list */ if ((err = der_encode_sequence_ex(list, inlen, buf, outlen, LTC_ASN1_SETOF)) != CRYPT_OK) { XFREE(buf); return err; } /* allocate edges */ edges = AUTO_CAST(XCALLOC(inlen, sizeof(*edges))); if (edges == NULL) { XFREE(buf); return CRYPT_MEM; } /* skip header */ ptr = buf + 1; /* now skip length data */ x = *ptr++; if (x >= 0x80) { ptr += (x & 0x7F); } /* get the size of the static header */ hdrlen = ((uintptr_t)ptr) - ((uintptr_t)buf); //<@r-lyeh /* scan for edges */ x = 0; while (ptr < (buf + *outlen)) { /* store start */ edges[x].start = ptr; /* skip type */ z = 1; /* parse length */ y = ptr[z++]; if (y < 128) { edges[x].size = y; } else { y &= 0x7F; edges[x].size = 0; while (y--) { edges[x].size = (edges[x].size << 8) | ((unsigned long)ptr[z++]); } } /* skip content */ edges[x].size += z; ptr += edges[x].size; ++x; } /* sort based on contents (using edges) */ XQSORT(edges, inlen, sizeof(*edges), &qsort_helper); /* copy static header */ XMEMCPY(out, buf, hdrlen); /* copy+sort using edges+indecies to output from buffer */ for (y = hdrlen, x = 0; x < inlen; x++) { XMEMCPY(out + y, edges[x].start, edges[x].size); y += edges[x].size; } #ifdef LTC_CLEAN_STACK zeromem(buf, *outlen); #endif /* free buffers */ XFREE(edges); XFREE(buf); return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c,v $ */ /* $Revision: 1.12 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_short_integer.c ASN.1 DER, encode an integer, Tom St Denis */ #ifdef LTC_DER /** Store a short integer in the range (0,2^32-1) @param num The integer to encode @param out [out] The destination for the DER encoded integers @param outlen [in/out] The max size and resulting size of the DER encoded integers @return CRYPT_OK if successful */ int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned long *outlen) { unsigned long len, x, y, z; int err; LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* force to 32 bits */ num &= 0xFFFFFFFFUL; /* find out how big this will be */ if ((err = der_length_short_integer(num, &len)) != CRYPT_OK) { return err; } if (*outlen < len) { *outlen = len; return CRYPT_BUFFER_OVERFLOW; } /* get len of output */ z = 0; y = num; while (y) { ++z; y >>= 8; } /* handle zero */ if (z == 0) { z = 1; } /* see if msb is set */ z += (num & (1UL << ((z << 3) - 1))) ? 1 : 0; /* adjust the number so the msB is non-zero */ for (x = 0; (z <= 4) && (x < (4 - z)); x++) { num <<= 8; } /* store header */ x = 0; out[x++] = 0x02; out[x++] = (unsigned char)z; /* if 31st bit is set output a leading zero and decrement count */ if (z == 5) { out[x++] = 0; --z; } /* store values */ for (y = 0; y < z; y++) { out[x++] = (unsigned char)((num >> 24) & 0xFF); num <<= 8; } /* we good */ *outlen = x; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c,v $ */ /* $Revision: 1.8 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_utctime.c ASN.1 DER, encode a UTCTIME, Tom St Denis */ #ifdef LTC_DER static const char baseten[] = "0123456789"; #define STORE_V(y) \ out[x++] = der_ia5_char_encode(baseten[(y / 10) % 10]); \ out[x++] = der_ia5_char_encode(baseten[y % 10]); /** Encodes a UTC time structure in DER format @param utctime The UTC time structure to encode @param out The destination of the DER encoding of the UTC time structure @param outlen [in/out] The length of the DER encoding @return CRYPT_OK if successful */ int der_encode_utctime(ltc_utctime *utctime, unsigned char *out, unsigned long *outlen) { unsigned long x, tmplen; int err; LTC_ARGCHK(utctime != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); if ((err = der_length_utctime(utctime, &tmplen)) != CRYPT_OK) { return err; } if (tmplen > *outlen) { *outlen = tmplen; return CRYPT_BUFFER_OVERFLOW; } /* store header */ out[0] = 0x17; /* store values */ x = 2; STORE_V(utctime->YY); STORE_V(utctime->MM); STORE_V(utctime->DD); STORE_V(utctime->hh); STORE_V(utctime->mm); STORE_V(utctime->ss); if (utctime->off_mm || utctime->off_hh) { out[x++] = der_ia5_char_encode(utctime->off_dir ? '-' : '+'); STORE_V(utctime->off_hh); STORE_V(utctime->off_mm); } else { out[x++] = der_ia5_char_encode('Z'); } /* store length */ out[1] = (unsigned char)(x - 2); /* all good let's return */ *outlen = x; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c,v $ */ /* $Revision: 1.10 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_encode_utf8_string.c ASN.1 DER, encode a UTF8 STRING, Tom St Denis */ #ifdef LTC_DER /** Store an UTF8 STRING @param in The array of UTF8 to store (one per wchar_t) @param inlen The number of UTF8 to store @param out [out] The destination for the DER encoded UTF8 STRING @param outlen [in/out] The max size and resulting size of the DER UTF8 STRING @return CRYPT_OK if successful */ int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { unsigned long x, y, len; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* get the size */ for (x = len = 0; x < inlen; x++) { if ((in[x] < 0) || (in[x] > 0x1FFFF)) { return CRYPT_INVALID_ARG; } len += der_utf8_charsize(in[x]); } if (len < 128) { y = 2 + len; } else if (len < 256) { y = 3 + len; } else if (len < 65536UL) { y = 4 + len; } else if (len < 16777216UL) { y = 5 + len; } else { return CRYPT_INVALID_ARG; } /* too big? */ if (y > *outlen) { *outlen = len; return CRYPT_BUFFER_OVERFLOW; } /* encode the header+len */ x = 0; out[x++] = 0x0C; if (len < 128) { out[x++] = (unsigned char)len; } else if (len < 256) { out[x++] = 0x81; out[x++] = (unsigned char)len; } else if (len < 65536UL) { out[x++] = 0x82; out[x++] = (unsigned char)((len >> 8) & 255); out[x++] = (unsigned char)(len & 255); } else if (len < 16777216UL) { out[x++] = 0x83; out[x++] = (unsigned char)((len >> 16) & 255); out[x++] = (unsigned char)((len >> 8) & 255); out[x++] = (unsigned char)(len & 255); } else { return CRYPT_INVALID_ARG; } /* store UTF8 */ for (y = 0; y < inlen; y++) { switch (der_utf8_charsize(in[y])) { case 1: out[x++] = (unsigned char)in[y]; break; case 2: out[x++] = 0xC0 | ((in[y] >> 6) & 0x1F); out[x++] = 0x80 | (in[y] & 0x3F); break; case 3: out[x++] = 0xE0 | ((in[y] >> 12) & 0x0F); out[x++] = 0x80 | ((in[y] >> 6) & 0x3F); out[x++] = 0x80 | (in[y] & 0x3F); break; case 4: out[x++] = 0xF0 | ((in[y] >> 18) & 0x07); out[x++] = 0x80 | ((in[y] >> 12) & 0x3F); out[x++] = 0x80 | ((in[y] >> 6) & 0x3F); out[x++] = 0x80 | (in[y] & 0x3F); break; } } /* retun length */ *outlen = x; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c,v $ */ /* $Revision: 1.9 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_length_bit_string.c ASN.1 DER, get length of BIT STRING, Tom St Denis */ #ifdef LTC_DER /** Gets length of DER encoding of BIT STRING @param nbits The number of bits in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful */ int der_length_bit_string(unsigned long nbits, unsigned long *outlen) { unsigned long nbytes; LTC_ARGCHK(outlen != NULL); /* get the number of the bytes */ nbytes = (nbits >> 3) + ((nbits & 7) ? 1 : 0) + 1; if (nbytes < 128) { /* 03 LL PP DD DD DD ... */ *outlen = 2 + nbytes; } else if (nbytes < 256) { /* 03 81 LL PP DD DD DD ... */ *outlen = 3 + nbytes; } else if (nbytes < 65536) { /* 03 82 LL LL PP DD DD DD ... */ *outlen = 4 + nbytes; } else { return CRYPT_INVALID_ARG; } return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c,v $ */ /* $Revision: 1.3 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_length_boolean.c ASN.1 DER, get length of a BOOLEAN, Tom St Denis */ #ifdef LTC_DER /** Gets length of DER encoding of a BOOLEAN @param outlen [out] The length of the DER encoding @return CRYPT_OK if successful */ int der_length_boolean(unsigned long *outlen) { LTC_ARGCHK(outlen != NULL); *outlen = 3; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c,v $ */ /* $Revision: 1.3 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_length_ia5_string.c ASN.1 DER, get length of IA5 STRING, Tom St Denis */ #ifdef LTC_DER static const struct { int code, value; } ia5_table[] = { { '\0', 0 }, { '\a', 7 }, { '\b', 8 }, { '\t', 9 }, { '\n', 10 }, { '\f', 12 }, { '\r', 13 }, { ' ', 32 }, { '!', 33 }, { '"', 34 }, { '#', 35 }, { '$', 36 }, { '%', 37 }, { '&', 38 }, { '\'', 39 }, { '(', 40 }, { ')', 41 }, { '*', 42 }, { '+', 43 }, { ',', 44 }, { '-', 45 }, { '.', 46 }, { '/', 47 }, { '0', 48 }, { '1', 49 }, { '2', 50 }, { '3', 51 }, { '4', 52 }, { '5', 53 }, { '6', 54 }, { '7', 55 }, { '8', 56 }, { '9', 57 }, { ':', 58 }, { ';', 59 }, { '<', 60 }, { '=', 61 }, { '>', 62 }, { '?', 63 }, { '@', 64 }, { 'A', 65 }, { 'B', 66 }, { 'C', 67 }, { 'D', 68 }, { 'E', 69 }, { 'F', 70 }, { 'G', 71 }, { 'H', 72 }, { 'I', 73 }, { 'J', 74 }, { 'K', 75 }, { 'L', 76 }, { 'M', 77 }, { 'N', 78 }, { 'O', 79 }, { 'P', 80 }, { 'Q', 81 }, { 'R', 82 }, { 'S', 83 }, { 'T', 84 }, { 'U', 85 }, { 'V', 86 }, { 'W', 87 }, { 'X', 88 }, { 'Y', 89 }, { 'Z', 90 }, { '[', 91 }, { '\\', 92 }, { ']', 93 }, { '^', 94 }, { '_', 95 }, { '`', 96 }, { 'a', 97 }, { 'b', 98 }, { 'c', 99 }, { 'd', 100 }, { 'e', 101 }, { 'f', 102 }, { 'g', 103 }, { 'h', 104 }, { 'i', 105 }, { 'j', 106 }, { 'k', 107 }, { 'l', 108 }, { 'm', 109 }, { 'n', 110 }, { 'o', 111 }, { 'p', 112 }, { 'q', 113 }, { 'r', 114 }, { 's', 115 }, { 't', 116 }, { 'u', 117 }, { 'v', 118 }, { 'w', 119 }, { 'x', 120 }, { 'y', 121 }, { 'z', 122 }, { '{', 123 }, { '|', 124 }, { '}', 125 }, { '~', 126 } }; int der_ia5_char_encode(int c) { int x; for (x = 0; x < (int)(sizeof(ia5_table) / sizeof(ia5_table[0])); x++) { if (ia5_table[x].code == c) { return ia5_table[x].value; } } return -1; } int der_ia5_value_decode(int v) { int x; for (x = 0; x < (int)(sizeof(ia5_table) / sizeof(ia5_table[0])); x++) { if (ia5_table[x].value == v) { return ia5_table[x].code; } } return -1; } /** Gets length of DER encoding of IA5 STRING @param octets The values you want to encode @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful */ int der_length_ia5_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen) { unsigned long x; LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(octets != NULL); /* scan string for validity */ for (x = 0; x < noctets; x++) { if (der_ia5_char_encode(octets[x]) == -1) { return CRYPT_INVALID_ARG; } } if (noctets < 128) { /* 16 LL DD DD DD ... */ *outlen = 2 + noctets; } else if (noctets < 256) { /* 16 81 LL DD DD DD ... */ *outlen = 3 + noctets; } else if (noctets < 65536UL) { /* 16 82 LL LL DD DD DD ... */ *outlen = 4 + noctets; } else if (noctets < 16777216UL) { /* 16 83 LL LL LL DD DD DD ... */ *outlen = 5 + noctets; } else { return CRYPT_INVALID_ARG; } return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c,v $ */ /* $Revision: 1.3 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_length_integer.c ASN.1 DER, get length of encoding, Tom St Denis */ #ifdef LTC_DER /** Gets length of DER encoding of num @param num The int to get the size of @param outlen [out] The length of the DER encoding for the given integer @return CRYPT_OK if successful */ int der_length_integer(void *num, unsigned long *outlen) { unsigned long z, len; int leading_zero; LTC_ARGCHK(num != NULL); LTC_ARGCHK(outlen != NULL); if (mp_cmp_d(num, 0) != LTC_MP_LT) { /* positive */ /* we only need a leading zero if the msb of the first byte is one */ if (((mp_count_bits(num) & 7) == 0) || (mp_iszero(num) == LTC_MP_YES)) { leading_zero = 1; } else { leading_zero = 0; } /* size for bignum */ z = len = leading_zero + mp_unsigned_bin_size(num); } else { /* it's negative */ /* find power of 2 that is a multiple of eight and greater than count bits */ leading_zero = 0; z = mp_count_bits(num); z = z + (8 - (z & 7)); if (((mp_cnt_lsb(num) + 1) == mp_count_bits(num)) && ((mp_count_bits(num) & 7) == 0)) --z; len = z = z >> 3; } /* now we need a length */ if (z < 128) { /* short form */ ++len; } else { /* long form (relies on z != 0), assumes length bytes < 128 */ ++len; while (z) { ++len; z >>= 8; } } /* we need a 0x02 to indicate it's INTEGER */ ++len; /* return length */ *outlen = len; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_length_object_identifier.c ASN.1 DER, get length of Object Identifier, Tom St Denis */ #ifdef LTC_DER unsigned long der_object_identifier_bits(unsigned long x) { unsigned long c; x &= 0xFFFFFFFF; c = 0; while (x) { ++c; x >>= 1; } return c; } /** Gets length of DER encoding of Object Identifier @param nwords The number of OID words @param words The actual OID words to get the size of @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful */ int der_length_object_identifier(unsigned long *words, unsigned long nwords, unsigned long *outlen) { unsigned long y, z, t, wordbuf; LTC_ARGCHK(words != NULL); LTC_ARGCHK(outlen != NULL); /* must be >= 2 words */ if (nwords < 2) { return CRYPT_INVALID_ARG; } /* word1 = 0,1,2,3 and word2 0..39 */ if ((words[0] > 3) || ((words[0] < 2) && (words[1] > 39))) { return CRYPT_INVALID_ARG; } /* leading word is the first two */ z = 0; wordbuf = words[0] * 40 + words[1]; for (y = 1; y < nwords; y++) { t = der_object_identifier_bits(wordbuf); z += t / 7 + ((t % 7) ? 1 : 0) + (wordbuf == 0 ? 1 : 0); if (y < nwords - 1) { /* grab next word */ wordbuf = words[y + 1]; } } /* now depending on the length our length encoding changes */ if (z < 128) { z += 2; } else if (z < 256) { z += 3; } else if (z < 65536UL) { z += 4; } else { return CRYPT_INVALID_ARG; } *outlen = z; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_length_octet_string.c ASN.1 DER, get length of OCTET STRING, Tom St Denis */ #ifdef LTC_DER /** Gets length of DER encoding of OCTET STRING @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful */ int der_length_octet_string(unsigned long noctets, unsigned long *outlen) { LTC_ARGCHK(outlen != NULL); if (noctets < 128) { /* 04 LL DD DD DD ... */ *outlen = 2 + noctets; } else if (noctets < 256) { /* 04 81 LL DD DD DD ... */ *outlen = 3 + noctets; } else if (noctets < 65536UL) { /* 04 82 LL LL DD DD DD ... */ *outlen = 4 + noctets; } else if (noctets < 16777216UL) { /* 04 83 LL LL LL DD DD DD ... */ *outlen = 5 + noctets; } else { return CRYPT_INVALID_ARG; } return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c,v $ */ /* $Revision: 1.3 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_length_printable_string.c ASN.1 DER, get length of Printable STRING, Tom St Denis */ #ifdef LTC_DER static const struct { int code, value; } printable_table[] = { { ' ', 32 }, { '\'', 39 }, { '(', 40 }, { ')', 41 }, { '+', 43 }, { ',', 44 }, { '-', 45 }, { '.', 46 }, { '/', 47 }, { '0', 48 }, { '1', 49 }, { '2', 50 }, { '3', 51 }, { '4', 52 }, { '5', 53 }, { '6', 54 }, { '7', 55 }, { '8', 56 }, { '9', 57 }, { ':', 58 }, { '=', 61 }, { '?', 63 }, { 'A', 65 }, { 'B', 66 }, { 'C', 67 }, { 'D', 68 }, { 'E', 69 }, { 'F', 70 }, { 'G', 71 }, { 'H', 72 }, { 'I', 73 }, { 'J', 74 }, { 'K', 75 }, { 'L', 76 }, { 'M', 77 }, { 'N', 78 }, { 'O', 79 }, { 'P', 80 }, { 'Q', 81 }, { 'R', 82 }, { 'S', 83 }, { 'T', 84 }, { 'U', 85 }, { 'V', 86 }, { 'W', 87 }, { 'X', 88 }, { 'Y', 89 }, { 'Z', 90 }, { 'a', 97 }, { 'b', 98 }, { 'c', 99 }, { 'd', 100 }, { 'e', 101 }, { 'f', 102 }, { 'g', 103 }, { 'h', 104 }, { 'i', 105 }, { 'j', 106 }, { 'k', 107 }, { 'l', 108 }, { 'm', 109 }, { 'n', 110 }, { 'o', 111 }, { 'p', 112 }, { 'q', 113 }, { 'r', 114 }, { 's', 115 }, { 't', 116 }, { 'u', 117 }, { 'v', 118 }, { 'w', 119 }, { 'x', 120 }, { 'y', 121 }, { 'z', 122 }, }; int der_printable_char_encode(int c) { int x; for (x = 0; x < (int)(sizeof(printable_table) / sizeof(printable_table[0])); x++) { if (printable_table[x].code == c) { return printable_table[x].value; } } return -1; } int der_printable_value_decode(int v) { int x; for (x = 0; x < (int)(sizeof(printable_table) / sizeof(printable_table[0])); x++) { if (printable_table[x].value == v) { return printable_table[x].code; } } return -1; } /** Gets length of DER encoding of Printable STRING @param octets The values you want to encode @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful */ int der_length_printable_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen) { unsigned long x; LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(octets != NULL); /* scan string for validity */ for (x = 0; x < noctets; x++) { if (der_printable_char_encode(octets[x]) == -1) { return CRYPT_INVALID_ARG; } } if (noctets < 128) { /* 16 LL DD DD DD ... */ *outlen = 2 + noctets; } else if (noctets < 256) { /* 16 81 LL DD DD DD ... */ *outlen = 3 + noctets; } else if (noctets < 65536UL) { /* 16 82 LL LL DD DD DD ... */ *outlen = 4 + noctets; } else if (noctets < 16777216UL) { /* 16 83 LL LL LL DD DD DD ... */ *outlen = 5 + noctets; } else { return CRYPT_INVALID_ARG; } return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c,v $ */ /* $Revision: 1.3 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_length_sequence.c ASN.1 DER, length a SEQUENCE, Tom St Denis */ #ifdef LTC_DER /** Get the length of a DER sequence @param list The sequences of items in the SEQUENCE @param inlen The number of items @param outlen [out] The length required in octets to store it @return CRYPT_OK on success */ int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, unsigned long *outlen) { int err, type; unsigned long size, x, y, z, i; void *data; LTC_ARGCHK(list != NULL); LTC_ARGCHK(outlen != NULL); /* get size of output that will be required */ y = 0; for (i = 0; i < inlen; i++) { type = list[i].type; size = list[i].size; data = list[i].data; if (type == LTC_ASN1_EOL) { break; } switch (type) { case LTC_ASN1_BOOLEAN: if ((err = der_length_boolean(&x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_INTEGER: if ((err = der_length_integer(data, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_SHORT_INTEGER: if ((err = der_length_short_integer(*((unsigned long *)data), &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_BIT_STRING: if ((err = der_length_bit_string(size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_OCTET_STRING: if ((err = der_length_octet_string(size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_NULL: y += 2; break; case LTC_ASN1_OBJECT_IDENTIFIER: if ((err = der_length_object_identifier(AUTO_CAST(data), size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_IA5_STRING: if ((err = der_length_ia5_string(AUTO_CAST(data), size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_PRINTABLE_STRING: if ((err = der_length_printable_string(AUTO_CAST(data), size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_UTCTIME: if ((err = der_length_utctime(AUTO_CAST(data), &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_UTF8_STRING: if ((err = der_length_utf8_string(AUTO_CAST(data), size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; case LTC_ASN1_SET: case LTC_ASN1_SETOF: case LTC_ASN1_SEQUENCE: if ((err = der_length_sequence(AUTO_CAST(data), size, &x)) != CRYPT_OK) { goto LBL_ERR; } y += x; break; default: err = CRYPT_INVALID_ARG; goto LBL_ERR; } } /* calc header size */ z = y; if (y < 128) { y += 2; } else if (y < 256) { /* 0x30 0x81 LL */ y += 3; } else if (y < 65536UL) { /* 0x30 0x82 LL LL */ y += 4; } else if (y < 16777216UL) { /* 0x30 0x83 LL LL LL */ y += 5; } else { err = CRYPT_INVALID_ARG; goto LBL_ERR; } /* store size */ *outlen = y; err = CRYPT_OK; LBL_ERR: return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c,v $ */ /* $Revision: 1.14 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_length_short_integer.c ASN.1 DER, get length of encoding, Tom St Denis */ #ifdef LTC_DER /** Gets length of DER encoding of num @param num The integer to get the size of @param outlen [out] The length of the DER encoding for the given integer @return CRYPT_OK if successful */ int der_length_short_integer(unsigned long num, unsigned long *outlen) { unsigned long z, y, len; LTC_ARGCHK(outlen != NULL); /* force to 32 bits */ num &= 0xFFFFFFFFUL; /* get the number of bytes */ z = 0; y = num; while (y) { ++z; y >>= 8; } /* handle zero */ if (z == 0) { z = 1; } /* we need a 0x02 to indicate it's INTEGER */ len = 1; /* length byte */ ++len; /* bytes in value */ len += z; /* see if msb is set */ len += (num & (1UL << ((z << 3) - 1))) ? 1 : 0; /* return length */ *outlen = len; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_length_utctime.c ASN.1 DER, get length of UTCTIME, Tom St Denis */ #ifdef LTC_DER /** Gets length of DER encoding of UTCTIME @param utctime The UTC time structure to get the size of @param outlen [out] The length of the DER encoding @return CRYPT_OK if successful */ int der_length_utctime(ltc_utctime *utctime, unsigned long *outlen) { LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(utctime != NULL); if ((utctime->off_hh == 0) && (utctime->off_mm == 0)) { /* we encode as YYMMDDhhmmssZ */ *outlen = 2 + 13; } else { /* we encode as YYMMDDhhmmss{+|-}hh'mm' */ *outlen = 2 + 17; } return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_length_utf8_string.c ASN.1 DER, get length of UTF8 STRING, Tom St Denis */ #ifdef LTC_DER /** Return the size in bytes of a UTF-8 character @param c The UTF-8 character to measure @return The size in bytes */ unsigned long der_utf8_charsize(const wchar_t c) { if (c <= 0x7F) { return 1; } else if (c <= 0x7FF) { return 2; } else if (c <= 0xFFFF) { return 3; } else { return 4; } } /** Gets length of DER encoding of UTF8 STRING @param in The characters to measure the length of @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful */ int der_length_utf8_string(const wchar_t *in, unsigned long noctets, unsigned long *outlen) { unsigned long x, len; LTC_ARGCHK(in != NULL); LTC_ARGCHK(outlen != NULL); len = 0; for (x = 0; x < noctets; x++) { if ((in[x] < 0) || (in[x] > 0x10FFFF)) { return CRYPT_INVALID_ARG; } len += der_utf8_charsize(in[x]); } if (len < 128) { /* 0C LL DD DD DD ... */ *outlen = 2 + len; } else if (len < 256) { /* 0C 81 LL DD DD DD ... */ *outlen = 3 + len; } else if (len < 65536UL) { /* 0C 82 LL LL DD DD DD ... */ *outlen = 4 + len; } else if (len < 16777216UL) { /* 0C 83 LL LL LL DD DD DD ... */ *outlen = 5 + len; } else { return CRYPT_INVALID_ARG; } return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file der_sequence_free.c ASN.1 DER, free's a structure allocated by der_decode_sequence_flexi(), Tom St Denis */ #ifdef LTC_DER /** Free memory allocated by der_decode_sequence_flexi() @param in The list to free */ void der_sequence_free(ltc_asn1_list *in) { ltc_asn1_list *l; /* walk to the start of the chain */ while (in->prev != NULL || in->parent != NULL) { if (in->parent != NULL) { in = in->parent; } else { in = in->prev; } } /* now walk the list and free stuff */ while (in != NULL) { /* is there a child? */ if (in->child) { /* disconnect */ in->child->parent = NULL; der_sequence_free(in->child); } switch (in->type) { case LTC_ASN1_SET: case LTC_ASN1_SETOF: case LTC_ASN1_SEQUENCE: break; case LTC_ASN1_INTEGER: if (in->data != NULL) { mp_clear(in->data); } break; default: if (in->data != NULL) { XFREE(in->data); } } /* move to next and free current */ l = in->next; free(in); in = l; } } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c,v $ */ /* $Revision: 1.4 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /* This holds the key settings. ***MUST*** be organized by size from smallest to largest. */ const ltc_ecc_set_type ltc_ecc_sets[] = { #ifdef ECC112 { 14, "SECP112R1", "DB7C2ABF62E35E668076BEAD208B", "659EF8BA043916EEDE8911702B22", "DB7C2ABF62E35E7628DFAC6561C5", "09487239995A5EE76B55F9C2F098", "A89CE5AF8724C0A23E0E0FF77500" }, #endif #ifdef ECC128 { 16, "SECP128R1", "FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFF", "E87579C11079F43DD824993C2CEE5ED3", "FFFFFFFE0000000075A30D1B9038A115", "161FF7528B899B2D0C28607CA52C5B86", "CF5AC8395BAFEB13C02DA292DDED7A83", }, #endif #ifdef ECC160 { 20, "SECP160R1", "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFF", "1C97BEFC54BD7A8B65ACF89F81D4D4ADC565FA45", "0100000000000000000001F4C8F927AED3CA752257", "4A96B5688EF573284664698968C38BB913CBFC82", "23A628553168947D59DCC912042351377AC5FB32", }, #endif #ifdef ECC192 { 24, "ECC-192", "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF", "64210519E59C80E70FA7E9AB72243049FEB8DEECC146B9B1", "FFFFFFFFFFFFFFFFFFFFFFFF99DEF836146BC9B1B4D22831", "188DA80EB03090F67CBF20EB43A18800F4FF0AFD82FF1012", "7192B95FFC8DA78631011ED6B24CDD573F977A11E794811", }, #endif #ifdef ECC224 { 28, "ECC-224", "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF000000000000000000000001", "B4050A850C04B3ABF54132565044B0B7D7BFD8BA270B39432355FFB4", "FFFFFFFFFFFFFFFFFFFFFFFFFFFF16A2E0B8F03E13DD29455C5C2A3D", "B70E0CBD6BB4BF7F321390B94A03C1D356C21122343280D6115C1D21", "BD376388B5F723FB4C22DFE6CD4375A05A07476444D5819985007E34", }, #endif #ifdef ECC256 { 32, "ECC-256", "FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFF", "5AC635D8AA3A93E7B3EBBD55769886BC651D06B0CC53B0F63BCE3C3E27D2604B", "FFFFFFFF00000000FFFFFFFFFFFFFFFFBCE6FAADA7179E84F3B9CAC2FC632551", "6B17D1F2E12C4247F8BCE6E563A440F277037D812DEB33A0F4A13945D898C296", "4FE342E2FE1A7F9B8EE7EB4A7C0F9E162BCE33576B315ECECBB6406837BF51F5", }, #endif #ifdef ECC384 { 48, "ECC-384", "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFF0000000000000000FFFFFFFF", "B3312FA7E23EE7E4988E056BE3F82D19181D9C6EFE8141120314088F5013875AC656398D8A2ED19D2A85C8EDD3EC2AEF", "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC7634D81F4372DDF581A0DB248B0A77AECEC196ACCC52973", "AA87CA22BE8B05378EB1C71EF320AD746E1D3B628BA79B9859F741E082542A385502F25DBF55296C3A545E3872760AB7", "3617DE4A96262C6F5D9E98BF9292DC29F8F41DBD289A147CE9DA3113B5F0B8C00A60B1CE1D7E819D7A431D7C90EA0E5F", }, #endif #ifdef ECC521 { 66, "ECC-521", "1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF", "51953EB9618E1C9A1F929A21A0B68540EEA2DA725B99B315F3B8B489918EF109E156193951EC7E937B1652C0BD3BB1BF073573DF883D2C34F1EF451FD46B503F00", "1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFA51868783BF2F966B7FCC0148F709A5D03BB5C9B8899C47AEBB6FB71E91386409", "C6858E06B70404E9CD9E3ECB662395B4429C648139053FB521F828AF606B4D3DBAA14B5E77EFE75928FE1DC127A2FFA8DE3348B3C1856A429BF97E7E31C2E5BD66", "11839296A789A3BC0045C8A5FB42C7D1BD998F54449579B446817AFBD17273E662C97EE72995EF42640C550B9013FAD0761353C7086A272C24088BE94769FD16650", }, #endif { 0, NULL, NULL, NULL, NULL, NULL, NULL } }; #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc.c,v $ */ /* $Revision: 1.40 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_ansi_x963_export.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** ECC X9.63 (Sec. 4.3.6) uncompressed export @param key Key to export @param out [out] destination of export @param outlen [in/out] Length of destination and final output size Return CRYPT_OK on success */ int ecc_ansi_x963_export(ecc_key *key, unsigned char *out, unsigned long *outlen) { unsigned char buf[ECC_BUF_SIZE]; unsigned long numlen; LTC_ARGCHK(key != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); if (ltc_ecc_is_valid_idx(key->idx) == 0) { return CRYPT_INVALID_ARG; } numlen = key->dp->size; if (*outlen < (1 + 2 * numlen)) { *outlen = 1 + 2 * numlen; return CRYPT_BUFFER_OVERFLOW; } /* store byte 0x04 */ out[0] = 0x04; /* pad and store x */ zeromem(buf, sizeof(buf)); mp_to_unsigned_bin(key->pubkey.x, buf + (numlen - mp_unsigned_bin_size(key->pubkey.x))); XMEMCPY(out + 1, buf, numlen); /* pad and store y */ zeromem(buf, sizeof(buf)); mp_to_unsigned_bin(key->pubkey.y, buf + (numlen - mp_unsigned_bin_size(key->pubkey.y))); XMEMCPY(out + 1 + numlen, buf, numlen); *outlen = 1 + 2 * numlen; return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_ansi_x963_import.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Import an ANSI X9.63 format public key @param in The input data to read @param inlen The length of the input data @param key [out] destination to store imported key \ */ int ecc_ansi_x963_import(const unsigned char *in, unsigned long inlen, ecc_key *key) { return ecc_ansi_x963_import_ex(in, inlen, key, NULL); } int ecc_ansi_x963_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, ltc_ecc_set_type *dp) { int x, err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(key != NULL); /* must be odd */ if ((inlen & 1) == 0) { return CRYPT_INVALID_ARG; } /* init key */ if (mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, NULL) != CRYPT_OK) { return CRYPT_MEM; } /* check for 4, 6 or 7 */ if ((in[0] != 4) && (in[0] != 6) && (in[0] != 7)) { err = CRYPT_INVALID_PACKET; goto error; } /* read data */ if ((err = mp_read_unsigned_bin(key->pubkey.x, (unsigned char *)in + 1, (inlen - 1) >> 1)) != CRYPT_OK) { goto error; } if ((err = mp_read_unsigned_bin(key->pubkey.y, (unsigned char *)in + 1 + ((inlen - 1) >> 1), (inlen - 1) >> 1)) != CRYPT_OK) { goto error; } if ((err = mp_set(key->pubkey.z, 1)) != CRYPT_OK) { goto error; } if (dp == NULL) { /* determine the idx */ for (x = 0; ltc_ecc_sets[x].size != 0; x++) { if ((unsigned)ltc_ecc_sets[x].size >= ((inlen - 1) >> 1)) { break; } } if (ltc_ecc_sets[x].size == 0) { err = CRYPT_INVALID_PACKET; goto error; } /* set the idx */ key->idx = x; key->dp = <c_ecc_sets[x]; } else { if (((inlen - 1) >> 1) != (unsigned long)dp->size) { err = CRYPT_INVALID_PACKET; goto error; } key->idx = -1; key->dp = dp; } key->type = PK_PUBLIC; /* we're done */ return CRYPT_OK; error: mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c,v $ */ /* $Revision: 1.11 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_decrypt_key.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Decrypt an ECC encrypted key @param in The ciphertext @param inlen The length of the ciphertext (octets) @param out [out] The plaintext @param outlen [in/out] The max size and resulting size of the plaintext @param key The corresponding private ECC key @return CRYPT_OK if successful */ int ecc_decrypt_key(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, ecc_key *key) { unsigned char *ecc_shared, *skey, *pub_expt; unsigned long x, y, hashOID[32]; int hash, err; ecc_key pubkey; ltc_asn1_list decode[3]; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); /* right key type? */ if (key->type != PK_PRIVATE) { return CRYPT_PK_NOT_PRIVATE; } /* decode to find out hash */ LTC_SET_ASN1(decode, 0, LTC_ASN1_OBJECT_IDENTIFIER, hashOID, sizeof(hashOID) / sizeof(hashOID[0])); if ((err = der_decode_sequence(in, inlen, decode, 1)) != CRYPT_OK) { return err; } hash = find_hash_oid(hashOID, decode[0].size); if (hash_is_valid(hash) != CRYPT_OK) { return CRYPT_INVALID_PACKET; } /* we now have the hash! */ /* allocate memory */ pub_expt = AUTO_CAST(XMALLOC(ECC_BUF_SIZE)); ecc_shared = AUTO_CAST(XMALLOC(ECC_BUF_SIZE)); skey = AUTO_CAST(XMALLOC(MAXBLOCKSIZE)); if ((pub_expt == NULL) || (ecc_shared == NULL) || (skey == NULL)) { if (pub_expt != NULL) { XFREE(pub_expt); } if (ecc_shared != NULL) { XFREE(ecc_shared); } if (skey != NULL) { XFREE(skey); } return CRYPT_MEM; } LTC_SET_ASN1(decode, 1, LTC_ASN1_OCTET_STRING, pub_expt, ECC_BUF_SIZE); LTC_SET_ASN1(decode, 2, LTC_ASN1_OCTET_STRING, skey, MAXBLOCKSIZE); /* read the structure in now */ if ((err = der_decode_sequence(in, inlen, decode, 3)) != CRYPT_OK) { goto LBL_ERR; } /* import ECC key from packet */ if ((err = ecc_import(AUTO_CAST(decode[1].data), decode[1].size, &pubkey)) != CRYPT_OK) { goto LBL_ERR; } /* make shared key */ x = ECC_BUF_SIZE; if ((err = ecc_shared_secret(key, &pubkey, ecc_shared, &x)) != CRYPT_OK) { ecc_free(&pubkey); goto LBL_ERR; } ecc_free(&pubkey); y = MIN(ECC_BUF_SIZE, MAXBLOCKSIZE); if ((err = hash_memory(hash, ecc_shared, x, ecc_shared, &y)) != CRYPT_OK) { goto LBL_ERR; } /* ensure the hash of the shared secret is at least as big as the encrypt itself */ if (decode[2].size > y) { err = CRYPT_INVALID_PACKET; goto LBL_ERR; } /* avoid buffer overflow */ if (*outlen < decode[2].size) { *outlen = decode[2].size; err = CRYPT_BUFFER_OVERFLOW; goto LBL_ERR; } /* Decrypt the key */ for (x = 0; x < decode[2].size; x++) { out[x] = skey[x] ^ ecc_shared[x]; } *outlen = x; err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK zeromem(pub_expt, ECC_BUF_SIZE); zeromem(ecc_shared, ECC_BUF_SIZE); zeromem(skey, MAXBLOCKSIZE); #endif XFREE(pub_expt); XFREE(ecc_shared); XFREE(skey); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_encrypt_key.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Encrypt a symmetric key with ECC @param in The symmetric key you want to encrypt @param inlen The length of the key to encrypt (octets) @param out [out] The destination for the ciphertext @param outlen [in/out] The max size and resulting size of the ciphertext @param prng An active PRNG state @param wprng The index of the PRNG you wish to use @param hash The index of the hash you want to use @param key The ECC key you want to encrypt to @return CRYPT_OK if successful */ int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, prng_state *prng, int wprng, int hash, ecc_key *key) { unsigned char *pub_expt, *ecc_shared, *skey; ecc_key pubkey; unsigned long x, y, pubkeysize; int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); /* check that wprng/cipher/hash are not invalid */ if ((err = prng_is_valid(wprng)) != CRYPT_OK) { return err; } if ((err = hash_is_valid(hash)) != CRYPT_OK) { return err; } if (inlen > hash_descriptor[hash].hashsize) { return CRYPT_INVALID_HASH; } /* make a random key and export the public copy */ if ((err = ecc_make_key_ex(prng, wprng, &pubkey, key->dp)) != CRYPT_OK) { return err; } pub_expt = AUTO_CAST(XMALLOC(ECC_BUF_SIZE)); ecc_shared = AUTO_CAST(XMALLOC(ECC_BUF_SIZE)); skey = AUTO_CAST(XMALLOC(MAXBLOCKSIZE)); if ((pub_expt == NULL) || (ecc_shared == NULL) || (skey == NULL)) { if (pub_expt != NULL) { XFREE(pub_expt); } if (ecc_shared != NULL) { XFREE(ecc_shared); } if (skey != NULL) { XFREE(skey); } ecc_free(&pubkey); return CRYPT_MEM; } pubkeysize = ECC_BUF_SIZE; if ((err = ecc_export(pub_expt, &pubkeysize, PK_PUBLIC, &pubkey)) != CRYPT_OK) { ecc_free(&pubkey); goto LBL_ERR; } /* make random key */ x = ECC_BUF_SIZE; if ((err = ecc_shared_secret(&pubkey, key, ecc_shared, &x)) != CRYPT_OK) { ecc_free(&pubkey); goto LBL_ERR; } ecc_free(&pubkey); y = MAXBLOCKSIZE; if ((err = hash_memory(hash, ecc_shared, x, skey, &y)) != CRYPT_OK) { goto LBL_ERR; } /* Encrypt key */ for (x = 0; x < inlen; x++) { skey[x] ^= in[x]; } err = der_encode_sequence_multi(out, outlen, LTC_ASN1_OBJECT_IDENTIFIER, hash_descriptor[hash].OIDlen, hash_descriptor[hash].OID, LTC_ASN1_OCTET_STRING, pubkeysize, pub_expt, LTC_ASN1_OCTET_STRING, inlen, skey, LTC_ASN1_EOL, 0UL, NULL); LBL_ERR: #ifdef LTC_CLEAN_STACK /* clean up */ zeromem(pub_expt, ECC_BUF_SIZE); zeromem(ecc_shared, ECC_BUF_SIZE); zeromem(skey, MAXBLOCKSIZE); #endif XFREE(skey); XFREE(ecc_shared); XFREE(pub_expt); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_export.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Export an ECC key as a binary packet @param out [out] Destination for the key @param outlen [in/out] Max size and resulting size of the exported key @param type The type of key you want to export (PK_PRIVATE or PK_PUBLIC) @param key The key to export @return CRYPT_OK if successful */ int ecc_export(unsigned char *out, unsigned long *outlen, int type, ecc_key *key) { int err; unsigned char flags[1]; unsigned long key_size; LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); /* type valid? */ if ((key->type != PK_PRIVATE) && (type == PK_PRIVATE)) { return CRYPT_PK_TYPE_MISMATCH; } if (ltc_ecc_is_valid_idx(key->idx) == 0) { return CRYPT_INVALID_ARG; } /* we store the NIST byte size */ key_size = key->dp->size; if (type == PK_PRIVATE) { flags[0] = 1; err = der_encode_sequence_multi(out, outlen, LTC_ASN1_BIT_STRING, 1UL, flags, LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, LTC_ASN1_INTEGER, 1UL, key->pubkey.x, LTC_ASN1_INTEGER, 1UL, key->pubkey.y, LTC_ASN1_INTEGER, 1UL, key->k, LTC_ASN1_EOL, 0UL, NULL); } else { flags[0] = 0; err = der_encode_sequence_multi(out, outlen, LTC_ASN1_BIT_STRING, 1UL, flags, LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, LTC_ASN1_INTEGER, 1UL, key->pubkey.x, LTC_ASN1_INTEGER, 1UL, key->pubkey.y, LTC_ASN1_EOL, 0UL, NULL); } return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_export.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_free.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Free an ECC key from memory @param key The key you wish to free */ void ecc_free(ecc_key *key) { LTC_ARGCHKVD(key != NULL); mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_free.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_get_size.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Get the size of an ECC key @param key The key to get the size of @return The size (octets) of the key or INT_MAX on error */ int ecc_get_size(ecc_key *key) { LTC_ARGCHK(key != NULL); if (ltc_ecc_is_valid_idx(key->idx)) return key->dp->size; else return INT_MAX; /* large value known to cause it to fail when passed to ecc_make_key() */ } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_get_size.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_import.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC static int is_point(ecc_key *key) { void *prime, *b, *t1, *t2; int err; if ((err = mp_init_multi(&prime, &b, &t1, &t2, NULL)) != CRYPT_OK) { return err; } /* load prime and b */ if ((err = mp_read_radix(prime, key->dp->prime, 16)) != CRYPT_OK) { goto error; } if ((err = mp_read_radix(b, key->dp->B, 16)) != CRYPT_OK) { goto error; } /* compute y^2 */ if ((err = mp_sqr(key->pubkey.y, t1)) != CRYPT_OK) { goto error; } /* compute x^3 */ if ((err = mp_sqr(key->pubkey.x, t2)) != CRYPT_OK) { goto error; } if ((err = mp_mod(t2, prime, t2)) != CRYPT_OK) { goto error; } if ((err = mp_mul(key->pubkey.x, t2, t2)) != CRYPT_OK) { goto error; } /* compute y^2 - x^3 */ if ((err = mp_sub(t1, t2, t1)) != CRYPT_OK) { goto error; } /* compute y^2 - x^3 + 3x */ if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } if ((err = mp_mod(t1, prime, t1)) != CRYPT_OK) { goto error; } while (mp_cmp_d(t1, 0) == LTC_MP_LT) { if ((err = mp_add(t1, prime, t1)) != CRYPT_OK) { goto error; } } while (mp_cmp(t1, prime) != LTC_MP_LT) { if ((err = mp_sub(t1, prime, t1)) != CRYPT_OK) { goto error; } } /* compare to b */ if (mp_cmp(t1, b) != LTC_MP_EQ) { err = CRYPT_INVALID_PACKET; } else { err = CRYPT_OK; } error: mp_clear_multi(prime, b, t1, t2, NULL); return err; } /** Import an ECC key from a binary packet @param in The packet to import @param inlen The length of the packet @param key [out] The destination of the import @return CRYPT_OK if successful, upon error all allocated memory will be freed */ int ecc_import(const unsigned char *in, unsigned long inlen, ecc_key *key) { return ecc_import_ex(in, inlen, key, NULL); } /** Import an ECC key from a binary packet, using user supplied domain params rather than one of the NIST ones @param in The packet to import @param inlen The length of the packet @param key [out] The destination of the import @param dp pointer to user supplied params; must be the same as the params used when exporting @return CRYPT_OK if successful, upon error all allocated memory will be freed */ int ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, const ltc_ecc_set_type *dp) { unsigned long key_size; unsigned char flags[1]; int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(key != NULL); LTC_ARGCHK(ltc_mp.name != NULL); /* init key */ if (mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, NULL) != CRYPT_OK) { return CRYPT_MEM; } /* find out what type of key it is */ if ((err = der_decode_sequence_multi(in, inlen, LTC_ASN1_BIT_STRING, 1UL, &flags, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto done; } if (flags[0] == 1) { /* private key */ key->type = PK_PRIVATE; if ((err = der_decode_sequence_multi(in, inlen, LTC_ASN1_BIT_STRING, 1UL, flags, LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, LTC_ASN1_INTEGER, 1UL, key->pubkey.x, LTC_ASN1_INTEGER, 1UL, key->pubkey.y, LTC_ASN1_INTEGER, 1UL, key->k, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto done; } } else { /* public key */ key->type = PK_PUBLIC; if ((err = der_decode_sequence_multi(in, inlen, LTC_ASN1_BIT_STRING, 1UL, flags, LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, LTC_ASN1_INTEGER, 1UL, key->pubkey.x, LTC_ASN1_INTEGER, 1UL, key->pubkey.y, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto done; } } if (dp == NULL) { /* find the idx */ for (key->idx = 0; ltc_ecc_sets[key->idx].size && (unsigned long)ltc_ecc_sets[key->idx].size != key_size; ++key->idx); if (ltc_ecc_sets[key->idx].size == 0) { err = CRYPT_INVALID_PACKET; goto done; } key->dp = <c_ecc_sets[key->idx]; } else { key->idx = -1; key->dp = dp; } /* set z */ if ((err = mp_set(key->pubkey.z, 1)) != CRYPT_OK) { goto done; } /* is it a point on the curve? */ if ((err = is_point(key)) != CRYPT_OK) { goto done; } /* we're good */ return CRYPT_OK; done: mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_import.c,v $ */ /* $Revision: 1.13 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_make_key.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Make a new ECC key @param prng An active PRNG state @param wprng The index of the PRNG you wish to use @param keysize The keysize for the new key (in octets from 20 to 65 bytes) @param key [out] Destination of the newly created key @return CRYPT_OK if successful, upon error all allocated memory will be freed */ int ecc_make_key(prng_state *prng, int wprng, int keysize, ecc_key *key) { int x, err; /* find key size */ for (x = 0; (keysize > ltc_ecc_sets[x].size) && (ltc_ecc_sets[x].size != 0); x++); keysize = ltc_ecc_sets[x].size; if ((keysize > ECC_MAXSIZE) || (ltc_ecc_sets[x].size == 0)) { return CRYPT_INVALID_KEYSIZE; } err = ecc_make_key_ex(prng, wprng, key, <c_ecc_sets[x]); key->idx = x; return err; } int ecc_make_key_ex(prng_state *prng, int wprng, ecc_key *key, const ltc_ecc_set_type *dp) { int err; ecc_point *base; void *prime, *order; unsigned char *buf; int keysize; LTC_ARGCHK(key != NULL); LTC_ARGCHK(ltc_mp.name != NULL); LTC_ARGCHK(dp != NULL); /* good prng? */ if ((err = prng_is_valid(wprng)) != CRYPT_OK) { return err; } key->idx = -1; key->dp = dp; keysize = dp->size; /* allocate ram */ base = NULL; buf = AUTO_CAST(XMALLOC(ECC_MAXSIZE)); if (buf == NULL) { return CRYPT_MEM; } /* make up random string */ if (prng_descriptor[wprng].read(buf, (unsigned long)keysize, prng) != (unsigned long)keysize) { err = CRYPT_ERROR_READPRNG; goto ERR_BUF; } /* setup the key variables */ if ((err = mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, &prime, &order, NULL)) != CRYPT_OK) { goto ERR_BUF; } base = ltc_ecc_new_point(); if (base == NULL) { err = CRYPT_MEM; goto errkey; } /* read in the specs for this key */ if ((err = mp_read_radix(prime, (char *)key->dp->prime, 16)) != CRYPT_OK) { goto errkey; } if ((err = mp_read_radix(order, (char *)key->dp->order, 16)) != CRYPT_OK) { goto errkey; } if ((err = mp_read_radix(base->x, (char *)key->dp->Gx, 16)) != CRYPT_OK) { goto errkey; } if ((err = mp_read_radix(base->y, (char *)key->dp->Gy, 16)) != CRYPT_OK) { goto errkey; } if ((err = mp_set(base->z, 1)) != CRYPT_OK) { goto errkey; } if ((err = mp_read_unsigned_bin(key->k, (unsigned char *)buf, keysize)) != CRYPT_OK) { goto errkey; } /* the key should be smaller than the order of base point */ if (mp_cmp(key->k, order) != LTC_MP_LT) { if ((err = mp_mod(key->k, order, key->k)) != CRYPT_OK) { goto errkey; } } /* make the public key */ if ((err = ltc_mp.ecc_ptmul(key->k, base, &key->pubkey, prime, 1)) != CRYPT_OK) { goto errkey; } key->type = PK_PRIVATE; /* free up ram */ err = CRYPT_OK; goto cleanup; errkey: mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); cleanup: ltc_ecc_del_point(base); mp_clear_multi(prime, order, NULL); ERR_BUF: #ifdef LTC_CLEAN_STACK zeromem(buf, ECC_MAXSIZE); #endif XFREE(buf); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_make_key.c,v $ */ /* $Revision: 1.13 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_shared_secret.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Create an ECC shared secret between two keys @param private_key The private ECC key @param public_key The public key @param out [out] Destination of the shared secret (Conforms to EC-DH from ANSI X9.63) @param outlen [in/out] The max size and resulting size of the shared secret @return CRYPT_OK if successful */ int ecc_shared_secret(ecc_key *private_key, ecc_key *public_key, unsigned char *out, unsigned long *outlen) { unsigned long x; ecc_point *result; void *prime; int err; LTC_ARGCHK(private_key != NULL); LTC_ARGCHK(public_key != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* type valid? */ if (private_key->type != PK_PRIVATE) { return CRYPT_PK_NOT_PRIVATE; } if ((ltc_ecc_is_valid_idx(private_key->idx) == 0) || (ltc_ecc_is_valid_idx(public_key->idx) == 0)) { return CRYPT_INVALID_ARG; } if (XSTRCMP(private_key->dp->name, public_key->dp->name) != 0) { return CRYPT_PK_TYPE_MISMATCH; } /* make new point */ result = ltc_ecc_new_point(); if (result == NULL) { return CRYPT_MEM; } if ((err = mp_init(&prime)) != CRYPT_OK) { ltc_ecc_del_point(result); return err; } if ((err = mp_read_radix(prime, (char *)private_key->dp->prime, 16)) != CRYPT_OK) { goto done; } if ((err = ltc_mp.ecc_ptmul(private_key->k, &public_key->pubkey, result, prime, 1)) != CRYPT_OK) { goto done; } x = (unsigned long)mp_unsigned_bin_size(prime); if (*outlen < x) { *outlen = x; err = CRYPT_BUFFER_OVERFLOW; goto done; } zeromem(out, x); if ((err = mp_to_unsigned_bin(result->x, out + (x - mp_unsigned_bin_size(result->x)))) != CRYPT_OK) { goto done; } err = CRYPT_OK; *outlen = x; done: mp_clear(prime); ltc_ecc_del_point(result); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_shared_secret.c,v $ */ /* $Revision: 1.10 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_sign_hash.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Sign a message digest @param in The message digest to sign @param inlen The length of the digest @param out [out] The destination for the signature @param outlen [in/out] The max size and resulting size of the signature @param prng An active PRNG state @param wprng The index of the PRNG you wish to use @param key A private ECC key @return CRYPT_OK if successful */ int ecc_sign_hash(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, prng_state *prng, int wprng, ecc_key *key) { ecc_key pubkey; void *r, *s, *e, *p; int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); /* is this a private key? */ if (key->type != PK_PRIVATE) { return CRYPT_PK_NOT_PRIVATE; } /* is the IDX valid ? */ if (ltc_ecc_is_valid_idx(key->idx) != 1) { return CRYPT_PK_INVALID_TYPE; } if ((err = prng_is_valid(wprng)) != CRYPT_OK) { return err; } /* get the hash and load it as a bignum into 'e' */ /* init the bignums */ if ((err = mp_init_multi(&r, &s, &p, &e, NULL)) != CRYPT_OK) { return err; } if ((err = mp_read_radix(p, (char *)key->dp->order, 16)) != CRYPT_OK) { goto errnokey; } if ((err = mp_read_unsigned_bin(e, (unsigned char *)in, (int)inlen)) != CRYPT_OK) { goto errnokey; } /* make up a key and export the public copy */ for ( ; ; ) { if ((err = ecc_make_key_ex(prng, wprng, &pubkey, key->dp)) != CRYPT_OK) { goto errnokey; } /* find r = x1 mod n */ if ((err = mp_mod(pubkey.pubkey.x, p, r)) != CRYPT_OK) { goto error; } if (mp_iszero(r) == LTC_MP_YES) { ecc_free(&pubkey); } else { /* find s = (e + xr)/k */ if ((err = mp_invmod(pubkey.k, p, pubkey.k)) != CRYPT_OK) { goto error; } /* k = 1/k */ if ((err = mp_mulmod(key->k, r, p, s)) != CRYPT_OK) { goto error; } /* s = xr */ if ((err = mp_add(e, s, s)) != CRYPT_OK) { goto error; } /* s = e + xr */ if ((err = mp_mod(s, p, s)) != CRYPT_OK) { goto error; } /* s = e + xr */ if ((err = mp_mulmod(s, pubkey.k, p, s)) != CRYPT_OK) { goto error; } /* s = (e + xr)/k */ ecc_free(&pubkey); if (mp_iszero(s) == LTC_MP_NO) { break; } } } /* store as SEQUENCE { r, s -- integer } */ err = der_encode_sequence_multi(out, outlen, LTC_ASN1_INTEGER, 1UL, r, LTC_ASN1_INTEGER, 1UL, s, LTC_ASN1_EOL, 0UL, NULL); goto errnokey; error: ecc_free(&pubkey); errnokey: mp_clear_multi(r, s, p, e, NULL); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_sign_hash.c,v $ */ /* $Revision: 1.11 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_sizes.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC void ecc_sizes(int *low, int *high) { int i; LTC_ARGCHKVD(low != NULL); LTC_ARGCHKVD(high != NULL); *low = INT_MAX; *high = 0; for (i = 0; ltc_ecc_sets[i].size != 0; i++) { if (ltc_ecc_sets[i].size < *low) { *low = ltc_ecc_sets[i].size; } if (ltc_ecc_sets[i].size > *high) { *high = ltc_ecc_sets[i].size; } } } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_sizes.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_test.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Perform on the ECC system @return CRYPT_OK if successful */ int ecc_test(void) { void *modulus, *order; ecc_point *G, *GG; int i, err, primality; if ((err = mp_init_multi(&modulus, &order, NULL)) != CRYPT_OK) { return err; } G = ltc_ecc_new_point(); GG = ltc_ecc_new_point(); if ((G == NULL) || (GG == NULL)) { mp_clear_multi(modulus, order, NULL); ltc_ecc_del_point(G); ltc_ecc_del_point(GG); return CRYPT_MEM; } for (i = 0; ltc_ecc_sets[i].size; i++) { #if 0 printf("Testing %d\n", ltc_ecc_sets[i].size); #endif if ((err = mp_read_radix(modulus, (char *)ltc_ecc_sets[i].prime, 16)) != CRYPT_OK) { goto done; } if ((err = mp_read_radix(order, (char *)ltc_ecc_sets[i].order, 16)) != CRYPT_OK) { goto done; } /* is prime actually prime? */ if ((err = mp_prime_is_prime(modulus, 8, &primality)) != CRYPT_OK) { goto done; } if (primality == 0) { err = CRYPT_FAIL_TESTVECTOR; goto done; } /* is order prime ? */ if ((err = mp_prime_is_prime(order, 8, &primality)) != CRYPT_OK) { goto done; } if (primality == 0) { err = CRYPT_FAIL_TESTVECTOR; goto done; } if ((err = mp_read_radix(G->x, (char *)ltc_ecc_sets[i].Gx, 16)) != CRYPT_OK) { goto done; } if ((err = mp_read_radix(G->y, (char *)ltc_ecc_sets[i].Gy, 16)) != CRYPT_OK) { goto done; } mp_set(G->z, 1); /* then we should have G == (order + 1)G */ if ((err = mp_add_d(order, 1, order)) != CRYPT_OK) { goto done; } if ((err = ltc_mp.ecc_ptmul(order, G, GG, modulus, 1)) != CRYPT_OK) { goto done; } if ((mp_cmp(G->x, GG->x) != LTC_MP_EQ) || (mp_cmp(G->y, GG->y) != LTC_MP_EQ)) { err = CRYPT_FAIL_TESTVECTOR; goto done; } } err = CRYPT_OK; done: ltc_ecc_del_point(GG); ltc_ecc_del_point(G); mp_clear_multi(order, modulus, NULL); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_test.c,v $ */ /* $Revision: 1.12 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ecc_verify_hash.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /* verify * * w = s^-1 mod n * u1 = xw * u2 = rw * X = u1*G + u2*Q * v = X_x1 mod n * accept if v == r */ /** Verify an ECC signature @param sig The signature to verify @param siglen The length of the signature (octets) @param hash The hash (message digest) that was signed @param hashlen The length of the hash (octets) @param stat Result of signature, 1==valid, 0==invalid @param key The corresponding public ECC key @return CRYPT_OK if successful (even if the signature is not valid) */ int ecc_verify_hash(const unsigned char *sig, unsigned long siglen, const unsigned char *hash, unsigned long hashlen, int *stat, ecc_key *key) { ecc_point *mG, *mQ; void *r, *s, *v, *w, *u1, *u2, *e, *p, *m; void *mp; int err; LTC_ARGCHK(sig != NULL); LTC_ARGCHK(hash != NULL); LTC_ARGCHK(stat != NULL); LTC_ARGCHK(key != NULL); /* default to invalid signature */ *stat = 0; mp = NULL; /* is the IDX valid ? */ if (ltc_ecc_is_valid_idx(key->idx) != 1) { return CRYPT_PK_INVALID_TYPE; } /* allocate ints */ if ((err = mp_init_multi(&r, &s, &v, &w, &u1, &u2, &p, &e, &m, NULL)) != CRYPT_OK) { return CRYPT_MEM; } /* allocate points */ mG = ltc_ecc_new_point(); mQ = ltc_ecc_new_point(); if ((mQ == NULL) || (mG == NULL)) { err = CRYPT_MEM; goto error; } /* parse header */ if ((err = der_decode_sequence_multi(sig, siglen, LTC_ASN1_INTEGER, 1UL, r, LTC_ASN1_INTEGER, 1UL, s, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto error; } /* get the order */ if ((err = mp_read_radix(p, (char *)key->dp->order, 16)) != CRYPT_OK) { goto error; } /* get the modulus */ if ((err = mp_read_radix(m, (char *)key->dp->prime, 16)) != CRYPT_OK) { goto error; } /* check for zero */ if (mp_iszero(r) || mp_iszero(s) || (mp_cmp(r, p) != LTC_MP_LT) || (mp_cmp(s, p) != LTC_MP_LT)) { err = CRYPT_INVALID_PACKET; goto error; } /* read hash */ if ((err = mp_read_unsigned_bin(e, (unsigned char *)hash, (int)hashlen)) != CRYPT_OK) { goto error; } /* w = s^-1 mod n */ if ((err = mp_invmod(s, p, w)) != CRYPT_OK) { goto error; } /* u1 = ew */ if ((err = mp_mulmod(e, w, p, u1)) != CRYPT_OK) { goto error; } /* u2 = rw */ if ((err = mp_mulmod(r, w, p, u2)) != CRYPT_OK) { goto error; } /* find mG and mQ */ if ((err = mp_read_radix(mG->x, (char *)key->dp->Gx, 16)) != CRYPT_OK) { goto error; } if ((err = mp_read_radix(mG->y, (char *)key->dp->Gy, 16)) != CRYPT_OK) { goto error; } if ((err = mp_set(mG->z, 1)) != CRYPT_OK) { goto error; } if ((err = mp_copy(key->pubkey.x, mQ->x)) != CRYPT_OK) { goto error; } if ((err = mp_copy(key->pubkey.y, mQ->y)) != CRYPT_OK) { goto error; } if ((err = mp_copy(key->pubkey.z, mQ->z)) != CRYPT_OK) { goto error; } /* compute u1*mG + u2*mQ = mG */ if (ltc_mp.ecc_mul2add == NULL) { if ((err = ltc_mp.ecc_ptmul(u1, mG, mG, m, 0)) != CRYPT_OK) { goto error; } if ((err = ltc_mp.ecc_ptmul(u2, mQ, mQ, m, 0)) != CRYPT_OK) { goto error; } /* find the montgomery mp */ if ((err = mp_montgomery_setup(m, &mp)) != CRYPT_OK) { goto error; } /* add them */ if ((err = ltc_mp.ecc_ptadd(mQ, mG, mG, m, mp)) != CRYPT_OK) { goto error; } /* reduce */ if ((err = ltc_mp.ecc_map(mG, m, mp)) != CRYPT_OK) { goto error; } } else { /* use Shamir's trick to compute u1*mG + u2*mQ using half of the doubles */ if ((err = ltc_mp.ecc_mul2add(mG, u1, mQ, u2, mG, m)) != CRYPT_OK) { goto error; } } /* v = X_x1 mod n */ if ((err = mp_mod(mG->x, p, v)) != CRYPT_OK) { goto error; } /* does v == r */ if (mp_cmp(v, r) == LTC_MP_EQ) { *stat = 1; } /* clear up and return */ err = CRYPT_OK; error: ltc_ecc_del_point(mG); ltc_ecc_del_point(mQ); mp_clear_multi(r, s, v, w, u1, u2, p, e, m, NULL); if (mp != NULL) { mp_montgomery_free(mp); } return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_verify_hash.c,v $ */ /* $Revision: 1.14 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file error_to_string.c Convert error codes to ASCII strings, Tom St Denis */ static const char * const err_2_str[] = { "CRYPT_OK", "CRYPT_ERROR", "Non-fatal 'no-operation' requested.", "Invalid keysize for block cipher.", "Invalid number of rounds for block cipher.", "Algorithm failed test vectors.", "Buffer overflow.", "Invalid input packet.", "Invalid number of bits for a PRNG.", "Error reading the PRNG.", "Invalid cipher specified.", "Invalid hash specified.", "Invalid PRNG specified.", "Out of memory.", "Invalid PK key or key type specified for function.", "A private PK key is required.", "Invalid argument provided.", "File Not Found", "Invalid PK type.", "Invalid PK system.", "Duplicate PK key found on keyring.", "Key not found in keyring.", "Invalid sized parameter.", "Invalid size for prime.", }; /** Convert an LTC error code to ASCII @param err The error code @return A pointer to the ASCII NUL terminated string for the error or "Invalid error code." if the err code was not valid. */ const char *error_to_string(int err) { if ((err < 0) || (err >= (int)(sizeof(err_2_str) / sizeof(err_2_str[0])))) { return "Invalid error code."; } else { return err_2_str[err]; } } /* $Source: /cvs/libtom/libtomcrypt/src/misc/error_to_string.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #define DESC_DEF_ONLY /* $Source: /cvs/libtom/libtomcrypt/src/math/gmp_desc.c,v $ */ /* $Revision: 1.16 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file hash_file.c Hash a file, Tom St Denis */ /** @param hash The index of the hash desired @param fname The name of the file you wish to hash @param out [out] The destination of the digest @param outlen [in/out] The max size and resulting size of the message digest @result CRYPT_OK if successful */ int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *outlen) { #ifdef LTC_NO_FILE return CRYPT_NOP; #else FILE *in; int err; LTC_ARGCHK(fname != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); if ((err = hash_is_valid(hash)) != CRYPT_OK) { return err; } in = fopen(fname, "rb"); if (in == NULL) { return CRYPT_FILE_NOTFOUND; } err = hash_filehandle(hash, in, out, outlen); if (fclose(in) != 0) { return CRYPT_ERROR; } return err; #endif } /* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_file.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:23 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file hash_filehandle.c Hash open files, Tom St Denis */ /** Hash data from an open file handle. @param hash The index of the hash you want to use @param in The FILE* handle of the file you want to hash @param out [out] The destination of the digest @param outlen [in/out] The max size and resulting size of the digest @result CRYPT_OK if successful */ int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen) { #ifdef LTC_NO_FILE return CRYPT_NOP; #else hash_state md; unsigned char buf[512]; size_t x; int err; LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(in != NULL); if ((err = hash_is_valid(hash)) != CRYPT_OK) { return err; } if (*outlen < hash_descriptor[hash].hashsize) { *outlen = hash_descriptor[hash].hashsize; return CRYPT_BUFFER_OVERFLOW; } if ((err = hash_descriptor[hash].init(&md)) != CRYPT_OK) { return err; } *outlen = hash_descriptor[hash].hashsize; do { x = fread(buf, 1, sizeof(buf), in); if ((err = hash_descriptor[hash].process(&md, buf, x)) != CRYPT_OK) { return err; } } while (x == sizeof(buf)); err = hash_descriptor[hash].done(&md, out); #ifdef LTC_CLEAN_STACK zeromem(buf, sizeof(buf)); #endif return err; #endif } /* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_filehandle.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:23 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file hash_memory.c Hash memory helper, Tom St Denis */ /** Hash a block of memory and store the digest. @param hash The index of the hash you wish to use @param in The data you wish to hash @param inlen The length of the data to hash (octets) @param out [out] Where to store the digest @param outlen [in/out] Max size and resulting size of the digest @return CRYPT_OK if successful */ int hash_memory(int hash, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { hash_state *md; int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); if ((err = hash_is_valid(hash)) != CRYPT_OK) { return err; } if (*outlen < hash_descriptor[hash].hashsize) { *outlen = hash_descriptor[hash].hashsize; return CRYPT_BUFFER_OVERFLOW; } md = AUTO_CAST(XMALLOC(sizeof(hash_state))); if (md == NULL) { return CRYPT_MEM; } if ((err = hash_descriptor[hash].init(md)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash].process(md, in, inlen)) != CRYPT_OK) { goto LBL_ERR; } err = hash_descriptor[hash].done(md, out); *outlen = hash_descriptor[hash].hashsize; LBL_ERR: #ifdef LTC_CLEAN_STACK zeromem(md, sizeof(hash_state)); #endif XFREE(md); return err; } /* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_memory.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:23 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include /** @file hash_memory_multi.c Hash (multiple buffers) memory helper, Tom St Denis */ /** Hash multiple (non-adjacent) blocks of memory at once. @param hash The index of the hash you wish to use @param out [out] Where to store the digest @param outlen [in/out] Max size and resulting size of the digest @param in The data you wish to hash @param inlen The length of the data to hash (octets) @param ... tuples of (data,len) pairs to hash, terminated with a (NULL,x) (x=don't care) @return CRYPT_OK if successful */ int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...) { hash_state *md; int err; va_list args; const unsigned char *curptr; unsigned long curlen; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); if ((err = hash_is_valid(hash)) != CRYPT_OK) { return err; } if (*outlen < hash_descriptor[hash].hashsize) { *outlen = hash_descriptor[hash].hashsize; return CRYPT_BUFFER_OVERFLOW; } md = AUTO_CAST(XMALLOC(sizeof(hash_state))); if (md == NULL) { return CRYPT_MEM; } if ((err = hash_descriptor[hash].init(md)) != CRYPT_OK) { goto LBL_ERR; } va_start(args, inlen); curptr = in; curlen = inlen; for ( ; ; ) { /* process buf */ if ((err = hash_descriptor[hash].process(md, curptr, curlen)) != CRYPT_OK) { goto LBL_ERR; } /* step to next */ curptr = va_arg(args, const unsigned char *); if (curptr == NULL) { break; } curlen = va_arg(args, unsigned long); } err = hash_descriptor[hash].done(md, out); *outlen = hash_descriptor[hash].hashsize; LBL_ERR: #ifdef LTC_CLEAN_STACK zeromem(md, sizeof(hash_state)); #endif XFREE(md); va_end(args); return err; } /* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_memory_multi.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:23 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ltc_ecc_is_valid_idx.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Returns whether an ECC idx is valid or not @param n The idx number to check @return 1 if valid, 0 if not */ int ltc_ecc_is_valid_idx(int n) { int x; for (x = 0; ltc_ecc_sets[x].size != 0; x++); /* -1 is a valid index --- indicating that the domain params were supplied by the user */ if ((n >= -1) && (n < x)) { return 1; } return 0; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ltc_ecc_map.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Map a projective jacbobian point back to affine space @param P [in/out] The point to map @param modulus The modulus of the field the ECC curve is in @param mp The "b" value from montgomery_setup() @return CRYPT_OK on success */ int ltc_ecc_map(ecc_point *P, void *modulus, void *mp) { void *t1, *t2; int err; LTC_ARGCHK(P != NULL); LTC_ARGCHK(modulus != NULL); LTC_ARGCHK(mp != NULL); if ((err = mp_init_multi(&t1, &t2, NULL)) != CRYPT_OK) { return CRYPT_MEM; } /* first map z back to normal */ if ((err = mp_montgomery_reduce(P->z, modulus, mp)) != CRYPT_OK) { goto done; } /* get 1/z */ if ((err = mp_invmod(P->z, modulus, t1)) != CRYPT_OK) { goto done; } /* get 1/z^2 and 1/z^3 */ if ((err = mp_sqr(t1, t2)) != CRYPT_OK) { goto done; } if ((err = mp_mod(t2, modulus, t2)) != CRYPT_OK) { goto done; } if ((err = mp_mul(t1, t2, t1)) != CRYPT_OK) { goto done; } if ((err = mp_mod(t1, modulus, t1)) != CRYPT_OK) { goto done; } /* multiply against x/y */ if ((err = mp_mul(P->x, t2, P->x)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(P->x, modulus, mp)) != CRYPT_OK) { goto done; } if ((err = mp_mul(P->y, t1, P->y)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(P->y, modulus, mp)) != CRYPT_OK) { goto done; } if ((err = mp_set(P->z, 1)) != CRYPT_OK) { goto done; } err = CRYPT_OK; done: mp_clear_multi(t1, t2, NULL); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_map.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ltc_ecc_mul2add.c ECC Crypto, Shamir's Trick, Tom St Denis */ #ifdef LTC_MECC #ifdef LTC_ECC_SHAMIR /** Computes kA*A + kB*B = C using Shamir's Trick @param A First point to multiply @param kA What to multiple A by @param B Second point to multiply @param kB What to multiple B by @param C [out] Destination point (can overlap with A or B @param modulus Modulus for curve @return CRYPT_OK on success */ int ltc_ecc_mul2add(ecc_point *A, void *kA, ecc_point *B, void *kB, ecc_point *C, void *modulus) { ecc_point *precomp[16]; unsigned bitbufA, bitbufB, lenA, lenB, len, x, y, nA, nB, nibble; unsigned char *tA, *tB; int err, first; void *mp, *mu; /* argchks */ LTC_ARGCHK(A != NULL); LTC_ARGCHK(B != NULL); LTC_ARGCHK(C != NULL); LTC_ARGCHK(kA != NULL); LTC_ARGCHK(kB != NULL); LTC_ARGCHK(modulus != NULL); /* allocate memory */ tA = AUTO_CAST(XCALLOC(1, ECC_BUF_SIZE)); if (tA == NULL) { return CRYPT_MEM; } tB = AUTO_CAST(XCALLOC(1, ECC_BUF_SIZE)); if (tB == NULL) { XFREE(tA); return CRYPT_MEM; } /* get sizes */ lenA = mp_unsigned_bin_size(kA); lenB = mp_unsigned_bin_size(kB); len = MAX(lenA, lenB); /* sanity check */ if ((lenA > ECC_BUF_SIZE) || (lenB > ECC_BUF_SIZE)) { err = CRYPT_INVALID_ARG; goto ERR_T; } /* extract and justify kA */ mp_to_unsigned_bin(kA, (len - lenA) + tA); /* extract and justify kB */ mp_to_unsigned_bin(kB, (len - lenB) + tB); /* allocate the table */ for (x = 0; x < 16; x++) { precomp[x] = ltc_ecc_new_point(); if (precomp[x] == NULL) { for (y = 0; y < x; ++y) { ltc_ecc_del_point(precomp[y]); } err = CRYPT_MEM; goto ERR_T; } } /* init montgomery reduction */ if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto ERR_P; } if ((err = mp_init(&mu)) != CRYPT_OK) { goto ERR_MP; } if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto ERR_MU; } /* copy ones ... */ if ((err = mp_mulmod(A->x, mu, modulus, precomp[1]->x)) != CRYPT_OK) { goto ERR_MU; } if ((err = mp_mulmod(A->y, mu, modulus, precomp[1]->y)) != CRYPT_OK) { goto ERR_MU; } if ((err = mp_mulmod(A->z, mu, modulus, precomp[1]->z)) != CRYPT_OK) { goto ERR_MU; } if ((err = mp_mulmod(B->x, mu, modulus, precomp[1 << 2]->x)) != CRYPT_OK) { goto ERR_MU; } if ((err = mp_mulmod(B->y, mu, modulus, precomp[1 << 2]->y)) != CRYPT_OK) { goto ERR_MU; } if ((err = mp_mulmod(B->z, mu, modulus, precomp[1 << 2]->z)) != CRYPT_OK) { goto ERR_MU; } /* precomp [i,0](A + B) table */ if ((err = ltc_mp.ecc_ptdbl(precomp[1], precomp[2], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } if ((err = ltc_mp.ecc_ptadd(precomp[1], precomp[2], precomp[3], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } /* precomp [0,i](A + B) table */ if ((err = ltc_mp.ecc_ptdbl(precomp[1 << 2], precomp[2 << 2], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } if ((err = ltc_mp.ecc_ptadd(precomp[1 << 2], precomp[2 << 2], precomp[3 << 2], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } /* precomp [i,j](A + B) table (i != 0, j != 0) */ for (x = 1; x < 4; x++) { for (y = 1; y < 4; y++) { if ((err = ltc_mp.ecc_ptadd(precomp[x], precomp[(y << 2)], precomp[x + (y << 2)], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } } } nibble = 3; first = 1; bitbufA = tA[0]; bitbufB = tB[0]; /* for every byte of the multiplicands */ for (x = -1; ; ) { /* grab a nibble */ if (++nibble == 4) { ++x; if (x == len) break; bitbufA = tA[x]; bitbufB = tB[x]; nibble = 0; } /* extract two bits from both, shift/update */ nA = (bitbufA >> 6) & 0x03; nB = (bitbufB >> 6) & 0x03; bitbufA = (bitbufA << 2) & 0xFF; bitbufB = (bitbufB << 2) & 0xFF; /* if both zero, if first, continue */ if ((nA == 0) && (nB == 0) && (first == 1)) { continue; } /* double twice, only if this isn't the first */ if (first == 0) { /* double twice */ if ((err = ltc_mp.ecc_ptdbl(C, C, modulus, mp)) != CRYPT_OK) { goto ERR_MU; } if ((err = ltc_mp.ecc_ptdbl(C, C, modulus, mp)) != CRYPT_OK) { goto ERR_MU; } } /* if not both zero */ if ((nA != 0) || (nB != 0)) { if (first == 1) { /* if first, copy from table */ first = 0; if ((err = mp_copy(precomp[nA + (nB << 2)]->x, C->x)) != CRYPT_OK) { goto ERR_MU; } if ((err = mp_copy(precomp[nA + (nB << 2)]->y, C->y)) != CRYPT_OK) { goto ERR_MU; } if ((err = mp_copy(precomp[nA + (nB << 2)]->z, C->z)) != CRYPT_OK) { goto ERR_MU; } } else { /* if not first, add from table */ if ((err = ltc_mp.ecc_ptadd(C, precomp[nA + (nB << 2)], C, modulus, mp)) != CRYPT_OK) { goto ERR_MU; } } } } /* reduce to affine */ err = ltc_ecc_map(C, modulus, mp); /* clean up */ ERR_MU: mp_clear(mu); ERR_MP: mp_montgomery_free(mp); ERR_P: for (x = 0; x < 16; x++) { ltc_ecc_del_point(precomp[x]); } ERR_T: #ifdef LTC_CLEAN_STACK zeromem(tA, ECC_BUF_SIZE); zeromem(tB, ECC_BUF_SIZE); #endif XFREE(tA); XFREE(tB); return err; } #endif #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c,v $ */ /* $Revision: 1.8 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ltc_ecc_mulmod.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC #ifndef LTC_ECC_TIMING_RESISTANT /* size of sliding window, don't change this! */ #define WINSIZE 4 /** Perform a point multiplication @param k The scalar to multiply by @param G The base point @param R [out] Destination for kG @param modulus The modulus of the field the ECC curve is in @param map Boolean whether to map back to affine or not (1==map, 0 == leave in projective) @return CRYPT_OK on success */ int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) { ecc_point *tG, *M[8]; int i, j, err; void *mu, *mp; unsigned long buf; int first, bitbuf, bitcpy, bitcnt, mode, digidx; LTC_ARGCHK(k != NULL); LTC_ARGCHK(G != NULL); LTC_ARGCHK(R != NULL); LTC_ARGCHK(modulus != NULL); /* init montgomery reduction */ if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { return err; } if ((err = mp_init(&mu)) != CRYPT_OK) { mp_montgomery_free(mp); return err; } if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { mp_montgomery_free(mp); mp_clear(mu); return err; } /* alloc ram for window temps */ for (i = 0; i < 8; i++) { M[i] = ltc_ecc_new_point(); if (M[i] == NULL) { for (j = 0; j < i; j++) { ltc_ecc_del_point(M[j]); } mp_montgomery_free(mp); mp_clear(mu); return CRYPT_MEM; } } /* make a copy of G incase R==G */ tG = ltc_ecc_new_point(); if (tG == NULL) { err = CRYPT_MEM; goto done; } /* tG = G and convert to montgomery */ if (mp_cmp_d(mu, 1) == LTC_MP_EQ) { if ((err = mp_copy(G->x, tG->x)) != CRYPT_OK) { goto done; } if ((err = mp_copy(G->y, tG->y)) != CRYPT_OK) { goto done; } if ((err = mp_copy(G->z, tG->z)) != CRYPT_OK) { goto done; } } else { if ((err = mp_mulmod(G->x, mu, modulus, tG->x)) != CRYPT_OK) { goto done; } if ((err = mp_mulmod(G->y, mu, modulus, tG->y)) != CRYPT_OK) { goto done; } if ((err = mp_mulmod(G->z, mu, modulus, tG->z)) != CRYPT_OK) { goto done; } } mp_clear(mu); mu = NULL; /* calc the M tab, which holds kG for k==8..15 */ /* M[0] == 8G */ if ((err = ltc_mp.ecc_ptdbl(tG, M[0], modulus, mp)) != CRYPT_OK) { goto done; } if ((err = ltc_mp.ecc_ptdbl(M[0], M[0], modulus, mp)) != CRYPT_OK) { goto done; } if ((err = ltc_mp.ecc_ptdbl(M[0], M[0], modulus, mp)) != CRYPT_OK) { goto done; } /* now find (8+k)G for k=1..7 */ for (j = 9; j < 16; j++) { if ((err = ltc_mp.ecc_ptadd(M[j - 9], tG, M[j - 8], modulus, mp)) != CRYPT_OK) { goto done; } } /* setup sliding window */ mode = 0; bitcnt = 1; buf = 0; digidx = mp_get_digit_count(k) - 1; bitcpy = bitbuf = 0; first = 1; /* perform ops */ for ( ; ; ) { /* grab next digit as required */ if (--bitcnt == 0) { if (digidx == -1) { break; } buf = mp_get_digit(k, digidx); bitcnt = (int)ltc_mp.bits_per_digit; --digidx; } /* grab the next msb from the ltiplicand */ i = (buf >> (ltc_mp.bits_per_digit - 1)) & 1; buf <<= 1; /* skip leading zero bits */ if ((mode == 0) && (i == 0)) { continue; } /* if the bit is zero and mode == 1 then we double */ if ((mode == 1) && (i == 0)) { if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { goto done; } continue; } /* else we add it to the window */ bitbuf |= (i << (WINSIZE - ++bitcpy)); mode = 2; if (bitcpy == WINSIZE) { /* if this is the first window we do a simple copy */ if (first == 1) { /* R = kG [k = first window] */ if ((err = mp_copy(M[bitbuf - 8]->x, R->x)) != CRYPT_OK) { goto done; } if ((err = mp_copy(M[bitbuf - 8]->y, R->y)) != CRYPT_OK) { goto done; } if ((err = mp_copy(M[bitbuf - 8]->z, R->z)) != CRYPT_OK) { goto done; } first = 0; } else { /* normal window */ /* ok window is filled so double as required and add */ /* double first */ for (j = 0; j < WINSIZE; j++) { if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { goto done; } } /* then add, bitbuf will be 8..15 [8..2^WINSIZE] guaranteed */ if ((err = ltc_mp.ecc_ptadd(R, M[bitbuf - 8], R, modulus, mp)) != CRYPT_OK) { goto done; } } /* empty window and reset */ bitcpy = bitbuf = 0; mode = 1; } } /* if bits remain then double/add */ if ((mode == 2) && (bitcpy > 0)) { /* double then add */ for (j = 0; j < bitcpy; j++) { /* only double if we have had at least one add first */ if (first == 0) { if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { goto done; } } bitbuf <<= 1; if ((bitbuf & (1 << WINSIZE)) != 0) { if (first == 1) { /* first add, so copy */ if ((err = mp_copy(tG->x, R->x)) != CRYPT_OK) { goto done; } if ((err = mp_copy(tG->y, R->y)) != CRYPT_OK) { goto done; } if ((err = mp_copy(tG->z, R->z)) != CRYPT_OK) { goto done; } first = 0; } else { /* then add */ if ((err = ltc_mp.ecc_ptadd(R, tG, R, modulus, mp)) != CRYPT_OK) { goto done; } } } } } /* map R back from projective space */ if (map) { err = ltc_ecc_map(R, modulus, mp); } else { err = CRYPT_OK; } done: if (mu != NULL) { mp_clear(mu); } mp_montgomery_free(mp); ltc_ecc_del_point(tG); for (i = 0; i < 8; i++) { ltc_ecc_del_point(M[i]); } return err; } #endif #undef WINSIZE #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c,v $ */ /* $Revision: 1.26 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ltc_ecc_mulmod_timing.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC #ifdef LTC_ECC_TIMING_RESISTANT /** Perform a point multiplication (timing resistant) @param k The scalar to multiply by @param G The base point @param R [out] Destination for kG @param modulus The modulus of the field the ECC curve is in @param map Boolean whether to map back to affine or not (1==map, 0 == leave in projective) @return CRYPT_OK on success */ int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) { ecc_point *tG, *M[3]; int i, j, err; void *mu, *mp; unsigned long buf; int first, bitbuf, bitcpy, bitcnt, mode, digidx; LTC_ARGCHK(k != NULL); LTC_ARGCHK(G != NULL); LTC_ARGCHK(R != NULL); LTC_ARGCHK(modulus != NULL); /* init montgomery reduction */ if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { return err; } if ((err = mp_init(&mu)) != CRYPT_OK) { mp_montgomery_free(mp); return err; } if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { mp_clear(mu); mp_montgomery_free(mp); return err; } /* alloc ram for window temps */ for (i = 0; i < 3; i++) { M[i] = ltc_ecc_new_point(); if (M[i] == NULL) { for (j = 0; j < i; j++) { ltc_ecc_del_point(M[j]); } mp_clear(mu); mp_montgomery_free(mp); return CRYPT_MEM; } } /* make a copy of G incase R==G */ tG = ltc_ecc_new_point(); if (tG == NULL) { err = CRYPT_MEM; goto done; } /* tG = G and convert to montgomery */ if ((err = mp_mulmod(G->x, mu, modulus, tG->x)) != CRYPT_OK) { goto done; } if ((err = mp_mulmod(G->y, mu, modulus, tG->y)) != CRYPT_OK) { goto done; } if ((err = mp_mulmod(G->z, mu, modulus, tG->z)) != CRYPT_OK) { goto done; } mp_clear(mu); mu = NULL; /* calc the M tab */ /* M[0] == G */ if ((err = mp_copy(tG->x, M[0]->x)) != CRYPT_OK) { goto done; } if ((err = mp_copy(tG->y, M[0]->y)) != CRYPT_OK) { goto done; } if ((err = mp_copy(tG->z, M[0]->z)) != CRYPT_OK) { goto done; } /* M[1] == 2G */ if ((err = ltc_mp.ecc_ptdbl(tG, M[1], modulus, mp)) != CRYPT_OK) { goto done; } /* setup sliding window */ mode = 0; bitcnt = 1; buf = 0; digidx = mp_get_digit_count(k) - 1; bitcpy = bitbuf = 0; first = 1; /* perform ops */ for ( ; ; ) { /* grab next digit as required */ if (--bitcnt == 0) { if (digidx == -1) { break; } buf = mp_get_digit(k, digidx); bitcnt = (int)MP_DIGIT_BIT; --digidx; } /* grab the next msb from the ltiplicand */ i = (buf >> (MP_DIGIT_BIT - 1)) & 1; buf <<= 1; if ((mode == 0) && (i == 0)) { /* dummy operations */ if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } if ((err = ltc_mp.ecc_ptdbl(M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } continue; } if ((mode == 0) && (i == 1)) { mode = 1; /* dummy operations */ if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } if ((err = ltc_mp.ecc_ptdbl(M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } continue; } if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[i ^ 1], modulus, mp)) != CRYPT_OK) { goto done; } if ((err = ltc_mp.ecc_ptdbl(M[i], M[i], modulus, mp)) != CRYPT_OK) { goto done; } } /* copy result out */ if ((err = mp_copy(M[0]->x, R->x)) != CRYPT_OK) { goto done; } if ((err = mp_copy(M[0]->y, R->y)) != CRYPT_OK) { goto done; } if ((err = mp_copy(M[0]->z, R->z)) != CRYPT_OK) { goto done; } /* map R back from projective space */ if (map) { err = ltc_ecc_map(R, modulus, mp); } else { err = CRYPT_OK; } done: if (mu != NULL) { mp_clear(mu); } mp_montgomery_free(mp); ltc_ecc_del_point(tG); for (i = 0; i < 3; i++) { ltc_ecc_del_point(M[i]); } return err; } #endif #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c,v $ */ /* $Revision: 1.13 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ltc_ecc_points.c ECC Crypto, Tom St Denis */ #ifdef LTC_MECC /** Allocate a new ECC point @return A newly allocated point or NULL on error */ ecc_point *ltc_ecc_new_point(void) { ecc_point *p; p = AUTO_CAST(XCALLOC(1, sizeof(*p))); if (p == NULL) { return NULL; } if (mp_init_multi(&p->x, &p->y, &p->z, NULL) != CRYPT_OK) { XFREE(p); return NULL; } return p; } /** Free an ECC point from memory @param p The point to free */ void ltc_ecc_del_point(ecc_point *p) { /* prevents free'ing null arguments */ if (p != NULL) { mp_clear_multi(p->x, p->y, p->z, NULL); /* note: p->z may be NULL but that's ok with this function anyways */ XFREE(p); } } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_points.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ltc_ecc_projective_add_point.c ECC Crypto, Tom St Denis */ #if defined(LTC_MECC) && (!defined(LTC_MECC_ACCEL) || defined(LTM_LTC_DESC)) /** Add two ECC points @param P The point to add @param Q The point to add @param R [out] The destination of the double @param modulus The modulus of the field the ECC curve is in @param mp The "b" value from montgomery_setup() @return CRYPT_OK on success */ int ltc_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *mp) { void *t1, *t2, *x, *y, *z; int err; LTC_ARGCHK(P != NULL); LTC_ARGCHK(Q != NULL); LTC_ARGCHK(R != NULL); LTC_ARGCHK(modulus != NULL); LTC_ARGCHK(mp != NULL); if ((err = mp_init_multi(&t1, &t2, &x, &y, &z, NULL)) != CRYPT_OK) { return err; } /* should we dbl instead? */ if ((err = mp_sub(modulus, Q->y, t1)) != CRYPT_OK) { goto done; } if ((mp_cmp(P->x, Q->x) == LTC_MP_EQ) && ((Q->z != NULL) && (mp_cmp(P->z, Q->z) == LTC_MP_EQ)) && ((mp_cmp(P->y, Q->y) == LTC_MP_EQ) || (mp_cmp(P->y, t1) == LTC_MP_EQ))) { mp_clear_multi(t1, t2, x, y, z, NULL); return ltc_ecc_projective_dbl_point(P, R, modulus, mp); } if ((err = mp_copy(P->x, x)) != CRYPT_OK) { goto done; } if ((err = mp_copy(P->y, y)) != CRYPT_OK) { goto done; } if ((err = mp_copy(P->z, z)) != CRYPT_OK) { goto done; } /* if Z is one then these are no-operations */ if (Q->z != NULL) { /* T1 = Z' * Z' */ if ((err = mp_sqr(Q->z, t1)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } /* X = X * T1 */ if ((err = mp_mul(t1, x, x)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } /* T1 = Z' * T1 */ if ((err = mp_mul(Q->z, t1, t1)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } /* Y = Y * T1 */ if ((err = mp_mul(t1, y, y)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(y, modulus, mp)) != CRYPT_OK) { goto done; } } /* T1 = Z*Z */ if ((err = mp_sqr(z, t1)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } /* T2 = X' * T1 */ if ((err = mp_mul(Q->x, t1, t2)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } /* T1 = Z * T1 */ if ((err = mp_mul(z, t1, t1)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } /* T1 = Y' * T1 */ if ((err = mp_mul(Q->y, t1, t1)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } /* Y = Y - T1 */ if ((err = mp_sub(y, t1, y)) != CRYPT_OK) { goto done; } if (mp_cmp_d(y, 0) == LTC_MP_LT) { if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } } /* T1 = 2T1 */ if ((err = mp_add(t1, t1, t1)) != CRYPT_OK) { goto done; } if (mp_cmp(t1, modulus) != LTC_MP_LT) { if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } } /* T1 = Y + T1 */ if ((err = mp_add(t1, y, t1)) != CRYPT_OK) { goto done; } if (mp_cmp(t1, modulus) != LTC_MP_LT) { if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } } /* X = X - T2 */ if ((err = mp_sub(x, t2, x)) != CRYPT_OK) { goto done; } if (mp_cmp_d(x, 0) == LTC_MP_LT) { if ((err = mp_add(x, modulus, x)) != CRYPT_OK) { goto done; } } /* T2 = 2T2 */ if ((err = mp_add(t2, t2, t2)) != CRYPT_OK) { goto done; } if (mp_cmp(t2, modulus) != LTC_MP_LT) { if ((err = mp_sub(t2, modulus, t2)) != CRYPT_OK) { goto done; } } /* T2 = X + T2 */ if ((err = mp_add(t2, x, t2)) != CRYPT_OK) { goto done; } if (mp_cmp(t2, modulus) != LTC_MP_LT) { if ((err = mp_sub(t2, modulus, t2)) != CRYPT_OK) { goto done; } } /* if Z' != 1 */ if (Q->z != NULL) { /* Z = Z * Z' */ if ((err = mp_mul(z, Q->z, z)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(z, modulus, mp)) != CRYPT_OK) { goto done; } } /* Z = Z * X */ if ((err = mp_mul(z, x, z)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(z, modulus, mp)) != CRYPT_OK) { goto done; } /* T1 = T1 * X */ if ((err = mp_mul(t1, x, t1)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } /* X = X * X */ if ((err = mp_sqr(x, x)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } /* T2 = T2 * x */ if ((err = mp_mul(t2, x, t2)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } /* T1 = T1 * X */ if ((err = mp_mul(t1, x, t1)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } /* X = Y*Y */ if ((err = mp_sqr(y, x)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } /* X = X - T2 */ if ((err = mp_sub(x, t2, x)) != CRYPT_OK) { goto done; } if (mp_cmp_d(x, 0) == LTC_MP_LT) { if ((err = mp_add(x, modulus, x)) != CRYPT_OK) { goto done; } } /* T2 = T2 - X */ if ((err = mp_sub(t2, x, t2)) != CRYPT_OK) { goto done; } if (mp_cmp_d(t2, 0) == LTC_MP_LT) { if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } } /* T2 = T2 - X */ if ((err = mp_sub(t2, x, t2)) != CRYPT_OK) { goto done; } if (mp_cmp_d(t2, 0) == LTC_MP_LT) { if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } } /* T2 = T2 * Y */ if ((err = mp_mul(t2, y, t2)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } /* Y = T2 - T1 */ if ((err = mp_sub(t2, t1, y)) != CRYPT_OK) { goto done; } if (mp_cmp_d(y, 0) == LTC_MP_LT) { if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } } /* Y = Y/2 */ if (mp_isodd(y)) { if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } } if ((err = mp_div_2(y, y)) != CRYPT_OK) { goto done; } if ((err = mp_copy(x, R->x)) != CRYPT_OK) { goto done; } if ((err = mp_copy(y, R->y)) != CRYPT_OK) { goto done; } if ((err = mp_copy(z, R->z)) != CRYPT_OK) { goto done; } err = CRYPT_OK; done: mp_clear_multi(t1, t2, x, y, z, NULL); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c,v $ */ /* $Revision: 1.16 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b * * All curves taken from NIST recommendation paper of July 1999 * Available at http://csrc.nist.gov/cryptval/dss.htm */ /** @file ltc_ecc_projective_dbl_point.c ECC Crypto, Tom St Denis */ #if defined(LTC_MECC) && (!defined(LTC_MECC_ACCEL) || defined(LTM_LTC_DESC)) /** Double an ECC point @param P The point to double @param R [out] The destination of the double @param modulus The modulus of the field the ECC curve is in @param mp The "b" value from montgomery_setup() @return CRYPT_OK on success */ int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void *mp) { void *t1, *t2; int err; LTC_ARGCHK(P != NULL); LTC_ARGCHK(R != NULL); LTC_ARGCHK(modulus != NULL); LTC_ARGCHK(mp != NULL); if ((err = mp_init_multi(&t1, &t2, NULL)) != CRYPT_OK) { return err; } if (P != R) { if ((err = mp_copy(P->x, R->x)) != CRYPT_OK) { goto done; } if ((err = mp_copy(P->y, R->y)) != CRYPT_OK) { goto done; } if ((err = mp_copy(P->z, R->z)) != CRYPT_OK) { goto done; } } /* t1 = Z * Z */ if ((err = mp_sqr(R->z, t1)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } /* Z = Y * Z */ if ((err = mp_mul(R->z, R->y, R->z)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(R->z, modulus, mp)) != CRYPT_OK) { goto done; } /* Z = 2Z */ if ((err = mp_add(R->z, R->z, R->z)) != CRYPT_OK) { goto done; } if (mp_cmp(R->z, modulus) != LTC_MP_LT) { if ((err = mp_sub(R->z, modulus, R->z)) != CRYPT_OK) { goto done; } } /* T2 = X - T1 */ if ((err = mp_sub(R->x, t1, t2)) != CRYPT_OK) { goto done; } if (mp_cmp_d(t2, 0) == LTC_MP_LT) { if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } } /* T1 = X + T1 */ if ((err = mp_add(t1, R->x, t1)) != CRYPT_OK) { goto done; } if (mp_cmp(t1, modulus) != LTC_MP_LT) { if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } } /* T2 = T1 * T2 */ if ((err = mp_mul(t1, t2, t2)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } /* T1 = 2T2 */ if ((err = mp_add(t2, t2, t1)) != CRYPT_OK) { goto done; } if (mp_cmp(t1, modulus) != LTC_MP_LT) { if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } } /* T1 = T1 + T2 */ if ((err = mp_add(t1, t2, t1)) != CRYPT_OK) { goto done; } if (mp_cmp(t1, modulus) != LTC_MP_LT) { if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } } /* Y = 2Y */ if ((err = mp_add(R->y, R->y, R->y)) != CRYPT_OK) { goto done; } if (mp_cmp(R->y, modulus) != LTC_MP_LT) { if ((err = mp_sub(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } } /* Y = Y * Y */ if ((err = mp_sqr(R->y, R->y)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } /* T2 = Y * Y */ if ((err = mp_sqr(R->y, t2)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } /* T2 = T2/2 */ if (mp_isodd(t2)) { if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } } if ((err = mp_div_2(t2, t2)) != CRYPT_OK) { goto done; } /* Y = Y * X */ if ((err = mp_mul(R->y, R->x, R->y)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } /* X = T1 * T1 */ if ((err = mp_sqr(t1, R->x)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(R->x, modulus, mp)) != CRYPT_OK) { goto done; } /* X = X - Y */ if ((err = mp_sub(R->x, R->y, R->x)) != CRYPT_OK) { goto done; } if (mp_cmp_d(R->x, 0) == LTC_MP_LT) { if ((err = mp_add(R->x, modulus, R->x)) != CRYPT_OK) { goto done; } } /* X = X - Y */ if ((err = mp_sub(R->x, R->y, R->x)) != CRYPT_OK) { goto done; } if (mp_cmp_d(R->x, 0) == LTC_MP_LT) { if ((err = mp_add(R->x, modulus, R->x)) != CRYPT_OK) { goto done; } } /* Y = Y - X */ if ((err = mp_sub(R->y, R->x, R->y)) != CRYPT_OK) { goto done; } if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { if ((err = mp_add(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } } /* Y = Y * T1 */ if ((err = mp_mul(R->y, t1, R->y)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } /* Y = Y - T2 */ if ((err = mp_sub(R->y, t2, R->y)) != CRYPT_OK) { goto done; } if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { if ((err = mp_add(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } } err = CRYPT_OK; done: mp_clear_multi(t1, t2, NULL); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c,v $ */ /* $Revision: 1.11 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #define DESC_DEF_ONLY #ifdef LTM_DESC #undef mp_init #undef mp_init_multi #undef mp_clear #undef mp_clear_multi #undef mp_init_copy #undef mp_neg #undef mp_copy #undef mp_set #undef mp_set_int #undef mp_get_int #undef mp_get_digit #undef mp_get_digit_count #undef mp_cmp #undef mp_cmp_d #undef mp_count_bits #undef mp_cnt_lsb #undef mp_2expt #undef mp_read_radix #undef mp_toradix #undef mp_unsigned_bin_size #undef mp_to_unsigned_bin #undef mp_read_unsigned_bin #undef mp_add #undef mp_add_d #undef mp_sub #undef mp_sub_d #undef mp_mul #undef mp_mul_d #undef mp_sqr #undef mp_div #undef mp_div_2 #undef mp_mod #undef mp_mod_d #undef mp_gcd #undef mp_lcm #undef mp_mulmod #undef mp_sqrmod #undef mp_invmod #undef mp_montgomery_setup #undef mp_montgomery_normalization #undef mp_montgomery_reduce #undef mp_montgomery_free #undef mp_exptmod #undef mp_prime_is_prime #undef mp_iszero #undef mp_isodd #undef mp_exch #undef mp_tohex static const struct { int mpi_code, ltc_code; } mpi_to_ltc_codes[] = { { MP_OKAY, CRYPT_OK }, { MP_MEM, CRYPT_MEM }, { MP_VAL, CRYPT_INVALID_ARG }, }; /** Convert a MPI error to a LTC error (Possibly the most powerful function ever! Oh wait... no) @param err The error to convert @return The equivalent LTC error code or CRYPT_ERROR if none found */ static int mpi_to_ltc_error(int err) { int x; for (x = 0; x < (int)(sizeof(mpi_to_ltc_codes) / sizeof(mpi_to_ltc_codes[0])); x++) { if (err == mpi_to_ltc_codes[x].mpi_code) { return mpi_to_ltc_codes[x].ltc_code; } } return CRYPT_ERROR; } static int init(void **a) { int err; LTC_ARGCHK(a != NULL); *a = XCALLOC(1, sizeof(mp_int)); if (*a == NULL) { return CRYPT_MEM; } if ((err = mpi_to_ltc_error(mp_init(AUTO_CAST(*a)))) != CRYPT_OK) { XFREE(*a); } return err; } static void deinit(void *a) { LTC_ARGCHKVD(a != NULL); mp_clear(AUTO_CAST(a)); XFREE(a); } static int neg(void *a, void *b) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); return mpi_to_ltc_error(mp_neg(AUTO_CAST(a), AUTO_CAST(b))); } static int copy(void *a, void *b) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); return mpi_to_ltc_error(mp_copy(AUTO_CAST(a), AUTO_CAST(b))); } static int init_copy(void **a, void *b) { if (init(a) != CRYPT_OK) { return CRYPT_MEM; } return copy(b, *a); } /* ---- trivial ---- */ static int set_int(void *a, unsigned long b) { LTC_ARGCHK(a != NULL); return mpi_to_ltc_error(mp_set_int(AUTO_CAST(a), AUTO_CAST(b))); } static unsigned long get_int(void *a) { LTC_ARGCHK(a != NULL); return mp_get_int(AUTO_CAST(a)); } static unsigned long get_digit(void *a, int n) { mp_int *A; LTC_ARGCHK(a != NULL); A = AUTO_CAST(a); return (n >= A->used || n < 0) ? 0 : A->dp[n]; } static int get_digit_count(void *a) { mp_int *A; LTC_ARGCHK(a != NULL); A = AUTO_CAST(a); return A->used; } static int compare(void *a, void *b) { int ret; LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); ret = mp_cmp(AUTO_CAST(a), AUTO_CAST(b)); switch (ret) { case MP_LT: return LTC_MP_LT; case MP_EQ: return LTC_MP_EQ; case MP_GT: return LTC_MP_GT; } return 0; } static int compare_d(void *a, unsigned long b) { int ret; LTC_ARGCHK(a != NULL); ret = mp_cmp_d(AUTO_CAST(a), AUTO_CAST(b)); switch (ret) { case MP_LT: return LTC_MP_LT; case MP_EQ: return LTC_MP_EQ; case MP_GT: return LTC_MP_GT; } return 0; } static int count_bits(void *a) { LTC_ARGCHK(a != NULL); return mp_count_bits(AUTO_CAST(a)); } static int count_lsb_bits(void *a) { LTC_ARGCHK(a != NULL); return mp_cnt_lsb(AUTO_CAST(a)); } static int twoexpt(void *a, int n) { LTC_ARGCHK(a != NULL); return mpi_to_ltc_error(mp_2expt(AUTO_CAST(a), n)); } /* ---- conversions ---- */ /* read ascii string */ static int read_radix(void *a, const char *b, int radix) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); return mpi_to_ltc_error(mp_read_radix(AUTO_CAST(a), AUTO_CAST(b), radix)); } /* write one */ static int write_radix(void *a, char *b, int radix) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); return mpi_to_ltc_error(mp_toradix(AUTO_CAST(a), b, radix)); } /* get size as unsigned char string */ static unsigned long unsigned_size(void *a) { LTC_ARGCHK(a != NULL); return mp_unsigned_bin_size(AUTO_CAST(a)); } /* store */ static int unsigned_write(void *a, unsigned char *b) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); return mpi_to_ltc_error(mp_to_unsigned_bin(AUTO_CAST(a), b)); } /* read */ static int unsigned_read(void *a, unsigned char *b, unsigned long len) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); return mpi_to_ltc_error(mp_read_unsigned_bin(AUTO_CAST(a), b, len)); } /* add */ static int add(void *a, void *b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_add(AUTO_CAST(a), AUTO_CAST(b), AUTO_CAST(c))); } static int addi(void *a, unsigned long b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_add_d(AUTO_CAST(a), b, AUTO_CAST(c))); } /* sub */ static int sub(void *a, void *b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_sub(AUTO_CAST(a), AUTO_CAST(b), AUTO_CAST(c))); } static int subi(void *a, unsigned long b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_sub_d(AUTO_CAST(a), b, AUTO_CAST(c))); } /* mul */ static int mul(void *a, void *b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_mul(AUTO_CAST(a), AUTO_CAST(b), AUTO_CAST(c))); } static int muli(void *a, unsigned long b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_mul_d(AUTO_CAST(a), b, AUTO_CAST(c))); } /* sqr */ static int sqr(void *a, void *b) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); return mpi_to_ltc_error(mp_sqr(AUTO_CAST(a), AUTO_CAST(b))); } /* div */ static int divide(void *a, void *b, void *c, void *d) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); return mpi_to_ltc_error(mp_div(AUTO_CAST(a), AUTO_CAST(b), AUTO_CAST(c), AUTO_CAST(d))); } static int div_2(void *a, void *b) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); return mpi_to_ltc_error(mp_div_2(AUTO_CAST(a), AUTO_CAST(b))); } /* modi */ static int modi(void *a, unsigned long b, unsigned long *c) { mp_digit tmp; int err; LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); if ((err = mpi_to_ltc_error(mp_mod_d(AUTO_CAST(a), b, &tmp))) != CRYPT_OK) { return err; } *c = tmp; return CRYPT_OK; } /* gcd */ static int gcd(void *a, void *b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_gcd(AUTO_CAST(a), AUTO_CAST(b), AUTO_CAST(c))); } /* lcm */ static int lcm(void *a, void *b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_lcm(AUTO_CAST(a), AUTO_CAST(b), AUTO_CAST(c))); } static int mulmod(void *a, void *b, void *c, void *d) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); LTC_ARGCHK(c != NULL); LTC_ARGCHK(d != NULL); return mpi_to_ltc_error(mp_mulmod(AUTO_CAST(a), AUTO_CAST(b), AUTO_CAST(c), AUTO_CAST(d))); } static int sqrmod(void *a, void *b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_sqrmod(AUTO_CAST(a), AUTO_CAST(b), AUTO_CAST(c))); } /* invmod */ static int invmod(void *a, void *b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_invmod(AUTO_CAST(a), AUTO_CAST(b), AUTO_CAST(c))); } /* setup */ static int montgomery_setup(void *a, void **b) { int err; LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); *b = XCALLOC(1, sizeof(mp_digit)); if (*b == NULL) { return CRYPT_MEM; } if ((err = mpi_to_ltc_error(mp_montgomery_setup(AUTO_CAST(a), (mp_digit *)*b))) != CRYPT_OK) { XFREE(*b); } return err; } /* get normalization value */ static int montgomery_normalization(void *a, void *b) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); return mpi_to_ltc_error(mp_montgomery_calc_normalization(AUTO_CAST(a), AUTO_CAST(b))); } /* reduce */ static int montgomery_reduce(void *a, void *b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_montgomery_reduce(AUTO_CAST(a), AUTO_CAST(b), *((mp_digit *)c))); } /* clean up */ static void montgomery_deinit(void *a) { XFREE(a); } static int exptmod(void *a, void *b, void *c, void *d) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); LTC_ARGCHK(c != NULL); LTC_ARGCHK(d != NULL); return mpi_to_ltc_error(mp_exptmod(AUTO_CAST(a), AUTO_CAST(b), AUTO_CAST(c), AUTO_CAST(d))); } static int isprime(void *a, int *b) { int err; LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); err = mpi_to_ltc_error(mp_prime_is_prime(AUTO_CAST(a), 8, AUTO_CAST(b))); *b = (*b == MP_YES) ? LTC_MP_YES : LTC_MP_NO; return err; } const ltc_math_descriptor ltm_desc = { "LibTomMath", (int)DIGIT_BIT, &init, &init_copy, &deinit, &neg, ©, &set_int, &get_int, &get_digit, &get_digit_count, &compare, &compare_d, &count_bits, &count_lsb_bits, &twoexpt, &read_radix, &write_radix, &unsigned_size, &unsigned_write, &unsigned_read, &add, &addi, &sub, &subi, &mul, &muli, &sqr, ÷, &div_2, &modi, &gcd, &lcm, &mulmod, &sqrmod, &invmod, &montgomery_setup, &montgomery_normalization, &montgomery_reduce, &montgomery_deinit, &exptmod, &isprime, #ifdef LTC_MECC #ifdef LTC_MECC_FP <c_ecc_fp_mulmod, #else <c_ecc_mulmod, #endif <c_ecc_projective_add_point, <c_ecc_projective_dbl_point, <c_ecc_map, #ifdef LTC_ECC_SHAMIR #ifdef LTC_MECC_FP <c_ecc_fp_mul2add, #else <c_ecc_mul2add, #endif /* LTC_MECC_FP */ #else NULL, #endif /* LTC_ECC_SHAMIR */ #else NULL, NULL,NULL, NULL, NULL, #endif /* LTC_MECC */ #ifdef LTC_MRSA &rsa_make_key, &rsa_exptmod, #else NULL, NULL #endif }; #define mp_init(a) ltc_mp.init(a) #define mp_init_multi ltc_init_multi #define mp_clear(a) ltc_mp.deinit(a) #define mp_clear_multi ltc_deinit_multi #define mp_init_copy(a, b) ltc_mp.init_copy(a, b) #define mp_neg(a, b) ltc_mp.neg(a, b) #define mp_copy(a, b) ltc_mp.copy(a, b) #define mp_set(a, b) ltc_mp.set_int(a, b) #define mp_set_int(a, b) ltc_mp.set_int(a, b) #define mp_get_int(a) ltc_mp.get_int(a) #define mp_get_digit(a, n) ltc_mp.get_digit(a, n) #define mp_get_digit_count(a) ltc_mp.get_digit_count(a) #define mp_cmp(a, b) ltc_mp.compare(a, b) #define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) #define mp_count_bits(a) ltc_mp.count_bits(a) #define mp_cnt_lsb(a) ltc_mp.count_lsb_bits(a) #define mp_2expt(a, b) ltc_mp.twoexpt(a, b) #define mp_read_radix(a, b, c) ltc_mp.read_radix(a, b, c) #define mp_toradix(a, b, c) ltc_mp.write_radix(a, b, c) #define mp_unsigned_bin_size(a) ltc_mp.unsigned_size(a) #define mp_to_unsigned_bin(a, b) ltc_mp.unsigned_write(a, b) #define mp_read_unsigned_bin(a, b, c) ltc_mp.unsigned_read(a, b, c) #define mp_add(a, b, c) ltc_mp.add(a, b, c) #define mp_add_d(a, b, c) ltc_mp.addi(a, b, c) #define mp_sub(a, b, c) ltc_mp.sub(a, b, c) #define mp_sub_d(a, b, c) ltc_mp.subi(a, b, c) #define mp_mul(a, b, c) ltc_mp.mul(a, b, c) #define mp_mul_d(a, b, c) ltc_mp.muli(a, b, c) #define mp_sqr(a, b) ltc_mp.sqr(a, b) #define mp_div(a, b, c, d) ltc_mp.mpdiv(a, b, c, d) #define mp_div_2(a, b) ltc_mp.div_2(a, b) #define mp_mod(a, b, c) ltc_mp.mpdiv(a, b, NULL, c) #define mp_mod_d(a, b, c) ltc_mp.modi(a, b, c) #define mp_gcd(a, b, c) ltc_mp.gcd(a, b, c) #define mp_lcm(a, b, c) ltc_mp.lcm(a, b, c) #define mp_mulmod(a, b, c, d) ltc_mp.mulmod(a, b, c, d) #define mp_sqrmod(a, b, c) ltc_mp.sqrmod(a, b, c) #define mp_invmod(a, b, c) ltc_mp.invmod(a, b, c) #define mp_montgomery_setup(a, b) ltc_mp.montgomery_setup(a, b) #define mp_montgomery_normalization(a, b) ltc_mp.montgomery_normalization(a, b) #define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) #define mp_montgomery_free(a) ltc_mp.montgomery_deinit(a) #define mp_exptmod(a, b, c, d) ltc_mp.exptmod(a, b, c, d) #define mp_prime_is_prime(a, b, c) ltc_mp.isprime(a, c) #define mp_iszero(a) (mp_cmp_d(a, 0) == LTC_MP_EQ ? LTC_MP_YES : LTC_MP_NO) #define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) #define mp_exch(a, b) do { void *ABC__tmp = a; a = b; b = ABC__tmp; } while (0); #define mp_tohex(a, b) mp_toradix(a, b, 16) #endif /* $Source: /cvs/libtom/libtomcrypt/src/math/ltm_desc.c,v $ */ /* $Revision: 1.31 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #ifdef MPI #include int ltc_init_multi(void **a, ...) { void **cur = a; int np = 0; va_list args; va_start(args, a); while (cur != NULL) { if (mp_init(cur) != CRYPT_OK) { /* failed */ va_list clean_list; va_start(clean_list, a); cur = a; while (np--) { mp_clear(*cur); cur = va_arg(clean_list, void **); } va_end(clean_list); return CRYPT_MEM; } ++np; cur = va_arg(args, void **); } va_end(args); return CRYPT_OK; } void ltc_deinit_multi(void *a, ...) { void *cur = a; va_list args; va_start(args, a); while (cur != NULL) { mp_clear(cur); cur = va_arg(args, void *); } va_end(args); } #endif /* $Source: /cvs/libtom/libtomcrypt/src/math/multi.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2006/12/28 01:27:23 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file pkcs_1_i2osp.c Integer to Octet I2OSP, Tom St Denis */ #ifdef LTC_PKCS_1 /* always stores the same # of bytes, pads with leading zero bytes as required */ /** LTC_PKCS #1 Integer to binary @param n The integer to store @param modulus_len The length of the RSA modulus @param out [out] The destination for the integer @return CRYPT_OK if successful */ int pkcs_1_i2osp(void *n, unsigned long modulus_len, unsigned char *out) { unsigned long size; size = mp_unsigned_bin_size(n); if (size > modulus_len) { return CRYPT_BUFFER_OVERFLOW; } /* store it */ zeromem(out, modulus_len); return mp_to_unsigned_bin(n, out + (modulus_len - size)); } #endif /* LTC_PKCS_1 */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file pkcs_1_mgf1.c The Mask Generation Function (MGF1) for LTC_PKCS #1, Tom St Denis */ #ifdef LTC_PKCS_1 /** Perform LTC_PKCS #1 MGF1 (internal) @param seed The seed for MGF1 @param seedlen The length of the seed @param hash_idx The index of the hash desired @param mask [out] The destination @param masklen The length of the mask desired @return CRYPT_OK if successful */ int pkcs_1_mgf1(int hash_idx, const unsigned char *seed, unsigned long seedlen, unsigned char *mask, unsigned long masklen) { unsigned long hLen, x; ulong32 counter; int err; hash_state *md; unsigned char *buf; LTC_ARGCHK(seed != NULL); LTC_ARGCHK(mask != NULL); /* ensure valid hash */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } /* get hash output size */ hLen = hash_descriptor[hash_idx].hashsize; /* allocate memory */ md = AUTO_CAST(XMALLOC(sizeof(hash_state))); buf = AUTO_CAST(XMALLOC(hLen)); if ((md == NULL) || (buf == NULL)) { if (md != NULL) { XFREE(md); } if (buf != NULL) { XFREE(buf); } return CRYPT_MEM; } /* start counter */ counter = 0; while (masklen > 0) { /* handle counter */ STORE32H(counter, buf); ++counter; /* get hash of seed || counter */ if ((err = hash_descriptor[hash_idx].init(md)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash_idx].process(md, seed, seedlen)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash_idx].process(md, buf, 4)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash_idx].done(md, buf)) != CRYPT_OK) { goto LBL_ERR; } /* store it */ for (x = 0; x < hLen && masklen > 0; x++, masklen--) { *mask++ = buf[x]; } } err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK zeromem(buf, hLen); zeromem(md, sizeof(hash_state)); #endif XFREE(buf); XFREE(md); return err; } #endif /* LTC_PKCS_1 */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c,v $ */ /* $Revision: 1.8 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file pkcs_1_oaep_decode.c OAEP Padding for LTC_PKCS #1, Tom St Denis */ #ifdef LTC_PKCS_1 /** LTC_PKCS #1 v2.00 OAEP decode @param msg The encoded data to decode @param msglen The length of the encoded data (octets) @param lparam The session or system data (can be NULL) @param lparamlen The length of the lparam @param modulus_bitlen The bit length of the RSA modulus @param hash_idx The index of the hash desired @param out [out] Destination of decoding @param outlen [in/out] The max size and resulting size of the decoding @param res [out] Result of decoding, 1==valid, 0==invalid @return CRYPT_OK if successful (even if invalid) */ int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, const unsigned char *lparam, unsigned long lparamlen, unsigned long modulus_bitlen, int hash_idx, unsigned char *out, unsigned long *outlen, int *res) { unsigned char *DB, *seed, *mask; unsigned long hLen, x, y, modulus_len; int err; LTC_ARGCHK(msg != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(res != NULL); /* default to invalid packet */ *res = 0; /* test valid hash */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } hLen = hash_descriptor[hash_idx].hashsize; modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); /* test hash/message size */ if ((2 * hLen >= (modulus_len - 2)) || (msglen != modulus_len)) { return CRYPT_PK_INVALID_SIZE; } /* allocate ram for DB/mask/salt of size modulus_len */ DB = AUTO_CAST(XMALLOC(modulus_len)); mask = AUTO_CAST(XMALLOC(modulus_len)); seed = AUTO_CAST(XMALLOC(hLen)); if ((DB == NULL) || (mask == NULL) || (seed == NULL)) { if (DB != NULL) { XFREE(DB); } if (mask != NULL) { XFREE(mask); } if (seed != NULL) { XFREE(seed); } return CRYPT_MEM; } /* ok so it's now in the form 0x00 || maskedseed || maskedDB 1 || hLen || modulus_len - hLen - 1 */ /* must have leading 0x00 byte */ if (msg[0] != 0x00) { err = CRYPT_OK; goto LBL_ERR; } /* now read the masked seed */ x = 1; XMEMCPY(seed, msg + x, hLen); x += hLen; /* now read the masked DB */ XMEMCPY(DB, msg + x, modulus_len - hLen - 1); x += modulus_len - hLen - 1; /* compute MGF1 of maskedDB (hLen) */ if ((err = pkcs_1_mgf1(hash_idx, DB, modulus_len - hLen - 1, mask, hLen)) != CRYPT_OK) { goto LBL_ERR; } /* XOR against seed */ for (y = 0; y < hLen; y++) { seed[y] ^= mask[y]; } /* compute MGF1 of seed (k - hlen - 1) */ if ((err = pkcs_1_mgf1(hash_idx, seed, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { goto LBL_ERR; } /* xor against DB */ for (y = 0; y < (modulus_len - hLen - 1); y++) { DB[y] ^= mask[y]; } /* now DB == lhash || PS || 0x01 || M, PS == k - mlen - 2hlen - 2 zeroes */ /* compute lhash and store it in seed [reuse temps!] */ x = modulus_len; if (lparam != NULL) { if ((err = hash_memory(hash_idx, lparam, lparamlen, seed, &x)) != CRYPT_OK) { goto LBL_ERR; } } else { /* can't pass hash_memory a NULL so use DB with zero length */ if ((err = hash_memory(hash_idx, DB, 0, seed, &x)) != CRYPT_OK) { goto LBL_ERR; } } /* compare the lhash'es */ if (XMEMCMP(seed, DB, hLen) != 0) { err = CRYPT_OK; goto LBL_ERR; } /* now zeroes before a 0x01 */ for (x = hLen; x < (modulus_len - hLen - 1) && DB[x] == 0x00; x++) { /* step... */ } /* error out if wasn't 0x01 */ if ((x == (modulus_len - hLen - 1)) || (DB[x] != 0x01)) { err = CRYPT_INVALID_PACKET; goto LBL_ERR; } /* rest is the message (and skip 0x01) */ if ((modulus_len - hLen - 1 - ++x) > *outlen) { *outlen = modulus_len - hLen - 1 - x; err = CRYPT_BUFFER_OVERFLOW; goto LBL_ERR; } /* copy message */ *outlen = modulus_len - hLen - 1 - x; XMEMCPY(out, DB + x, modulus_len - hLen - 1 - x); x += modulus_len - hLen - 1; /* valid packet */ *res = 1; err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK zeromem(DB, modulus_len); zeromem(seed, hLen); zeromem(mask, modulus_len); #endif XFREE(seed); XFREE(mask); XFREE(DB); return err; } #endif /* LTC_PKCS_1 */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c,v $ */ /* $Revision: 1.13 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file pkcs_1_oaep_encode.c OAEP Padding for LTC_PKCS #1, Tom St Denis */ #ifdef LTC_PKCS_1 /** LTC_PKCS #1 v2.00 OAEP encode @param msg The data to encode @param msglen The length of the data to encode (octets) @param lparam A session or system parameter (can be NULL) @param lparamlen The length of the lparam data @param modulus_bitlen The bit length of the RSA modulus @param prng An active PRNG state @param prng_idx The index of the PRNG desired @param hash_idx The index of the hash desired @param out [out] The destination for the encoded data @param outlen [in/out] The max size and resulting size of the encoded data @return CRYPT_OK if successful */ int pkcs_1_oaep_encode(const unsigned char *msg, unsigned long msglen, const unsigned char *lparam, unsigned long lparamlen, unsigned long modulus_bitlen, prng_state *prng, int prng_idx, int hash_idx, unsigned char *out, unsigned long *outlen) { unsigned char *DB, *seed, *mask; unsigned long hLen, x, y, modulus_len; int err; LTC_ARGCHK(msg != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* test valid hash */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } /* valid prng */ if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { return err; } hLen = hash_descriptor[hash_idx].hashsize; modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); /* test message size */ if ((2 * hLen >= (modulus_len - 2)) || (msglen > (modulus_len - 2 * hLen - 2))) { return CRYPT_PK_INVALID_SIZE; } /* allocate ram for DB/mask/salt of size modulus_len */ DB = AUTO_CAST(XMALLOC(modulus_len)); mask = AUTO_CAST(XMALLOC(modulus_len)); seed = AUTO_CAST(XMALLOC(hLen)); if ((DB == NULL) || (mask == NULL) || (seed == NULL)) { if (DB != NULL) { XFREE(DB); } if (mask != NULL) { XFREE(mask); } if (seed != NULL) { XFREE(seed); } return CRYPT_MEM; } /* get lhash */ /* DB == lhash || PS || 0x01 || M, PS == k - mlen - 2hlen - 2 zeroes */ x = modulus_len; if (lparam != NULL) { if ((err = hash_memory(hash_idx, lparam, lparamlen, DB, &x)) != CRYPT_OK) { goto LBL_ERR; } } else { /* can't pass hash_memory a NULL so use DB with zero length */ if ((err = hash_memory(hash_idx, DB, 0, DB, &x)) != CRYPT_OK) { goto LBL_ERR; } } /* append PS then 0x01 (to lhash) */ x = hLen; y = modulus_len - msglen - 2 * hLen - 2; XMEMSET(DB + x, 0, y); x += y; /* 0x01 byte */ DB[x++] = 0x01; /* message (length = msglen) */ XMEMCPY(DB + x, msg, msglen); x += msglen; /* now choose a random seed */ if (prng_descriptor[prng_idx].read(seed, hLen, prng) != hLen) { err = CRYPT_ERROR_READPRNG; goto LBL_ERR; } /* compute MGF1 of seed (k - hlen - 1) */ if ((err = pkcs_1_mgf1(hash_idx, seed, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { goto LBL_ERR; } /* xor against DB */ for (y = 0; y < (modulus_len - hLen - 1); y++) { DB[y] ^= mask[y]; } /* compute MGF1 of maskedDB (hLen) */ if ((err = pkcs_1_mgf1(hash_idx, DB, modulus_len - hLen - 1, mask, hLen)) != CRYPT_OK) { goto LBL_ERR; } /* XOR against seed */ for (y = 0; y < hLen; y++) { seed[y] ^= mask[y]; } /* create string of length modulus_len */ if (*outlen < modulus_len) { *outlen = modulus_len; err = CRYPT_BUFFER_OVERFLOW; goto LBL_ERR; } /* start output which is 0x00 || maskedSeed || maskedDB */ x = 0; out[x++] = 0x00; XMEMCPY(out + x, seed, hLen); x += hLen; XMEMCPY(out + x, DB, modulus_len - hLen - 1); x += modulus_len - hLen - 1; *outlen = x; err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK zeromem(DB, modulus_len); zeromem(seed, hLen); zeromem(mask, modulus_len); #endif XFREE(seed); XFREE(mask); XFREE(DB); return err; } #endif /* LTC_PKCS_1 */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c,v $ */ /* $Revision: 1.9 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file pkcs_1_os2ip.c Octet to Integer OS2IP, Tom St Denis */ #ifdef LTC_PKCS_1 /** Read a binary string into an mp_int @param n [out] The mp_int destination @param in The binary string to read @param inlen The length of the binary string @return CRYPT_OK if successful */ int pkcs_1_os2ip(void *n, unsigned char *in, unsigned long inlen) { return mp_read_unsigned_bin(n, in, inlen); } #endif /* LTC_PKCS_1 */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file pkcs_1_pss_decode.c LTC_PKCS #1 PSS Signature Padding, Tom St Denis */ #ifdef LTC_PKCS_1 /** LTC_PKCS #1 v2.00 PSS decode @param msghash The hash to verify @param msghashlen The length of the hash (octets) @param sig The signature data (encoded data) @param siglen The length of the signature data (octets) @param saltlen The length of the salt used (octets) @param hash_idx The index of the hash desired @param modulus_bitlen The bit length of the RSA modulus @param res [out] The result of the comparison, 1==valid, 0==invalid @return CRYPT_OK if successful (even if the comparison failed) */ int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen, const unsigned char *sig, unsigned long siglen, unsigned long saltlen, int hash_idx, unsigned long modulus_bitlen, int *res) { unsigned char *DB, *mask, *salt, *hash; unsigned long x, y, hLen, modulus_len; int err; hash_state md; LTC_ARGCHK(msghash != NULL); LTC_ARGCHK(res != NULL); /* default to invalid */ *res = 0; /* ensure hash is valid */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } hLen = hash_descriptor[hash_idx].hashsize; modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); /* check sizes */ if ((saltlen > modulus_len) || (modulus_len < hLen + saltlen + 2) || (siglen != modulus_len)) { return CRYPT_PK_INVALID_SIZE; } /* allocate ram for DB/mask/salt/hash of size modulus_len */ DB = AUTO_CAST(XMALLOC(modulus_len)); mask = AUTO_CAST(XMALLOC(modulus_len)); salt = AUTO_CAST(XMALLOC(modulus_len)); hash = AUTO_CAST(XMALLOC(modulus_len)); if ((DB == NULL) || (mask == NULL) || (salt == NULL) || (hash == NULL)) { if (DB != NULL) { XFREE(DB); } if (mask != NULL) { XFREE(mask); } if (salt != NULL) { XFREE(salt); } if (hash != NULL) { XFREE(hash); } return CRYPT_MEM; } /* ensure the 0xBC byte */ if (sig[siglen - 1] != 0xBC) { err = CRYPT_INVALID_PACKET; goto LBL_ERR; } /* copy out the DB */ x = 0; XMEMCPY(DB, sig + x, modulus_len - hLen - 1); x += modulus_len - hLen - 1; /* copy out the hash */ XMEMCPY(hash, sig + x, hLen); x += hLen; /* check the MSB */ if ((sig[0] & ~(0xFF >> ((modulus_len << 3) - (modulus_bitlen - 1)))) != 0) { err = CRYPT_INVALID_PACKET; goto LBL_ERR; } /* generate mask of length modulus_len - hLen - 1 from hash */ if ((err = pkcs_1_mgf1(hash_idx, hash, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { goto LBL_ERR; } /* xor against DB */ for (y = 0; y < (modulus_len - hLen - 1); y++) { DB[y] ^= mask[y]; } /* now clear the first byte [make sure smaller than modulus] */ DB[0] &= 0xFF >> ((modulus_len << 3) - (modulus_bitlen - 1)); /* DB = PS || 0x01 || salt, PS == modulus_len - saltlen - hLen - 2 zero bytes */ /* check for zeroes and 0x01 */ for (x = 0; x < modulus_len - saltlen - hLen - 2; x++) { if (DB[x] != 0x00) { err = CRYPT_INVALID_PACKET; goto LBL_ERR; } } /* check for the 0x01 */ if (DB[x++] != 0x01) { err = CRYPT_INVALID_PACKET; goto LBL_ERR; } /* M = (eight) 0x00 || msghash || salt, mask = H(M) */ if ((err = hash_descriptor[hash_idx].init(&md)) != CRYPT_OK) { goto LBL_ERR; } zeromem(mask, 8); if ((err = hash_descriptor[hash_idx].process(&md, mask, 8)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash_idx].process(&md, msghash, msghashlen)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash_idx].process(&md, DB + x, saltlen)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash_idx].done(&md, mask)) != CRYPT_OK) { goto LBL_ERR; } /* mask == hash means valid signature */ if (XMEMCMP(mask, hash, hLen) == 0) { *res = 1; } err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK zeromem(DB, modulus_len); zeromem(mask, modulus_len); zeromem(salt, modulus_len); zeromem(hash, modulus_len); #endif XFREE(hash); XFREE(salt); XFREE(mask); XFREE(DB); return err; } #endif /* LTC_PKCS_1 */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c,v $ */ /* $Revision: 1.11 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file pkcs_1_pss_encode.c LTC_PKCS #1 PSS Signature Padding, Tom St Denis */ #ifdef LTC_PKCS_1 /** LTC_PKCS #1 v2.00 Signature Encoding @param msghash The hash to encode @param msghashlen The length of the hash (octets) @param saltlen The length of the salt desired (octets) @param prng An active PRNG context @param prng_idx The index of the PRNG desired @param hash_idx The index of the hash desired @param modulus_bitlen The bit length of the RSA modulus @param out [out] The destination of the encoding @param outlen [in/out] The max size and resulting size of the encoded data @return CRYPT_OK if successful */ int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen, unsigned long saltlen, prng_state *prng, int prng_idx, int hash_idx, unsigned long modulus_bitlen, unsigned char *out, unsigned long *outlen) { unsigned char *DB, *mask, *salt, *hash; unsigned long x, y, hLen, modulus_len; int err; hash_state md; LTC_ARGCHK(msghash != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* ensure hash and PRNG are valid */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { return err; } hLen = hash_descriptor[hash_idx].hashsize; modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); /* check sizes */ if ((saltlen > modulus_len) || (modulus_len < hLen + saltlen + 2)) { return CRYPT_PK_INVALID_SIZE; } /* allocate ram for DB/mask/salt/hash of size modulus_len */ DB = AUTO_CAST(XMALLOC(modulus_len)); mask = AUTO_CAST(XMALLOC(modulus_len)); salt = AUTO_CAST(XMALLOC(modulus_len)); hash = AUTO_CAST(XMALLOC(modulus_len)); if ((DB == NULL) || (mask == NULL) || (salt == NULL) || (hash == NULL)) { if (DB != NULL) { XFREE(DB); } if (mask != NULL) { XFREE(mask); } if (salt != NULL) { XFREE(salt); } if (hash != NULL) { XFREE(hash); } return CRYPT_MEM; } /* generate random salt */ if (saltlen > 0) { if (prng_descriptor[prng_idx].read(salt, saltlen, prng) != saltlen) { err = CRYPT_ERROR_READPRNG; goto LBL_ERR; } } /* M = (eight) 0x00 || msghash || salt, hash = H(M) */ if ((err = hash_descriptor[hash_idx].init(&md)) != CRYPT_OK) { goto LBL_ERR; } zeromem(DB, 8); if ((err = hash_descriptor[hash_idx].process(&md, DB, 8)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash_idx].process(&md, msghash, msghashlen)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash_idx].process(&md, salt, saltlen)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash_idx].done(&md, hash)) != CRYPT_OK) { goto LBL_ERR; } /* generate DB = PS || 0x01 || salt, PS == modulus_len - saltlen - hLen - 2 zero bytes */ x = 0; XMEMSET(DB + x, 0, modulus_len - saltlen - hLen - 2); x += modulus_len - saltlen - hLen - 2; DB[x++] = 0x01; XMEMCPY(DB + x, salt, saltlen); x += saltlen; /* generate mask of length modulus_len - hLen - 1 from hash */ if ((err = pkcs_1_mgf1(hash_idx, hash, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { goto LBL_ERR; } /* xor against DB */ for (y = 0; y < (modulus_len - hLen - 1); y++) { DB[y] ^= mask[y]; } /* output is DB || hash || 0xBC */ if (*outlen < modulus_len) { *outlen = modulus_len; err = CRYPT_BUFFER_OVERFLOW; goto LBL_ERR; } /* DB len = modulus_len - hLen - 1 */ y = 0; XMEMCPY(out + y, DB, modulus_len - hLen - 1); y += modulus_len - hLen - 1; /* hash */ XMEMCPY(out + y, hash, hLen); y += hLen; /* 0xBC */ out[y] = 0xBC; /* now clear the 8*modulus_len - modulus_bitlen most significant bits */ out[0] &= 0xFF >> ((modulus_len << 3) - (modulus_bitlen - 1)); /* store output size */ *outlen = modulus_len; err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK zeromem(DB, modulus_len); zeromem(mask, modulus_len); zeromem(salt, modulus_len); zeromem(hash, modulus_len); #endif XFREE(hash); XFREE(salt); XFREE(mask); XFREE(DB); return err; } #endif /* LTC_PKCS_1 */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c,v $ */ /* $Revision: 1.9 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file pkcs_1_v1_5_decode.c * * LTC_PKCS #1 v1.5 Padding. (Andreas Lange) */ #ifdef LTC_PKCS_1 /** @brief LTC_PKCS #1 v1.5 decode. * * @param msg The encoded data to decode * @param msglen The length of the encoded data (octets) * @param block_type Block type to use in padding (\sa ltc_pkcs_1_v1_5_blocks) * @param modulus_bitlen The bit length of the RSA modulus * @param out [out] Destination of decoding * @param outlen [in/out] The max size and resulting size of the decoding * @param is_valid [out] Boolean whether the padding was valid * * @return CRYPT_OK if successful (even if invalid) */ int pkcs_1_v1_5_decode(const unsigned char *msg, unsigned long msglen, int block_type, unsigned long modulus_bitlen, unsigned char *out, unsigned long *outlen, int *is_valid) { unsigned long modulus_len, ps_len, i; int result; /* default to invalid packet */ *is_valid = 0; modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); /* test message size */ if ((msglen > modulus_len) || (modulus_len < 11)) { return CRYPT_PK_INVALID_SIZE; } /* separate encoded message */ if ((msg[0] != 0x00) || (msg[1] != (unsigned char)block_type)) { result = CRYPT_INVALID_PACKET; goto bail; } if (block_type == LTC_LTC_PKCS_1_EME) { for (i = 2; i < modulus_len; i++) { /* separator */ if (msg[i] == 0x00) { break; } } ps_len = i++ - 2; if ((i >= modulus_len) || (ps_len < 8)) { /* There was no octet with hexadecimal value 0x00 to separate ps from m, * or the length of ps is less than 8 octets. */ result = CRYPT_INVALID_PACKET; goto bail; } } else { for (i = 2; i < modulus_len - 1; i++) { if (msg[i] != 0xFF) { break; } } /* separator check */ if (msg[i] != 0) { /* There was no octet with hexadecimal value 0x00 to separate ps from m. */ result = CRYPT_INVALID_PACKET; goto bail; } ps_len = i - 2; } if (*outlen < (msglen - (2 + ps_len + 1))) { *outlen = msglen - (2 + ps_len + 1); result = CRYPT_BUFFER_OVERFLOW; goto bail; } *outlen = (msglen - (2 + ps_len + 1)); XMEMCPY(out, &msg[2 + ps_len + 1], *outlen); /* valid packet */ *is_valid = 1; result = CRYPT_OK; bail: return result; } /* pkcs_1_v1_5_decode */ #endif /* #ifdef LTC_PKCS_1 */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /*! \file pkcs_1_v1_5_encode.c * * LTC_PKCS #1 v1.5 Padding (Andreas Lange) */ #ifdef LTC_PKCS_1 /*! \brief LTC_PKCS #1 v1.5 encode. * * \param msg The data to encode * \param msglen The length of the data to encode (octets) * \param block_type Block type to use in padding (\sa ltc_pkcs_1_v1_5_blocks) * \param modulus_bitlen The bit length of the RSA modulus * \param prng An active PRNG state (only for LTC_LTC_PKCS_1_EME) * \param prng_idx The index of the PRNG desired (only for LTC_LTC_PKCS_1_EME) * \param out [out] The destination for the encoded data * \param outlen [in/out] The max size and resulting size of the encoded data * * \return CRYPT_OK if successful */ int pkcs_1_v1_5_encode(const unsigned char *msg, unsigned long msglen, int block_type, unsigned long modulus_bitlen, prng_state *prng, int prng_idx, unsigned char *out, unsigned long *outlen) { unsigned long modulus_len, ps_len, i; unsigned char *ps; int result; /* valid block_type? */ if ((block_type != LTC_LTC_PKCS_1_EMSA) && (block_type != LTC_LTC_PKCS_1_EME)) { return CRYPT_PK_INVALID_PADDING; } if (block_type == LTC_LTC_PKCS_1_EME) { /* encryption padding, we need a valid PRNG */ if ((result = prng_is_valid(prng_idx)) != CRYPT_OK) { return result; } } modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); /* test message size */ if ((msglen + 11) > modulus_len) { return CRYPT_PK_INVALID_SIZE; } if (*outlen < modulus_len) { *outlen = modulus_len; result = CRYPT_BUFFER_OVERFLOW; goto bail; } /* generate an octets string PS */ ps = &out[2]; ps_len = modulus_len - msglen - 3; if (block_type == LTC_LTC_PKCS_1_EME) { /* now choose a random ps */ if (prng_descriptor[prng_idx].read(ps, ps_len, prng) != ps_len) { result = CRYPT_ERROR_READPRNG; goto bail; } /* transform zero bytes (if any) to non-zero random bytes */ for (i = 0; i < ps_len; i++) { while (ps[i] == 0) { if (prng_descriptor[prng_idx].read(&ps[i], 1, prng) != 1) { result = CRYPT_ERROR_READPRNG; goto bail; } } } } else { XMEMSET(ps, 0xFF, ps_len); } /* create string of length modulus_len */ out[0] = 0x00; out[1] = (unsigned char)block_type;/* block_type 1 or 2 */ out[2 + ps_len] = 0x00; XMEMCPY(&out[2 + ps_len + 1], msg, msglen); *outlen = modulus_len; result = CRYPT_OK; bail: return result; } /* pkcs_1_v1_5_encode */ #endif /* #ifdef LTC_PKCS_1 */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c,v $ */ /* $Revision: 1.4 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rand_prime.c Generate a random prime, Tom St Denis */ #define USE_BBS 1 int rand_prime(void *N, long len, prng_state *prng, int wprng) { int err, res, type; unsigned char *buf; LTC_ARGCHK(N != NULL); /* get type */ if (len < 0) { type = USE_BBS; len = -len; } else { type = 0; } /* allow sizes between 2 and 512 bytes for a prime size */ if ((len < 2) || (len > 512)) { return CRYPT_INVALID_PRIME_SIZE; } /* valid PRNG? Better be! */ if ((err = prng_is_valid(wprng)) != CRYPT_OK) { return err; } /* allocate buffer to work with */ buf = AUTO_CAST(XCALLOC(1, len)); if (buf == NULL) { return CRYPT_MEM; } do { /* generate value */ if (prng_descriptor[wprng].read(buf, len, prng) != (unsigned long)len) { XFREE(buf); return CRYPT_ERROR_READPRNG; } /* munge bits */ buf[0] |= 0x80 | 0x40; buf[len - 1] |= 0x01 | ((type & USE_BBS) ? 0x02 : 0x00); /* load value */ if ((err = mp_read_unsigned_bin(N, buf, len)) != CRYPT_OK) { XFREE(buf); return err; } /* test */ if ((err = mp_prime_is_prime(N, 8, &res)) != CRYPT_OK) { XFREE(buf); return err; } } while (res == LTC_MP_NO); #ifdef LTC_CLEAN_STACK zeromem(buf, len); #endif XFREE(buf); return CRYPT_OK; } /* $Source: /cvs/libtom/libtomcrypt/src/math/rand_prime.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:23 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rng_get_bytes.c portable way to get secure random bits to feed a PRNG (Tom St Denis) */ #ifdef LTC_DEVRANDOM /* on *NIX read /dev/random */ static unsigned long rng_nix(unsigned char *buf, unsigned long len, void (*callback)(void)) { #ifdef LTC_NO_FILE return 0; #else FILE *f; unsigned long x; #ifdef TRY_URANDOM_FIRST f = fopen("/dev/urandom", "rb"); if (f == NULL) #endif /* TRY_URANDOM_FIRST */ f = fopen("/dev/random", "rb"); if (f == NULL) { return 0; } /* disable buffering */ if (setvbuf(f, NULL, _IONBF, 0) != 0) { fclose(f); return 0; } x = (unsigned long)fread(buf, 1, (size_t)len, f); fclose(f); return x; #endif /* LTC_NO_FILE */ } #endif /* LTC_DEVRANDOM */ /* on ANSI C platforms with 100 < CLOCKS_PER_SEC < 10000 */ #if defined(CLOCKS_PER_SEC) && !defined(WINCE) #define ANSI_RNG static unsigned long rng_ansic(unsigned char *buf, unsigned long len, void (*callback)(void)) { clock_t t1; int l, acc, bits, a, b; if ((XCLOCKS_PER_SEC < 100) || (XCLOCKS_PER_SEC > 10000)) { return 0; } l = len; bits = 8; acc = a = b = 0; while (len--) { if (callback != NULL) callback(); while (bits--) { do { t1 = XCLOCK(); while (t1 == XCLOCK()) a ^= 1; t1 = XCLOCK(); while (t1 == XCLOCK()) b ^= 1; } while (a == b); acc = (acc << 1) | a; } *buf++ = acc; acc = 0; bits = 8; } acc = bits = a = b = 0; return l; } #endif /* Try the Microsoft CSP */ #if defined(WIN32) || defined(WINCE) #if !defined( _WIN32_WINNT ) || _WIN32_WINNT < 0x0501 #undef _WIN32_WINNT #define _WIN32_WINNT 0x0501 // requires Windows XP minimum #endif #ifdef WINCE #define UNDER_CE #define ARM #endif #include #include static unsigned long rng_win32(unsigned char *buf, unsigned long len, void (*callback)(void)) { HCRYPTPROV hProv = 0; if (!CryptAcquireContext(&hProv, NULL, MS_DEF_PROV, PROV_RSA_FULL, (CRYPT_VERIFYCONTEXT | CRYPT_MACHINE_KEYSET)) && !CryptAcquireContext(&hProv, NULL, MS_DEF_PROV, PROV_RSA_FULL, CRYPT_VERIFYCONTEXT | CRYPT_MACHINE_KEYSET | CRYPT_NEWKEYSET)) return 0; if (CryptGenRandom(hProv, len, buf) == TRUE) { CryptReleaseContext(hProv, 0); return len; } else { CryptReleaseContext(hProv, 0); return 0; } } #endif /* WIN32 */ /** Read the system RNG @param out Destination @param outlen Length desired (octets) @param callback Pointer to void function to act as "callback" when RNG is slow. This can be NULL @return Number of octets read */ unsigned long rng_get_bytes(unsigned char *out, unsigned long outlen, void (*callback)(void)) { unsigned long x; LTC_ARGCHK(out != NULL); #if defined(LTC_DEVRANDOM) x = rng_nix(out, outlen, callback); if (x != 0) { return x; } #endif #ifdef WIN32 x = rng_win32(out, outlen, callback); if (x != 0) { return x; } #endif #ifdef ANSI_RNG x = rng_ansic(out, outlen, callback); if (x != 0) { return x; } #endif return 0; } /* $Source: /cvs/libtom/libtomcrypt/src/prngs/rng_get_bytes.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rng_make_prng.c portable way to get secure random bits to feed a PRNG (Tom St Denis) */ /** Create a PRNG from a RNG @param bits Number of bits of entropy desired (64 ... 1024) @param wprng Index of which PRNG to setup @param prng [out] PRNG state to initialize @param callback A pointer to a void function for when the RNG is slow, this can be NULL @return CRYPT_OK if successful */ int rng_make_prng(int bits, int wprng, prng_state *prng, void (*callback)(void)) { unsigned char buf[256]; int err; LTC_ARGCHK(prng != NULL); /* check parameter */ if ((err = prng_is_valid(wprng)) != CRYPT_OK) { return err; } if ((bits < 64) || (bits > 1024)) { return CRYPT_INVALID_PRNGSIZE; } if ((err = prng_descriptor[wprng].start(prng)) != CRYPT_OK) { return err; } bits = ((bits / 8) + ((bits & 7) != 0 ? 1 : 0)) * 2; if (rng_get_bytes(buf, (unsigned long)bits, callback) != (unsigned long)bits) { return CRYPT_ERROR_READPRNG; } if ((err = prng_descriptor[wprng].add_entropy(buf, (unsigned long)bits, prng)) != CRYPT_OK) { return err; } if ((err = prng_descriptor[wprng].ready(prng)) != CRYPT_OK) { return err; } #ifdef LTC_CLEAN_STACK zeromem(buf, sizeof(buf)); #endif return CRYPT_OK; } /* $Source: /cvs/libtom/libtomcrypt/src/prngs/rng_make_prng.c,v $ */ /* $Revision: 1.5 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rsa_decrypt_key.c RSA LTC_PKCS #1 Decryption, Tom St Denis and Andreas Lange */ #ifdef LTC_MRSA /** LTC_PKCS #1 decrypt then v1.5 or OAEP depad @param in The ciphertext @param inlen The length of the ciphertext (octets) @param out [out] The plaintext @param outlen [in/out] The max size and resulting size of the plaintext (octets) @param lparam The system "lparam" value @param lparamlen The length of the lparam value (octets) @param hash_idx The index of the hash desired @param padding Type of padding (LTC_LTC_PKCS_1_OAEP or LTC_LTC_PKCS_1_V1_5) @param stat [out] Result of the decryption, 1==valid, 0==invalid @param key The corresponding private RSA key @return CRYPT_OK if succcessul (even if invalid) */ int rsa_decrypt_key_ex(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, const unsigned char *lparam, unsigned long lparamlen, int hash_idx, int padding, int *stat, rsa_key *key) { unsigned long modulus_bitlen, modulus_bytelen, x; int err; unsigned char *tmp; LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); LTC_ARGCHK(stat != NULL); /* default to invalid */ *stat = 0; /* valid padding? */ if ((padding != LTC_LTC_PKCS_1_V1_5) && (padding != LTC_LTC_PKCS_1_OAEP)) { return CRYPT_PK_INVALID_PADDING; } if (padding == LTC_LTC_PKCS_1_OAEP) { /* valid hash ? */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } } /* get modulus len in bits */ modulus_bitlen = mp_count_bits((key->N)); /* outlen must be at least the size of the modulus */ modulus_bytelen = mp_unsigned_bin_size((key->N)); if (modulus_bytelen != inlen) { return CRYPT_INVALID_PACKET; } /* allocate ram */ tmp = AUTO_CAST(XMALLOC(inlen)); if (tmp == NULL) { return CRYPT_MEM; } /* rsa decode the packet */ x = inlen; if ((err = ltc_mp.rsa_me(in, inlen, tmp, &x, PK_PRIVATE, key)) != CRYPT_OK) { XFREE(tmp); return err; } if (padding == LTC_LTC_PKCS_1_OAEP) { /* now OAEP decode the packet */ err = pkcs_1_oaep_decode(tmp, x, lparam, lparamlen, modulus_bitlen, hash_idx, out, outlen, stat); } else { /* now LTC_PKCS #1 v1.5 depad the packet */ err = pkcs_1_v1_5_decode(tmp, x, LTC_LTC_PKCS_1_EME, modulus_bitlen, out, outlen, stat); } XFREE(tmp); return err; } #endif /* LTC_MRSA */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c,v $ */ /* $Revision: 1.10 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rsa_encrypt_key.c RSA LTC_PKCS #1 encryption, Tom St Denis and Andreas Lange */ #ifdef LTC_MRSA /** (LTC_PKCS #1 v2.0) OAEP pad then encrypt @param in The plaintext @param inlen The length of the plaintext (octets) @param out [out] The ciphertext @param outlen [in/out] The max size and resulting size of the ciphertext @param lparam The system "lparam" for the encryption @param lparamlen The length of lparam (octets) @param prng An active PRNG @param prng_idx The index of the desired prng @param hash_idx The index of the desired hash @param padding Type of padding (LTC_LTC_PKCS_1_OAEP or LTC_LTC_PKCS_1_V1_5) @param key The RSA key to encrypt to @return CRYPT_OK if successful */ int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, const unsigned char *lparam, unsigned long lparamlen, prng_state *prng, int prng_idx, int hash_idx, int padding, rsa_key *key) { unsigned long modulus_bitlen, modulus_bytelen, x; int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); /* valid padding? */ if ((padding != LTC_LTC_PKCS_1_V1_5) && (padding != LTC_LTC_PKCS_1_OAEP)) { return CRYPT_PK_INVALID_PADDING; } /* valid prng? */ if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { return err; } if (padding == LTC_LTC_PKCS_1_OAEP) { /* valid hash? */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } } /* get modulus len in bits */ modulus_bitlen = mp_count_bits((key->N)); /* outlen must be at least the size of the modulus */ modulus_bytelen = mp_unsigned_bin_size((key->N)); if (modulus_bytelen > *outlen) { *outlen = modulus_bytelen; return CRYPT_BUFFER_OVERFLOW; } if (padding == LTC_LTC_PKCS_1_OAEP) { /* OAEP pad the key */ x = *outlen; if ((err = pkcs_1_oaep_encode(in, inlen, lparam, lparamlen, modulus_bitlen, prng, prng_idx, hash_idx, out, &x)) != CRYPT_OK) { return err; } } else { /* LTC_PKCS #1 v1.5 pad the key */ x = *outlen; if ((err = pkcs_1_v1_5_encode(in, inlen, LTC_LTC_PKCS_1_EME, modulus_bitlen, prng, prng_idx, out, &x)) != CRYPT_OK) { return err; } } /* rsa exptmod the OAEP or LTC_PKCS #1 v1.5 pad */ return ltc_mp.rsa_me(out, x, out, outlen, PK_PUBLIC, key); } #endif /* LTC_MRSA */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c,v $ */ /* $Revision: 1.10 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rsa_exptmod.c RSA LTC_PKCS exptmod, Tom St Denis */ #ifdef LTC_MRSA /** Compute an RSA modular exponentiation @param in The input data to send into RSA @param inlen The length of the input (octets) @param out [out] The destination @param outlen [in/out] The max size and resulting size of the output @param which Which exponent to use, e.g. PK_PRIVATE or PK_PUBLIC @param key The RSA key to use @return CRYPT_OK if successful */ int rsa_exptmod(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, int which, rsa_key *key) { void *tmp, *tmpa, *tmpb; unsigned long x; int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); /* is the key of the right type for the operation? */ if ((which == PK_PRIVATE) && (key->type != PK_PRIVATE)) { return CRYPT_PK_NOT_PRIVATE; } /* must be a private or public operation */ if ((which != PK_PRIVATE) && (which != PK_PUBLIC)) { return CRYPT_PK_INVALID_TYPE; } /* init and copy into tmp */ if ((err = mp_init_multi(&tmp, &tmpa, &tmpb, NULL)) != CRYPT_OK) { return err; } if ((err = mp_read_unsigned_bin(tmp, (unsigned char *)in, (int)inlen)) != CRYPT_OK) { goto error; } /* sanity check on the input */ if (mp_cmp(key->N, tmp) == LTC_MP_LT) { err = CRYPT_PK_INVALID_SIZE; goto error; } /* are we using the private exponent and is the key optimized? */ if (which == PK_PRIVATE) { /* tmpa = tmp^dP mod p */ if ((err = mp_exptmod(tmp, key->dP, key->p, tmpa)) != CRYPT_OK) { goto error; } /* tmpb = tmp^dQ mod q */ if ((err = mp_exptmod(tmp, key->dQ, key->q, tmpb)) != CRYPT_OK) { goto error; } /* tmp = (tmpa - tmpb) * qInv (mod p) */ if ((err = mp_sub(tmpa, tmpb, tmp)) != CRYPT_OK) { goto error; } if ((err = mp_mulmod(tmp, key->qP, key->p, tmp)) != CRYPT_OK) { goto error; } /* tmp = tmpb + q * tmp */ if ((err = mp_mul(tmp, key->q, tmp)) != CRYPT_OK) { goto error; } if ((err = mp_add(tmp, tmpb, tmp)) != CRYPT_OK) { goto error; } } else { /* exptmod it */ if ((err = mp_exptmod(tmp, key->e, key->N, tmp)) != CRYPT_OK) { goto error; } } /* read it back */ x = (unsigned long)mp_unsigned_bin_size(key->N); if (x > *outlen) { *outlen = x; err = CRYPT_BUFFER_OVERFLOW; goto error; } /* this should never happen ... */ if (mp_unsigned_bin_size(tmp) > mp_unsigned_bin_size(key->N)) { err = CRYPT_ERROR; goto error; } *outlen = x; /* convert it */ zeromem(out, x); if ((err = mp_to_unsigned_bin(tmp, out + (x - mp_unsigned_bin_size(tmp)))) != CRYPT_OK) { goto error; } /* clean up and return */ err = CRYPT_OK; error: mp_clear_multi(tmp, tmpa, tmpb, NULL); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_exptmod.c,v $ */ /* $Revision: 1.18 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rsa_free.c Free an RSA key, Tom St Denis */ #ifdef LTC_MRSA /** Free an RSA key from memory @param key The RSA key to free */ void rsa_free(rsa_key *key) { LTC_ARGCHKVD(key != NULL); mp_clear_multi(key->e, key->d, key->N, key->dQ, key->dP, key->qP, key->p, key->q, NULL); } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_free.c,v $ */ /* $Revision: 1.10 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rsa_import.c Import a LTC_PKCS RSA key, Tom St Denis */ #ifdef LTC_MRSA /** Import an RSAPublicKey or RSAPrivateKey [two-prime only, only support >= 1024-bit keys, defined in LTC_PKCS #1 v2.1] @param in The packet to import from @param inlen It's length (octets) @param key [out] Destination for newly imported key @return CRYPT_OK if successful, upon error allocated memory is freed */ int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key) { int err; void *zero; unsigned char *tmpbuf; unsigned long t, x, y, z, tmpoid[16]; ltc_asn1_list ssl_pubkey_hashoid[2]; ltc_asn1_list ssl_pubkey[2]; LTC_ARGCHK(in != NULL); LTC_ARGCHK(key != NULL); LTC_ARGCHK(ltc_mp.name != NULL); /* init key */ if ((err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, &key->dP, &key->qP, &key->p, &key->q, NULL)) != CRYPT_OK) { return err; } /* see if the OpenSSL DER format RSA public key will work */ tmpbuf = AUTO_CAST(XCALLOC(1, MAX_RSA_SIZE * 8)); if (tmpbuf == NULL) { err = CRYPT_MEM; goto LBL_ERR; } /* this includes the internal hash ID and optional params (NULL in this case) */ LTC_SET_ASN1(ssl_pubkey_hashoid, 0, LTC_ASN1_OBJECT_IDENTIFIER, tmpoid, sizeof(tmpoid) / sizeof(tmpoid[0])); LTC_SET_ASN1(ssl_pubkey_hashoid, 1, LTC_ASN1_NULL, NULL, 0); /* the actual format of the SSL DER key is odd, it stores a RSAPublicKey in a **BIT** string ... so we have to extract it then proceed to convert bit to octet */ LTC_SET_ASN1(ssl_pubkey, 0, LTC_ASN1_SEQUENCE, &ssl_pubkey_hashoid, 2); LTC_SET_ASN1(ssl_pubkey, 1, LTC_ASN1_BIT_STRING, tmpbuf, MAX_RSA_SIZE * 8); if (der_decode_sequence(in, inlen, ssl_pubkey, 2UL) == CRYPT_OK) { /* ok now we have to reassemble the BIT STRING to an OCTET STRING. Thanks OpenSSL... */ for (t = y = z = x = 0; x < ssl_pubkey[1].size; x++) { y = (y << 1) | tmpbuf[x]; if (++z == 8) { tmpbuf[t++] = (unsigned char)y; y = 0; z = 0; } } /* now it should be SEQUENCE { INTEGER, INTEGER } */ if ((err = der_decode_sequence_multi(tmpbuf, t, LTC_ASN1_INTEGER, 1UL, key->N, LTC_ASN1_INTEGER, 1UL, key->e, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { XFREE(tmpbuf); goto LBL_ERR; } XFREE(tmpbuf); key->type = PK_PUBLIC; return CRYPT_OK; } XFREE(tmpbuf); /* not SSL public key, try to match against LTC_PKCS #1 standards */ if ((err = der_decode_sequence_multi(in, inlen, LTC_ASN1_INTEGER, 1UL, key->N, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto LBL_ERR; } if (mp_cmp_d(key->N, 0) == LTC_MP_EQ) { if ((err = mp_init(&zero)) != CRYPT_OK) { goto LBL_ERR; } /* it's a private key */ if ((err = der_decode_sequence_multi(in, inlen, LTC_ASN1_INTEGER, 1UL, zero, LTC_ASN1_INTEGER, 1UL, key->N, LTC_ASN1_INTEGER, 1UL, key->e, LTC_ASN1_INTEGER, 1UL, key->d, LTC_ASN1_INTEGER, 1UL, key->p, LTC_ASN1_INTEGER, 1UL, key->q, LTC_ASN1_INTEGER, 1UL, key->dP, LTC_ASN1_INTEGER, 1UL, key->dQ, LTC_ASN1_INTEGER, 1UL, key->qP, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { mp_clear(zero); goto LBL_ERR; } mp_clear(zero); key->type = PK_PRIVATE; } else if (mp_cmp_d(key->N, 1) == LTC_MP_EQ) { /* we don't support multi-prime RSA */ err = CRYPT_PK_INVALID_TYPE; goto LBL_ERR; } else { /* it's a public key and we lack e */ if ((err = der_decode_sequence_multi(in, inlen, LTC_ASN1_INTEGER, 1UL, key->N, LTC_ASN1_INTEGER, 1UL, key->e, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto LBL_ERR; } key->type = PK_PUBLIC; } return CRYPT_OK; LBL_ERR: mp_clear_multi(key->d, key->e, key->N, key->dQ, key->dP, key->qP, key->p, key->q, NULL); return err; } #endif /* LTC_MRSA */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_import.c,v $ */ /* $Revision: 1.23 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rsa_make_key.c RSA key generation, Tom St Denis */ #ifdef LTC_MRSA /** Create an RSA key @param prng An active PRNG state @param wprng The index of the PRNG desired @param size The size of the modulus (key size) desired (octets) @param e The "e" value (public key). e==65537 is a good choice @param key [out] Destination of a newly created private key pair @return CRYPT_OK if successful, upon error all allocated ram is freed */ int rsa_make_key(prng_state *prng, int wprng, int size, long e, rsa_key *key) { void *p, *q, *tmp1, *tmp2, *tmp3; int err; LTC_ARGCHK(ltc_mp.name != NULL); LTC_ARGCHK(key != NULL); if ((size < (MIN_RSA_SIZE / 8)) || (size > (MAX_RSA_SIZE / 8))) { return CRYPT_INVALID_KEYSIZE; } if ((e < 3) || ((e & 1) == 0)) { return CRYPT_INVALID_ARG; } if ((err = prng_is_valid(wprng)) != CRYPT_OK) { return err; } if ((err = mp_init_multi(&p, &q, &tmp1, &tmp2, &tmp3, NULL)) != CRYPT_OK) { return err; } /* make primes p and q (optimization provided by Wayne Scott) */ if ((err = mp_set_int(tmp3, e)) != CRYPT_OK) { goto errkey; } /* tmp3 = e */ /* make prime "p" */ do { if ((err = rand_prime(p, size / 2, prng, wprng)) != CRYPT_OK) { goto errkey; } if ((err = mp_sub_d(p, 1, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = p-1 */ if ((err = mp_gcd(tmp1, tmp3, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = gcd(p-1, e) */ } while (mp_cmp_d(tmp2, 1) != 0); /* while e divides p-1 */ /* make prime "q" */ do { if ((err = rand_prime(q, size / 2, prng, wprng)) != CRYPT_OK) { goto errkey; } if ((err = mp_sub_d(q, 1, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = q-1 */ if ((err = mp_gcd(tmp1, tmp3, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = gcd(q-1, e) */ } while (mp_cmp_d(tmp2, 1) != 0); /* while e divides q-1 */ /* tmp1 = lcm(p-1, q-1) */ if ((err = mp_sub_d(p, 1, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = p-1 */ /* tmp1 = q-1 (previous do/while loop) */ if ((err = mp_lcm(tmp1, tmp2, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = lcm(p-1, q-1) */ /* make key */ if ((err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, &key->dP, &key->qP, &key->p, &key->q, NULL)) != CRYPT_OK) { goto errkey; } if ((err = mp_set_int(key->e, e)) != CRYPT_OK) { goto errkey; } /* key->e = e */ if ((err = mp_invmod(key->e, tmp1, key->d)) != CRYPT_OK) { goto errkey; } /* key->d = 1/e mod lcm(p-1,q-1) */ if ((err = mp_mul(p, q, key->N)) != CRYPT_OK) { goto errkey; } /* key->N = pq */ /* optimize for CRT now */ /* find d mod q-1 and d mod p-1 */ if ((err = mp_sub_d(p, 1, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = q-1 */ if ((err = mp_sub_d(q, 1, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = p-1 */ if ((err = mp_mod(key->d, tmp1, key->dP)) != CRYPT_OK) { goto errkey; } /* dP = d mod p-1 */ if ((err = mp_mod(key->d, tmp2, key->dQ)) != CRYPT_OK) { goto errkey; } /* dQ = d mod q-1 */ if ((err = mp_invmod(q, p, key->qP)) != CRYPT_OK) { goto errkey; } /* qP = 1/q mod p */ if ((err = mp_copy(p, key->p)) != CRYPT_OK) { goto errkey; } if ((err = mp_copy(q, key->q)) != CRYPT_OK) { goto errkey; } /* set key type (in this case it's CRT optimized) */ key->type = PK_PRIVATE; /* return ok and free temps */ err = CRYPT_OK; goto cleanup; errkey: mp_clear_multi(key->d, key->e, key->N, key->dQ, key->dP, key->qP, key->p, key->q, NULL); cleanup: mp_clear_multi(tmp3, tmp2, tmp1, p, q, NULL); return err; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_make_key.c,v $ */ /* $Revision: 1.16 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rsa_sign_hash.c RSA LTC_PKCS #1 v1.5 and v2 PSS sign hash, Tom St Denis and Andreas Lange */ #ifdef LTC_MRSA /** LTC_PKCS #1 pad then sign @param in The hash to sign @param inlen The length of the hash to sign (octets) @param out [out] The signature @param outlen [in/out] The max size and resulting size of the signature @param padding Type of padding (LTC_LTC_PKCS_1_PSS or LTC_LTC_PKCS_1_V1_5) @param prng An active PRNG state @param prng_idx The index of the PRNG desired @param hash_idx The index of the hash desired @param saltlen The length of the salt desired (octets) @param key The private RSA key to use @return CRYPT_OK if successful */ int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, int padding, prng_state *prng, int prng_idx, int hash_idx, unsigned long saltlen, rsa_key *key) { unsigned long modulus_bitlen, modulus_bytelen, x, y; int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); /* valid padding? */ if ((padding != LTC_LTC_PKCS_1_V1_5) && (padding != LTC_LTC_PKCS_1_PSS)) { return CRYPT_PK_INVALID_PADDING; } if (padding == LTC_LTC_PKCS_1_PSS) { /* valid prng and hash ? */ if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { return err; } if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } } /* get modulus len in bits */ modulus_bitlen = mp_count_bits((key->N)); /* outlen must be at least the size of the modulus */ modulus_bytelen = mp_unsigned_bin_size((key->N)); if (modulus_bytelen > *outlen) { *outlen = modulus_bytelen; return CRYPT_BUFFER_OVERFLOW; } if (padding == LTC_LTC_PKCS_1_PSS) { /* PSS pad the key */ x = *outlen; if ((err = pkcs_1_pss_encode(in, inlen, saltlen, prng, prng_idx, hash_idx, modulus_bitlen, out, &x)) != CRYPT_OK) { return err; } } else { /* LTC_PKCS #1 v1.5 pad the hash */ unsigned char *tmpin; ltc_asn1_list digestinfo[2], siginfo[2]; /* not all hashes have OIDs... so sad */ if (hash_descriptor[hash_idx].OIDlen == 0) { return CRYPT_INVALID_ARG; } /* construct the SEQUENCE SEQUENCE { SEQUENCE {hashoid OID blah NULL } hash OCTET STRING } */ LTC_SET_ASN1(digestinfo, 0, LTC_ASN1_OBJECT_IDENTIFIER, hash_descriptor[hash_idx].OID, hash_descriptor[hash_idx].OIDlen); LTC_SET_ASN1(digestinfo, 1, LTC_ASN1_NULL, NULL, 0); LTC_SET_ASN1(siginfo, 0, LTC_ASN1_SEQUENCE, digestinfo, 2); LTC_SET_ASN1(siginfo, 1, LTC_ASN1_OCTET_STRING, in, inlen); /* allocate memory for the encoding */ y = mp_unsigned_bin_size(key->N); tmpin = AUTO_CAST(XMALLOC(y)); if (tmpin == NULL) { return CRYPT_MEM; } if ((err = der_encode_sequence(siginfo, 2, tmpin, &y)) != CRYPT_OK) { XFREE(tmpin); return err; } x = *outlen; if ((err = pkcs_1_v1_5_encode(tmpin, y, LTC_LTC_PKCS_1_EMSA, modulus_bitlen, NULL, 0, out, &x)) != CRYPT_OK) { XFREE(tmpin); return err; } XFREE(tmpin); } /* RSA encode it */ return ltc_mp.rsa_me(out, x, out, outlen, PK_PRIVATE, key); } #endif /* LTC_MRSA */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_sign_hash.c,v $ */ /* $Revision: 1.11 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rsa_verify_hash.c RSA LTC_PKCS #1 v1.5 or v2 PSS signature verification, Tom St Denis and Andreas Lange */ #ifdef LTC_MRSA /** LTC_PKCS #1 de-sign then v1.5 or PSS depad @param sig The signature data @param siglen The length of the signature data (octets) @param hash The hash of the message that was signed @param hashlen The length of the hash of the message that was signed (octets) @param padding Type of padding (LTC_LTC_PKCS_1_PSS or LTC_LTC_PKCS_1_V1_5) @param hash_idx The index of the desired hash @param saltlen The length of the salt used during signature @param stat [out] The result of the signature comparison, 1==valid, 0==invalid @param key The public RSA key corresponding to the key that performed the signature @return CRYPT_OK on success (even if the signature is invalid) */ int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen, const unsigned char *hash, unsigned long hashlen, int padding, int hash_idx, unsigned long saltlen, int *stat, rsa_key *key) { unsigned long modulus_bitlen, modulus_bytelen, x; int err; unsigned char *tmpbuf; LTC_ARGCHK(hash != NULL); LTC_ARGCHK(sig != NULL); LTC_ARGCHK(stat != NULL); LTC_ARGCHK(key != NULL); /* default to invalid */ *stat = 0; /* valid padding? */ if ((padding != LTC_LTC_PKCS_1_V1_5) && (padding != LTC_LTC_PKCS_1_PSS)) { return CRYPT_PK_INVALID_PADDING; } if (padding == LTC_LTC_PKCS_1_PSS) { /* valid hash ? */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } } /* get modulus len in bits */ modulus_bitlen = mp_count_bits((key->N)); /* outlen must be at least the size of the modulus */ modulus_bytelen = mp_unsigned_bin_size((key->N)); if (modulus_bytelen != siglen) { return CRYPT_INVALID_PACKET; } /* allocate temp buffer for decoded sig */ tmpbuf = AUTO_CAST(XMALLOC(siglen)); if (tmpbuf == NULL) { return CRYPT_MEM; } /* RSA decode it */ x = siglen; if ((err = ltc_mp.rsa_me(sig, siglen, tmpbuf, &x, PK_PUBLIC, key)) != CRYPT_OK) { XFREE(tmpbuf); return err; } /* make sure the output is the right size */ if (x != siglen) { XFREE(tmpbuf); return CRYPT_INVALID_PACKET; } if (padding == LTC_LTC_PKCS_1_PSS) { /* PSS decode and verify it */ err = pkcs_1_pss_decode(hash, hashlen, tmpbuf, x, saltlen, hash_idx, modulus_bitlen, stat); } else { /* LTC_PKCS #1 v1.5 decode it */ unsigned char *out; unsigned long outlen, loid[16]; int decoded; ltc_asn1_list digestinfo[2], siginfo[2]; /* not all hashes have OIDs... so sad */ if (hash_descriptor[hash_idx].OIDlen == 0) { err = CRYPT_INVALID_ARG; goto bail_2; } /* allocate temp buffer for decoded hash */ outlen = ((modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0)) - 3; out = AUTO_CAST(XMALLOC(outlen)); if (out == NULL) { err = CRYPT_MEM; goto bail_2; } if ((err = pkcs_1_v1_5_decode(tmpbuf, x, LTC_LTC_PKCS_1_EMSA, modulus_bitlen, out, &outlen, &decoded)) != CRYPT_OK) { XFREE(out); goto bail_2; } /* now we must decode out[0...outlen-1] using ASN.1, test the OID and then test the hash */ /* construct the SEQUENCE SEQUENCE { SEQUENCE {hashoid OID blah NULL } hash OCTET STRING } */ LTC_SET_ASN1(digestinfo, 0, LTC_ASN1_OBJECT_IDENTIFIER, loid, sizeof(loid) / sizeof(loid[0])); LTC_SET_ASN1(digestinfo, 1, LTC_ASN1_NULL, NULL, 0); LTC_SET_ASN1(siginfo, 0, LTC_ASN1_SEQUENCE, digestinfo, 2); LTC_SET_ASN1(siginfo, 1, LTC_ASN1_OCTET_STRING, tmpbuf, siglen); if ((err = der_decode_sequence(out, outlen, siginfo, 2)) != CRYPT_OK) { XFREE(out); goto bail_2; } /* test OID */ if ((digestinfo[0].size == hash_descriptor[hash_idx].OIDlen) && (XMEMCMP(digestinfo[0].data, hash_descriptor[hash_idx].OID, sizeof(unsigned long) * hash_descriptor[hash_idx].OIDlen) == 0) && (siginfo[1].size == hashlen) && (XMEMCMP(siginfo[1].data, hash, hashlen) == 0)) { *stat = 1; } #ifdef LTC_CLEAN_STACK zeromem(out, outlen); #endif XFREE(out); } bail_2: #ifdef LTC_CLEAN_STACK zeromem(tmpbuf, siglen); #endif XFREE(tmpbuf); return err; } #endif /* LTC_MRSA */ /* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_verify_hash.c,v $ */ /* $Revision: 1.13 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file sprng.c Secure PRNG, Tom St Denis */ /* A secure PRNG using the RNG functions. Basically this is a * wrapper that allows you to use a secure RNG as a PRNG * in the various other functions. */ #ifdef LTC_SPRNG const struct ltc_prng_descriptor sprng_desc = { "sprng", 0, &sprng_start, &sprng_add_entropy, &sprng_ready, &sprng_read, &sprng_done, &sprng_export, &sprng_import, &sprng_test }; /** Start the PRNG @param prng [out] The PRNG state to initialize @return CRYPT_OK if successful */ int sprng_start(prng_state *prng) { return CRYPT_OK; } /** Add entropy to the PRNG state @param in The data to add @param inlen Length of the data to add @param prng PRNG state to update @return CRYPT_OK if successful */ int sprng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) { return CRYPT_OK; } /** Make the PRNG ready to read from @param prng The PRNG to make active @return CRYPT_OK if successful */ int sprng_ready(prng_state *prng) { return CRYPT_OK; } /** Read from the PRNG @param out Destination @param outlen Length of output @param prng The active PRNG to read from @return Number of octets read */ unsigned long sprng_read(unsigned char *out, unsigned long outlen, prng_state *prng) { LTC_ARGCHK(out != NULL); return rng_get_bytes(out, outlen, NULL); } /** Terminate the PRNG @param prng The PRNG to terminate @return CRYPT_OK if successful */ int sprng_done(prng_state *prng) { return CRYPT_OK; } /** Export the PRNG state @param out [out] Destination @param outlen [in/out] Max size and resulting size of the state @param prng The PRNG to export @return CRYPT_OK if successful */ int sprng_export(unsigned char *out, unsigned long *outlen, prng_state *prng) { LTC_ARGCHK(outlen != NULL); *outlen = 0; return CRYPT_OK; } /** Import a PRNG state @param in The PRNG state @param inlen Size of the state @param prng The PRNG to import @return CRYPT_OK if successful */ int sprng_import(const unsigned char *in, unsigned long inlen, prng_state *prng) { return CRYPT_OK; } /** PRNG self-test @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled */ int sprng_test(void) { return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/prngs/sprng.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file base64_decode.c Compliant base64 code donated by Wayne Scott (wscott@bitmover.com) base64 URL Safe variant (RFC 4648 section 5) by Karel Miko */ #if defined(LTC_BASE64) || defined (LTC_BASE64_URL) #if defined(LTC_BASE64) static const unsigned char map_base64[256] = { 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 62, 255, 255, 255, 63, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 255, 255, 255, 254, 255, 255, 255, 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 255, 255, 255, 255, 255, 255, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255 }; #endif /* LTC_BASE64 */ #if defined(LTC_BASE64_URL) static const unsigned char map_base64url[] = { 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 62, 255, 255, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 255, 255, 255, 254, 255, 255, 255, 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 255, 255, 255, 255, 63, 255, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255 }; #endif /* LTC_BASE64_URL */ enum { relaxed = 0, strict = 1 }; static int _base64_decode_internal(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, const unsigned char *map, int is_strict) { unsigned long t, x, y, z; unsigned char c; int g; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); g = 0; /* '=' counter */ for (x = y = z = t = 0; x < inlen; x++) { c = map[in[x]&0xFF]; if (c == 254) { g++; continue; } else if (is_strict && g > 0) { /* we only allow '=' to be at the end */ return CRYPT_INVALID_PACKET; } if (c == 255) { if (is_strict) return CRYPT_INVALID_PACKET; else continue; } t = (t<<6)|c; if (++y == 4) { if (z + 3 > *outlen) return CRYPT_BUFFER_OVERFLOW; out[z++] = (unsigned char)((t>>16)&255); out[z++] = (unsigned char)((t>>8)&255); out[z++] = (unsigned char)(t&255); y = t = 0; } } if (y != 0) { int allow_b64url = 0; #ifdef LTC_BASE64_URL if (map == map_base64url) { allow_b64url = 1; } #endif if (y == 1) return CRYPT_INVALID_PACKET; if ((y + g) != 4 && is_strict && !allow_b64url) return CRYPT_INVALID_PACKET; t = t << (6 * (4 - y)); if (z + y - 1 > *outlen) return CRYPT_BUFFER_OVERFLOW; if (y >= 2) out[z++] = (unsigned char) ((t >> 16) & 255); if (y == 3) out[z++] = (unsigned char) ((t >> 8) & 255); } *outlen = z; return CRYPT_OK; } #if defined(LTC_BASE64) /** Relaxed base64 decode a block of memory @param in The base64 data to decode @param inlen The length of the base64 data @param out [out] The destination of the binary decoded data @param outlen [in/out] The max size and resulting size of the decoded data @return CRYPT_OK if successful */ int base64_decode(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { return _base64_decode_internal(in, inlen, out, outlen, map_base64, relaxed); } /** Strict base64 decode a block of memory @param in The base64 data to decode @param inlen The length of the base64 data @param out [out] The destination of the binary decoded data @param outlen [in/out] The max size and resulting size of the decoded data @return CRYPT_OK if successful */ int base64_strict_decode(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { return _base64_decode_internal(in, inlen, out, outlen, map_base64, strict); } #endif /* LTC_BASE64 */ #if defined(LTC_BASE64_URL) /** Relaxed base64 (URL Safe, RFC 4648 section 5) decode a block of memory @param in The base64 data to decode @param inlen The length of the base64 data @param out [out] The destination of the binary decoded data @param outlen [in/out] The max size and resulting size of the decoded data @return CRYPT_OK if successful */ int base64url_decode(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { return _base64_decode_internal(in, inlen, out, outlen, map_base64url, relaxed); } /** Strict base64 (URL Safe, RFC 4648 section 5) decode a block of memory @param in The base64 data to decode @param inlen The length of the base64 data @param out [out] The destination of the binary decoded data @param outlen [in/out] The max size and resulting size of the decoded data @return CRYPT_OK if successful */ int base64url_strict_decode(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { return _base64_decode_internal(in, inlen, out, outlen, map_base64url, strict); } #endif /* LTC_BASE64_URL */ #endif /** @file zeromem.c Zero a block of memory, Tom St Denis */ /** Zero a block of memory @param out The destination of the area to zero @param outlen The length of the area to zero (octets) */ void zeromem(void *out, size_t outlen) { unsigned char *mem = AUTO_CAST(out); LTC_ARGCHKVD(out != NULL); while (outlen-- > 0) { *mem++ = 0; } } /* $Source: /cvs/libtom/libtomcrypt/src/misc/zeromem.c,v $ */ /* $Revision: 1.7 $ */ /* $Date: 2006/12/28 01:27:24 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file sha1.c LTC_SHA1 code by Tom St Denis */ #ifdef LTC_SHA1 const struct ltc_hash_descriptor sha1_desc = { "sha1", 2, 20, 64, /* OID */ { 1, 3, 14, 3, 2, 26, }, 6, &sha1_init, &sha1_process, &sha1_done, &sha1_test, NULL }; #define F0(x, y, z) (z ^ (x & (y ^ z))) #define F1(x, y, z) (x ^ y ^ z) #define F2(x, y, z) ((x & y) | (z & (x | y))) #define F3(x, y, z) (x ^ y ^ z) #ifdef LTC_CLEAN_STACK static int _sha1_compress(hash_state *md, unsigned char *buf) #else static int sha1_compress(hash_state *md, unsigned char *buf) #endif { ulong32 a, b, c, d, e, W[80], i; #ifdef LTC_SMALL_CODE ulong32 t; #endif /* copy the state into 512-bits into W[0..15] */ for (i = 0; i < 16; i++) { LOAD32H(W[i], buf + (4 * i)); } /* copy state */ a = md->sha1.state[0]; b = md->sha1.state[1]; c = md->sha1.state[2]; d = md->sha1.state[3]; e = md->sha1.state[4]; /* expand it */ for (i = 16; i < 80; i++) { W[i] = ROL(W[i - 3] ^ W[i - 8] ^ W[i - 14] ^ W[i - 16], 1); } /* compress */ /* round one */ #define FF0(a, b, c, d, e, i) e = (ROLc(a, 5) + F0(b, c, d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); #define FF1(a, b, c, d, e, i) e = (ROLc(a, 5) + F1(b, c, d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); #define FF2(a, b, c, d, e, i) e = (ROLc(a, 5) + F2(b, c, d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); #define FF3(a, b, c, d, e, i) e = (ROLc(a, 5) + F3(b, c, d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); #ifdef LTC_SMALL_CODE for (i = 0; i < 20; ) { FF0(a, b, c, d, e, i++); t = e; e = d; d = c; c = b; b = a; a = t; } for ( ; i < 40; ) { FF1(a, b, c, d, e, i++); t = e; e = d; d = c; c = b; b = a; a = t; } for ( ; i < 60; ) { FF2(a, b, c, d, e, i++); t = e; e = d; d = c; c = b; b = a; a = t; } for ( ; i < 80; ) { FF3(a, b, c, d, e, i++); t = e; e = d; d = c; c = b; b = a; a = t; } #else for (i = 0; i < 20; ) { FF0(a, b, c, d, e, i++); FF0(e, a, b, c, d, i++); FF0(d, e, a, b, c, i++); FF0(c, d, e, a, b, i++); FF0(b, c, d, e, a, i++); } /* round two */ for ( ; i < 40; ) { FF1(a, b, c, d, e, i++); FF1(e, a, b, c, d, i++); FF1(d, e, a, b, c, i++); FF1(c, d, e, a, b, i++); FF1(b, c, d, e, a, i++); } /* round three */ for ( ; i < 60; ) { FF2(a, b, c, d, e, i++); FF2(e, a, b, c, d, i++); FF2(d, e, a, b, c, i++); FF2(c, d, e, a, b, i++); FF2(b, c, d, e, a, i++); } /* round four */ for ( ; i < 80; ) { FF3(a, b, c, d, e, i++); FF3(e, a, b, c, d, i++); FF3(d, e, a, b, c, i++); FF3(c, d, e, a, b, i++); FF3(b, c, d, e, a, i++); } #endif #undef FF0 #undef FF1 #undef FF2 #undef FF3 /* store */ md->sha1.state[0] = md->sha1.state[0] + a; md->sha1.state[1] = md->sha1.state[1] + b; md->sha1.state[2] = md->sha1.state[2] + c; md->sha1.state[3] = md->sha1.state[3] + d; md->sha1.state[4] = md->sha1.state[4] + e; return CRYPT_OK; } #ifdef LTC_CLEAN_STACK static int sha1_compress(hash_state *md, unsigned char *buf) { int err; err = _sha1_compress(md, buf); burn_stack(sizeof(ulong32) * 87); return err; } #endif /** Initialize the hash state @param md The hash state you wish to initialize @return CRYPT_OK if successful */ int sha1_init(hash_state *md) { LTC_ARGCHK(md != NULL); md->sha1.state[0] = 0x67452301UL; md->sha1.state[1] = 0xefcdab89UL; md->sha1.state[2] = 0x98badcfeUL; md->sha1.state[3] = 0x10325476UL; md->sha1.state[4] = 0xc3d2e1f0UL; md->sha1.curlen = 0; md->sha1.length = 0; return CRYPT_OK; } /** Process a block of memory though the hash @param md The hash state @param in The data to hash @param inlen The length of the data (octets) @return CRYPT_OK if successful */ HASH_PROCESS(sha1_process, sha1_compress, sha1, 64) /** Terminate the hash to get the digest @param md The hash state @param out [out] The destination of the hash (20 bytes) @return CRYPT_OK if successful */ int sha1_done(hash_state *md, unsigned char *out) { int i; LTC_ARGCHK(md != NULL); LTC_ARGCHK(out != NULL); if (md->sha1.curlen >= sizeof(md->sha1.buf)) { return CRYPT_INVALID_ARG; } /* increase the length of the message */ md->sha1.length += md->sha1.curlen * 8; /* append the '1' bit */ md->sha1.buf[md->sha1.curlen++] = (unsigned char)0x80; /* if the length is currently above 56 bytes we append zeros * then compress. Then we can fall back to padding zeros and length * encoding like normal. */ if (md->sha1.curlen > 56) { while (md->sha1.curlen < 64) { md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; } sha1_compress(md, md->sha1.buf); md->sha1.curlen = 0; } /* pad upto 56 bytes of zeroes */ while (md->sha1.curlen < 56) { md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; } /* store length */ STORE64H(md->sha1.length, md->sha1.buf + 56); sha1_compress(md, md->sha1.buf); /* copy output */ for (i = 0; i < 5; i++) { STORE32H(md->sha1.state[i], out + (4 * i)); } #ifdef LTC_CLEAN_STACK zeromem(md, sizeof(hash_state)); #endif return CRYPT_OK; } /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled */ int sha1_test(void) { #ifndef LTC_TEST return CRYPT_NOP; #else static const struct { char *msg; unsigned char hash[20]; } tests[] = { { "abc", { 0xa9, 0x99, 0x3e, 0x36, 0x47, 0x06, 0x81, 0x6a, 0xba, 0x3e, 0x25, 0x71, 0x78, 0x50, 0xc2, 0x6c, 0x9c, 0xd0, 0xd8, 0x9d } }, { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", { 0x84, 0x98, 0x3E, 0x44, 0x1C, 0x3B, 0xD2, 0x6E, 0xBA, 0xAE, 0x4A, 0xA1, 0xF9, 0x51, 0x29, 0xE5, 0xE5, 0x46, 0x70, 0xF1 } } }; int i; unsigned char tmp[20]; hash_state md; for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { sha1_init(&md); sha1_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); sha1_done(&md, tmp); if (XMEMCMP(tmp, tests[i].hash, 20) != 0) { return CRYPT_FAIL_TESTVECTOR; } } return CRYPT_OK; #endif } #endif /* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha1.c,v $ */ /* $Revision: 1.10 $ */ /* $Date: 2007/05/12 14:25:28 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file sha256.c LTC_SHA256 by Tom St Denis */ #ifdef LTC_SHA256 const struct ltc_hash_descriptor sha256_desc = { "sha256", 0, 32, 64, /* OID */ { 2, 16, 840, 1, 101, 3, 4, 2, 1, }, 9, &sha256_init, &sha256_process, &sha256_done, &sha256_test, NULL }; #ifdef LTC_SMALL_CODE /* the K array */ static const ulong32 K[64] = { 0x428a2f98UL, 0x71374491UL, 0xb5c0fbcfUL, 0xe9b5dba5UL, 0x3956c25bUL, 0x59f111f1UL, 0x923f82a4UL, 0xab1c5ed5UL, 0xd807aa98UL, 0x12835b01UL, 0x243185beUL, 0x550c7dc3UL, 0x72be5d74UL, 0x80deb1feUL, 0x9bdc06a7UL, 0xc19bf174UL, 0xe49b69c1UL, 0xefbe4786UL, 0x0fc19dc6UL, 0x240ca1ccUL, 0x2de92c6fUL, 0x4a7484aaUL, 0x5cb0a9dcUL, 0x76f988daUL, 0x983e5152UL, 0xa831c66dUL, 0xb00327c8UL, 0xbf597fc7UL, 0xc6e00bf3UL, 0xd5a79147UL, 0x06ca6351UL, 0x14292967UL, 0x27b70a85UL, 0x2e1b2138UL, 0x4d2c6dfcUL, 0x53380d13UL, 0x650a7354UL, 0x766a0abbUL, 0x81c2c92eUL, 0x92722c85UL, 0xa2bfe8a1UL, 0xa81a664bUL, 0xc24b8b70UL, 0xc76c51a3UL, 0xd192e819UL, 0xd6990624UL, 0xf40e3585UL, 0x106aa070UL, 0x19a4c116UL, 0x1e376c08UL, 0x2748774cUL, 0x34b0bcb5UL, 0x391c0cb3UL, 0x4ed8aa4aUL, 0x5b9cca4fUL, 0x682e6ff3UL, 0x748f82eeUL, 0x78a5636fUL, 0x84c87814UL, 0x8cc70208UL, 0x90befffaUL, 0xa4506cebUL, 0xbef9a3f7UL, 0xc67178f2UL }; #endif /* Various logical functions */ #define Ch(x,y,z) (z ^ (x & (y ^ z))) #define Maj(x,y,z) (((x | y) & z) | (x & y)) #define S(x, n) RORc((x),(n)) #define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) #define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) #define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) #define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) #define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) /* compress 512-bits */ #ifdef LTC_CLEAN_STACK static int _sha256_compress(hash_state * md, unsigned char *buf) #else static int sha256_compress(hash_state * md, unsigned char *buf) #endif { ulong32 S[8], W[64], t0, t1; #ifdef LTC_SMALL_CODE ulong32 t; #endif int i; /* copy state into S */ for (i = 0; i < 8; i++) { S[i] = md->sha256.state[i]; } /* copy the state into 512-bits into W[0..15] */ for (i = 0; i < 16; i++) { LOAD32H(W[i], buf + (4*i)); } /* fill W[16..63] */ for (i = 16; i < 64; i++) { W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; } /* Compress */ #ifdef LTC_SMALL_CODE #define RND(a,b,c,d,e,f,g,h,i) \ t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ t1 = Sigma0(a) + Maj(a, b, c); \ d += t0; \ h = t0 + t1; for (i = 0; i < 64; ++i) { RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; } #else #define RND(a,b,c,d,e,f,g,h,i,ki) \ t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \ t1 = Sigma0(a) + Maj(a, b, c); \ d += t0; \ h = t0 + t1; RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98); RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491); RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf); RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5); RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b); RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1); RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5); RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98); RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01); RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be); RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3); RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74); RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe); RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174); RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1); RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786); RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6); RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc); RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f); RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa); RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da); RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152); RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d); RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8); RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7); RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3); RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147); RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967); RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85); RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138); RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc); RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13); RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354); RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb); RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85); RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1); RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b); RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70); RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3); RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819); RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624); RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070); RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116); RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08); RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c); RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5); RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3); RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a); RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3); RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee); RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f); RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814); RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208); RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa); RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb); RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2); #undef RND #endif /* feedback */ for (i = 0; i < 8; i++) { md->sha256.state[i] = md->sha256.state[i] + S[i]; } return CRYPT_OK; } #ifdef LTC_CLEAN_STACK static int sha256_compress(hash_state * md, unsigned char *buf) { int err; err = _sha256_compress(md, buf); burn_stack(sizeof(ulong32) * 74); return err; } #endif /** Initialize the hash state @param md The hash state you wish to initialize @return CRYPT_OK if successful */ int sha256_init(hash_state * md) { LTC_ARGCHK(md != NULL); md->sha256.curlen = 0; md->sha256.length = 0; md->sha256.state[0] = 0x6A09E667UL; md->sha256.state[1] = 0xBB67AE85UL; md->sha256.state[2] = 0x3C6EF372UL; md->sha256.state[3] = 0xA54FF53AUL; md->sha256.state[4] = 0x510E527FUL; md->sha256.state[5] = 0x9B05688CUL; md->sha256.state[6] = 0x1F83D9ABUL; md->sha256.state[7] = 0x5BE0CD19UL; return CRYPT_OK; } /** Process a block of memory though the hash @param md The hash state @param in The data to hash @param inlen The length of the data (octets) @return CRYPT_OK if successful */ HASH_PROCESS(sha256_process, sha256_compress, sha256, 64) /** Terminate the hash to get the digest @param md The hash state @param out [out] The destination of the hash (32 bytes) @return CRYPT_OK if successful */ int sha256_done(hash_state * md, unsigned char *out) { int i; LTC_ARGCHK(md != NULL); LTC_ARGCHK(out != NULL); if (md->sha256.curlen >= sizeof(md->sha256.buf)) { return CRYPT_INVALID_ARG; } /* increase the length of the message */ md->sha256.length += md->sha256.curlen * 8; /* append the '1' bit */ md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80; /* if the length is currently above 56 bytes we append zeros * then compress. Then we can fall back to padding zeros and length * encoding like normal. */ if (md->sha256.curlen > 56) { while (md->sha256.curlen < 64) { md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; } sha256_compress(md, md->sha256.buf); md->sha256.curlen = 0; } /* pad upto 56 bytes of zeroes */ while (md->sha256.curlen < 56) { md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; } /* store length */ STORE64H(md->sha256.length, md->sha256.buf+56); sha256_compress(md, md->sha256.buf); /* copy output */ for (i = 0; i < 8; i++) { STORE32H(md->sha256.state[i], out+(4*i)); } #ifdef LTC_CLEAN_STACK zeromem(md, sizeof(hash_state)); #endif return CRYPT_OK; } /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled */ int sha256_test(void) { #ifndef LTC_TEST return CRYPT_NOP; #else static const struct { char *msg; unsigned char hash[32]; } tests[] = { { "abc", { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea, 0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23, 0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c, 0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad } }, { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, 0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39, 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, 0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 } }, }; int i; unsigned char tmp[32]; hash_state md; for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { sha256_init(&md); sha256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); sha256_done(&md, tmp); if (XMEMCMP(tmp, tests[i].hash, 32) != 0) { return CRYPT_FAIL_TESTVECTOR; } } return CRYPT_OK; #endif } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @param sha384.c LTC_SHA384 hash included in sha512.c, Tom St Denis */ #if defined(LTC_SHA384) && defined(LTC_SHA512) const struct ltc_hash_descriptor sha384_desc = { "sha384", 4, 48, 128, /* OID */ { 2, 16, 840, 1, 101, 3, 4, 2, 2, }, 9, &sha384_init, &sha512_process, &sha384_done, &sha384_test, NULL }; /** Initialize the hash state @param md The hash state you wish to initialize @return CRYPT_OK if successful */ int sha384_init(hash_state * md) { LTC_ARGCHK(md != NULL); md->sha512.curlen = 0; md->sha512.length = 0; md->sha512.state[0] = CONST64(0xcbbb9d5dc1059ed8); md->sha512.state[1] = CONST64(0x629a292a367cd507); md->sha512.state[2] = CONST64(0x9159015a3070dd17); md->sha512.state[3] = CONST64(0x152fecd8f70e5939); md->sha512.state[4] = CONST64(0x67332667ffc00b31); md->sha512.state[5] = CONST64(0x8eb44a8768581511); md->sha512.state[6] = CONST64(0xdb0c2e0d64f98fa7); md->sha512.state[7] = CONST64(0x47b5481dbefa4fa4); return CRYPT_OK; } /** Terminate the hash to get the digest @param md The hash state @param out [out] The destination of the hash (48 bytes) @return CRYPT_OK if successful */ int sha384_done(hash_state * md, unsigned char *out) { unsigned char buf[64]; LTC_ARGCHK(md != NULL); LTC_ARGCHK(out != NULL); if (md->sha512.curlen >= sizeof(md->sha512.buf)) { return CRYPT_INVALID_ARG; } sha512_done(md, buf); XMEMCPY(out, buf, 48); #ifdef LTC_CLEAN_STACK zeromem(buf, sizeof(buf)); #endif return CRYPT_OK; } /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled */ int sha384_test(void) { #ifndef LTC_TEST return CRYPT_NOP; #else static const struct { char *msg; unsigned char hash[48]; } tests[] = { { "abc", { 0xcb, 0x00, 0x75, 0x3f, 0x45, 0xa3, 0x5e, 0x8b, 0xb5, 0xa0, 0x3d, 0x69, 0x9a, 0xc6, 0x50, 0x07, 0x27, 0x2c, 0x32, 0xab, 0x0e, 0xde, 0xd1, 0x63, 0x1a, 0x8b, 0x60, 0x5a, 0x43, 0xff, 0x5b, 0xed, 0x80, 0x86, 0x07, 0x2b, 0xa1, 0xe7, 0xcc, 0x23, 0x58, 0xba, 0xec, 0xa1, 0x34, 0xc8, 0x25, 0xa7 } }, { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", { 0x09, 0x33, 0x0c, 0x33, 0xf7, 0x11, 0x47, 0xe8, 0x3d, 0x19, 0x2f, 0xc7, 0x82, 0xcd, 0x1b, 0x47, 0x53, 0x11, 0x1b, 0x17, 0x3b, 0x3b, 0x05, 0xd2, 0x2f, 0xa0, 0x80, 0x86, 0xe3, 0xb0, 0xf7, 0x12, 0xfc, 0xc7, 0xc7, 0x1a, 0x55, 0x7e, 0x2d, 0xb9, 0x66, 0xc3, 0xe9, 0xfa, 0x91, 0x74, 0x60, 0x39 } }, }; int i; unsigned char tmp[48]; hash_state md; for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { sha384_init(&md); sha384_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); sha384_done(&md, tmp); if (XMEMCMP(tmp, tests[i].hash, 48) != 0) { return CRYPT_FAIL_TESTVECTOR; } } return CRYPT_OK; #endif } #endif /* defined(LTC_SHA384) && defined(LTC_SHA512) */ /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @param sha512.c LTC_SHA512 by Tom St Denis */ #ifdef LTC_SHA512 const struct ltc_hash_descriptor sha512_desc = { "sha512", 5, 64, 128, /* OID */ { 2, 16, 840, 1, 101, 3, 4, 2, 3, }, 9, &sha512_init, &sha512_process, &sha512_done, &sha512_test, NULL }; /* the K array */ static const ulong64 K[80] = { CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd), CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc), CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019), CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118), CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe), CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2), CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1), CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694), CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3), CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65), CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483), CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5), CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210), CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4), CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725), CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70), CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926), CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df), CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8), CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b), CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001), CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30), CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910), CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8), CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53), CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8), CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb), CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3), CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60), CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec), CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9), CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b), CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207), CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178), CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6), CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b), CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493), CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c), CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a), CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817) }; /* Various logical functions */ #undef S #undef R #undef Sigma0 #undef Sigma1 #undef Gamma0 #undef Gamma1 #define Ch(x,y,z) (z ^ (x & (y ^ z))) #define Maj(x,y,z) (((x | y) & z) | (x & y)) #define S(x, n) ROR64c(x, n) #define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) #define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) #define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) #define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) #define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) /* compress 1024-bits */ #ifdef LTC_CLEAN_STACK static int _sha512_compress(hash_state * md, unsigned char *buf) #else static int sha512_compress(hash_state * md, unsigned char *buf) #endif { ulong64 S[8], W[80], t0, t1; int i; /* copy state into S */ for (i = 0; i < 8; i++) { S[i] = md->sha512.state[i]; } /* copy the state into 1024-bits into W[0..15] */ for (i = 0; i < 16; i++) { LOAD64H(W[i], buf + (8*i)); } /* fill W[16..79] */ for (i = 16; i < 80; i++) { W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; } /* Compress */ #ifdef LTC_SMALL_CODE for (i = 0; i < 80; i++) { t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; S[4] = S[3] + t0; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t0 + t1; } #else #define RND(a,b,c,d,e,f,g,h,i) \ t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ t1 = Sigma0(a) + Maj(a, b, c); \ d += t0; \ h = t0 + t1; for (i = 0; i < 80; i += 8) { RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); } #endif /* feedback */ for (i = 0; i < 8; i++) { md->sha512.state[i] = md->sha512.state[i] + S[i]; } return CRYPT_OK; } /* compress 1024-bits */ #ifdef LTC_CLEAN_STACK static int sha512_compress(hash_state * md, unsigned char *buf) { int err; err = _sha512_compress(md, buf); burn_stack(sizeof(ulong64) * 90 + sizeof(int)); return err; } #endif /** Initialize the hash state @param md The hash state you wish to initialize @return CRYPT_OK if successful */ int sha512_init(hash_state * md) { LTC_ARGCHK(md != NULL); md->sha512.curlen = 0; md->sha512.length = 0; md->sha512.state[0] = CONST64(0x6a09e667f3bcc908); md->sha512.state[1] = CONST64(0xbb67ae8584caa73b); md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b); md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1); md->sha512.state[4] = CONST64(0x510e527fade682d1); md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f); md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b); md->sha512.state[7] = CONST64(0x5be0cd19137e2179); return CRYPT_OK; } /** Process a block of memory though the hash @param md The hash state @param in The data to hash @param inlen The length of the data (octets) @return CRYPT_OK if successful */ HASH_PROCESS(sha512_process, sha512_compress, sha512, 128) /** Terminate the hash to get the digest @param md The hash state @param out [out] The destination of the hash (64 bytes) @return CRYPT_OK if successful */ int sha512_done(hash_state * md, unsigned char *out) { int i; LTC_ARGCHK(md != NULL); LTC_ARGCHK(out != NULL); if (md->sha512.curlen >= sizeof(md->sha512.buf)) { return CRYPT_INVALID_ARG; } /* increase the length of the message */ md->sha512.length += md->sha512.curlen * CONST64(8); /* append the '1' bit */ md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80; /* if the length is currently above 112 bytes we append zeros * then compress. Then we can fall back to padding zeros and length * encoding like normal. */ if (md->sha512.curlen > 112) { while (md->sha512.curlen < 128) { md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; } sha512_compress(md, md->sha512.buf); md->sha512.curlen = 0; } /* pad upto 120 bytes of zeroes * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash * > 2^64 bits of data... :-) */ while (md->sha512.curlen < 120) { md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; } /* store length */ STORE64H(md->sha512.length, md->sha512.buf+120); sha512_compress(md, md->sha512.buf); /* copy output */ for (i = 0; i < 8; i++) { STORE64H(md->sha512.state[i], out+(8*i)); } #ifdef LTC_CLEAN_STACK zeromem(md, sizeof(hash_state)); #endif return CRYPT_OK; } /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled */ int sha512_test(void) { #ifndef LTC_TEST return CRYPT_NOP; #else static const struct { char *msg; unsigned char hash[64]; } tests[] = { { "abc", { 0xdd, 0xaf, 0x35, 0xa1, 0x93, 0x61, 0x7a, 0xba, 0xcc, 0x41, 0x73, 0x49, 0xae, 0x20, 0x41, 0x31, 0x12, 0xe6, 0xfa, 0x4e, 0x89, 0xa9, 0x7e, 0xa2, 0x0a, 0x9e, 0xee, 0xe6, 0x4b, 0x55, 0xd3, 0x9a, 0x21, 0x92, 0x99, 0x2a, 0x27, 0x4f, 0xc1, 0xa8, 0x36, 0xba, 0x3c, 0x23, 0xa3, 0xfe, 0xeb, 0xbd, 0x45, 0x4d, 0x44, 0x23, 0x64, 0x3c, 0xe8, 0x0e, 0x2a, 0x9a, 0xc9, 0x4f, 0xa5, 0x4c, 0xa4, 0x9f } }, { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", { 0x8e, 0x95, 0x9b, 0x75, 0xda, 0xe3, 0x13, 0xda, 0x8c, 0xf4, 0xf7, 0x28, 0x14, 0xfc, 0x14, 0x3f, 0x8f, 0x77, 0x79, 0xc6, 0xeb, 0x9f, 0x7f, 0xa1, 0x72, 0x99, 0xae, 0xad, 0xb6, 0x88, 0x90, 0x18, 0x50, 0x1d, 0x28, 0x9e, 0x49, 0x00, 0xf7, 0xe4, 0x33, 0x1b, 0x99, 0xde, 0xc4, 0xb5, 0x43, 0x3a, 0xc7, 0xd3, 0x29, 0xee, 0xb6, 0xdd, 0x26, 0x54, 0x5e, 0x96, 0xe5, 0x5b, 0x87, 0x4b, 0xe9, 0x09 } }, }; int i; unsigned char tmp[64]; hash_state md; for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { sha512_init(&md); sha512_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); sha512_done(&md, tmp); if (XMEMCMP(tmp, tests[i].hash, 64) != 0) { return CRYPT_FAIL_TESTVECTOR; } } return CRYPT_OK; #endif } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file hmac_init.c HMAC support, initialize state, Tom St Denis/Dobes Vandermeer */ #ifdef LTC_HMAC #define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize /** Initialize an HMAC context. @param hmac The HMAC state @param hash The index of the hash you want to use @param key The secret key @param keylen The length of the secret key (octets) @return CRYPT_OK if successful */ int hmac_init(hmac_state *hmac, int hash, const unsigned char *key, unsigned long keylen) { unsigned char *buf; unsigned long hashsize; unsigned long i, z; int err; LTC_ARGCHK(hmac != NULL); LTC_ARGCHK(key != NULL); /* valid hash? */ if ((err = hash_is_valid(hash)) != CRYPT_OK) { return err; } hmac->hash = hash; hashsize = hash_descriptor[hash].hashsize; /* valid key length? */ if (keylen == 0) { return CRYPT_INVALID_KEYSIZE; } /* allocate ram for buf */ buf = AUTO_CAST(XMALLOC(LTC_HMAC_BLOCKSIZE)); if (buf == NULL) { return CRYPT_MEM; } /* allocate memory for key */ hmac->key = AUTO_CAST(XMALLOC(LTC_HMAC_BLOCKSIZE)); if (hmac->key == NULL) { XFREE(buf); return CRYPT_MEM; } /* (1) make sure we have a large enough key */ if(keylen > LTC_HMAC_BLOCKSIZE) { z = LTC_HMAC_BLOCKSIZE; if ((err = hash_memory(hash, key, keylen, hmac->key, &z)) != CRYPT_OK) { goto LBL_ERR; } keylen = hashsize; } else { XMEMCPY(hmac->key, key, (size_t)keylen); } if(keylen < LTC_HMAC_BLOCKSIZE) { zeromem((hmac->key) + keylen, (size_t)(LTC_HMAC_BLOCKSIZE - keylen)); } /* Create the initial vector for step (3) */ for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { buf[i] = hmac->key[i] ^ 0x36; } /* Pre-pend that to the hash data */ if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { goto LBL_ERR; } goto done; LBL_ERR: /* free the key since we failed */ XFREE(hmac->key); done: #ifdef LTC_CLEAN_STACK zeromem(buf, LTC_HMAC_BLOCKSIZE); #endif XFREE(buf); return err; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file hmac_process.c HMAC support, process data, Tom St Denis/Dobes Vandermeer */ #ifdef LTC_HMAC /** Process data through HMAC @param hmac The hmac state @param in The data to send through HMAC @param inlen The length of the data to HMAC (octets) @return CRYPT_OK if successful */ int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen) { int err; LTC_ARGCHK(hmac != NULL); LTC_ARGCHK(in != NULL); if ((err = hash_is_valid(hmac->hash)) != CRYPT_OK) { return err; } return hash_descriptor[hmac->hash].process(&hmac->md, in, inlen); } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file hmac_done.c HMAC support, terminate stream, Tom St Denis/Dobes Vandermeer */ #ifdef LTC_HMAC #define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize /** Terminate an HMAC session @param hmac The HMAC state @param out [out] The destination of the HMAC authentication tag @param outlen [in/out] The max size and resulting size of the HMAC authentication tag @return CRYPT_OK if successful */ int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen) { unsigned char *buf, *isha; unsigned long hashsize, i; int hash, err; LTC_ARGCHK(hmac != NULL); LTC_ARGCHK(out != NULL); /* test hash */ hash = hmac->hash; if((err = hash_is_valid(hash)) != CRYPT_OK) { return err; } /* get the hash message digest size */ hashsize = hash_descriptor[hash].hashsize; /* allocate buffers */ buf = AUTO_CAST(XMALLOC(LTC_HMAC_BLOCKSIZE)); isha = AUTO_CAST(XMALLOC(hashsize)); if (buf == NULL || isha == NULL) { if (buf != NULL) { XFREE(buf); } if (isha != NULL) { XFREE(isha); } return CRYPT_MEM; } /* Get the hash of the first HMAC vector plus the data */ if ((err = hash_descriptor[hash].done(&hmac->md, isha)) != CRYPT_OK) { goto LBL_ERR; } /* Create the second HMAC vector vector for step (3) */ for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { buf[i] = hmac->key[i] ^ 0x5C; } /* Now calculate the "outer" hash for step (5), (6), and (7) */ if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash].process(&hmac->md, isha, hashsize)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hash_descriptor[hash].done(&hmac->md, buf)) != CRYPT_OK) { goto LBL_ERR; } /* copy to output */ for (i = 0; i < hashsize && i < *outlen; i++) { out[i] = buf[i]; } *outlen = i; err = CRYPT_OK; LBL_ERR: XFREE(hmac->key); #ifdef LTC_CLEAN_STACK zeromem(isha, hashsize); zeromem(buf, hashsize); zeromem(hmac, sizeof(*hmac)); #endif XFREE(isha); XFREE(buf); return err; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ #define __LTC_AES_TAB_C__ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* The precomputed tables for AES */ /* Te0[x] = S [x].[02, 01, 01, 03]; Te1[x] = S [x].[03, 02, 01, 01]; Te2[x] = S [x].[01, 03, 02, 01]; Te3[x] = S [x].[01, 01, 03, 02]; Te4[x] = S [x].[01, 01, 01, 01]; Td0[x] = Si[x].[0e, 09, 0d, 0b]; Td1[x] = Si[x].[0b, 0e, 09, 0d]; Td2[x] = Si[x].[0d, 0b, 0e, 09]; Td3[x] = Si[x].[09, 0d, 0b, 0e]; Td4[x] = Si[x].[01, 01, 01, 01]; */ #ifdef __LTC_AES_TAB_C__ /** @file aes_tab.c AES tables */ static const ulong32 TE0[256] = { 0xc66363a5UL, 0xf87c7c84UL, 0xee777799UL, 0xf67b7b8dUL, 0xfff2f20dUL, 0xd66b6bbdUL, 0xde6f6fb1UL, 0x91c5c554UL, 0x60303050UL, 0x02010103UL, 0xce6767a9UL, 0x562b2b7dUL, 0xe7fefe19UL, 0xb5d7d762UL, 0x4dababe6UL, 0xec76769aUL, 0x8fcaca45UL, 0x1f82829dUL, 0x89c9c940UL, 0xfa7d7d87UL, 0xeffafa15UL, 0xb25959ebUL, 0x8e4747c9UL, 0xfbf0f00bUL, 0x41adadecUL, 0xb3d4d467UL, 0x5fa2a2fdUL, 0x45afafeaUL, 0x239c9cbfUL, 0x53a4a4f7UL, 0xe4727296UL, 0x9bc0c05bUL, 0x75b7b7c2UL, 0xe1fdfd1cUL, 0x3d9393aeUL, 0x4c26266aUL, 0x6c36365aUL, 0x7e3f3f41UL, 0xf5f7f702UL, 0x83cccc4fUL, 0x6834345cUL, 0x51a5a5f4UL, 0xd1e5e534UL, 0xf9f1f108UL, 0xe2717193UL, 0xabd8d873UL, 0x62313153UL, 0x2a15153fUL, 0x0804040cUL, 0x95c7c752UL, 0x46232365UL, 0x9dc3c35eUL, 0x30181828UL, 0x379696a1UL, 0x0a05050fUL, 0x2f9a9ab5UL, 0x0e070709UL, 0x24121236UL, 0x1b80809bUL, 0xdfe2e23dUL, 0xcdebeb26UL, 0x4e272769UL, 0x7fb2b2cdUL, 0xea75759fUL, 0x1209091bUL, 0x1d83839eUL, 0x582c2c74UL, 0x341a1a2eUL, 0x361b1b2dUL, 0xdc6e6eb2UL, 0xb45a5aeeUL, 0x5ba0a0fbUL, 0xa45252f6UL, 0x763b3b4dUL, 0xb7d6d661UL, 0x7db3b3ceUL, 0x5229297bUL, 0xdde3e33eUL, 0x5e2f2f71UL, 0x13848497UL, 0xa65353f5UL, 0xb9d1d168UL, 0x00000000UL, 0xc1eded2cUL, 0x40202060UL, 0xe3fcfc1fUL, 0x79b1b1c8UL, 0xb65b5bedUL, 0xd46a6abeUL, 0x8dcbcb46UL, 0x67bebed9UL, 0x7239394bUL, 0x944a4adeUL, 0x984c4cd4UL, 0xb05858e8UL, 0x85cfcf4aUL, 0xbbd0d06bUL, 0xc5efef2aUL, 0x4faaaae5UL, 0xedfbfb16UL, 0x864343c5UL, 0x9a4d4dd7UL, 0x66333355UL, 0x11858594UL, 0x8a4545cfUL, 0xe9f9f910UL, 0x04020206UL, 0xfe7f7f81UL, 0xa05050f0UL, 0x783c3c44UL, 0x259f9fbaUL, 0x4ba8a8e3UL, 0xa25151f3UL, 0x5da3a3feUL, 0x804040c0UL, 0x058f8f8aUL, 0x3f9292adUL, 0x219d9dbcUL, 0x70383848UL, 0xf1f5f504UL, 0x63bcbcdfUL, 0x77b6b6c1UL, 0xafdada75UL, 0x42212163UL, 0x20101030UL, 0xe5ffff1aUL, 0xfdf3f30eUL, 0xbfd2d26dUL, 0x81cdcd4cUL, 0x180c0c14UL, 0x26131335UL, 0xc3ecec2fUL, 0xbe5f5fe1UL, 0x359797a2UL, 0x884444ccUL, 0x2e171739UL, 0x93c4c457UL, 0x55a7a7f2UL, 0xfc7e7e82UL, 0x7a3d3d47UL, 0xc86464acUL, 0xba5d5de7UL, 0x3219192bUL, 0xe6737395UL, 0xc06060a0UL, 0x19818198UL, 0x9e4f4fd1UL, 0xa3dcdc7fUL, 0x44222266UL, 0x542a2a7eUL, 0x3b9090abUL, 0x0b888883UL, 0x8c4646caUL, 0xc7eeee29UL, 0x6bb8b8d3UL, 0x2814143cUL, 0xa7dede79UL, 0xbc5e5ee2UL, 0x160b0b1dUL, 0xaddbdb76UL, 0xdbe0e03bUL, 0x64323256UL, 0x743a3a4eUL, 0x140a0a1eUL, 0x924949dbUL, 0x0c06060aUL, 0x4824246cUL, 0xb85c5ce4UL, 0x9fc2c25dUL, 0xbdd3d36eUL, 0x43acacefUL, 0xc46262a6UL, 0x399191a8UL, 0x319595a4UL, 0xd3e4e437UL, 0xf279798bUL, 0xd5e7e732UL, 0x8bc8c843UL, 0x6e373759UL, 0xda6d6db7UL, 0x018d8d8cUL, 0xb1d5d564UL, 0x9c4e4ed2UL, 0x49a9a9e0UL, 0xd86c6cb4UL, 0xac5656faUL, 0xf3f4f407UL, 0xcfeaea25UL, 0xca6565afUL, 0xf47a7a8eUL, 0x47aeaee9UL, 0x10080818UL, 0x6fbabad5UL, 0xf0787888UL, 0x4a25256fUL, 0x5c2e2e72UL, 0x381c1c24UL, 0x57a6a6f1UL, 0x73b4b4c7UL, 0x97c6c651UL, 0xcbe8e823UL, 0xa1dddd7cUL, 0xe874749cUL, 0x3e1f1f21UL, 0x964b4bddUL, 0x61bdbddcUL, 0x0d8b8b86UL, 0x0f8a8a85UL, 0xe0707090UL, 0x7c3e3e42UL, 0x71b5b5c4UL, 0xcc6666aaUL, 0x904848d8UL, 0x06030305UL, 0xf7f6f601UL, 0x1c0e0e12UL, 0xc26161a3UL, 0x6a35355fUL, 0xae5757f9UL, 0x69b9b9d0UL, 0x17868691UL, 0x99c1c158UL, 0x3a1d1d27UL, 0x279e9eb9UL, 0xd9e1e138UL, 0xebf8f813UL, 0x2b9898b3UL, 0x22111133UL, 0xd26969bbUL, 0xa9d9d970UL, 0x078e8e89UL, 0x339494a7UL, 0x2d9b9bb6UL, 0x3c1e1e22UL, 0x15878792UL, 0xc9e9e920UL, 0x87cece49UL, 0xaa5555ffUL, 0x50282878UL, 0xa5dfdf7aUL, 0x038c8c8fUL, 0x59a1a1f8UL, 0x09898980UL, 0x1a0d0d17UL, 0x65bfbfdaUL, 0xd7e6e631UL, 0x844242c6UL, 0xd06868b8UL, 0x824141c3UL, 0x299999b0UL, 0x5a2d2d77UL, 0x1e0f0f11UL, 0x7bb0b0cbUL, 0xa85454fcUL, 0x6dbbbbd6UL, 0x2c16163aUL, }; #ifndef PELI_TAB static const ulong32 Te4[256] = { 0x63636363UL, 0x7c7c7c7cUL, 0x77777777UL, 0x7b7b7b7bUL, 0xf2f2f2f2UL, 0x6b6b6b6bUL, 0x6f6f6f6fUL, 0xc5c5c5c5UL, 0x30303030UL, 0x01010101UL, 0x67676767UL, 0x2b2b2b2bUL, 0xfefefefeUL, 0xd7d7d7d7UL, 0xababababUL, 0x76767676UL, 0xcacacacaUL, 0x82828282UL, 0xc9c9c9c9UL, 0x7d7d7d7dUL, 0xfafafafaUL, 0x59595959UL, 0x47474747UL, 0xf0f0f0f0UL, 0xadadadadUL, 0xd4d4d4d4UL, 0xa2a2a2a2UL, 0xafafafafUL, 0x9c9c9c9cUL, 0xa4a4a4a4UL, 0x72727272UL, 0xc0c0c0c0UL, 0xb7b7b7b7UL, 0xfdfdfdfdUL, 0x93939393UL, 0x26262626UL, 0x36363636UL, 0x3f3f3f3fUL, 0xf7f7f7f7UL, 0xccccccccUL, 0x34343434UL, 0xa5a5a5a5UL, 0xe5e5e5e5UL, 0xf1f1f1f1UL, 0x71717171UL, 0xd8d8d8d8UL, 0x31313131UL, 0x15151515UL, 0x04040404UL, 0xc7c7c7c7UL, 0x23232323UL, 0xc3c3c3c3UL, 0x18181818UL, 0x96969696UL, 0x05050505UL, 0x9a9a9a9aUL, 0x07070707UL, 0x12121212UL, 0x80808080UL, 0xe2e2e2e2UL, 0xebebebebUL, 0x27272727UL, 0xb2b2b2b2UL, 0x75757575UL, 0x09090909UL, 0x83838383UL, 0x2c2c2c2cUL, 0x1a1a1a1aUL, 0x1b1b1b1bUL, 0x6e6e6e6eUL, 0x5a5a5a5aUL, 0xa0a0a0a0UL, 0x52525252UL, 0x3b3b3b3bUL, 0xd6d6d6d6UL, 0xb3b3b3b3UL, 0x29292929UL, 0xe3e3e3e3UL, 0x2f2f2f2fUL, 0x84848484UL, 0x53535353UL, 0xd1d1d1d1UL, 0x00000000UL, 0xededededUL, 0x20202020UL, 0xfcfcfcfcUL, 0xb1b1b1b1UL, 0x5b5b5b5bUL, 0x6a6a6a6aUL, 0xcbcbcbcbUL, 0xbebebebeUL, 0x39393939UL, 0x4a4a4a4aUL, 0x4c4c4c4cUL, 0x58585858UL, 0xcfcfcfcfUL, 0xd0d0d0d0UL, 0xefefefefUL, 0xaaaaaaaaUL, 0xfbfbfbfbUL, 0x43434343UL, 0x4d4d4d4dUL, 0x33333333UL, 0x85858585UL, 0x45454545UL, 0xf9f9f9f9UL, 0x02020202UL, 0x7f7f7f7fUL, 0x50505050UL, 0x3c3c3c3cUL, 0x9f9f9f9fUL, 0xa8a8a8a8UL, 0x51515151UL, 0xa3a3a3a3UL, 0x40404040UL, 0x8f8f8f8fUL, 0x92929292UL, 0x9d9d9d9dUL, 0x38383838UL, 0xf5f5f5f5UL, 0xbcbcbcbcUL, 0xb6b6b6b6UL, 0xdadadadaUL, 0x21212121UL, 0x10101010UL, 0xffffffffUL, 0xf3f3f3f3UL, 0xd2d2d2d2UL, 0xcdcdcdcdUL, 0x0c0c0c0cUL, 0x13131313UL, 0xececececUL, 0x5f5f5f5fUL, 0x97979797UL, 0x44444444UL, 0x17171717UL, 0xc4c4c4c4UL, 0xa7a7a7a7UL, 0x7e7e7e7eUL, 0x3d3d3d3dUL, 0x64646464UL, 0x5d5d5d5dUL, 0x19191919UL, 0x73737373UL, 0x60606060UL, 0x81818181UL, 0x4f4f4f4fUL, 0xdcdcdcdcUL, 0x22222222UL, 0x2a2a2a2aUL, 0x90909090UL, 0x88888888UL, 0x46464646UL, 0xeeeeeeeeUL, 0xb8b8b8b8UL, 0x14141414UL, 0xdedededeUL, 0x5e5e5e5eUL, 0x0b0b0b0bUL, 0xdbdbdbdbUL, 0xe0e0e0e0UL, 0x32323232UL, 0x3a3a3a3aUL, 0x0a0a0a0aUL, 0x49494949UL, 0x06060606UL, 0x24242424UL, 0x5c5c5c5cUL, 0xc2c2c2c2UL, 0xd3d3d3d3UL, 0xacacacacUL, 0x62626262UL, 0x91919191UL, 0x95959595UL, 0xe4e4e4e4UL, 0x79797979UL, 0xe7e7e7e7UL, 0xc8c8c8c8UL, 0x37373737UL, 0x6d6d6d6dUL, 0x8d8d8d8dUL, 0xd5d5d5d5UL, 0x4e4e4e4eUL, 0xa9a9a9a9UL, 0x6c6c6c6cUL, 0x56565656UL, 0xf4f4f4f4UL, 0xeaeaeaeaUL, 0x65656565UL, 0x7a7a7a7aUL, 0xaeaeaeaeUL, 0x08080808UL, 0xbabababaUL, 0x78787878UL, 0x25252525UL, 0x2e2e2e2eUL, 0x1c1c1c1cUL, 0xa6a6a6a6UL, 0xb4b4b4b4UL, 0xc6c6c6c6UL, 0xe8e8e8e8UL, 0xddddddddUL, 0x74747474UL, 0x1f1f1f1fUL, 0x4b4b4b4bUL, 0xbdbdbdbdUL, 0x8b8b8b8bUL, 0x8a8a8a8aUL, 0x70707070UL, 0x3e3e3e3eUL, 0xb5b5b5b5UL, 0x66666666UL, 0x48484848UL, 0x03030303UL, 0xf6f6f6f6UL, 0x0e0e0e0eUL, 0x61616161UL, 0x35353535UL, 0x57575757UL, 0xb9b9b9b9UL, 0x86868686UL, 0xc1c1c1c1UL, 0x1d1d1d1dUL, 0x9e9e9e9eUL, 0xe1e1e1e1UL, 0xf8f8f8f8UL, 0x98989898UL, 0x11111111UL, 0x69696969UL, 0xd9d9d9d9UL, 0x8e8e8e8eUL, 0x94949494UL, 0x9b9b9b9bUL, 0x1e1e1e1eUL, 0x87878787UL, 0xe9e9e9e9UL, 0xcecececeUL, 0x55555555UL, 0x28282828UL, 0xdfdfdfdfUL, 0x8c8c8c8cUL, 0xa1a1a1a1UL, 0x89898989UL, 0x0d0d0d0dUL, 0xbfbfbfbfUL, 0xe6e6e6e6UL, 0x42424242UL, 0x68686868UL, 0x41414141UL, 0x99999999UL, 0x2d2d2d2dUL, 0x0f0f0f0fUL, 0xb0b0b0b0UL, 0x54545454UL, 0xbbbbbbbbUL, 0x16161616UL, }; #endif #ifndef ENCRYPT_ONLY static const ulong32 TD0[256] = { 0x51f4a750UL, 0x7e416553UL, 0x1a17a4c3UL, 0x3a275e96UL, 0x3bab6bcbUL, 0x1f9d45f1UL, 0xacfa58abUL, 0x4be30393UL, 0x2030fa55UL, 0xad766df6UL, 0x88cc7691UL, 0xf5024c25UL, 0x4fe5d7fcUL, 0xc52acbd7UL, 0x26354480UL, 0xb562a38fUL, 0xdeb15a49UL, 0x25ba1b67UL, 0x45ea0e98UL, 0x5dfec0e1UL, 0xc32f7502UL, 0x814cf012UL, 0x8d4697a3UL, 0x6bd3f9c6UL, 0x038f5fe7UL, 0x15929c95UL, 0xbf6d7aebUL, 0x955259daUL, 0xd4be832dUL, 0x587421d3UL, 0x49e06929UL, 0x8ec9c844UL, 0x75c2896aUL, 0xf48e7978UL, 0x99583e6bUL, 0x27b971ddUL, 0xbee14fb6UL, 0xf088ad17UL, 0xc920ac66UL, 0x7dce3ab4UL, 0x63df4a18UL, 0xe51a3182UL, 0x97513360UL, 0x62537f45UL, 0xb16477e0UL, 0xbb6bae84UL, 0xfe81a01cUL, 0xf9082b94UL, 0x70486858UL, 0x8f45fd19UL, 0x94de6c87UL, 0x527bf8b7UL, 0xab73d323UL, 0x724b02e2UL, 0xe31f8f57UL, 0x6655ab2aUL, 0xb2eb2807UL, 0x2fb5c203UL, 0x86c57b9aUL, 0xd33708a5UL, 0x302887f2UL, 0x23bfa5b2UL, 0x02036abaUL, 0xed16825cUL, 0x8acf1c2bUL, 0xa779b492UL, 0xf307f2f0UL, 0x4e69e2a1UL, 0x65daf4cdUL, 0x0605bed5UL, 0xd134621fUL, 0xc4a6fe8aUL, 0x342e539dUL, 0xa2f355a0UL, 0x058ae132UL, 0xa4f6eb75UL, 0x0b83ec39UL, 0x4060efaaUL, 0x5e719f06UL, 0xbd6e1051UL, 0x3e218af9UL, 0x96dd063dUL, 0xdd3e05aeUL, 0x4de6bd46UL, 0x91548db5UL, 0x71c45d05UL, 0x0406d46fUL, 0x605015ffUL, 0x1998fb24UL, 0xd6bde997UL, 0x894043ccUL, 0x67d99e77UL, 0xb0e842bdUL, 0x07898b88UL, 0xe7195b38UL, 0x79c8eedbUL, 0xa17c0a47UL, 0x7c420fe9UL, 0xf8841ec9UL, 0x00000000UL, 0x09808683UL, 0x322bed48UL, 0x1e1170acUL, 0x6c5a724eUL, 0xfd0efffbUL, 0x0f853856UL, 0x3daed51eUL, 0x362d3927UL, 0x0a0fd964UL, 0x685ca621UL, 0x9b5b54d1UL, 0x24362e3aUL, 0x0c0a67b1UL, 0x9357e70fUL, 0xb4ee96d2UL, 0x1b9b919eUL, 0x80c0c54fUL, 0x61dc20a2UL, 0x5a774b69UL, 0x1c121a16UL, 0xe293ba0aUL, 0xc0a02ae5UL, 0x3c22e043UL, 0x121b171dUL, 0x0e090d0bUL, 0xf28bc7adUL, 0x2db6a8b9UL, 0x141ea9c8UL, 0x57f11985UL, 0xaf75074cUL, 0xee99ddbbUL, 0xa37f60fdUL, 0xf701269fUL, 0x5c72f5bcUL, 0x44663bc5UL, 0x5bfb7e34UL, 0x8b432976UL, 0xcb23c6dcUL, 0xb6edfc68UL, 0xb8e4f163UL, 0xd731dccaUL, 0x42638510UL, 0x13972240UL, 0x84c61120UL, 0x854a247dUL, 0xd2bb3df8UL, 0xaef93211UL, 0xc729a16dUL, 0x1d9e2f4bUL, 0xdcb230f3UL, 0x0d8652ecUL, 0x77c1e3d0UL, 0x2bb3166cUL, 0xa970b999UL, 0x119448faUL, 0x47e96422UL, 0xa8fc8cc4UL, 0xa0f03f1aUL, 0x567d2cd8UL, 0x223390efUL, 0x87494ec7UL, 0xd938d1c1UL, 0x8ccaa2feUL, 0x98d40b36UL, 0xa6f581cfUL, 0xa57ade28UL, 0xdab78e26UL, 0x3fadbfa4UL, 0x2c3a9de4UL, 0x5078920dUL, 0x6a5fcc9bUL, 0x547e4662UL, 0xf68d13c2UL, 0x90d8b8e8UL, 0x2e39f75eUL, 0x82c3aff5UL, 0x9f5d80beUL, 0x69d0937cUL, 0x6fd52da9UL, 0xcf2512b3UL, 0xc8ac993bUL, 0x10187da7UL, 0xe89c636eUL, 0xdb3bbb7bUL, 0xcd267809UL, 0x6e5918f4UL, 0xec9ab701UL, 0x834f9aa8UL, 0xe6956e65UL, 0xaaffe67eUL, 0x21bccf08UL, 0xef15e8e6UL, 0xbae79bd9UL, 0x4a6f36ceUL, 0xea9f09d4UL, 0x29b07cd6UL, 0x31a4b2afUL, 0x2a3f2331UL, 0xc6a59430UL, 0x35a266c0UL, 0x744ebc37UL, 0xfc82caa6UL, 0xe090d0b0UL, 0x33a7d815UL, 0xf104984aUL, 0x41ecdaf7UL, 0x7fcd500eUL, 0x1791f62fUL, 0x764dd68dUL, 0x43efb04dUL, 0xccaa4d54UL, 0xe49604dfUL, 0x9ed1b5e3UL, 0x4c6a881bUL, 0xc12c1fb8UL, 0x4665517fUL, 0x9d5eea04UL, 0x018c355dUL, 0xfa877473UL, 0xfb0b412eUL, 0xb3671d5aUL, 0x92dbd252UL, 0xe9105633UL, 0x6dd64713UL, 0x9ad7618cUL, 0x37a10c7aUL, 0x59f8148eUL, 0xeb133c89UL, 0xcea927eeUL, 0xb761c935UL, 0xe11ce5edUL, 0x7a47b13cUL, 0x9cd2df59UL, 0x55f2733fUL, 0x1814ce79UL, 0x73c737bfUL, 0x53f7cdeaUL, 0x5ffdaa5bUL, 0xdf3d6f14UL, 0x7844db86UL, 0xcaaff381UL, 0xb968c43eUL, 0x3824342cUL, 0xc2a3405fUL, 0x161dc372UL, 0xbce2250cUL, 0x283c498bUL, 0xff0d9541UL, 0x39a80171UL, 0x080cb3deUL, 0xd8b4e49cUL, 0x6456c190UL, 0x7bcb8461UL, 0xd532b670UL, 0x486c5c74UL, 0xd0b85742UL, }; static const ulong32 Td4[256] = { 0x52525252UL, 0x09090909UL, 0x6a6a6a6aUL, 0xd5d5d5d5UL, 0x30303030UL, 0x36363636UL, 0xa5a5a5a5UL, 0x38383838UL, 0xbfbfbfbfUL, 0x40404040UL, 0xa3a3a3a3UL, 0x9e9e9e9eUL, 0x81818181UL, 0xf3f3f3f3UL, 0xd7d7d7d7UL, 0xfbfbfbfbUL, 0x7c7c7c7cUL, 0xe3e3e3e3UL, 0x39393939UL, 0x82828282UL, 0x9b9b9b9bUL, 0x2f2f2f2fUL, 0xffffffffUL, 0x87878787UL, 0x34343434UL, 0x8e8e8e8eUL, 0x43434343UL, 0x44444444UL, 0xc4c4c4c4UL, 0xdedededeUL, 0xe9e9e9e9UL, 0xcbcbcbcbUL, 0x54545454UL, 0x7b7b7b7bUL, 0x94949494UL, 0x32323232UL, 0xa6a6a6a6UL, 0xc2c2c2c2UL, 0x23232323UL, 0x3d3d3d3dUL, 0xeeeeeeeeUL, 0x4c4c4c4cUL, 0x95959595UL, 0x0b0b0b0bUL, 0x42424242UL, 0xfafafafaUL, 0xc3c3c3c3UL, 0x4e4e4e4eUL, 0x08080808UL, 0x2e2e2e2eUL, 0xa1a1a1a1UL, 0x66666666UL, 0x28282828UL, 0xd9d9d9d9UL, 0x24242424UL, 0xb2b2b2b2UL, 0x76767676UL, 0x5b5b5b5bUL, 0xa2a2a2a2UL, 0x49494949UL, 0x6d6d6d6dUL, 0x8b8b8b8bUL, 0xd1d1d1d1UL, 0x25252525UL, 0x72727272UL, 0xf8f8f8f8UL, 0xf6f6f6f6UL, 0x64646464UL, 0x86868686UL, 0x68686868UL, 0x98989898UL, 0x16161616UL, 0xd4d4d4d4UL, 0xa4a4a4a4UL, 0x5c5c5c5cUL, 0xccccccccUL, 0x5d5d5d5dUL, 0x65656565UL, 0xb6b6b6b6UL, 0x92929292UL, 0x6c6c6c6cUL, 0x70707070UL, 0x48484848UL, 0x50505050UL, 0xfdfdfdfdUL, 0xededededUL, 0xb9b9b9b9UL, 0xdadadadaUL, 0x5e5e5e5eUL, 0x15151515UL, 0x46464646UL, 0x57575757UL, 0xa7a7a7a7UL, 0x8d8d8d8dUL, 0x9d9d9d9dUL, 0x84848484UL, 0x90909090UL, 0xd8d8d8d8UL, 0xababababUL, 0x00000000UL, 0x8c8c8c8cUL, 0xbcbcbcbcUL, 0xd3d3d3d3UL, 0x0a0a0a0aUL, 0xf7f7f7f7UL, 0xe4e4e4e4UL, 0x58585858UL, 0x05050505UL, 0xb8b8b8b8UL, 0xb3b3b3b3UL, 0x45454545UL, 0x06060606UL, 0xd0d0d0d0UL, 0x2c2c2c2cUL, 0x1e1e1e1eUL, 0x8f8f8f8fUL, 0xcacacacaUL, 0x3f3f3f3fUL, 0x0f0f0f0fUL, 0x02020202UL, 0xc1c1c1c1UL, 0xafafafafUL, 0xbdbdbdbdUL, 0x03030303UL, 0x01010101UL, 0x13131313UL, 0x8a8a8a8aUL, 0x6b6b6b6bUL, 0x3a3a3a3aUL, 0x91919191UL, 0x11111111UL, 0x41414141UL, 0x4f4f4f4fUL, 0x67676767UL, 0xdcdcdcdcUL, 0xeaeaeaeaUL, 0x97979797UL, 0xf2f2f2f2UL, 0xcfcfcfcfUL, 0xcecececeUL, 0xf0f0f0f0UL, 0xb4b4b4b4UL, 0xe6e6e6e6UL, 0x73737373UL, 0x96969696UL, 0xacacacacUL, 0x74747474UL, 0x22222222UL, 0xe7e7e7e7UL, 0xadadadadUL, 0x35353535UL, 0x85858585UL, 0xe2e2e2e2UL, 0xf9f9f9f9UL, 0x37373737UL, 0xe8e8e8e8UL, 0x1c1c1c1cUL, 0x75757575UL, 0xdfdfdfdfUL, 0x6e6e6e6eUL, 0x47474747UL, 0xf1f1f1f1UL, 0x1a1a1a1aUL, 0x71717171UL, 0x1d1d1d1dUL, 0x29292929UL, 0xc5c5c5c5UL, 0x89898989UL, 0x6f6f6f6fUL, 0xb7b7b7b7UL, 0x62626262UL, 0x0e0e0e0eUL, 0xaaaaaaaaUL, 0x18181818UL, 0xbebebebeUL, 0x1b1b1b1bUL, 0xfcfcfcfcUL, 0x56565656UL, 0x3e3e3e3eUL, 0x4b4b4b4bUL, 0xc6c6c6c6UL, 0xd2d2d2d2UL, 0x79797979UL, 0x20202020UL, 0x9a9a9a9aUL, 0xdbdbdbdbUL, 0xc0c0c0c0UL, 0xfefefefeUL, 0x78787878UL, 0xcdcdcdcdUL, 0x5a5a5a5aUL, 0xf4f4f4f4UL, 0x1f1f1f1fUL, 0xddddddddUL, 0xa8a8a8a8UL, 0x33333333UL, 0x88888888UL, 0x07070707UL, 0xc7c7c7c7UL, 0x31313131UL, 0xb1b1b1b1UL, 0x12121212UL, 0x10101010UL, 0x59595959UL, 0x27272727UL, 0x80808080UL, 0xececececUL, 0x5f5f5f5fUL, 0x60606060UL, 0x51515151UL, 0x7f7f7f7fUL, 0xa9a9a9a9UL, 0x19191919UL, 0xb5b5b5b5UL, 0x4a4a4a4aUL, 0x0d0d0d0dUL, 0x2d2d2d2dUL, 0xe5e5e5e5UL, 0x7a7a7a7aUL, 0x9f9f9f9fUL, 0x93939393UL, 0xc9c9c9c9UL, 0x9c9c9c9cUL, 0xefefefefUL, 0xa0a0a0a0UL, 0xe0e0e0e0UL, 0x3b3b3b3bUL, 0x4d4d4d4dUL, 0xaeaeaeaeUL, 0x2a2a2a2aUL, 0xf5f5f5f5UL, 0xb0b0b0b0UL, 0xc8c8c8c8UL, 0xebebebebUL, 0xbbbbbbbbUL, 0x3c3c3c3cUL, 0x83838383UL, 0x53535353UL, 0x99999999UL, 0x61616161UL, 0x17171717UL, 0x2b2b2b2bUL, 0x04040404UL, 0x7e7e7e7eUL, 0xbabababaUL, 0x77777777UL, 0xd6d6d6d6UL, 0x26262626UL, 0xe1e1e1e1UL, 0x69696969UL, 0x14141414UL, 0x63636363UL, 0x55555555UL, 0x21212121UL, 0x0c0c0c0cUL, 0x7d7d7d7dUL, }; #endif /* ENCRYPT_ONLY */ #ifdef LTC_SMALL_CODE #define Te0(x) TE0[x] #define Te1(x) RORc(TE0[x], 8) #define Te2(x) RORc(TE0[x], 16) #define Te3(x) RORc(TE0[x], 24) #define Td0(x) TD0[x] #define Td1(x) RORc(TD0[x], 8) #define Td2(x) RORc(TD0[x], 16) #define Td3(x) RORc(TD0[x], 24) #define Te4_0 0x000000FF & Te4 #define Te4_1 0x0000FF00 & Te4 #define Te4_2 0x00FF0000 & Te4 #define Te4_3 0xFF000000 & Te4 #else #define Te0(x) TE0[x] #define Te1(x) TE1[x] #define Te2(x) TE2[x] #define Te3(x) TE3[x] #define Td0(x) TD0[x] #define Td1(x) TD1[x] #define Td2(x) TD2[x] #define Td3(x) TD3[x] static const ulong32 TE1[256] = { 0xa5c66363UL, 0x84f87c7cUL, 0x99ee7777UL, 0x8df67b7bUL, 0x0dfff2f2UL, 0xbdd66b6bUL, 0xb1de6f6fUL, 0x5491c5c5UL, 0x50603030UL, 0x03020101UL, 0xa9ce6767UL, 0x7d562b2bUL, 0x19e7fefeUL, 0x62b5d7d7UL, 0xe64dababUL, 0x9aec7676UL, 0x458fcacaUL, 0x9d1f8282UL, 0x4089c9c9UL, 0x87fa7d7dUL, 0x15effafaUL, 0xebb25959UL, 0xc98e4747UL, 0x0bfbf0f0UL, 0xec41adadUL, 0x67b3d4d4UL, 0xfd5fa2a2UL, 0xea45afafUL, 0xbf239c9cUL, 0xf753a4a4UL, 0x96e47272UL, 0x5b9bc0c0UL, 0xc275b7b7UL, 0x1ce1fdfdUL, 0xae3d9393UL, 0x6a4c2626UL, 0x5a6c3636UL, 0x417e3f3fUL, 0x02f5f7f7UL, 0x4f83ccccUL, 0x5c683434UL, 0xf451a5a5UL, 0x34d1e5e5UL, 0x08f9f1f1UL, 0x93e27171UL, 0x73abd8d8UL, 0x53623131UL, 0x3f2a1515UL, 0x0c080404UL, 0x5295c7c7UL, 0x65462323UL, 0x5e9dc3c3UL, 0x28301818UL, 0xa1379696UL, 0x0f0a0505UL, 0xb52f9a9aUL, 0x090e0707UL, 0x36241212UL, 0x9b1b8080UL, 0x3ddfe2e2UL, 0x26cdebebUL, 0x694e2727UL, 0xcd7fb2b2UL, 0x9fea7575UL, 0x1b120909UL, 0x9e1d8383UL, 0x74582c2cUL, 0x2e341a1aUL, 0x2d361b1bUL, 0xb2dc6e6eUL, 0xeeb45a5aUL, 0xfb5ba0a0UL, 0xf6a45252UL, 0x4d763b3bUL, 0x61b7d6d6UL, 0xce7db3b3UL, 0x7b522929UL, 0x3edde3e3UL, 0x715e2f2fUL, 0x97138484UL, 0xf5a65353UL, 0x68b9d1d1UL, 0x00000000UL, 0x2cc1ededUL, 0x60402020UL, 0x1fe3fcfcUL, 0xc879b1b1UL, 0xedb65b5bUL, 0xbed46a6aUL, 0x468dcbcbUL, 0xd967bebeUL, 0x4b723939UL, 0xde944a4aUL, 0xd4984c4cUL, 0xe8b05858UL, 0x4a85cfcfUL, 0x6bbbd0d0UL, 0x2ac5efefUL, 0xe54faaaaUL, 0x16edfbfbUL, 0xc5864343UL, 0xd79a4d4dUL, 0x55663333UL, 0x94118585UL, 0xcf8a4545UL, 0x10e9f9f9UL, 0x06040202UL, 0x81fe7f7fUL, 0xf0a05050UL, 0x44783c3cUL, 0xba259f9fUL, 0xe34ba8a8UL, 0xf3a25151UL, 0xfe5da3a3UL, 0xc0804040UL, 0x8a058f8fUL, 0xad3f9292UL, 0xbc219d9dUL, 0x48703838UL, 0x04f1f5f5UL, 0xdf63bcbcUL, 0xc177b6b6UL, 0x75afdadaUL, 0x63422121UL, 0x30201010UL, 0x1ae5ffffUL, 0x0efdf3f3UL, 0x6dbfd2d2UL, 0x4c81cdcdUL, 0x14180c0cUL, 0x35261313UL, 0x2fc3ececUL, 0xe1be5f5fUL, 0xa2359797UL, 0xcc884444UL, 0x392e1717UL, 0x5793c4c4UL, 0xf255a7a7UL, 0x82fc7e7eUL, 0x477a3d3dUL, 0xacc86464UL, 0xe7ba5d5dUL, 0x2b321919UL, 0x95e67373UL, 0xa0c06060UL, 0x98198181UL, 0xd19e4f4fUL, 0x7fa3dcdcUL, 0x66442222UL, 0x7e542a2aUL, 0xab3b9090UL, 0x830b8888UL, 0xca8c4646UL, 0x29c7eeeeUL, 0xd36bb8b8UL, 0x3c281414UL, 0x79a7dedeUL, 0xe2bc5e5eUL, 0x1d160b0bUL, 0x76addbdbUL, 0x3bdbe0e0UL, 0x56643232UL, 0x4e743a3aUL, 0x1e140a0aUL, 0xdb924949UL, 0x0a0c0606UL, 0x6c482424UL, 0xe4b85c5cUL, 0x5d9fc2c2UL, 0x6ebdd3d3UL, 0xef43acacUL, 0xa6c46262UL, 0xa8399191UL, 0xa4319595UL, 0x37d3e4e4UL, 0x8bf27979UL, 0x32d5e7e7UL, 0x438bc8c8UL, 0x596e3737UL, 0xb7da6d6dUL, 0x8c018d8dUL, 0x64b1d5d5UL, 0xd29c4e4eUL, 0xe049a9a9UL, 0xb4d86c6cUL, 0xfaac5656UL, 0x07f3f4f4UL, 0x25cfeaeaUL, 0xafca6565UL, 0x8ef47a7aUL, 0xe947aeaeUL, 0x18100808UL, 0xd56fbabaUL, 0x88f07878UL, 0x6f4a2525UL, 0x725c2e2eUL, 0x24381c1cUL, 0xf157a6a6UL, 0xc773b4b4UL, 0x5197c6c6UL, 0x23cbe8e8UL, 0x7ca1ddddUL, 0x9ce87474UL, 0x213e1f1fUL, 0xdd964b4bUL, 0xdc61bdbdUL, 0x860d8b8bUL, 0x850f8a8aUL, 0x90e07070UL, 0x427c3e3eUL, 0xc471b5b5UL, 0xaacc6666UL, 0xd8904848UL, 0x05060303UL, 0x01f7f6f6UL, 0x121c0e0eUL, 0xa3c26161UL, 0x5f6a3535UL, 0xf9ae5757UL, 0xd069b9b9UL, 0x91178686UL, 0x5899c1c1UL, 0x273a1d1dUL, 0xb9279e9eUL, 0x38d9e1e1UL, 0x13ebf8f8UL, 0xb32b9898UL, 0x33221111UL, 0xbbd26969UL, 0x70a9d9d9UL, 0x89078e8eUL, 0xa7339494UL, 0xb62d9b9bUL, 0x223c1e1eUL, 0x92158787UL, 0x20c9e9e9UL, 0x4987ceceUL, 0xffaa5555UL, 0x78502828UL, 0x7aa5dfdfUL, 0x8f038c8cUL, 0xf859a1a1UL, 0x80098989UL, 0x171a0d0dUL, 0xda65bfbfUL, 0x31d7e6e6UL, 0xc6844242UL, 0xb8d06868UL, 0xc3824141UL, 0xb0299999UL, 0x775a2d2dUL, 0x111e0f0fUL, 0xcb7bb0b0UL, 0xfca85454UL, 0xd66dbbbbUL, 0x3a2c1616UL, }; static const ulong32 TE2[256] = { 0x63a5c663UL, 0x7c84f87cUL, 0x7799ee77UL, 0x7b8df67bUL, 0xf20dfff2UL, 0x6bbdd66bUL, 0x6fb1de6fUL, 0xc55491c5UL, 0x30506030UL, 0x01030201UL, 0x67a9ce67UL, 0x2b7d562bUL, 0xfe19e7feUL, 0xd762b5d7UL, 0xabe64dabUL, 0x769aec76UL, 0xca458fcaUL, 0x829d1f82UL, 0xc94089c9UL, 0x7d87fa7dUL, 0xfa15effaUL, 0x59ebb259UL, 0x47c98e47UL, 0xf00bfbf0UL, 0xadec41adUL, 0xd467b3d4UL, 0xa2fd5fa2UL, 0xafea45afUL, 0x9cbf239cUL, 0xa4f753a4UL, 0x7296e472UL, 0xc05b9bc0UL, 0xb7c275b7UL, 0xfd1ce1fdUL, 0x93ae3d93UL, 0x266a4c26UL, 0x365a6c36UL, 0x3f417e3fUL, 0xf702f5f7UL, 0xcc4f83ccUL, 0x345c6834UL, 0xa5f451a5UL, 0xe534d1e5UL, 0xf108f9f1UL, 0x7193e271UL, 0xd873abd8UL, 0x31536231UL, 0x153f2a15UL, 0x040c0804UL, 0xc75295c7UL, 0x23654623UL, 0xc35e9dc3UL, 0x18283018UL, 0x96a13796UL, 0x050f0a05UL, 0x9ab52f9aUL, 0x07090e07UL, 0x12362412UL, 0x809b1b80UL, 0xe23ddfe2UL, 0xeb26cdebUL, 0x27694e27UL, 0xb2cd7fb2UL, 0x759fea75UL, 0x091b1209UL, 0x839e1d83UL, 0x2c74582cUL, 0x1a2e341aUL, 0x1b2d361bUL, 0x6eb2dc6eUL, 0x5aeeb45aUL, 0xa0fb5ba0UL, 0x52f6a452UL, 0x3b4d763bUL, 0xd661b7d6UL, 0xb3ce7db3UL, 0x297b5229UL, 0xe33edde3UL, 0x2f715e2fUL, 0x84971384UL, 0x53f5a653UL, 0xd168b9d1UL, 0x00000000UL, 0xed2cc1edUL, 0x20604020UL, 0xfc1fe3fcUL, 0xb1c879b1UL, 0x5bedb65bUL, 0x6abed46aUL, 0xcb468dcbUL, 0xbed967beUL, 0x394b7239UL, 0x4ade944aUL, 0x4cd4984cUL, 0x58e8b058UL, 0xcf4a85cfUL, 0xd06bbbd0UL, 0xef2ac5efUL, 0xaae54faaUL, 0xfb16edfbUL, 0x43c58643UL, 0x4dd79a4dUL, 0x33556633UL, 0x85941185UL, 0x45cf8a45UL, 0xf910e9f9UL, 0x02060402UL, 0x7f81fe7fUL, 0x50f0a050UL, 0x3c44783cUL, 0x9fba259fUL, 0xa8e34ba8UL, 0x51f3a251UL, 0xa3fe5da3UL, 0x40c08040UL, 0x8f8a058fUL, 0x92ad3f92UL, 0x9dbc219dUL, 0x38487038UL, 0xf504f1f5UL, 0xbcdf63bcUL, 0xb6c177b6UL, 0xda75afdaUL, 0x21634221UL, 0x10302010UL, 0xff1ae5ffUL, 0xf30efdf3UL, 0xd26dbfd2UL, 0xcd4c81cdUL, 0x0c14180cUL, 0x13352613UL, 0xec2fc3ecUL, 0x5fe1be5fUL, 0x97a23597UL, 0x44cc8844UL, 0x17392e17UL, 0xc45793c4UL, 0xa7f255a7UL, 0x7e82fc7eUL, 0x3d477a3dUL, 0x64acc864UL, 0x5de7ba5dUL, 0x192b3219UL, 0x7395e673UL, 0x60a0c060UL, 0x81981981UL, 0x4fd19e4fUL, 0xdc7fa3dcUL, 0x22664422UL, 0x2a7e542aUL, 0x90ab3b90UL, 0x88830b88UL, 0x46ca8c46UL, 0xee29c7eeUL, 0xb8d36bb8UL, 0x143c2814UL, 0xde79a7deUL, 0x5ee2bc5eUL, 0x0b1d160bUL, 0xdb76addbUL, 0xe03bdbe0UL, 0x32566432UL, 0x3a4e743aUL, 0x0a1e140aUL, 0x49db9249UL, 0x060a0c06UL, 0x246c4824UL, 0x5ce4b85cUL, 0xc25d9fc2UL, 0xd36ebdd3UL, 0xacef43acUL, 0x62a6c462UL, 0x91a83991UL, 0x95a43195UL, 0xe437d3e4UL, 0x798bf279UL, 0xe732d5e7UL, 0xc8438bc8UL, 0x37596e37UL, 0x6db7da6dUL, 0x8d8c018dUL, 0xd564b1d5UL, 0x4ed29c4eUL, 0xa9e049a9UL, 0x6cb4d86cUL, 0x56faac56UL, 0xf407f3f4UL, 0xea25cfeaUL, 0x65afca65UL, 0x7a8ef47aUL, 0xaee947aeUL, 0x08181008UL, 0xbad56fbaUL, 0x7888f078UL, 0x256f4a25UL, 0x2e725c2eUL, 0x1c24381cUL, 0xa6f157a6UL, 0xb4c773b4UL, 0xc65197c6UL, 0xe823cbe8UL, 0xdd7ca1ddUL, 0x749ce874UL, 0x1f213e1fUL, 0x4bdd964bUL, 0xbddc61bdUL, 0x8b860d8bUL, 0x8a850f8aUL, 0x7090e070UL, 0x3e427c3eUL, 0xb5c471b5UL, 0x66aacc66UL, 0x48d89048UL, 0x03050603UL, 0xf601f7f6UL, 0x0e121c0eUL, 0x61a3c261UL, 0x355f6a35UL, 0x57f9ae57UL, 0xb9d069b9UL, 0x86911786UL, 0xc15899c1UL, 0x1d273a1dUL, 0x9eb9279eUL, 0xe138d9e1UL, 0xf813ebf8UL, 0x98b32b98UL, 0x11332211UL, 0x69bbd269UL, 0xd970a9d9UL, 0x8e89078eUL, 0x94a73394UL, 0x9bb62d9bUL, 0x1e223c1eUL, 0x87921587UL, 0xe920c9e9UL, 0xce4987ceUL, 0x55ffaa55UL, 0x28785028UL, 0xdf7aa5dfUL, 0x8c8f038cUL, 0xa1f859a1UL, 0x89800989UL, 0x0d171a0dUL, 0xbfda65bfUL, 0xe631d7e6UL, 0x42c68442UL, 0x68b8d068UL, 0x41c38241UL, 0x99b02999UL, 0x2d775a2dUL, 0x0f111e0fUL, 0xb0cb7bb0UL, 0x54fca854UL, 0xbbd66dbbUL, 0x163a2c16UL, }; static const ulong32 TE3[256] = { 0x6363a5c6UL, 0x7c7c84f8UL, 0x777799eeUL, 0x7b7b8df6UL, 0xf2f20dffUL, 0x6b6bbdd6UL, 0x6f6fb1deUL, 0xc5c55491UL, 0x30305060UL, 0x01010302UL, 0x6767a9ceUL, 0x2b2b7d56UL, 0xfefe19e7UL, 0xd7d762b5UL, 0xababe64dUL, 0x76769aecUL, 0xcaca458fUL, 0x82829d1fUL, 0xc9c94089UL, 0x7d7d87faUL, 0xfafa15efUL, 0x5959ebb2UL, 0x4747c98eUL, 0xf0f00bfbUL, 0xadadec41UL, 0xd4d467b3UL, 0xa2a2fd5fUL, 0xafafea45UL, 0x9c9cbf23UL, 0xa4a4f753UL, 0x727296e4UL, 0xc0c05b9bUL, 0xb7b7c275UL, 0xfdfd1ce1UL, 0x9393ae3dUL, 0x26266a4cUL, 0x36365a6cUL, 0x3f3f417eUL, 0xf7f702f5UL, 0xcccc4f83UL, 0x34345c68UL, 0xa5a5f451UL, 0xe5e534d1UL, 0xf1f108f9UL, 0x717193e2UL, 0xd8d873abUL, 0x31315362UL, 0x15153f2aUL, 0x04040c08UL, 0xc7c75295UL, 0x23236546UL, 0xc3c35e9dUL, 0x18182830UL, 0x9696a137UL, 0x05050f0aUL, 0x9a9ab52fUL, 0x0707090eUL, 0x12123624UL, 0x80809b1bUL, 0xe2e23ddfUL, 0xebeb26cdUL, 0x2727694eUL, 0xb2b2cd7fUL, 0x75759feaUL, 0x09091b12UL, 0x83839e1dUL, 0x2c2c7458UL, 0x1a1a2e34UL, 0x1b1b2d36UL, 0x6e6eb2dcUL, 0x5a5aeeb4UL, 0xa0a0fb5bUL, 0x5252f6a4UL, 0x3b3b4d76UL, 0xd6d661b7UL, 0xb3b3ce7dUL, 0x29297b52UL, 0xe3e33eddUL, 0x2f2f715eUL, 0x84849713UL, 0x5353f5a6UL, 0xd1d168b9UL, 0x00000000UL, 0xeded2cc1UL, 0x20206040UL, 0xfcfc1fe3UL, 0xb1b1c879UL, 0x5b5bedb6UL, 0x6a6abed4UL, 0xcbcb468dUL, 0xbebed967UL, 0x39394b72UL, 0x4a4ade94UL, 0x4c4cd498UL, 0x5858e8b0UL, 0xcfcf4a85UL, 0xd0d06bbbUL, 0xefef2ac5UL, 0xaaaae54fUL, 0xfbfb16edUL, 0x4343c586UL, 0x4d4dd79aUL, 0x33335566UL, 0x85859411UL, 0x4545cf8aUL, 0xf9f910e9UL, 0x02020604UL, 0x7f7f81feUL, 0x5050f0a0UL, 0x3c3c4478UL, 0x9f9fba25UL, 0xa8a8e34bUL, 0x5151f3a2UL, 0xa3a3fe5dUL, 0x4040c080UL, 0x8f8f8a05UL, 0x9292ad3fUL, 0x9d9dbc21UL, 0x38384870UL, 0xf5f504f1UL, 0xbcbcdf63UL, 0xb6b6c177UL, 0xdada75afUL, 0x21216342UL, 0x10103020UL, 0xffff1ae5UL, 0xf3f30efdUL, 0xd2d26dbfUL, 0xcdcd4c81UL, 0x0c0c1418UL, 0x13133526UL, 0xecec2fc3UL, 0x5f5fe1beUL, 0x9797a235UL, 0x4444cc88UL, 0x1717392eUL, 0xc4c45793UL, 0xa7a7f255UL, 0x7e7e82fcUL, 0x3d3d477aUL, 0x6464acc8UL, 0x5d5de7baUL, 0x19192b32UL, 0x737395e6UL, 0x6060a0c0UL, 0x81819819UL, 0x4f4fd19eUL, 0xdcdc7fa3UL, 0x22226644UL, 0x2a2a7e54UL, 0x9090ab3bUL, 0x8888830bUL, 0x4646ca8cUL, 0xeeee29c7UL, 0xb8b8d36bUL, 0x14143c28UL, 0xdede79a7UL, 0x5e5ee2bcUL, 0x0b0b1d16UL, 0xdbdb76adUL, 0xe0e03bdbUL, 0x32325664UL, 0x3a3a4e74UL, 0x0a0a1e14UL, 0x4949db92UL, 0x06060a0cUL, 0x24246c48UL, 0x5c5ce4b8UL, 0xc2c25d9fUL, 0xd3d36ebdUL, 0xacacef43UL, 0x6262a6c4UL, 0x9191a839UL, 0x9595a431UL, 0xe4e437d3UL, 0x79798bf2UL, 0xe7e732d5UL, 0xc8c8438bUL, 0x3737596eUL, 0x6d6db7daUL, 0x8d8d8c01UL, 0xd5d564b1UL, 0x4e4ed29cUL, 0xa9a9e049UL, 0x6c6cb4d8UL, 0x5656faacUL, 0xf4f407f3UL, 0xeaea25cfUL, 0x6565afcaUL, 0x7a7a8ef4UL, 0xaeaee947UL, 0x08081810UL, 0xbabad56fUL, 0x787888f0UL, 0x25256f4aUL, 0x2e2e725cUL, 0x1c1c2438UL, 0xa6a6f157UL, 0xb4b4c773UL, 0xc6c65197UL, 0xe8e823cbUL, 0xdddd7ca1UL, 0x74749ce8UL, 0x1f1f213eUL, 0x4b4bdd96UL, 0xbdbddc61UL, 0x8b8b860dUL, 0x8a8a850fUL, 0x707090e0UL, 0x3e3e427cUL, 0xb5b5c471UL, 0x6666aaccUL, 0x4848d890UL, 0x03030506UL, 0xf6f601f7UL, 0x0e0e121cUL, 0x6161a3c2UL, 0x35355f6aUL, 0x5757f9aeUL, 0xb9b9d069UL, 0x86869117UL, 0xc1c15899UL, 0x1d1d273aUL, 0x9e9eb927UL, 0xe1e138d9UL, 0xf8f813ebUL, 0x9898b32bUL, 0x11113322UL, 0x6969bbd2UL, 0xd9d970a9UL, 0x8e8e8907UL, 0x9494a733UL, 0x9b9bb62dUL, 0x1e1e223cUL, 0x87879215UL, 0xe9e920c9UL, 0xcece4987UL, 0x5555ffaaUL, 0x28287850UL, 0xdfdf7aa5UL, 0x8c8c8f03UL, 0xa1a1f859UL, 0x89898009UL, 0x0d0d171aUL, 0xbfbfda65UL, 0xe6e631d7UL, 0x4242c684UL, 0x6868b8d0UL, 0x4141c382UL, 0x9999b029UL, 0x2d2d775aUL, 0x0f0f111eUL, 0xb0b0cb7bUL, 0x5454fca8UL, 0xbbbbd66dUL, 0x16163a2cUL, }; #ifndef PELI_TAB static const ulong32 Te4_0[] = { 0x00000063UL, 0x0000007cUL, 0x00000077UL, 0x0000007bUL, 0x000000f2UL, 0x0000006bUL, 0x0000006fUL, 0x000000c5UL, 0x00000030UL, 0x00000001UL, 0x00000067UL, 0x0000002bUL, 0x000000feUL, 0x000000d7UL, 0x000000abUL, 0x00000076UL, 0x000000caUL, 0x00000082UL, 0x000000c9UL, 0x0000007dUL, 0x000000faUL, 0x00000059UL, 0x00000047UL, 0x000000f0UL, 0x000000adUL, 0x000000d4UL, 0x000000a2UL, 0x000000afUL, 0x0000009cUL, 0x000000a4UL, 0x00000072UL, 0x000000c0UL, 0x000000b7UL, 0x000000fdUL, 0x00000093UL, 0x00000026UL, 0x00000036UL, 0x0000003fUL, 0x000000f7UL, 0x000000ccUL, 0x00000034UL, 0x000000a5UL, 0x000000e5UL, 0x000000f1UL, 0x00000071UL, 0x000000d8UL, 0x00000031UL, 0x00000015UL, 0x00000004UL, 0x000000c7UL, 0x00000023UL, 0x000000c3UL, 0x00000018UL, 0x00000096UL, 0x00000005UL, 0x0000009aUL, 0x00000007UL, 0x00000012UL, 0x00000080UL, 0x000000e2UL, 0x000000ebUL, 0x00000027UL, 0x000000b2UL, 0x00000075UL, 0x00000009UL, 0x00000083UL, 0x0000002cUL, 0x0000001aUL, 0x0000001bUL, 0x0000006eUL, 0x0000005aUL, 0x000000a0UL, 0x00000052UL, 0x0000003bUL, 0x000000d6UL, 0x000000b3UL, 0x00000029UL, 0x000000e3UL, 0x0000002fUL, 0x00000084UL, 0x00000053UL, 0x000000d1UL, 0x00000000UL, 0x000000edUL, 0x00000020UL, 0x000000fcUL, 0x000000b1UL, 0x0000005bUL, 0x0000006aUL, 0x000000cbUL, 0x000000beUL, 0x00000039UL, 0x0000004aUL, 0x0000004cUL, 0x00000058UL, 0x000000cfUL, 0x000000d0UL, 0x000000efUL, 0x000000aaUL, 0x000000fbUL, 0x00000043UL, 0x0000004dUL, 0x00000033UL, 0x00000085UL, 0x00000045UL, 0x000000f9UL, 0x00000002UL, 0x0000007fUL, 0x00000050UL, 0x0000003cUL, 0x0000009fUL, 0x000000a8UL, 0x00000051UL, 0x000000a3UL, 0x00000040UL, 0x0000008fUL, 0x00000092UL, 0x0000009dUL, 0x00000038UL, 0x000000f5UL, 0x000000bcUL, 0x000000b6UL, 0x000000daUL, 0x00000021UL, 0x00000010UL, 0x000000ffUL, 0x000000f3UL, 0x000000d2UL, 0x000000cdUL, 0x0000000cUL, 0x00000013UL, 0x000000ecUL, 0x0000005fUL, 0x00000097UL, 0x00000044UL, 0x00000017UL, 0x000000c4UL, 0x000000a7UL, 0x0000007eUL, 0x0000003dUL, 0x00000064UL, 0x0000005dUL, 0x00000019UL, 0x00000073UL, 0x00000060UL, 0x00000081UL, 0x0000004fUL, 0x000000dcUL, 0x00000022UL, 0x0000002aUL, 0x00000090UL, 0x00000088UL, 0x00000046UL, 0x000000eeUL, 0x000000b8UL, 0x00000014UL, 0x000000deUL, 0x0000005eUL, 0x0000000bUL, 0x000000dbUL, 0x000000e0UL, 0x00000032UL, 0x0000003aUL, 0x0000000aUL, 0x00000049UL, 0x00000006UL, 0x00000024UL, 0x0000005cUL, 0x000000c2UL, 0x000000d3UL, 0x000000acUL, 0x00000062UL, 0x00000091UL, 0x00000095UL, 0x000000e4UL, 0x00000079UL, 0x000000e7UL, 0x000000c8UL, 0x00000037UL, 0x0000006dUL, 0x0000008dUL, 0x000000d5UL, 0x0000004eUL, 0x000000a9UL, 0x0000006cUL, 0x00000056UL, 0x000000f4UL, 0x000000eaUL, 0x00000065UL, 0x0000007aUL, 0x000000aeUL, 0x00000008UL, 0x000000baUL, 0x00000078UL, 0x00000025UL, 0x0000002eUL, 0x0000001cUL, 0x000000a6UL, 0x000000b4UL, 0x000000c6UL, 0x000000e8UL, 0x000000ddUL, 0x00000074UL, 0x0000001fUL, 0x0000004bUL, 0x000000bdUL, 0x0000008bUL, 0x0000008aUL, 0x00000070UL, 0x0000003eUL, 0x000000b5UL, 0x00000066UL, 0x00000048UL, 0x00000003UL, 0x000000f6UL, 0x0000000eUL, 0x00000061UL, 0x00000035UL, 0x00000057UL, 0x000000b9UL, 0x00000086UL, 0x000000c1UL, 0x0000001dUL, 0x0000009eUL, 0x000000e1UL, 0x000000f8UL, 0x00000098UL, 0x00000011UL, 0x00000069UL, 0x000000d9UL, 0x0000008eUL, 0x00000094UL, 0x0000009bUL, 0x0000001eUL, 0x00000087UL, 0x000000e9UL, 0x000000ceUL, 0x00000055UL, 0x00000028UL, 0x000000dfUL, 0x0000008cUL, 0x000000a1UL, 0x00000089UL, 0x0000000dUL, 0x000000bfUL, 0x000000e6UL, 0x00000042UL, 0x00000068UL, 0x00000041UL, 0x00000099UL, 0x0000002dUL, 0x0000000fUL, 0x000000b0UL, 0x00000054UL, 0x000000bbUL, 0x00000016UL }; static const ulong32 Te4_1[] = { 0x00006300UL, 0x00007c00UL, 0x00007700UL, 0x00007b00UL, 0x0000f200UL, 0x00006b00UL, 0x00006f00UL, 0x0000c500UL, 0x00003000UL, 0x00000100UL, 0x00006700UL, 0x00002b00UL, 0x0000fe00UL, 0x0000d700UL, 0x0000ab00UL, 0x00007600UL, 0x0000ca00UL, 0x00008200UL, 0x0000c900UL, 0x00007d00UL, 0x0000fa00UL, 0x00005900UL, 0x00004700UL, 0x0000f000UL, 0x0000ad00UL, 0x0000d400UL, 0x0000a200UL, 0x0000af00UL, 0x00009c00UL, 0x0000a400UL, 0x00007200UL, 0x0000c000UL, 0x0000b700UL, 0x0000fd00UL, 0x00009300UL, 0x00002600UL, 0x00003600UL, 0x00003f00UL, 0x0000f700UL, 0x0000cc00UL, 0x00003400UL, 0x0000a500UL, 0x0000e500UL, 0x0000f100UL, 0x00007100UL, 0x0000d800UL, 0x00003100UL, 0x00001500UL, 0x00000400UL, 0x0000c700UL, 0x00002300UL, 0x0000c300UL, 0x00001800UL, 0x00009600UL, 0x00000500UL, 0x00009a00UL, 0x00000700UL, 0x00001200UL, 0x00008000UL, 0x0000e200UL, 0x0000eb00UL, 0x00002700UL, 0x0000b200UL, 0x00007500UL, 0x00000900UL, 0x00008300UL, 0x00002c00UL, 0x00001a00UL, 0x00001b00UL, 0x00006e00UL, 0x00005a00UL, 0x0000a000UL, 0x00005200UL, 0x00003b00UL, 0x0000d600UL, 0x0000b300UL, 0x00002900UL, 0x0000e300UL, 0x00002f00UL, 0x00008400UL, 0x00005300UL, 0x0000d100UL, 0x00000000UL, 0x0000ed00UL, 0x00002000UL, 0x0000fc00UL, 0x0000b100UL, 0x00005b00UL, 0x00006a00UL, 0x0000cb00UL, 0x0000be00UL, 0x00003900UL, 0x00004a00UL, 0x00004c00UL, 0x00005800UL, 0x0000cf00UL, 0x0000d000UL, 0x0000ef00UL, 0x0000aa00UL, 0x0000fb00UL, 0x00004300UL, 0x00004d00UL, 0x00003300UL, 0x00008500UL, 0x00004500UL, 0x0000f900UL, 0x00000200UL, 0x00007f00UL, 0x00005000UL, 0x00003c00UL, 0x00009f00UL, 0x0000a800UL, 0x00005100UL, 0x0000a300UL, 0x00004000UL, 0x00008f00UL, 0x00009200UL, 0x00009d00UL, 0x00003800UL, 0x0000f500UL, 0x0000bc00UL, 0x0000b600UL, 0x0000da00UL, 0x00002100UL, 0x00001000UL, 0x0000ff00UL, 0x0000f300UL, 0x0000d200UL, 0x0000cd00UL, 0x00000c00UL, 0x00001300UL, 0x0000ec00UL, 0x00005f00UL, 0x00009700UL, 0x00004400UL, 0x00001700UL, 0x0000c400UL, 0x0000a700UL, 0x00007e00UL, 0x00003d00UL, 0x00006400UL, 0x00005d00UL, 0x00001900UL, 0x00007300UL, 0x00006000UL, 0x00008100UL, 0x00004f00UL, 0x0000dc00UL, 0x00002200UL, 0x00002a00UL, 0x00009000UL, 0x00008800UL, 0x00004600UL, 0x0000ee00UL, 0x0000b800UL, 0x00001400UL, 0x0000de00UL, 0x00005e00UL, 0x00000b00UL, 0x0000db00UL, 0x0000e000UL, 0x00003200UL, 0x00003a00UL, 0x00000a00UL, 0x00004900UL, 0x00000600UL, 0x00002400UL, 0x00005c00UL, 0x0000c200UL, 0x0000d300UL, 0x0000ac00UL, 0x00006200UL, 0x00009100UL, 0x00009500UL, 0x0000e400UL, 0x00007900UL, 0x0000e700UL, 0x0000c800UL, 0x00003700UL, 0x00006d00UL, 0x00008d00UL, 0x0000d500UL, 0x00004e00UL, 0x0000a900UL, 0x00006c00UL, 0x00005600UL, 0x0000f400UL, 0x0000ea00UL, 0x00006500UL, 0x00007a00UL, 0x0000ae00UL, 0x00000800UL, 0x0000ba00UL, 0x00007800UL, 0x00002500UL, 0x00002e00UL, 0x00001c00UL, 0x0000a600UL, 0x0000b400UL, 0x0000c600UL, 0x0000e800UL, 0x0000dd00UL, 0x00007400UL, 0x00001f00UL, 0x00004b00UL, 0x0000bd00UL, 0x00008b00UL, 0x00008a00UL, 0x00007000UL, 0x00003e00UL, 0x0000b500UL, 0x00006600UL, 0x00004800UL, 0x00000300UL, 0x0000f600UL, 0x00000e00UL, 0x00006100UL, 0x00003500UL, 0x00005700UL, 0x0000b900UL, 0x00008600UL, 0x0000c100UL, 0x00001d00UL, 0x00009e00UL, 0x0000e100UL, 0x0000f800UL, 0x00009800UL, 0x00001100UL, 0x00006900UL, 0x0000d900UL, 0x00008e00UL, 0x00009400UL, 0x00009b00UL, 0x00001e00UL, 0x00008700UL, 0x0000e900UL, 0x0000ce00UL, 0x00005500UL, 0x00002800UL, 0x0000df00UL, 0x00008c00UL, 0x0000a100UL, 0x00008900UL, 0x00000d00UL, 0x0000bf00UL, 0x0000e600UL, 0x00004200UL, 0x00006800UL, 0x00004100UL, 0x00009900UL, 0x00002d00UL, 0x00000f00UL, 0x0000b000UL, 0x00005400UL, 0x0000bb00UL, 0x00001600UL }; static const ulong32 Te4_2[] = { 0x00630000UL, 0x007c0000UL, 0x00770000UL, 0x007b0000UL, 0x00f20000UL, 0x006b0000UL, 0x006f0000UL, 0x00c50000UL, 0x00300000UL, 0x00010000UL, 0x00670000UL, 0x002b0000UL, 0x00fe0000UL, 0x00d70000UL, 0x00ab0000UL, 0x00760000UL, 0x00ca0000UL, 0x00820000UL, 0x00c90000UL, 0x007d0000UL, 0x00fa0000UL, 0x00590000UL, 0x00470000UL, 0x00f00000UL, 0x00ad0000UL, 0x00d40000UL, 0x00a20000UL, 0x00af0000UL, 0x009c0000UL, 0x00a40000UL, 0x00720000UL, 0x00c00000UL, 0x00b70000UL, 0x00fd0000UL, 0x00930000UL, 0x00260000UL, 0x00360000UL, 0x003f0000UL, 0x00f70000UL, 0x00cc0000UL, 0x00340000UL, 0x00a50000UL, 0x00e50000UL, 0x00f10000UL, 0x00710000UL, 0x00d80000UL, 0x00310000UL, 0x00150000UL, 0x00040000UL, 0x00c70000UL, 0x00230000UL, 0x00c30000UL, 0x00180000UL, 0x00960000UL, 0x00050000UL, 0x009a0000UL, 0x00070000UL, 0x00120000UL, 0x00800000UL, 0x00e20000UL, 0x00eb0000UL, 0x00270000UL, 0x00b20000UL, 0x00750000UL, 0x00090000UL, 0x00830000UL, 0x002c0000UL, 0x001a0000UL, 0x001b0000UL, 0x006e0000UL, 0x005a0000UL, 0x00a00000UL, 0x00520000UL, 0x003b0000UL, 0x00d60000UL, 0x00b30000UL, 0x00290000UL, 0x00e30000UL, 0x002f0000UL, 0x00840000UL, 0x00530000UL, 0x00d10000UL, 0x00000000UL, 0x00ed0000UL, 0x00200000UL, 0x00fc0000UL, 0x00b10000UL, 0x005b0000UL, 0x006a0000UL, 0x00cb0000UL, 0x00be0000UL, 0x00390000UL, 0x004a0000UL, 0x004c0000UL, 0x00580000UL, 0x00cf0000UL, 0x00d00000UL, 0x00ef0000UL, 0x00aa0000UL, 0x00fb0000UL, 0x00430000UL, 0x004d0000UL, 0x00330000UL, 0x00850000UL, 0x00450000UL, 0x00f90000UL, 0x00020000UL, 0x007f0000UL, 0x00500000UL, 0x003c0000UL, 0x009f0000UL, 0x00a80000UL, 0x00510000UL, 0x00a30000UL, 0x00400000UL, 0x008f0000UL, 0x00920000UL, 0x009d0000UL, 0x00380000UL, 0x00f50000UL, 0x00bc0000UL, 0x00b60000UL, 0x00da0000UL, 0x00210000UL, 0x00100000UL, 0x00ff0000UL, 0x00f30000UL, 0x00d20000UL, 0x00cd0000UL, 0x000c0000UL, 0x00130000UL, 0x00ec0000UL, 0x005f0000UL, 0x00970000UL, 0x00440000UL, 0x00170000UL, 0x00c40000UL, 0x00a70000UL, 0x007e0000UL, 0x003d0000UL, 0x00640000UL, 0x005d0000UL, 0x00190000UL, 0x00730000UL, 0x00600000UL, 0x00810000UL, 0x004f0000UL, 0x00dc0000UL, 0x00220000UL, 0x002a0000UL, 0x00900000UL, 0x00880000UL, 0x00460000UL, 0x00ee0000UL, 0x00b80000UL, 0x00140000UL, 0x00de0000UL, 0x005e0000UL, 0x000b0000UL, 0x00db0000UL, 0x00e00000UL, 0x00320000UL, 0x003a0000UL, 0x000a0000UL, 0x00490000UL, 0x00060000UL, 0x00240000UL, 0x005c0000UL, 0x00c20000UL, 0x00d30000UL, 0x00ac0000UL, 0x00620000UL, 0x00910000UL, 0x00950000UL, 0x00e40000UL, 0x00790000UL, 0x00e70000UL, 0x00c80000UL, 0x00370000UL, 0x006d0000UL, 0x008d0000UL, 0x00d50000UL, 0x004e0000UL, 0x00a90000UL, 0x006c0000UL, 0x00560000UL, 0x00f40000UL, 0x00ea0000UL, 0x00650000UL, 0x007a0000UL, 0x00ae0000UL, 0x00080000UL, 0x00ba0000UL, 0x00780000UL, 0x00250000UL, 0x002e0000UL, 0x001c0000UL, 0x00a60000UL, 0x00b40000UL, 0x00c60000UL, 0x00e80000UL, 0x00dd0000UL, 0x00740000UL, 0x001f0000UL, 0x004b0000UL, 0x00bd0000UL, 0x008b0000UL, 0x008a0000UL, 0x00700000UL, 0x003e0000UL, 0x00b50000UL, 0x00660000UL, 0x00480000UL, 0x00030000UL, 0x00f60000UL, 0x000e0000UL, 0x00610000UL, 0x00350000UL, 0x00570000UL, 0x00b90000UL, 0x00860000UL, 0x00c10000UL, 0x001d0000UL, 0x009e0000UL, 0x00e10000UL, 0x00f80000UL, 0x00980000UL, 0x00110000UL, 0x00690000UL, 0x00d90000UL, 0x008e0000UL, 0x00940000UL, 0x009b0000UL, 0x001e0000UL, 0x00870000UL, 0x00e90000UL, 0x00ce0000UL, 0x00550000UL, 0x00280000UL, 0x00df0000UL, 0x008c0000UL, 0x00a10000UL, 0x00890000UL, 0x000d0000UL, 0x00bf0000UL, 0x00e60000UL, 0x00420000UL, 0x00680000UL, 0x00410000UL, 0x00990000UL, 0x002d0000UL, 0x000f0000UL, 0x00b00000UL, 0x00540000UL, 0x00bb0000UL, 0x00160000UL }; static const ulong32 Te4_3[] = { 0x63000000UL, 0x7c000000UL, 0x77000000UL, 0x7b000000UL, 0xf2000000UL, 0x6b000000UL, 0x6f000000UL, 0xc5000000UL, 0x30000000UL, 0x01000000UL, 0x67000000UL, 0x2b000000UL, 0xfe000000UL, 0xd7000000UL, 0xab000000UL, 0x76000000UL, 0xca000000UL, 0x82000000UL, 0xc9000000UL, 0x7d000000UL, 0xfa000000UL, 0x59000000UL, 0x47000000UL, 0xf0000000UL, 0xad000000UL, 0xd4000000UL, 0xa2000000UL, 0xaf000000UL, 0x9c000000UL, 0xa4000000UL, 0x72000000UL, 0xc0000000UL, 0xb7000000UL, 0xfd000000UL, 0x93000000UL, 0x26000000UL, 0x36000000UL, 0x3f000000UL, 0xf7000000UL, 0xcc000000UL, 0x34000000UL, 0xa5000000UL, 0xe5000000UL, 0xf1000000UL, 0x71000000UL, 0xd8000000UL, 0x31000000UL, 0x15000000UL, 0x04000000UL, 0xc7000000UL, 0x23000000UL, 0xc3000000UL, 0x18000000UL, 0x96000000UL, 0x05000000UL, 0x9a000000UL, 0x07000000UL, 0x12000000UL, 0x80000000UL, 0xe2000000UL, 0xeb000000UL, 0x27000000UL, 0xb2000000UL, 0x75000000UL, 0x09000000UL, 0x83000000UL, 0x2c000000UL, 0x1a000000UL, 0x1b000000UL, 0x6e000000UL, 0x5a000000UL, 0xa0000000UL, 0x52000000UL, 0x3b000000UL, 0xd6000000UL, 0xb3000000UL, 0x29000000UL, 0xe3000000UL, 0x2f000000UL, 0x84000000UL, 0x53000000UL, 0xd1000000UL, 0x00000000UL, 0xed000000UL, 0x20000000UL, 0xfc000000UL, 0xb1000000UL, 0x5b000000UL, 0x6a000000UL, 0xcb000000UL, 0xbe000000UL, 0x39000000UL, 0x4a000000UL, 0x4c000000UL, 0x58000000UL, 0xcf000000UL, 0xd0000000UL, 0xef000000UL, 0xaa000000UL, 0xfb000000UL, 0x43000000UL, 0x4d000000UL, 0x33000000UL, 0x85000000UL, 0x45000000UL, 0xf9000000UL, 0x02000000UL, 0x7f000000UL, 0x50000000UL, 0x3c000000UL, 0x9f000000UL, 0xa8000000UL, 0x51000000UL, 0xa3000000UL, 0x40000000UL, 0x8f000000UL, 0x92000000UL, 0x9d000000UL, 0x38000000UL, 0xf5000000UL, 0xbc000000UL, 0xb6000000UL, 0xda000000UL, 0x21000000UL, 0x10000000UL, 0xff000000UL, 0xf3000000UL, 0xd2000000UL, 0xcd000000UL, 0x0c000000UL, 0x13000000UL, 0xec000000UL, 0x5f000000UL, 0x97000000UL, 0x44000000UL, 0x17000000UL, 0xc4000000UL, 0xa7000000UL, 0x7e000000UL, 0x3d000000UL, 0x64000000UL, 0x5d000000UL, 0x19000000UL, 0x73000000UL, 0x60000000UL, 0x81000000UL, 0x4f000000UL, 0xdc000000UL, 0x22000000UL, 0x2a000000UL, 0x90000000UL, 0x88000000UL, 0x46000000UL, 0xee000000UL, 0xb8000000UL, 0x14000000UL, 0xde000000UL, 0x5e000000UL, 0x0b000000UL, 0xdb000000UL, 0xe0000000UL, 0x32000000UL, 0x3a000000UL, 0x0a000000UL, 0x49000000UL, 0x06000000UL, 0x24000000UL, 0x5c000000UL, 0xc2000000UL, 0xd3000000UL, 0xac000000UL, 0x62000000UL, 0x91000000UL, 0x95000000UL, 0xe4000000UL, 0x79000000UL, 0xe7000000UL, 0xc8000000UL, 0x37000000UL, 0x6d000000UL, 0x8d000000UL, 0xd5000000UL, 0x4e000000UL, 0xa9000000UL, 0x6c000000UL, 0x56000000UL, 0xf4000000UL, 0xea000000UL, 0x65000000UL, 0x7a000000UL, 0xae000000UL, 0x08000000UL, 0xba000000UL, 0x78000000UL, 0x25000000UL, 0x2e000000UL, 0x1c000000UL, 0xa6000000UL, 0xb4000000UL, 0xc6000000UL, 0xe8000000UL, 0xdd000000UL, 0x74000000UL, 0x1f000000UL, 0x4b000000UL, 0xbd000000UL, 0x8b000000UL, 0x8a000000UL, 0x70000000UL, 0x3e000000UL, 0xb5000000UL, 0x66000000UL, 0x48000000UL, 0x03000000UL, 0xf6000000UL, 0x0e000000UL, 0x61000000UL, 0x35000000UL, 0x57000000UL, 0xb9000000UL, 0x86000000UL, 0xc1000000UL, 0x1d000000UL, 0x9e000000UL, 0xe1000000UL, 0xf8000000UL, 0x98000000UL, 0x11000000UL, 0x69000000UL, 0xd9000000UL, 0x8e000000UL, 0x94000000UL, 0x9b000000UL, 0x1e000000UL, 0x87000000UL, 0xe9000000UL, 0xce000000UL, 0x55000000UL, 0x28000000UL, 0xdf000000UL, 0x8c000000UL, 0xa1000000UL, 0x89000000UL, 0x0d000000UL, 0xbf000000UL, 0xe6000000UL, 0x42000000UL, 0x68000000UL, 0x41000000UL, 0x99000000UL, 0x2d000000UL, 0x0f000000UL, 0xb0000000UL, 0x54000000UL, 0xbb000000UL, 0x16000000UL }; #endif /* pelimac */ #ifndef ENCRYPT_ONLY static const ulong32 TD1[256] = { 0x5051f4a7UL, 0x537e4165UL, 0xc31a17a4UL, 0x963a275eUL, 0xcb3bab6bUL, 0xf11f9d45UL, 0xabacfa58UL, 0x934be303UL, 0x552030faUL, 0xf6ad766dUL, 0x9188cc76UL, 0x25f5024cUL, 0xfc4fe5d7UL, 0xd7c52acbUL, 0x80263544UL, 0x8fb562a3UL, 0x49deb15aUL, 0x6725ba1bUL, 0x9845ea0eUL, 0xe15dfec0UL, 0x02c32f75UL, 0x12814cf0UL, 0xa38d4697UL, 0xc66bd3f9UL, 0xe7038f5fUL, 0x9515929cUL, 0xebbf6d7aUL, 0xda955259UL, 0x2dd4be83UL, 0xd3587421UL, 0x2949e069UL, 0x448ec9c8UL, 0x6a75c289UL, 0x78f48e79UL, 0x6b99583eUL, 0xdd27b971UL, 0xb6bee14fUL, 0x17f088adUL, 0x66c920acUL, 0xb47dce3aUL, 0x1863df4aUL, 0x82e51a31UL, 0x60975133UL, 0x4562537fUL, 0xe0b16477UL, 0x84bb6baeUL, 0x1cfe81a0UL, 0x94f9082bUL, 0x58704868UL, 0x198f45fdUL, 0x8794de6cUL, 0xb7527bf8UL, 0x23ab73d3UL, 0xe2724b02UL, 0x57e31f8fUL, 0x2a6655abUL, 0x07b2eb28UL, 0x032fb5c2UL, 0x9a86c57bUL, 0xa5d33708UL, 0xf2302887UL, 0xb223bfa5UL, 0xba02036aUL, 0x5ced1682UL, 0x2b8acf1cUL, 0x92a779b4UL, 0xf0f307f2UL, 0xa14e69e2UL, 0xcd65daf4UL, 0xd50605beUL, 0x1fd13462UL, 0x8ac4a6feUL, 0x9d342e53UL, 0xa0a2f355UL, 0x32058ae1UL, 0x75a4f6ebUL, 0x390b83ecUL, 0xaa4060efUL, 0x065e719fUL, 0x51bd6e10UL, 0xf93e218aUL, 0x3d96dd06UL, 0xaedd3e05UL, 0x464de6bdUL, 0xb591548dUL, 0x0571c45dUL, 0x6f0406d4UL, 0xff605015UL, 0x241998fbUL, 0x97d6bde9UL, 0xcc894043UL, 0x7767d99eUL, 0xbdb0e842UL, 0x8807898bUL, 0x38e7195bUL, 0xdb79c8eeUL, 0x47a17c0aUL, 0xe97c420fUL, 0xc9f8841eUL, 0x00000000UL, 0x83098086UL, 0x48322bedUL, 0xac1e1170UL, 0x4e6c5a72UL, 0xfbfd0effUL, 0x560f8538UL, 0x1e3daed5UL, 0x27362d39UL, 0x640a0fd9UL, 0x21685ca6UL, 0xd19b5b54UL, 0x3a24362eUL, 0xb10c0a67UL, 0x0f9357e7UL, 0xd2b4ee96UL, 0x9e1b9b91UL, 0x4f80c0c5UL, 0xa261dc20UL, 0x695a774bUL, 0x161c121aUL, 0x0ae293baUL, 0xe5c0a02aUL, 0x433c22e0UL, 0x1d121b17UL, 0x0b0e090dUL, 0xadf28bc7UL, 0xb92db6a8UL, 0xc8141ea9UL, 0x8557f119UL, 0x4caf7507UL, 0xbbee99ddUL, 0xfda37f60UL, 0x9ff70126UL, 0xbc5c72f5UL, 0xc544663bUL, 0x345bfb7eUL, 0x768b4329UL, 0xdccb23c6UL, 0x68b6edfcUL, 0x63b8e4f1UL, 0xcad731dcUL, 0x10426385UL, 0x40139722UL, 0x2084c611UL, 0x7d854a24UL, 0xf8d2bb3dUL, 0x11aef932UL, 0x6dc729a1UL, 0x4b1d9e2fUL, 0xf3dcb230UL, 0xec0d8652UL, 0xd077c1e3UL, 0x6c2bb316UL, 0x99a970b9UL, 0xfa119448UL, 0x2247e964UL, 0xc4a8fc8cUL, 0x1aa0f03fUL, 0xd8567d2cUL, 0xef223390UL, 0xc787494eUL, 0xc1d938d1UL, 0xfe8ccaa2UL, 0x3698d40bUL, 0xcfa6f581UL, 0x28a57adeUL, 0x26dab78eUL, 0xa43fadbfUL, 0xe42c3a9dUL, 0x0d507892UL, 0x9b6a5fccUL, 0x62547e46UL, 0xc2f68d13UL, 0xe890d8b8UL, 0x5e2e39f7UL, 0xf582c3afUL, 0xbe9f5d80UL, 0x7c69d093UL, 0xa96fd52dUL, 0xb3cf2512UL, 0x3bc8ac99UL, 0xa710187dUL, 0x6ee89c63UL, 0x7bdb3bbbUL, 0x09cd2678UL, 0xf46e5918UL, 0x01ec9ab7UL, 0xa8834f9aUL, 0x65e6956eUL, 0x7eaaffe6UL, 0x0821bccfUL, 0xe6ef15e8UL, 0xd9bae79bUL, 0xce4a6f36UL, 0xd4ea9f09UL, 0xd629b07cUL, 0xaf31a4b2UL, 0x312a3f23UL, 0x30c6a594UL, 0xc035a266UL, 0x37744ebcUL, 0xa6fc82caUL, 0xb0e090d0UL, 0x1533a7d8UL, 0x4af10498UL, 0xf741ecdaUL, 0x0e7fcd50UL, 0x2f1791f6UL, 0x8d764dd6UL, 0x4d43efb0UL, 0x54ccaa4dUL, 0xdfe49604UL, 0xe39ed1b5UL, 0x1b4c6a88UL, 0xb8c12c1fUL, 0x7f466551UL, 0x049d5eeaUL, 0x5d018c35UL, 0x73fa8774UL, 0x2efb0b41UL, 0x5ab3671dUL, 0x5292dbd2UL, 0x33e91056UL, 0x136dd647UL, 0x8c9ad761UL, 0x7a37a10cUL, 0x8e59f814UL, 0x89eb133cUL, 0xeecea927UL, 0x35b761c9UL, 0xede11ce5UL, 0x3c7a47b1UL, 0x599cd2dfUL, 0x3f55f273UL, 0x791814ceUL, 0xbf73c737UL, 0xea53f7cdUL, 0x5b5ffdaaUL, 0x14df3d6fUL, 0x867844dbUL, 0x81caaff3UL, 0x3eb968c4UL, 0x2c382434UL, 0x5fc2a340UL, 0x72161dc3UL, 0x0cbce225UL, 0x8b283c49UL, 0x41ff0d95UL, 0x7139a801UL, 0xde080cb3UL, 0x9cd8b4e4UL, 0x906456c1UL, 0x617bcb84UL, 0x70d532b6UL, 0x74486c5cUL, 0x42d0b857UL, }; static const ulong32 TD2[256] = { 0xa75051f4UL, 0x65537e41UL, 0xa4c31a17UL, 0x5e963a27UL, 0x6bcb3babUL, 0x45f11f9dUL, 0x58abacfaUL, 0x03934be3UL, 0xfa552030UL, 0x6df6ad76UL, 0x769188ccUL, 0x4c25f502UL, 0xd7fc4fe5UL, 0xcbd7c52aUL, 0x44802635UL, 0xa38fb562UL, 0x5a49deb1UL, 0x1b6725baUL, 0x0e9845eaUL, 0xc0e15dfeUL, 0x7502c32fUL, 0xf012814cUL, 0x97a38d46UL, 0xf9c66bd3UL, 0x5fe7038fUL, 0x9c951592UL, 0x7aebbf6dUL, 0x59da9552UL, 0x832dd4beUL, 0x21d35874UL, 0x692949e0UL, 0xc8448ec9UL, 0x896a75c2UL, 0x7978f48eUL, 0x3e6b9958UL, 0x71dd27b9UL, 0x4fb6bee1UL, 0xad17f088UL, 0xac66c920UL, 0x3ab47dceUL, 0x4a1863dfUL, 0x3182e51aUL, 0x33609751UL, 0x7f456253UL, 0x77e0b164UL, 0xae84bb6bUL, 0xa01cfe81UL, 0x2b94f908UL, 0x68587048UL, 0xfd198f45UL, 0x6c8794deUL, 0xf8b7527bUL, 0xd323ab73UL, 0x02e2724bUL, 0x8f57e31fUL, 0xab2a6655UL, 0x2807b2ebUL, 0xc2032fb5UL, 0x7b9a86c5UL, 0x08a5d337UL, 0x87f23028UL, 0xa5b223bfUL, 0x6aba0203UL, 0x825ced16UL, 0x1c2b8acfUL, 0xb492a779UL, 0xf2f0f307UL, 0xe2a14e69UL, 0xf4cd65daUL, 0xbed50605UL, 0x621fd134UL, 0xfe8ac4a6UL, 0x539d342eUL, 0x55a0a2f3UL, 0xe132058aUL, 0xeb75a4f6UL, 0xec390b83UL, 0xefaa4060UL, 0x9f065e71UL, 0x1051bd6eUL, 0x8af93e21UL, 0x063d96ddUL, 0x05aedd3eUL, 0xbd464de6UL, 0x8db59154UL, 0x5d0571c4UL, 0xd46f0406UL, 0x15ff6050UL, 0xfb241998UL, 0xe997d6bdUL, 0x43cc8940UL, 0x9e7767d9UL, 0x42bdb0e8UL, 0x8b880789UL, 0x5b38e719UL, 0xeedb79c8UL, 0x0a47a17cUL, 0x0fe97c42UL, 0x1ec9f884UL, 0x00000000UL, 0x86830980UL, 0xed48322bUL, 0x70ac1e11UL, 0x724e6c5aUL, 0xfffbfd0eUL, 0x38560f85UL, 0xd51e3daeUL, 0x3927362dUL, 0xd9640a0fUL, 0xa621685cUL, 0x54d19b5bUL, 0x2e3a2436UL, 0x67b10c0aUL, 0xe70f9357UL, 0x96d2b4eeUL, 0x919e1b9bUL, 0xc54f80c0UL, 0x20a261dcUL, 0x4b695a77UL, 0x1a161c12UL, 0xba0ae293UL, 0x2ae5c0a0UL, 0xe0433c22UL, 0x171d121bUL, 0x0d0b0e09UL, 0xc7adf28bUL, 0xa8b92db6UL, 0xa9c8141eUL, 0x198557f1UL, 0x074caf75UL, 0xddbbee99UL, 0x60fda37fUL, 0x269ff701UL, 0xf5bc5c72UL, 0x3bc54466UL, 0x7e345bfbUL, 0x29768b43UL, 0xc6dccb23UL, 0xfc68b6edUL, 0xf163b8e4UL, 0xdccad731UL, 0x85104263UL, 0x22401397UL, 0x112084c6UL, 0x247d854aUL, 0x3df8d2bbUL, 0x3211aef9UL, 0xa16dc729UL, 0x2f4b1d9eUL, 0x30f3dcb2UL, 0x52ec0d86UL, 0xe3d077c1UL, 0x166c2bb3UL, 0xb999a970UL, 0x48fa1194UL, 0x642247e9UL, 0x8cc4a8fcUL, 0x3f1aa0f0UL, 0x2cd8567dUL, 0x90ef2233UL, 0x4ec78749UL, 0xd1c1d938UL, 0xa2fe8ccaUL, 0x0b3698d4UL, 0x81cfa6f5UL, 0xde28a57aUL, 0x8e26dab7UL, 0xbfa43fadUL, 0x9de42c3aUL, 0x920d5078UL, 0xcc9b6a5fUL, 0x4662547eUL, 0x13c2f68dUL, 0xb8e890d8UL, 0xf75e2e39UL, 0xaff582c3UL, 0x80be9f5dUL, 0x937c69d0UL, 0x2da96fd5UL, 0x12b3cf25UL, 0x993bc8acUL, 0x7da71018UL, 0x636ee89cUL, 0xbb7bdb3bUL, 0x7809cd26UL, 0x18f46e59UL, 0xb701ec9aUL, 0x9aa8834fUL, 0x6e65e695UL, 0xe67eaaffUL, 0xcf0821bcUL, 0xe8e6ef15UL, 0x9bd9bae7UL, 0x36ce4a6fUL, 0x09d4ea9fUL, 0x7cd629b0UL, 0xb2af31a4UL, 0x23312a3fUL, 0x9430c6a5UL, 0x66c035a2UL, 0xbc37744eUL, 0xcaa6fc82UL, 0xd0b0e090UL, 0xd81533a7UL, 0x984af104UL, 0xdaf741ecUL, 0x500e7fcdUL, 0xf62f1791UL, 0xd68d764dUL, 0xb04d43efUL, 0x4d54ccaaUL, 0x04dfe496UL, 0xb5e39ed1UL, 0x881b4c6aUL, 0x1fb8c12cUL, 0x517f4665UL, 0xea049d5eUL, 0x355d018cUL, 0x7473fa87UL, 0x412efb0bUL, 0x1d5ab367UL, 0xd25292dbUL, 0x5633e910UL, 0x47136dd6UL, 0x618c9ad7UL, 0x0c7a37a1UL, 0x148e59f8UL, 0x3c89eb13UL, 0x27eecea9UL, 0xc935b761UL, 0xe5ede11cUL, 0xb13c7a47UL, 0xdf599cd2UL, 0x733f55f2UL, 0xce791814UL, 0x37bf73c7UL, 0xcdea53f7UL, 0xaa5b5ffdUL, 0x6f14df3dUL, 0xdb867844UL, 0xf381caafUL, 0xc43eb968UL, 0x342c3824UL, 0x405fc2a3UL, 0xc372161dUL, 0x250cbce2UL, 0x498b283cUL, 0x9541ff0dUL, 0x017139a8UL, 0xb3de080cUL, 0xe49cd8b4UL, 0xc1906456UL, 0x84617bcbUL, 0xb670d532UL, 0x5c74486cUL, 0x5742d0b8UL, }; static const ulong32 TD3[256] = { 0xf4a75051UL, 0x4165537eUL, 0x17a4c31aUL, 0x275e963aUL, 0xab6bcb3bUL, 0x9d45f11fUL, 0xfa58abacUL, 0xe303934bUL, 0x30fa5520UL, 0x766df6adUL, 0xcc769188UL, 0x024c25f5UL, 0xe5d7fc4fUL, 0x2acbd7c5UL, 0x35448026UL, 0x62a38fb5UL, 0xb15a49deUL, 0xba1b6725UL, 0xea0e9845UL, 0xfec0e15dUL, 0x2f7502c3UL, 0x4cf01281UL, 0x4697a38dUL, 0xd3f9c66bUL, 0x8f5fe703UL, 0x929c9515UL, 0x6d7aebbfUL, 0x5259da95UL, 0xbe832dd4UL, 0x7421d358UL, 0xe0692949UL, 0xc9c8448eUL, 0xc2896a75UL, 0x8e7978f4UL, 0x583e6b99UL, 0xb971dd27UL, 0xe14fb6beUL, 0x88ad17f0UL, 0x20ac66c9UL, 0xce3ab47dUL, 0xdf4a1863UL, 0x1a3182e5UL, 0x51336097UL, 0x537f4562UL, 0x6477e0b1UL, 0x6bae84bbUL, 0x81a01cfeUL, 0x082b94f9UL, 0x48685870UL, 0x45fd198fUL, 0xde6c8794UL, 0x7bf8b752UL, 0x73d323abUL, 0x4b02e272UL, 0x1f8f57e3UL, 0x55ab2a66UL, 0xeb2807b2UL, 0xb5c2032fUL, 0xc57b9a86UL, 0x3708a5d3UL, 0x2887f230UL, 0xbfa5b223UL, 0x036aba02UL, 0x16825cedUL, 0xcf1c2b8aUL, 0x79b492a7UL, 0x07f2f0f3UL, 0x69e2a14eUL, 0xdaf4cd65UL, 0x05bed506UL, 0x34621fd1UL, 0xa6fe8ac4UL, 0x2e539d34UL, 0xf355a0a2UL, 0x8ae13205UL, 0xf6eb75a4UL, 0x83ec390bUL, 0x60efaa40UL, 0x719f065eUL, 0x6e1051bdUL, 0x218af93eUL, 0xdd063d96UL, 0x3e05aeddUL, 0xe6bd464dUL, 0x548db591UL, 0xc45d0571UL, 0x06d46f04UL, 0x5015ff60UL, 0x98fb2419UL, 0xbde997d6UL, 0x4043cc89UL, 0xd99e7767UL, 0xe842bdb0UL, 0x898b8807UL, 0x195b38e7UL, 0xc8eedb79UL, 0x7c0a47a1UL, 0x420fe97cUL, 0x841ec9f8UL, 0x00000000UL, 0x80868309UL, 0x2bed4832UL, 0x1170ac1eUL, 0x5a724e6cUL, 0x0efffbfdUL, 0x8538560fUL, 0xaed51e3dUL, 0x2d392736UL, 0x0fd9640aUL, 0x5ca62168UL, 0x5b54d19bUL, 0x362e3a24UL, 0x0a67b10cUL, 0x57e70f93UL, 0xee96d2b4UL, 0x9b919e1bUL, 0xc0c54f80UL, 0xdc20a261UL, 0x774b695aUL, 0x121a161cUL, 0x93ba0ae2UL, 0xa02ae5c0UL, 0x22e0433cUL, 0x1b171d12UL, 0x090d0b0eUL, 0x8bc7adf2UL, 0xb6a8b92dUL, 0x1ea9c814UL, 0xf1198557UL, 0x75074cafUL, 0x99ddbbeeUL, 0x7f60fda3UL, 0x01269ff7UL, 0x72f5bc5cUL, 0x663bc544UL, 0xfb7e345bUL, 0x4329768bUL, 0x23c6dccbUL, 0xedfc68b6UL, 0xe4f163b8UL, 0x31dccad7UL, 0x63851042UL, 0x97224013UL, 0xc6112084UL, 0x4a247d85UL, 0xbb3df8d2UL, 0xf93211aeUL, 0x29a16dc7UL, 0x9e2f4b1dUL, 0xb230f3dcUL, 0x8652ec0dUL, 0xc1e3d077UL, 0xb3166c2bUL, 0x70b999a9UL, 0x9448fa11UL, 0xe9642247UL, 0xfc8cc4a8UL, 0xf03f1aa0UL, 0x7d2cd856UL, 0x3390ef22UL, 0x494ec787UL, 0x38d1c1d9UL, 0xcaa2fe8cUL, 0xd40b3698UL, 0xf581cfa6UL, 0x7ade28a5UL, 0xb78e26daUL, 0xadbfa43fUL, 0x3a9de42cUL, 0x78920d50UL, 0x5fcc9b6aUL, 0x7e466254UL, 0x8d13c2f6UL, 0xd8b8e890UL, 0x39f75e2eUL, 0xc3aff582UL, 0x5d80be9fUL, 0xd0937c69UL, 0xd52da96fUL, 0x2512b3cfUL, 0xac993bc8UL, 0x187da710UL, 0x9c636ee8UL, 0x3bbb7bdbUL, 0x267809cdUL, 0x5918f46eUL, 0x9ab701ecUL, 0x4f9aa883UL, 0x956e65e6UL, 0xffe67eaaUL, 0xbccf0821UL, 0x15e8e6efUL, 0xe79bd9baUL, 0x6f36ce4aUL, 0x9f09d4eaUL, 0xb07cd629UL, 0xa4b2af31UL, 0x3f23312aUL, 0xa59430c6UL, 0xa266c035UL, 0x4ebc3774UL, 0x82caa6fcUL, 0x90d0b0e0UL, 0xa7d81533UL, 0x04984af1UL, 0xecdaf741UL, 0xcd500e7fUL, 0x91f62f17UL, 0x4dd68d76UL, 0xefb04d43UL, 0xaa4d54ccUL, 0x9604dfe4UL, 0xd1b5e39eUL, 0x6a881b4cUL, 0x2c1fb8c1UL, 0x65517f46UL, 0x5eea049dUL, 0x8c355d01UL, 0x877473faUL, 0x0b412efbUL, 0x671d5ab3UL, 0xdbd25292UL, 0x105633e9UL, 0xd647136dUL, 0xd7618c9aUL, 0xa10c7a37UL, 0xf8148e59UL, 0x133c89ebUL, 0xa927eeceUL, 0x61c935b7UL, 0x1ce5ede1UL, 0x47b13c7aUL, 0xd2df599cUL, 0xf2733f55UL, 0x14ce7918UL, 0xc737bf73UL, 0xf7cdea53UL, 0xfdaa5b5fUL, 0x3d6f14dfUL, 0x44db8678UL, 0xaff381caUL, 0x68c43eb9UL, 0x24342c38UL, 0xa3405fc2UL, 0x1dc37216UL, 0xe2250cbcUL, 0x3c498b28UL, 0x0d9541ffUL, 0xa8017139UL, 0x0cb3de08UL, 0xb4e49cd8UL, 0x56c19064UL, 0xcb84617bUL, 0x32b670d5UL, 0x6c5c7448UL, 0xb85742d0UL, }; static const ulong32 Tks0[] = { 0x00000000UL, 0x0e090d0bUL, 0x1c121a16UL, 0x121b171dUL, 0x3824342cUL, 0x362d3927UL, 0x24362e3aUL, 0x2a3f2331UL, 0x70486858UL, 0x7e416553UL, 0x6c5a724eUL, 0x62537f45UL, 0x486c5c74UL, 0x4665517fUL, 0x547e4662UL, 0x5a774b69UL, 0xe090d0b0UL, 0xee99ddbbUL, 0xfc82caa6UL, 0xf28bc7adUL, 0xd8b4e49cUL, 0xd6bde997UL, 0xc4a6fe8aUL, 0xcaaff381UL, 0x90d8b8e8UL, 0x9ed1b5e3UL, 0x8ccaa2feUL, 0x82c3aff5UL, 0xa8fc8cc4UL, 0xa6f581cfUL, 0xb4ee96d2UL, 0xbae79bd9UL, 0xdb3bbb7bUL, 0xd532b670UL, 0xc729a16dUL, 0xc920ac66UL, 0xe31f8f57UL, 0xed16825cUL, 0xff0d9541UL, 0xf104984aUL, 0xab73d323UL, 0xa57ade28UL, 0xb761c935UL, 0xb968c43eUL, 0x9357e70fUL, 0x9d5eea04UL, 0x8f45fd19UL, 0x814cf012UL, 0x3bab6bcbUL, 0x35a266c0UL, 0x27b971ddUL, 0x29b07cd6UL, 0x038f5fe7UL, 0x0d8652ecUL, 0x1f9d45f1UL, 0x119448faUL, 0x4be30393UL, 0x45ea0e98UL, 0x57f11985UL, 0x59f8148eUL, 0x73c737bfUL, 0x7dce3ab4UL, 0x6fd52da9UL, 0x61dc20a2UL, 0xad766df6UL, 0xa37f60fdUL, 0xb16477e0UL, 0xbf6d7aebUL, 0x955259daUL, 0x9b5b54d1UL, 0x894043ccUL, 0x87494ec7UL, 0xdd3e05aeUL, 0xd33708a5UL, 0xc12c1fb8UL, 0xcf2512b3UL, 0xe51a3182UL, 0xeb133c89UL, 0xf9082b94UL, 0xf701269fUL, 0x4de6bd46UL, 0x43efb04dUL, 0x51f4a750UL, 0x5ffdaa5bUL, 0x75c2896aUL, 0x7bcb8461UL, 0x69d0937cUL, 0x67d99e77UL, 0x3daed51eUL, 0x33a7d815UL, 0x21bccf08UL, 0x2fb5c203UL, 0x058ae132UL, 0x0b83ec39UL, 0x1998fb24UL, 0x1791f62fUL, 0x764dd68dUL, 0x7844db86UL, 0x6a5fcc9bUL, 0x6456c190UL, 0x4e69e2a1UL, 0x4060efaaUL, 0x527bf8b7UL, 0x5c72f5bcUL, 0x0605bed5UL, 0x080cb3deUL, 0x1a17a4c3UL, 0x141ea9c8UL, 0x3e218af9UL, 0x302887f2UL, 0x223390efUL, 0x2c3a9de4UL, 0x96dd063dUL, 0x98d40b36UL, 0x8acf1c2bUL, 0x84c61120UL, 0xaef93211UL, 0xa0f03f1aUL, 0xb2eb2807UL, 0xbce2250cUL, 0xe6956e65UL, 0xe89c636eUL, 0xfa877473UL, 0xf48e7978UL, 0xdeb15a49UL, 0xd0b85742UL, 0xc2a3405fUL, 0xccaa4d54UL, 0x41ecdaf7UL, 0x4fe5d7fcUL, 0x5dfec0e1UL, 0x53f7cdeaUL, 0x79c8eedbUL, 0x77c1e3d0UL, 0x65daf4cdUL, 0x6bd3f9c6UL, 0x31a4b2afUL, 0x3fadbfa4UL, 0x2db6a8b9UL, 0x23bfa5b2UL, 0x09808683UL, 0x07898b88UL, 0x15929c95UL, 0x1b9b919eUL, 0xa17c0a47UL, 0xaf75074cUL, 0xbd6e1051UL, 0xb3671d5aUL, 0x99583e6bUL, 0x97513360UL, 0x854a247dUL, 0x8b432976UL, 0xd134621fUL, 0xdf3d6f14UL, 0xcd267809UL, 0xc32f7502UL, 0xe9105633UL, 0xe7195b38UL, 0xf5024c25UL, 0xfb0b412eUL, 0x9ad7618cUL, 0x94de6c87UL, 0x86c57b9aUL, 0x88cc7691UL, 0xa2f355a0UL, 0xacfa58abUL, 0xbee14fb6UL, 0xb0e842bdUL, 0xea9f09d4UL, 0xe49604dfUL, 0xf68d13c2UL, 0xf8841ec9UL, 0xd2bb3df8UL, 0xdcb230f3UL, 0xcea927eeUL, 0xc0a02ae5UL, 0x7a47b13cUL, 0x744ebc37UL, 0x6655ab2aUL, 0x685ca621UL, 0x42638510UL, 0x4c6a881bUL, 0x5e719f06UL, 0x5078920dUL, 0x0a0fd964UL, 0x0406d46fUL, 0x161dc372UL, 0x1814ce79UL, 0x322bed48UL, 0x3c22e043UL, 0x2e39f75eUL, 0x2030fa55UL, 0xec9ab701UL, 0xe293ba0aUL, 0xf088ad17UL, 0xfe81a01cUL, 0xd4be832dUL, 0xdab78e26UL, 0xc8ac993bUL, 0xc6a59430UL, 0x9cd2df59UL, 0x92dbd252UL, 0x80c0c54fUL, 0x8ec9c844UL, 0xa4f6eb75UL, 0xaaffe67eUL, 0xb8e4f163UL, 0xb6edfc68UL, 0x0c0a67b1UL, 0x02036abaUL, 0x10187da7UL, 0x1e1170acUL, 0x342e539dUL, 0x3a275e96UL, 0x283c498bUL, 0x26354480UL, 0x7c420fe9UL, 0x724b02e2UL, 0x605015ffUL, 0x6e5918f4UL, 0x44663bc5UL, 0x4a6f36ceUL, 0x587421d3UL, 0x567d2cd8UL, 0x37a10c7aUL, 0x39a80171UL, 0x2bb3166cUL, 0x25ba1b67UL, 0x0f853856UL, 0x018c355dUL, 0x13972240UL, 0x1d9e2f4bUL, 0x47e96422UL, 0x49e06929UL, 0x5bfb7e34UL, 0x55f2733fUL, 0x7fcd500eUL, 0x71c45d05UL, 0x63df4a18UL, 0x6dd64713UL, 0xd731dccaUL, 0xd938d1c1UL, 0xcb23c6dcUL, 0xc52acbd7UL, 0xef15e8e6UL, 0xe11ce5edUL, 0xf307f2f0UL, 0xfd0efffbUL, 0xa779b492UL, 0xa970b999UL, 0xbb6bae84UL, 0xb562a38fUL, 0x9f5d80beUL, 0x91548db5UL, 0x834f9aa8UL, 0x8d4697a3UL }; static const ulong32 Tks1[] = { 0x00000000UL, 0x0b0e090dUL, 0x161c121aUL, 0x1d121b17UL, 0x2c382434UL, 0x27362d39UL, 0x3a24362eUL, 0x312a3f23UL, 0x58704868UL, 0x537e4165UL, 0x4e6c5a72UL, 0x4562537fUL, 0x74486c5cUL, 0x7f466551UL, 0x62547e46UL, 0x695a774bUL, 0xb0e090d0UL, 0xbbee99ddUL, 0xa6fc82caUL, 0xadf28bc7UL, 0x9cd8b4e4UL, 0x97d6bde9UL, 0x8ac4a6feUL, 0x81caaff3UL, 0xe890d8b8UL, 0xe39ed1b5UL, 0xfe8ccaa2UL, 0xf582c3afUL, 0xc4a8fc8cUL, 0xcfa6f581UL, 0xd2b4ee96UL, 0xd9bae79bUL, 0x7bdb3bbbUL, 0x70d532b6UL, 0x6dc729a1UL, 0x66c920acUL, 0x57e31f8fUL, 0x5ced1682UL, 0x41ff0d95UL, 0x4af10498UL, 0x23ab73d3UL, 0x28a57adeUL, 0x35b761c9UL, 0x3eb968c4UL, 0x0f9357e7UL, 0x049d5eeaUL, 0x198f45fdUL, 0x12814cf0UL, 0xcb3bab6bUL, 0xc035a266UL, 0xdd27b971UL, 0xd629b07cUL, 0xe7038f5fUL, 0xec0d8652UL, 0xf11f9d45UL, 0xfa119448UL, 0x934be303UL, 0x9845ea0eUL, 0x8557f119UL, 0x8e59f814UL, 0xbf73c737UL, 0xb47dce3aUL, 0xa96fd52dUL, 0xa261dc20UL, 0xf6ad766dUL, 0xfda37f60UL, 0xe0b16477UL, 0xebbf6d7aUL, 0xda955259UL, 0xd19b5b54UL, 0xcc894043UL, 0xc787494eUL, 0xaedd3e05UL, 0xa5d33708UL, 0xb8c12c1fUL, 0xb3cf2512UL, 0x82e51a31UL, 0x89eb133cUL, 0x94f9082bUL, 0x9ff70126UL, 0x464de6bdUL, 0x4d43efb0UL, 0x5051f4a7UL, 0x5b5ffdaaUL, 0x6a75c289UL, 0x617bcb84UL, 0x7c69d093UL, 0x7767d99eUL, 0x1e3daed5UL, 0x1533a7d8UL, 0x0821bccfUL, 0x032fb5c2UL, 0x32058ae1UL, 0x390b83ecUL, 0x241998fbUL, 0x2f1791f6UL, 0x8d764dd6UL, 0x867844dbUL, 0x9b6a5fccUL, 0x906456c1UL, 0xa14e69e2UL, 0xaa4060efUL, 0xb7527bf8UL, 0xbc5c72f5UL, 0xd50605beUL, 0xde080cb3UL, 0xc31a17a4UL, 0xc8141ea9UL, 0xf93e218aUL, 0xf2302887UL, 0xef223390UL, 0xe42c3a9dUL, 0x3d96dd06UL, 0x3698d40bUL, 0x2b8acf1cUL, 0x2084c611UL, 0x11aef932UL, 0x1aa0f03fUL, 0x07b2eb28UL, 0x0cbce225UL, 0x65e6956eUL, 0x6ee89c63UL, 0x73fa8774UL, 0x78f48e79UL, 0x49deb15aUL, 0x42d0b857UL, 0x5fc2a340UL, 0x54ccaa4dUL, 0xf741ecdaUL, 0xfc4fe5d7UL, 0xe15dfec0UL, 0xea53f7cdUL, 0xdb79c8eeUL, 0xd077c1e3UL, 0xcd65daf4UL, 0xc66bd3f9UL, 0xaf31a4b2UL, 0xa43fadbfUL, 0xb92db6a8UL, 0xb223bfa5UL, 0x83098086UL, 0x8807898bUL, 0x9515929cUL, 0x9e1b9b91UL, 0x47a17c0aUL, 0x4caf7507UL, 0x51bd6e10UL, 0x5ab3671dUL, 0x6b99583eUL, 0x60975133UL, 0x7d854a24UL, 0x768b4329UL, 0x1fd13462UL, 0x14df3d6fUL, 0x09cd2678UL, 0x02c32f75UL, 0x33e91056UL, 0x38e7195bUL, 0x25f5024cUL, 0x2efb0b41UL, 0x8c9ad761UL, 0x8794de6cUL, 0x9a86c57bUL, 0x9188cc76UL, 0xa0a2f355UL, 0xabacfa58UL, 0xb6bee14fUL, 0xbdb0e842UL, 0xd4ea9f09UL, 0xdfe49604UL, 0xc2f68d13UL, 0xc9f8841eUL, 0xf8d2bb3dUL, 0xf3dcb230UL, 0xeecea927UL, 0xe5c0a02aUL, 0x3c7a47b1UL, 0x37744ebcUL, 0x2a6655abUL, 0x21685ca6UL, 0x10426385UL, 0x1b4c6a88UL, 0x065e719fUL, 0x0d507892UL, 0x640a0fd9UL, 0x6f0406d4UL, 0x72161dc3UL, 0x791814ceUL, 0x48322bedUL, 0x433c22e0UL, 0x5e2e39f7UL, 0x552030faUL, 0x01ec9ab7UL, 0x0ae293baUL, 0x17f088adUL, 0x1cfe81a0UL, 0x2dd4be83UL, 0x26dab78eUL, 0x3bc8ac99UL, 0x30c6a594UL, 0x599cd2dfUL, 0x5292dbd2UL, 0x4f80c0c5UL, 0x448ec9c8UL, 0x75a4f6ebUL, 0x7eaaffe6UL, 0x63b8e4f1UL, 0x68b6edfcUL, 0xb10c0a67UL, 0xba02036aUL, 0xa710187dUL, 0xac1e1170UL, 0x9d342e53UL, 0x963a275eUL, 0x8b283c49UL, 0x80263544UL, 0xe97c420fUL, 0xe2724b02UL, 0xff605015UL, 0xf46e5918UL, 0xc544663bUL, 0xce4a6f36UL, 0xd3587421UL, 0xd8567d2cUL, 0x7a37a10cUL, 0x7139a801UL, 0x6c2bb316UL, 0x6725ba1bUL, 0x560f8538UL, 0x5d018c35UL, 0x40139722UL, 0x4b1d9e2fUL, 0x2247e964UL, 0x2949e069UL, 0x345bfb7eUL, 0x3f55f273UL, 0x0e7fcd50UL, 0x0571c45dUL, 0x1863df4aUL, 0x136dd647UL, 0xcad731dcUL, 0xc1d938d1UL, 0xdccb23c6UL, 0xd7c52acbUL, 0xe6ef15e8UL, 0xede11ce5UL, 0xf0f307f2UL, 0xfbfd0effUL, 0x92a779b4UL, 0x99a970b9UL, 0x84bb6baeUL, 0x8fb562a3UL, 0xbe9f5d80UL, 0xb591548dUL, 0xa8834f9aUL, 0xa38d4697UL }; static const ulong32 Tks2[] = { 0x00000000UL, 0x0d0b0e09UL, 0x1a161c12UL, 0x171d121bUL, 0x342c3824UL, 0x3927362dUL, 0x2e3a2436UL, 0x23312a3fUL, 0x68587048UL, 0x65537e41UL, 0x724e6c5aUL, 0x7f456253UL, 0x5c74486cUL, 0x517f4665UL, 0x4662547eUL, 0x4b695a77UL, 0xd0b0e090UL, 0xddbbee99UL, 0xcaa6fc82UL, 0xc7adf28bUL, 0xe49cd8b4UL, 0xe997d6bdUL, 0xfe8ac4a6UL, 0xf381caafUL, 0xb8e890d8UL, 0xb5e39ed1UL, 0xa2fe8ccaUL, 0xaff582c3UL, 0x8cc4a8fcUL, 0x81cfa6f5UL, 0x96d2b4eeUL, 0x9bd9bae7UL, 0xbb7bdb3bUL, 0xb670d532UL, 0xa16dc729UL, 0xac66c920UL, 0x8f57e31fUL, 0x825ced16UL, 0x9541ff0dUL, 0x984af104UL, 0xd323ab73UL, 0xde28a57aUL, 0xc935b761UL, 0xc43eb968UL, 0xe70f9357UL, 0xea049d5eUL, 0xfd198f45UL, 0xf012814cUL, 0x6bcb3babUL, 0x66c035a2UL, 0x71dd27b9UL, 0x7cd629b0UL, 0x5fe7038fUL, 0x52ec0d86UL, 0x45f11f9dUL, 0x48fa1194UL, 0x03934be3UL, 0x0e9845eaUL, 0x198557f1UL, 0x148e59f8UL, 0x37bf73c7UL, 0x3ab47dceUL, 0x2da96fd5UL, 0x20a261dcUL, 0x6df6ad76UL, 0x60fda37fUL, 0x77e0b164UL, 0x7aebbf6dUL, 0x59da9552UL, 0x54d19b5bUL, 0x43cc8940UL, 0x4ec78749UL, 0x05aedd3eUL, 0x08a5d337UL, 0x1fb8c12cUL, 0x12b3cf25UL, 0x3182e51aUL, 0x3c89eb13UL, 0x2b94f908UL, 0x269ff701UL, 0xbd464de6UL, 0xb04d43efUL, 0xa75051f4UL, 0xaa5b5ffdUL, 0x896a75c2UL, 0x84617bcbUL, 0x937c69d0UL, 0x9e7767d9UL, 0xd51e3daeUL, 0xd81533a7UL, 0xcf0821bcUL, 0xc2032fb5UL, 0xe132058aUL, 0xec390b83UL, 0xfb241998UL, 0xf62f1791UL, 0xd68d764dUL, 0xdb867844UL, 0xcc9b6a5fUL, 0xc1906456UL, 0xe2a14e69UL, 0xefaa4060UL, 0xf8b7527bUL, 0xf5bc5c72UL, 0xbed50605UL, 0xb3de080cUL, 0xa4c31a17UL, 0xa9c8141eUL, 0x8af93e21UL, 0x87f23028UL, 0x90ef2233UL, 0x9de42c3aUL, 0x063d96ddUL, 0x0b3698d4UL, 0x1c2b8acfUL, 0x112084c6UL, 0x3211aef9UL, 0x3f1aa0f0UL, 0x2807b2ebUL, 0x250cbce2UL, 0x6e65e695UL, 0x636ee89cUL, 0x7473fa87UL, 0x7978f48eUL, 0x5a49deb1UL, 0x5742d0b8UL, 0x405fc2a3UL, 0x4d54ccaaUL, 0xdaf741ecUL, 0xd7fc4fe5UL, 0xc0e15dfeUL, 0xcdea53f7UL, 0xeedb79c8UL, 0xe3d077c1UL, 0xf4cd65daUL, 0xf9c66bd3UL, 0xb2af31a4UL, 0xbfa43fadUL, 0xa8b92db6UL, 0xa5b223bfUL, 0x86830980UL, 0x8b880789UL, 0x9c951592UL, 0x919e1b9bUL, 0x0a47a17cUL, 0x074caf75UL, 0x1051bd6eUL, 0x1d5ab367UL, 0x3e6b9958UL, 0x33609751UL, 0x247d854aUL, 0x29768b43UL, 0x621fd134UL, 0x6f14df3dUL, 0x7809cd26UL, 0x7502c32fUL, 0x5633e910UL, 0x5b38e719UL, 0x4c25f502UL, 0x412efb0bUL, 0x618c9ad7UL, 0x6c8794deUL, 0x7b9a86c5UL, 0x769188ccUL, 0x55a0a2f3UL, 0x58abacfaUL, 0x4fb6bee1UL, 0x42bdb0e8UL, 0x09d4ea9fUL, 0x04dfe496UL, 0x13c2f68dUL, 0x1ec9f884UL, 0x3df8d2bbUL, 0x30f3dcb2UL, 0x27eecea9UL, 0x2ae5c0a0UL, 0xb13c7a47UL, 0xbc37744eUL, 0xab2a6655UL, 0xa621685cUL, 0x85104263UL, 0x881b4c6aUL, 0x9f065e71UL, 0x920d5078UL, 0xd9640a0fUL, 0xd46f0406UL, 0xc372161dUL, 0xce791814UL, 0xed48322bUL, 0xe0433c22UL, 0xf75e2e39UL, 0xfa552030UL, 0xb701ec9aUL, 0xba0ae293UL, 0xad17f088UL, 0xa01cfe81UL, 0x832dd4beUL, 0x8e26dab7UL, 0x993bc8acUL, 0x9430c6a5UL, 0xdf599cd2UL, 0xd25292dbUL, 0xc54f80c0UL, 0xc8448ec9UL, 0xeb75a4f6UL, 0xe67eaaffUL, 0xf163b8e4UL, 0xfc68b6edUL, 0x67b10c0aUL, 0x6aba0203UL, 0x7da71018UL, 0x70ac1e11UL, 0x539d342eUL, 0x5e963a27UL, 0x498b283cUL, 0x44802635UL, 0x0fe97c42UL, 0x02e2724bUL, 0x15ff6050UL, 0x18f46e59UL, 0x3bc54466UL, 0x36ce4a6fUL, 0x21d35874UL, 0x2cd8567dUL, 0x0c7a37a1UL, 0x017139a8UL, 0x166c2bb3UL, 0x1b6725baUL, 0x38560f85UL, 0x355d018cUL, 0x22401397UL, 0x2f4b1d9eUL, 0x642247e9UL, 0x692949e0UL, 0x7e345bfbUL, 0x733f55f2UL, 0x500e7fcdUL, 0x5d0571c4UL, 0x4a1863dfUL, 0x47136dd6UL, 0xdccad731UL, 0xd1c1d938UL, 0xc6dccb23UL, 0xcbd7c52aUL, 0xe8e6ef15UL, 0xe5ede11cUL, 0xf2f0f307UL, 0xfffbfd0eUL, 0xb492a779UL, 0xb999a970UL, 0xae84bb6bUL, 0xa38fb562UL, 0x80be9f5dUL, 0x8db59154UL, 0x9aa8834fUL, 0x97a38d46UL }; static const ulong32 Tks3[] = { 0x00000000UL, 0x090d0b0eUL, 0x121a161cUL, 0x1b171d12UL, 0x24342c38UL, 0x2d392736UL, 0x362e3a24UL, 0x3f23312aUL, 0x48685870UL, 0x4165537eUL, 0x5a724e6cUL, 0x537f4562UL, 0x6c5c7448UL, 0x65517f46UL, 0x7e466254UL, 0x774b695aUL, 0x90d0b0e0UL, 0x99ddbbeeUL, 0x82caa6fcUL, 0x8bc7adf2UL, 0xb4e49cd8UL, 0xbde997d6UL, 0xa6fe8ac4UL, 0xaff381caUL, 0xd8b8e890UL, 0xd1b5e39eUL, 0xcaa2fe8cUL, 0xc3aff582UL, 0xfc8cc4a8UL, 0xf581cfa6UL, 0xee96d2b4UL, 0xe79bd9baUL, 0x3bbb7bdbUL, 0x32b670d5UL, 0x29a16dc7UL, 0x20ac66c9UL, 0x1f8f57e3UL, 0x16825cedUL, 0x0d9541ffUL, 0x04984af1UL, 0x73d323abUL, 0x7ade28a5UL, 0x61c935b7UL, 0x68c43eb9UL, 0x57e70f93UL, 0x5eea049dUL, 0x45fd198fUL, 0x4cf01281UL, 0xab6bcb3bUL, 0xa266c035UL, 0xb971dd27UL, 0xb07cd629UL, 0x8f5fe703UL, 0x8652ec0dUL, 0x9d45f11fUL, 0x9448fa11UL, 0xe303934bUL, 0xea0e9845UL, 0xf1198557UL, 0xf8148e59UL, 0xc737bf73UL, 0xce3ab47dUL, 0xd52da96fUL, 0xdc20a261UL, 0x766df6adUL, 0x7f60fda3UL, 0x6477e0b1UL, 0x6d7aebbfUL, 0x5259da95UL, 0x5b54d19bUL, 0x4043cc89UL, 0x494ec787UL, 0x3e05aeddUL, 0x3708a5d3UL, 0x2c1fb8c1UL, 0x2512b3cfUL, 0x1a3182e5UL, 0x133c89ebUL, 0x082b94f9UL, 0x01269ff7UL, 0xe6bd464dUL, 0xefb04d43UL, 0xf4a75051UL, 0xfdaa5b5fUL, 0xc2896a75UL, 0xcb84617bUL, 0xd0937c69UL, 0xd99e7767UL, 0xaed51e3dUL, 0xa7d81533UL, 0xbccf0821UL, 0xb5c2032fUL, 0x8ae13205UL, 0x83ec390bUL, 0x98fb2419UL, 0x91f62f17UL, 0x4dd68d76UL, 0x44db8678UL, 0x5fcc9b6aUL, 0x56c19064UL, 0x69e2a14eUL, 0x60efaa40UL, 0x7bf8b752UL, 0x72f5bc5cUL, 0x05bed506UL, 0x0cb3de08UL, 0x17a4c31aUL, 0x1ea9c814UL, 0x218af93eUL, 0x2887f230UL, 0x3390ef22UL, 0x3a9de42cUL, 0xdd063d96UL, 0xd40b3698UL, 0xcf1c2b8aUL, 0xc6112084UL, 0xf93211aeUL, 0xf03f1aa0UL, 0xeb2807b2UL, 0xe2250cbcUL, 0x956e65e6UL, 0x9c636ee8UL, 0x877473faUL, 0x8e7978f4UL, 0xb15a49deUL, 0xb85742d0UL, 0xa3405fc2UL, 0xaa4d54ccUL, 0xecdaf741UL, 0xe5d7fc4fUL, 0xfec0e15dUL, 0xf7cdea53UL, 0xc8eedb79UL, 0xc1e3d077UL, 0xdaf4cd65UL, 0xd3f9c66bUL, 0xa4b2af31UL, 0xadbfa43fUL, 0xb6a8b92dUL, 0xbfa5b223UL, 0x80868309UL, 0x898b8807UL, 0x929c9515UL, 0x9b919e1bUL, 0x7c0a47a1UL, 0x75074cafUL, 0x6e1051bdUL, 0x671d5ab3UL, 0x583e6b99UL, 0x51336097UL, 0x4a247d85UL, 0x4329768bUL, 0x34621fd1UL, 0x3d6f14dfUL, 0x267809cdUL, 0x2f7502c3UL, 0x105633e9UL, 0x195b38e7UL, 0x024c25f5UL, 0x0b412efbUL, 0xd7618c9aUL, 0xde6c8794UL, 0xc57b9a86UL, 0xcc769188UL, 0xf355a0a2UL, 0xfa58abacUL, 0xe14fb6beUL, 0xe842bdb0UL, 0x9f09d4eaUL, 0x9604dfe4UL, 0x8d13c2f6UL, 0x841ec9f8UL, 0xbb3df8d2UL, 0xb230f3dcUL, 0xa927eeceUL, 0xa02ae5c0UL, 0x47b13c7aUL, 0x4ebc3774UL, 0x55ab2a66UL, 0x5ca62168UL, 0x63851042UL, 0x6a881b4cUL, 0x719f065eUL, 0x78920d50UL, 0x0fd9640aUL, 0x06d46f04UL, 0x1dc37216UL, 0x14ce7918UL, 0x2bed4832UL, 0x22e0433cUL, 0x39f75e2eUL, 0x30fa5520UL, 0x9ab701ecUL, 0x93ba0ae2UL, 0x88ad17f0UL, 0x81a01cfeUL, 0xbe832dd4UL, 0xb78e26daUL, 0xac993bc8UL, 0xa59430c6UL, 0xd2df599cUL, 0xdbd25292UL, 0xc0c54f80UL, 0xc9c8448eUL, 0xf6eb75a4UL, 0xffe67eaaUL, 0xe4f163b8UL, 0xedfc68b6UL, 0x0a67b10cUL, 0x036aba02UL, 0x187da710UL, 0x1170ac1eUL, 0x2e539d34UL, 0x275e963aUL, 0x3c498b28UL, 0x35448026UL, 0x420fe97cUL, 0x4b02e272UL, 0x5015ff60UL, 0x5918f46eUL, 0x663bc544UL, 0x6f36ce4aUL, 0x7421d358UL, 0x7d2cd856UL, 0xa10c7a37UL, 0xa8017139UL, 0xb3166c2bUL, 0xba1b6725UL, 0x8538560fUL, 0x8c355d01UL, 0x97224013UL, 0x9e2f4b1dUL, 0xe9642247UL, 0xe0692949UL, 0xfb7e345bUL, 0xf2733f55UL, 0xcd500e7fUL, 0xc45d0571UL, 0xdf4a1863UL, 0xd647136dUL, 0x31dccad7UL, 0x38d1c1d9UL, 0x23c6dccbUL, 0x2acbd7c5UL, 0x15e8e6efUL, 0x1ce5ede1UL, 0x07f2f0f3UL, 0x0efffbfdUL, 0x79b492a7UL, 0x70b999a9UL, 0x6bae84bbUL, 0x62a38fb5UL, 0x5d80be9fUL, 0x548db591UL, 0x4f9aa883UL, 0x4697a38dUL }; #endif /* ENCRYPT_ONLY */ #endif /* SMALL CODE */ static const ulong32 rcon[] = { 0x01000000UL, 0x02000000UL, 0x04000000UL, 0x08000000UL, 0x10000000UL, 0x20000000UL, 0x40000000UL, 0x80000000UL, 0x1B000000UL, 0x36000000UL, /* for 128-bit blocks, Rijndael never uses more than 10 rcon values */ }; #endif /* __LTC_AES_TAB_C__ */ /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* AES implementation by Tom St Denis * * Derived from the Public Domain source code by --- * rijndael-alg-fst.c * * @version 3.0 (December 2000) * * Optimised ANSI C code for the Rijndael cipher (now AES) * * @author Vincent Rijmen * @author Antoon Bosselaers * @author Paulo Barreto --- */ /** @file aes.c Implementation of AES */ #ifdef LTC_RIJNDAEL #ifndef ENCRYPT_ONLY #define SETUP rijndael_setup #define ECB_ENC rijndael_ecb_encrypt #define ECB_DEC rijndael_ecb_decrypt #define ECB_DONE rijndael_done #define ECB_TEST rijndael_test #define ECB_KS rijndael_keysize const struct ltc_cipher_descriptor rijndael_desc = { "rijndael", 6, 16, 32, 16, 10, SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS, // NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; const struct ltc_cipher_descriptor aes_desc = { "aes", 6, 16, 32, 16, 10, SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS, // NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; #else #define SETUP rijndael_enc_setup #define ECB_ENC rijndael_enc_ecb_encrypt #define ECB_KS rijndael_enc_keysize #define ECB_DONE rijndael_enc_done const struct ltc_cipher_descriptor rijndael_enc_desc = { "rijndael", 6, 16, 32, 16, 10, SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS, // NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; const struct ltc_cipher_descriptor aes_enc_desc = { "aes", 6, 16, 32, 16, 10, SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS, // NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; #endif #define __LTC_AES_TAB_C__ static ulong32 setup_mix(ulong32 temp) { return (Te4_3[byte(temp, 2)]) ^ (Te4_2[byte(temp, 1)]) ^ (Te4_1[byte(temp, 0)]) ^ (Te4_0[byte(temp, 3)]); } #ifndef ENCRYPT_ONLY #ifdef LTC_SMALL_CODE static ulong32 setup_mix2(ulong32 temp) { return Td0(255 & Te4[byte(temp, 3)]) ^ Td1(255 & Te4[byte(temp, 2)]) ^ Td2(255 & Te4[byte(temp, 1)]) ^ Td3(255 & Te4[byte(temp, 0)]); } #endif #endif /** Initialize the AES (Rijndael) block cipher @param key The symmetric key you wish to pass @param keylen The key length in bytes @param num_rounds The number of rounds desired (0 for default) @param skey The key in as scheduled by this function. @return CRYPT_OK if successful */ int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) { int i; ulong32 temp, *rk; #ifndef ENCRYPT_ONLY ulong32 *rrk; #endif LTC_ARGCHK(key != NULL); LTC_ARGCHK(skey != NULL); if (keylen != 16 && keylen != 24 && keylen != 32) { return CRYPT_INVALID_KEYSIZE; } if (num_rounds != 0 && num_rounds != (10 + ((keylen/8)-2)*2)) { return CRYPT_INVALID_ROUNDS; } skey->rijndael.Nr = 10 + ((keylen/8)-2)*2; /* setup the forward key */ i = 0; rk = skey->rijndael.eK; LOAD32H(rk[0], key ); LOAD32H(rk[1], key + 4); LOAD32H(rk[2], key + 8); LOAD32H(rk[3], key + 12); if (keylen == 16) { for (;;) { temp = rk[3]; rk[4] = rk[0] ^ setup_mix(temp) ^ rcon[i]; rk[5] = rk[1] ^ rk[4]; rk[6] = rk[2] ^ rk[5]; rk[7] = rk[3] ^ rk[6]; if (++i == 10) { break; } rk += 4; } } else if (keylen == 24) { LOAD32H(rk[4], key + 16); LOAD32H(rk[5], key + 20); for (;;) { #ifdef _MSC_VER temp = skey->rijndael.eK[rk - skey->rijndael.eK + 5]; #else temp = rk[5]; #endif rk[ 6] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; rk[ 7] = rk[ 1] ^ rk[ 6]; rk[ 8] = rk[ 2] ^ rk[ 7]; rk[ 9] = rk[ 3] ^ rk[ 8]; if (++i == 8) { break; } rk[10] = rk[ 4] ^ rk[ 9]; rk[11] = rk[ 5] ^ rk[10]; rk += 6; } } else if (keylen == 32) { LOAD32H(rk[4], key + 16); LOAD32H(rk[5], key + 20); LOAD32H(rk[6], key + 24); LOAD32H(rk[7], key + 28); for (;;) { #ifdef _MSC_VER temp = skey->rijndael.eK[rk - skey->rijndael.eK + 7]; #else temp = rk[7]; #endif rk[ 8] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; rk[ 9] = rk[ 1] ^ rk[ 8]; rk[10] = rk[ 2] ^ rk[ 9]; rk[11] = rk[ 3] ^ rk[10]; if (++i == 7) { break; } temp = rk[11]; rk[12] = rk[ 4] ^ setup_mix(RORc(temp, 8)); rk[13] = rk[ 5] ^ rk[12]; rk[14] = rk[ 6] ^ rk[13]; rk[15] = rk[ 7] ^ rk[14]; rk += 8; } } else { /* this can't happen */ /* coverity[dead_error_line] */ return CRYPT_ERROR; } #ifndef ENCRYPT_ONLY /* setup the inverse key now */ rk = skey->rijndael.dK; rrk = skey->rijndael.eK + (28 + keylen) - 4; /* apply the inverse MixColumn transform to all round keys but the first and the last: */ /* copy first */ *rk++ = *rrk++; *rk++ = *rrk++; *rk++ = *rrk++; *rk = *rrk; rk -= 3; rrk -= 3; for (i = 1; i < skey->rijndael.Nr; i++) { rrk -= 4; rk += 4; #ifdef LTC_SMALL_CODE temp = rrk[0]; rk[0] = setup_mix2(temp); temp = rrk[1]; rk[1] = setup_mix2(temp); temp = rrk[2]; rk[2] = setup_mix2(temp); temp = rrk[3]; rk[3] = setup_mix2(temp); #else temp = rrk[0]; rk[0] = Tks0[byte(temp, 3)] ^ Tks1[byte(temp, 2)] ^ Tks2[byte(temp, 1)] ^ Tks3[byte(temp, 0)]; temp = rrk[1]; rk[1] = Tks0[byte(temp, 3)] ^ Tks1[byte(temp, 2)] ^ Tks2[byte(temp, 1)] ^ Tks3[byte(temp, 0)]; temp = rrk[2]; rk[2] = Tks0[byte(temp, 3)] ^ Tks1[byte(temp, 2)] ^ Tks2[byte(temp, 1)] ^ Tks3[byte(temp, 0)]; temp = rrk[3]; rk[3] = Tks0[byte(temp, 3)] ^ Tks1[byte(temp, 2)] ^ Tks2[byte(temp, 1)] ^ Tks3[byte(temp, 0)]; #endif } /* copy last */ rrk -= 4; rk += 4; *rk++ = *rrk++; *rk++ = *rrk++; *rk++ = *rrk++; *rk = *rrk; #endif /* ENCRYPT_ONLY */ return CRYPT_OK; } /** Encrypts a block of text with AES @param pt The input plaintext (16 bytes) @param ct The output ciphertext (16 bytes) @param skey The key as scheduled @return CRYPT_OK if successful */ #ifdef LTC_CLEAN_STACK static int _rijndael_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) #else int ECB_ENC(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) #endif { ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk; int Nr, r; LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); LTC_ARGCHK(skey != NULL); Nr = skey->rijndael.Nr; rk = skey->rijndael.eK; /* * map byte array block to cipher state * and add initial round key: */ LOAD32H(s0, pt ); s0 ^= rk[0]; LOAD32H(s1, pt + 4); s1 ^= rk[1]; LOAD32H(s2, pt + 8); s2 ^= rk[2]; LOAD32H(s3, pt + 12); s3 ^= rk[3]; #ifdef LTC_SMALL_CODE for (r = 0; ; r++) { rk += 4; t0 = Te0(byte(s0, 3)) ^ Te1(byte(s1, 2)) ^ Te2(byte(s2, 1)) ^ Te3(byte(s3, 0)) ^ rk[0]; t1 = Te0(byte(s1, 3)) ^ Te1(byte(s2, 2)) ^ Te2(byte(s3, 1)) ^ Te3(byte(s0, 0)) ^ rk[1]; t2 = Te0(byte(s2, 3)) ^ Te1(byte(s3, 2)) ^ Te2(byte(s0, 1)) ^ Te3(byte(s1, 0)) ^ rk[2]; t3 = Te0(byte(s3, 3)) ^ Te1(byte(s0, 2)) ^ Te2(byte(s1, 1)) ^ Te3(byte(s2, 0)) ^ rk[3]; if (r == Nr-2) { break; } s0 = t0; s1 = t1; s2 = t2; s3 = t3; } rk += 4; #else /* * Nr - 1 full rounds: */ r = Nr >> 1; for (;;) { t0 = Te0(byte(s0, 3)) ^ Te1(byte(s1, 2)) ^ Te2(byte(s2, 1)) ^ Te3(byte(s3, 0)) ^ rk[4]; t1 = Te0(byte(s1, 3)) ^ Te1(byte(s2, 2)) ^ Te2(byte(s3, 1)) ^ Te3(byte(s0, 0)) ^ rk[5]; t2 = Te0(byte(s2, 3)) ^ Te1(byte(s3, 2)) ^ Te2(byte(s0, 1)) ^ Te3(byte(s1, 0)) ^ rk[6]; t3 = Te0(byte(s3, 3)) ^ Te1(byte(s0, 2)) ^ Te2(byte(s1, 1)) ^ Te3(byte(s2, 0)) ^ rk[7]; rk += 8; if (--r == 0) { break; } s0 = Te0(byte(t0, 3)) ^ Te1(byte(t1, 2)) ^ Te2(byte(t2, 1)) ^ Te3(byte(t3, 0)) ^ rk[0]; s1 = Te0(byte(t1, 3)) ^ Te1(byte(t2, 2)) ^ Te2(byte(t3, 1)) ^ Te3(byte(t0, 0)) ^ rk[1]; s2 = Te0(byte(t2, 3)) ^ Te1(byte(t3, 2)) ^ Te2(byte(t0, 1)) ^ Te3(byte(t1, 0)) ^ rk[2]; s3 = Te0(byte(t3, 3)) ^ Te1(byte(t0, 2)) ^ Te2(byte(t1, 1)) ^ Te3(byte(t2, 0)) ^ rk[3]; } #endif /* * apply last round and * map cipher state to byte array block: */ s0 = (Te4_3[byte(t0, 3)]) ^ (Te4_2[byte(t1, 2)]) ^ (Te4_1[byte(t2, 1)]) ^ (Te4_0[byte(t3, 0)]) ^ rk[0]; STORE32H(s0, ct); s1 = (Te4_3[byte(t1, 3)]) ^ (Te4_2[byte(t2, 2)]) ^ (Te4_1[byte(t3, 1)]) ^ (Te4_0[byte(t0, 0)]) ^ rk[1]; STORE32H(s1, ct+4); s2 = (Te4_3[byte(t2, 3)]) ^ (Te4_2[byte(t3, 2)]) ^ (Te4_1[byte(t0, 1)]) ^ (Te4_0[byte(t1, 0)]) ^ rk[2]; STORE32H(s2, ct+8); s3 = (Te4_3[byte(t3, 3)]) ^ (Te4_2[byte(t0, 2)]) ^ (Te4_1[byte(t1, 1)]) ^ (Te4_0[byte(t2, 0)]) ^ rk[3]; STORE32H(s3, ct+12); return CRYPT_OK; } #ifdef LTC_CLEAN_STACK int ECB_ENC(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) { int err = _rijndael_ecb_encrypt(pt, ct, skey); burn_stack(sizeof(unsigned long)*8 + sizeof(unsigned long*) + sizeof(int)*2); return err; } #endif #ifndef ENCRYPT_ONLY /** Decrypts a block of text with AES @param ct The input ciphertext (16 bytes) @param pt The output plaintext (16 bytes) @param skey The key as scheduled @return CRYPT_OK if successful */ #ifdef LTC_CLEAN_STACK static int _rijndael_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) #else int ECB_DEC(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) #endif { ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk; int Nr, r; LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); LTC_ARGCHK(skey != NULL); Nr = skey->rijndael.Nr; rk = skey->rijndael.dK; /* * map byte array block to cipher state * and add initial round key: */ LOAD32H(s0, ct ); s0 ^= rk[0]; LOAD32H(s1, ct + 4); s1 ^= rk[1]; LOAD32H(s2, ct + 8); s2 ^= rk[2]; LOAD32H(s3, ct + 12); s3 ^= rk[3]; #ifdef LTC_SMALL_CODE for (r = 0; ; r++) { rk += 4; t0 = Td0(byte(s0, 3)) ^ Td1(byte(s3, 2)) ^ Td2(byte(s2, 1)) ^ Td3(byte(s1, 0)) ^ rk[0]; t1 = Td0(byte(s1, 3)) ^ Td1(byte(s0, 2)) ^ Td2(byte(s3, 1)) ^ Td3(byte(s2, 0)) ^ rk[1]; t2 = Td0(byte(s2, 3)) ^ Td1(byte(s1, 2)) ^ Td2(byte(s0, 1)) ^ Td3(byte(s3, 0)) ^ rk[2]; t3 = Td0(byte(s3, 3)) ^ Td1(byte(s2, 2)) ^ Td2(byte(s1, 1)) ^ Td3(byte(s0, 0)) ^ rk[3]; if (r == Nr-2) { break; } s0 = t0; s1 = t1; s2 = t2; s3 = t3; } rk += 4; #else /* * Nr - 1 full rounds: */ r = Nr >> 1; for (;;) { t0 = Td0(byte(s0, 3)) ^ Td1(byte(s3, 2)) ^ Td2(byte(s2, 1)) ^ Td3(byte(s1, 0)) ^ rk[4]; t1 = Td0(byte(s1, 3)) ^ Td1(byte(s0, 2)) ^ Td2(byte(s3, 1)) ^ Td3(byte(s2, 0)) ^ rk[5]; t2 = Td0(byte(s2, 3)) ^ Td1(byte(s1, 2)) ^ Td2(byte(s0, 1)) ^ Td3(byte(s3, 0)) ^ rk[6]; t3 = Td0(byte(s3, 3)) ^ Td1(byte(s2, 2)) ^ Td2(byte(s1, 1)) ^ Td3(byte(s0, 0)) ^ rk[7]; rk += 8; if (--r == 0) { break; } s0 = Td0(byte(t0, 3)) ^ Td1(byte(t3, 2)) ^ Td2(byte(t2, 1)) ^ Td3(byte(t1, 0)) ^ rk[0]; s1 = Td0(byte(t1, 3)) ^ Td1(byte(t0, 2)) ^ Td2(byte(t3, 1)) ^ Td3(byte(t2, 0)) ^ rk[1]; s2 = Td0(byte(t2, 3)) ^ Td1(byte(t1, 2)) ^ Td2(byte(t0, 1)) ^ Td3(byte(t3, 0)) ^ rk[2]; s3 = Td0(byte(t3, 3)) ^ Td1(byte(t2, 2)) ^ Td2(byte(t1, 1)) ^ Td3(byte(t0, 0)) ^ rk[3]; } #endif /* * apply last round and * map cipher state to byte array block: */ s0 = (Td4[byte(t0, 3)] & 0xff000000) ^ (Td4[byte(t3, 2)] & 0x00ff0000) ^ (Td4[byte(t2, 1)] & 0x0000ff00) ^ (Td4[byte(t1, 0)] & 0x000000ff) ^ rk[0]; STORE32H(s0, pt); s1 = (Td4[byte(t1, 3)] & 0xff000000) ^ (Td4[byte(t0, 2)] & 0x00ff0000) ^ (Td4[byte(t3, 1)] & 0x0000ff00) ^ (Td4[byte(t2, 0)] & 0x000000ff) ^ rk[1]; STORE32H(s1, pt+4); s2 = (Td4[byte(t2, 3)] & 0xff000000) ^ (Td4[byte(t1, 2)] & 0x00ff0000) ^ (Td4[byte(t0, 1)] & 0x0000ff00) ^ (Td4[byte(t3, 0)] & 0x000000ff) ^ rk[2]; STORE32H(s2, pt+8); s3 = (Td4[byte(t3, 3)] & 0xff000000) ^ (Td4[byte(t2, 2)] & 0x00ff0000) ^ (Td4[byte(t1, 1)] & 0x0000ff00) ^ (Td4[byte(t0, 0)] & 0x000000ff) ^ rk[3]; STORE32H(s3, pt+12); return CRYPT_OK; } #ifdef LTC_CLEAN_STACK int ECB_DEC(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) { int err = _rijndael_ecb_decrypt(ct, pt, skey); burn_stack(sizeof(unsigned long)*8 + sizeof(unsigned long*) + sizeof(int)*2); return err; } #endif /** Performs a self-test of the AES block cipher @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled */ int ECB_TEST(void) { #ifndef LTC_TEST return CRYPT_NOP; #else int err; static const struct { int keylen; unsigned char key[32], pt[16], ct[16]; } tests[] = { { 16, { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77, 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff }, { 0x69, 0xc4, 0xe0, 0xd8, 0x6a, 0x7b, 0x04, 0x30, 0xd8, 0xcd, 0xb7, 0x80, 0x70, 0xb4, 0xc5, 0x5a } }, { 24, { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17 }, { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77, 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff }, { 0xdd, 0xa9, 0x7c, 0xa4, 0x86, 0x4c, 0xdf, 0xe0, 0x6e, 0xaf, 0x70, 0xa0, 0xec, 0x0d, 0x71, 0x91 } }, { 32, { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }, { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77, 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff }, { 0x8e, 0xa2, 0xb7, 0xca, 0x51, 0x67, 0x45, 0xbf, 0xea, 0xfc, 0x49, 0x90, 0x4b, 0x49, 0x60, 0x89 } } }; symmetric_key key; unsigned char tmp[2][16]; int i, y; for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { zeromem(&key, sizeof(key)); if ((err = rijndael_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { return err; } rijndael_ecb_encrypt(tests[i].pt, tmp[0], &key); rijndael_ecb_decrypt(tmp[0], tmp[1], &key); if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) { #if 0 printf("\n\nTest %d failed\n", i); if (XMEMCMP(tmp[0], tests[i].ct, 16)) { printf("CT: "); for (i = 0; i < 16; i++) { printf("%02x ", tmp[0][i]); } printf("\n"); } else { printf("PT: "); for (i = 0; i < 16; i++) { printf("%02x ", tmp[1][i]); } printf("\n"); } #endif return CRYPT_FAIL_TESTVECTOR; } /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ for (y = 0; y < 16; y++) tmp[0][y] = 0; for (y = 0; y < 1000; y++) rijndael_ecb_encrypt(tmp[0], tmp[0], &key); for (y = 0; y < 1000; y++) rijndael_ecb_decrypt(tmp[0], tmp[0], &key); for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; } return CRYPT_OK; #endif } #endif /* ENCRYPT_ONLY */ /** Terminate the context @param skey The scheduled key */ void ECB_DONE(symmetric_key *skey) { //LTC_UNUSED_PARAM(skey); } /** Gets suitable key size @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. @return CRYPT_OK if the input key size is acceptable. */ int ECB_KS(int *keysize) { LTC_ARGCHK(keysize != NULL); if (*keysize < 16) return CRYPT_INVALID_KEYSIZE; if (*keysize < 24) { *keysize = 16; return CRYPT_OK; } else if (*keysize < 32) { *keysize = 24; return CRYPT_OK; } else { *keysize = 32; return CRYPT_OK; } } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file cbc_decrypt.c CBC implementation, encrypt block, Tom St Denis */ #ifdef LTC_CBC_MODE /** CBC decrypt @param ct Ciphertext @param pt [out] Plaintext @param len The number of bytes to process (must be multiple of block length) @param cbc CBC state @return CRYPT_OK if successful */ int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CBC *cbc) { int x, err; unsigned char tmp[16]; #ifdef LTC_FAST LTC_FAST_TYPE tmpy; #else unsigned char tmpy; #endif LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); LTC_ARGCHK(cbc != NULL); if ((err = cipher_is_valid(cbc->cipher)) != CRYPT_OK) { return err; } /* is blocklen valid? */ if (cbc->blocklen < 1 || cbc->blocklen > (int)sizeof(cbc->IV)) { return CRYPT_INVALID_ARG; } if (len % cbc->blocklen) { return CRYPT_INVALID_ARG; } #ifdef LTC_FAST if (cbc->blocklen % sizeof(LTC_FAST_TYPE)) { return CRYPT_INVALID_ARG; } #endif if (cipher_descriptor[cbc->cipher].accel_cbc_decrypt != NULL) { return cipher_descriptor[cbc->cipher].accel_cbc_decrypt(ct, pt, len / cbc->blocklen, cbc->IV, &cbc->key); } else { while (len) { /* decrypt */ if ((err = cipher_descriptor[cbc->cipher].ecb_decrypt(ct, tmp, &cbc->key)) != CRYPT_OK) { return err; } /* xor IV against plaintext */ #if defined(LTC_FAST) for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { tmpy = *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) ^ *((LTC_FAST_TYPE*)((unsigned char *)tmp + x)); *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) = *((LTC_FAST_TYPE*)((unsigned char *)ct + x)); *((LTC_FAST_TYPE*)((unsigned char *)pt + x)) = tmpy; } #else for (x = 0; x < cbc->blocklen; x++) { tmpy = tmp[x] ^ cbc->IV[x]; cbc->IV[x] = ct[x]; pt[x] = tmpy; } #endif ct += cbc->blocklen; pt += cbc->blocklen; len -= cbc->blocklen; } } return CRYPT_OK; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file cbc_done.c CBC implementation, finish chain, Tom St Denis */ #ifdef LTC_CBC_MODE /** Terminate the chain @param cbc The CBC chain to terminate @return CRYPT_OK on success */ int cbc_done(symmetric_CBC *cbc) { int err; LTC_ARGCHK(cbc != NULL); if ((err = cipher_is_valid(cbc->cipher)) != CRYPT_OK) { return err; } cipher_descriptor[cbc->cipher].done(&cbc->key); return CRYPT_OK; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file cbc_encrypt.c CBC implementation, encrypt block, Tom St Denis */ #ifdef LTC_CBC_MODE /** CBC encrypt @param pt Plaintext @param ct [out] Ciphertext @param len The number of bytes to process (must be multiple of block length) @param cbc CBC state @return CRYPT_OK if successful */ int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CBC *cbc) { int x, err; LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); LTC_ARGCHK(cbc != NULL); if ((err = cipher_is_valid(cbc->cipher)) != CRYPT_OK) { return err; } /* is blocklen valid? */ if (cbc->blocklen < 1 || cbc->blocklen > (int)sizeof(cbc->IV)) { return CRYPT_INVALID_ARG; } if (len % cbc->blocklen) { return CRYPT_INVALID_ARG; } #ifdef LTC_FAST if (cbc->blocklen % sizeof(LTC_FAST_TYPE)) { return CRYPT_INVALID_ARG; } #endif if (cipher_descriptor[cbc->cipher].accel_cbc_encrypt != NULL) { return cipher_descriptor[cbc->cipher].accel_cbc_encrypt(pt, ct, len / cbc->blocklen, cbc->IV, &cbc->key); } else { while (len) { /* xor IV against plaintext */ #if defined(LTC_FAST) for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) ^= *((LTC_FAST_TYPE*)((unsigned char *)pt + x)); } #else for (x = 0; x < cbc->blocklen; x++) { cbc->IV[x] ^= pt[x]; } #endif /* encrypt */ if ((err = cipher_descriptor[cbc->cipher].ecb_encrypt(cbc->IV, ct, &cbc->key)) != CRYPT_OK) { return err; } /* store IV [ciphertext] for a future block */ #if defined(LTC_FAST) for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) = *((LTC_FAST_TYPE*)((unsigned char *)ct + x)); } #else for (x = 0; x < cbc->blocklen; x++) { cbc->IV[x] = ct[x]; } #endif ct += cbc->blocklen; pt += cbc->blocklen; len -= cbc->blocklen; } } return CRYPT_OK; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file cbc_getiv.c CBC implementation, get IV, Tom St Denis */ #ifdef LTC_CBC_MODE /** Get the current initial vector @param IV [out] The destination of the initial vector @param len [in/out] The max size and resulting size of the initial vector @param cbc The CBC state @return CRYPT_OK if successful */ int cbc_getiv(unsigned char *IV, unsigned long *len, symmetric_CBC *cbc) { LTC_ARGCHK(IV != NULL); LTC_ARGCHK(len != NULL); LTC_ARGCHK(cbc != NULL); if ((unsigned long)cbc->blocklen > *len) { *len = cbc->blocklen; return CRYPT_BUFFER_OVERFLOW; } XMEMCPY(IV, cbc->IV, cbc->blocklen); *len = cbc->blocklen; return CRYPT_OK; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file cbc_setiv.c CBC implementation, set IV, Tom St Denis */ #ifdef LTC_CBC_MODE /** Set an initial vector @param IV The initial vector @param len The length of the vector (in octets) @param cbc The CBC state @return CRYPT_OK if successful */ int cbc_setiv(const unsigned char *IV, unsigned long len, symmetric_CBC *cbc) { LTC_ARGCHK(IV != NULL); LTC_ARGCHK(cbc != NULL); if (len != (unsigned long)cbc->blocklen) { return CRYPT_INVALID_ARG; } XMEMCPY(cbc->IV, IV, len); return CRYPT_OK; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file cbc_start.c CBC implementation, start chain, Tom St Denis */ #ifdef LTC_CBC_MODE /** Initialize a CBC context @param cipher The index of the cipher desired @param IV The initial vector @param key The secret key @param keylen The length of the secret key (octets) @param num_rounds Number of rounds in the cipher desired (0 for default) @param cbc The CBC state to initialize @return CRYPT_OK if successful */ int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_CBC *cbc) { int x, err; LTC_ARGCHK(IV != NULL); LTC_ARGCHK(key != NULL); LTC_ARGCHK(cbc != NULL); /* bad param? */ if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { return err; } /* setup cipher */ if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &cbc->key)) != CRYPT_OK) { return err; } /* copy IV */ cbc->blocklen = cipher_descriptor[cipher].block_length; cbc->cipher = cipher; for (x = 0; x < cbc->blocklen; x++) { cbc->IV[x] = IV[x]; } return CRYPT_OK; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file gcm_add_iv.c GCM implementation, add IV data to the state, by Tom St Denis */ #ifdef LTC_GCM_MODE /** Add IV data to the GCM state @param gcm The GCM state @param IV The initial value data to add @param IVlen The length of the IV @return CRYPT_OK on success */ int gcm_add_iv(gcm_state *gcm, const unsigned char *IV, unsigned long IVlen) { unsigned long x, y; int err; LTC_ARGCHK(gcm != NULL); if (IVlen > 0) { LTC_ARGCHK(IV != NULL); } /* must be in IV mode */ if (gcm->mode != LTC_GCM_MODE_IV) { return CRYPT_INVALID_ARG; } if (gcm->buflen >= 16 || gcm->buflen < 0) { return CRYPT_INVALID_ARG; } if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { return err; } /* trip the ivmode flag */ if (IVlen + gcm->buflen > 12) { gcm->ivmode |= 1; } x = 0; #ifdef LTC_FAST if (gcm->buflen == 0) { for (x = 0; x < (IVlen & ~15); x += 16) { for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&IV[x + y])); } gcm_mult_h(gcm, gcm->X); gcm->totlen += 128; } IV += x; } #endif /* start adding IV data to the state */ for (; x < IVlen; x++) { gcm->buf[gcm->buflen++] = *IV++; if (gcm->buflen == 16) { /* GF mult it */ for (y = 0; y < 16; y++) { gcm->X[y] ^= gcm->buf[y]; } gcm_mult_h(gcm, gcm->X); gcm->buflen = 0; gcm->totlen += 128; } } return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_add_iv.c,v $ */ /* $Revision: 1.9 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file gcm_done.c GCM implementation, Terminate the stream, by Tom St Denis */ #ifdef LTC_GCM_MODE /** Terminate a GCM stream @param gcm The GCM state @param tag [out] The destination for the MAC tag @param taglen [in/out] The length of the MAC tag @return CRYPT_OK on success */ int gcm_done(gcm_state *gcm, unsigned char *tag, unsigned long *taglen) { unsigned long x; int err; LTC_ARGCHK(gcm != NULL); LTC_ARGCHK(tag != NULL); LTC_ARGCHK(taglen != NULL); if (gcm->buflen > 16 || gcm->buflen < 0) { return CRYPT_INVALID_ARG; } if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { return err; } if (gcm->mode != LTC_GCM_MODE_TEXT) { return CRYPT_INVALID_ARG; } /* handle remaining ciphertext */ if (gcm->buflen) { gcm->pttotlen += gcm->buflen * CONST64(8); gcm_mult_h(gcm, gcm->X); } /* length */ STORE64H(gcm->totlen, gcm->buf); STORE64H(gcm->pttotlen, gcm->buf+8); for (x = 0; x < 16; x++) { gcm->X[x] ^= gcm->buf[x]; } gcm_mult_h(gcm, gcm->X); /* encrypt original counter */ if ((err = cipher_descriptor[gcm->cipher].ecb_encrypt(gcm->Y_0, gcm->buf, &gcm->K)) != CRYPT_OK) { return err; } for (x = 0; x < 16 && x < *taglen; x++) { tag[x] = gcm->buf[x] ^ gcm->X[x]; } *taglen = x; cipher_descriptor[gcm->cipher].done(&gcm->K); return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_done.c,v $ */ /* $Revision: 1.11 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file gcm_init.c GCM implementation, initialize state, by Tom St Denis */ #ifdef LTC_GCM_MODE /** Initialize a GCM state @param gcm The GCM state to initialize @param cipher The index of the cipher to use @param key The secret key @param keylen The length of the secret key @return CRYPT_OK on success */ int gcm_init(gcm_state *gcm, int cipher, const unsigned char *key, int keylen) { int err; unsigned char B[16]; #ifdef LTC_GCM_TABLES int x, y, z, t; #endif LTC_ARGCHK(gcm != NULL); LTC_ARGCHK(key != NULL); #ifdef LTC_FAST if (16 % sizeof(LTC_FAST_TYPE)) { return CRYPT_INVALID_ARG; } #endif /* is cipher valid? */ if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { return err; } if (cipher_descriptor[cipher].block_length != 16) { return CRYPT_INVALID_CIPHER; } /* schedule key */ if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &gcm->K)) != CRYPT_OK) { return err; } /* H = E(0) */ zeromem(B, 16); if ((err = cipher_descriptor[cipher].ecb_encrypt(B, gcm->H, &gcm->K)) != CRYPT_OK) { return err; } /* setup state */ zeromem(gcm->buf, sizeof(gcm->buf)); zeromem(gcm->X, sizeof(gcm->X)); gcm->cipher = cipher; gcm->mode = LTC_GCM_MODE_IV; gcm->ivmode = 0; gcm->buflen = 0; gcm->totlen = 0; gcm->pttotlen = 0; #ifdef LTC_GCM_TABLES /* setup tables */ /* generate the first table as it has no shifting (from which we make the other tables) */ zeromem(B, 16); for (y = 0; y < 256; y++) { B[0] = y; gcm_gf_mult(gcm->H, B, &gcm->PC[0][y][0]); } /* now generate the rest of the tables based the previous table */ for (x = 1; x < 16; x++) { for (y = 0; y < 256; y++) { /* now shift it right by 8 bits */ t = gcm->PC[x-1][y][15]; for (z = 15; z > 0; z--) { gcm->PC[x][y][z] = gcm->PC[x-1][y][z-1]; } gcm->PC[x][y][0] = gcm_shift_table[t<<1]; gcm->PC[x][y][1] ^= gcm_shift_table[(t<<1)+1]; } } #endif return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_init.c,v $ */ /* $Revision: 1.20 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file gcm_process.c GCM implementation, process message data, by Tom St Denis */ #ifdef LTC_GCM_MODE /** Process plaintext/ciphertext through GCM @param gcm The GCM state @param pt The plaintext @param ptlen The plaintext length (ciphertext length is the same) @param ct The ciphertext @param direction Encrypt or Decrypt mode (GCM_ENCRYPT or GCM_DECRYPT) @return CRYPT_OK on success */ int gcm_process(gcm_state *gcm, unsigned char *pt, unsigned long ptlen, unsigned char *ct, int direction) { unsigned long x; int y, err; unsigned char b; LTC_ARGCHK(gcm != NULL); if (ptlen > 0) { LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); } if (gcm->buflen > 16 || gcm->buflen < 0) { return CRYPT_INVALID_ARG; } if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { return err; } /* in AAD mode? */ if (gcm->mode == LTC_GCM_MODE_AAD) { /* let's process the AAD */ if (gcm->buflen) { gcm->totlen += gcm->buflen * CONST64(8); gcm_mult_h(gcm, gcm->X); } /* increment counter */ for (y = 15; y >= 12; y--) { if (++gcm->Y[y] & 255) { break; } } /* encrypt the counter */ if ((err = cipher_descriptor[gcm->cipher].ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { return err; } gcm->buflen = 0; gcm->mode = LTC_GCM_MODE_TEXT; } if (gcm->mode != LTC_GCM_MODE_TEXT) { return CRYPT_INVALID_ARG; } x = 0; #ifdef LTC_FAST if (gcm->buflen == 0) { if (direction == GCM_ENCRYPT) { for (x = 0; x < (ptlen & ~15); x += 16) { /* ctr encrypt */ for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { *((LTC_FAST_TYPE*)(&ct[x + y])) = *((LTC_FAST_TYPE*)(&pt[x+y])) ^ *((LTC_FAST_TYPE*)(&gcm->buf[y])); *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&ct[x+y])); } /* GMAC it */ gcm->pttotlen += 128; gcm_mult_h(gcm, gcm->X); /* increment counter */ for (y = 15; y >= 12; y--) { if (++gcm->Y[y] & 255) { break; } } if ((err = cipher_descriptor[gcm->cipher].ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { return err; } } } else { for (x = 0; x < (ptlen & ~15); x += 16) { /* ctr encrypt */ for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&ct[x+y])); *((LTC_FAST_TYPE*)(&pt[x + y])) = *((LTC_FAST_TYPE*)(&ct[x+y])) ^ *((LTC_FAST_TYPE*)(&gcm->buf[y])); } /* GMAC it */ gcm->pttotlen += 128; gcm_mult_h(gcm, gcm->X); /* increment counter */ for (y = 15; y >= 12; y--) { if (++gcm->Y[y] & 255) { break; } } if ((err = cipher_descriptor[gcm->cipher].ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { return err; } } } } #endif /* process text */ for (; x < ptlen; x++) { if (gcm->buflen == 16) { gcm->pttotlen += 128; gcm_mult_h(gcm, gcm->X); /* increment counter */ for (y = 15; y >= 12; y--) { if (++gcm->Y[y] & 255) { break; } } if ((err = cipher_descriptor[gcm->cipher].ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { return err; } gcm->buflen = 0; } if (direction == GCM_ENCRYPT) { b = ct[x] = pt[x] ^ gcm->buf[gcm->buflen]; } else { b = ct[x]; pt[x] = ct[x] ^ gcm->buf[gcm->buflen]; } gcm->X[gcm->buflen++] ^= b; } return CRYPT_OK; } #endif /* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_process.c,v $ */ /* $Revision: 1.16 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file gcm_mult_h.c GCM implementation, do the GF mult, by Tom St Denis */ #if defined(LTC_GCM_MODE) /** GCM multiply by H @param gcm The GCM state which holds the H value @param I The value to multiply H by */ void gcm_mult_h(gcm_state *gcm, unsigned char *I) { unsigned char T[16]; #ifdef LTC_GCM_TABLES int x, y; #ifdef LTC_GCM_TABLES_SSE2 asm("movdqa (%0),%%xmm0"::"r"(&gcm->PC[0][I[0]][0])); for (x = 1; x < 16; x++) { asm("pxor (%0),%%xmm0"::"r"(&gcm->PC[x][I[x]][0])); } asm("movdqa %%xmm0,(%0)"::"r"(&T)); #else XMEMCPY(T, &gcm->PC[0][I[0]][0], 16); for (x = 1; x < 16; x++) { #ifdef LTC_FAST for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { *((LTC_FAST_TYPE *)(T + y)) ^= *((LTC_FAST_TYPE *)(&gcm->PC[x][I[x]][y])); } #else for (y = 0; y < 16; y++) { T[y] ^= gcm->PC[x][I[x]][y]; } #endif /* LTC_FAST */ } #endif /* LTC_GCM_TABLES_SSE2 */ #else gcm_gf_mult(gcm->H, I, T); #endif XMEMCPY(I, T, 16); } #endif /* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_mult_h.c,v $ */ /* $Revision: 1.6 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file gcm_gf_mult.c GCM implementation, do the GF mult, by Tom St Denis */ #if defined(LTC_GCM_TABLES) || defined(LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST)) /* this is x*2^128 mod p(x) ... the results are 16 bytes each stored in a packed format. Since only the * lower 16 bits are not zero'ed I removed the upper 14 bytes */ const unsigned char gcm_shift_table[256*2] = { 0x00, 0x00, 0x01, 0xc2, 0x03, 0x84, 0x02, 0x46, 0x07, 0x08, 0x06, 0xca, 0x04, 0x8c, 0x05, 0x4e, 0x0e, 0x10, 0x0f, 0xd2, 0x0d, 0x94, 0x0c, 0x56, 0x09, 0x18, 0x08, 0xda, 0x0a, 0x9c, 0x0b, 0x5e, 0x1c, 0x20, 0x1d, 0xe2, 0x1f, 0xa4, 0x1e, 0x66, 0x1b, 0x28, 0x1a, 0xea, 0x18, 0xac, 0x19, 0x6e, 0x12, 0x30, 0x13, 0xf2, 0x11, 0xb4, 0x10, 0x76, 0x15, 0x38, 0x14, 0xfa, 0x16, 0xbc, 0x17, 0x7e, 0x38, 0x40, 0x39, 0x82, 0x3b, 0xc4, 0x3a, 0x06, 0x3f, 0x48, 0x3e, 0x8a, 0x3c, 0xcc, 0x3d, 0x0e, 0x36, 0x50, 0x37, 0x92, 0x35, 0xd4, 0x34, 0x16, 0x31, 0x58, 0x30, 0x9a, 0x32, 0xdc, 0x33, 0x1e, 0x24, 0x60, 0x25, 0xa2, 0x27, 0xe4, 0x26, 0x26, 0x23, 0x68, 0x22, 0xaa, 0x20, 0xec, 0x21, 0x2e, 0x2a, 0x70, 0x2b, 0xb2, 0x29, 0xf4, 0x28, 0x36, 0x2d, 0x78, 0x2c, 0xba, 0x2e, 0xfc, 0x2f, 0x3e, 0x70, 0x80, 0x71, 0x42, 0x73, 0x04, 0x72, 0xc6, 0x77, 0x88, 0x76, 0x4a, 0x74, 0x0c, 0x75, 0xce, 0x7e, 0x90, 0x7f, 0x52, 0x7d, 0x14, 0x7c, 0xd6, 0x79, 0x98, 0x78, 0x5a, 0x7a, 0x1c, 0x7b, 0xde, 0x6c, 0xa0, 0x6d, 0x62, 0x6f, 0x24, 0x6e, 0xe6, 0x6b, 0xa8, 0x6a, 0x6a, 0x68, 0x2c, 0x69, 0xee, 0x62, 0xb0, 0x63, 0x72, 0x61, 0x34, 0x60, 0xf6, 0x65, 0xb8, 0x64, 0x7a, 0x66, 0x3c, 0x67, 0xfe, 0x48, 0xc0, 0x49, 0x02, 0x4b, 0x44, 0x4a, 0x86, 0x4f, 0xc8, 0x4e, 0x0a, 0x4c, 0x4c, 0x4d, 0x8e, 0x46, 0xd0, 0x47, 0x12, 0x45, 0x54, 0x44, 0x96, 0x41, 0xd8, 0x40, 0x1a, 0x42, 0x5c, 0x43, 0x9e, 0x54, 0xe0, 0x55, 0x22, 0x57, 0x64, 0x56, 0xa6, 0x53, 0xe8, 0x52, 0x2a, 0x50, 0x6c, 0x51, 0xae, 0x5a, 0xf0, 0x5b, 0x32, 0x59, 0x74, 0x58, 0xb6, 0x5d, 0xf8, 0x5c, 0x3a, 0x5e, 0x7c, 0x5f, 0xbe, 0xe1, 0x00, 0xe0, 0xc2, 0xe2, 0x84, 0xe3, 0x46, 0xe6, 0x08, 0xe7, 0xca, 0xe5, 0x8c, 0xe4, 0x4e, 0xef, 0x10, 0xee, 0xd2, 0xec, 0x94, 0xed, 0x56, 0xe8, 0x18, 0xe9, 0xda, 0xeb, 0x9c, 0xea, 0x5e, 0xfd, 0x20, 0xfc, 0xe2, 0xfe, 0xa4, 0xff, 0x66, 0xfa, 0x28, 0xfb, 0xea, 0xf9, 0xac, 0xf8, 0x6e, 0xf3, 0x30, 0xf2, 0xf2, 0xf0, 0xb4, 0xf1, 0x76, 0xf4, 0x38, 0xf5, 0xfa, 0xf7, 0xbc, 0xf6, 0x7e, 0xd9, 0x40, 0xd8, 0x82, 0xda, 0xc4, 0xdb, 0x06, 0xde, 0x48, 0xdf, 0x8a, 0xdd, 0xcc, 0xdc, 0x0e, 0xd7, 0x50, 0xd6, 0x92, 0xd4, 0xd4, 0xd5, 0x16, 0xd0, 0x58, 0xd1, 0x9a, 0xd3, 0xdc, 0xd2, 0x1e, 0xc5, 0x60, 0xc4, 0xa2, 0xc6, 0xe4, 0xc7, 0x26, 0xc2, 0x68, 0xc3, 0xaa, 0xc1, 0xec, 0xc0, 0x2e, 0xcb, 0x70, 0xca, 0xb2, 0xc8, 0xf4, 0xc9, 0x36, 0xcc, 0x78, 0xcd, 0xba, 0xcf, 0xfc, 0xce, 0x3e, 0x91, 0x80, 0x90, 0x42, 0x92, 0x04, 0x93, 0xc6, 0x96, 0x88, 0x97, 0x4a, 0x95, 0x0c, 0x94, 0xce, 0x9f, 0x90, 0x9e, 0x52, 0x9c, 0x14, 0x9d, 0xd6, 0x98, 0x98, 0x99, 0x5a, 0x9b, 0x1c, 0x9a, 0xde, 0x8d, 0xa0, 0x8c, 0x62, 0x8e, 0x24, 0x8f, 0xe6, 0x8a, 0xa8, 0x8b, 0x6a, 0x89, 0x2c, 0x88, 0xee, 0x83, 0xb0, 0x82, 0x72, 0x80, 0x34, 0x81, 0xf6, 0x84, 0xb8, 0x85, 0x7a, 0x87, 0x3c, 0x86, 0xfe, 0xa9, 0xc0, 0xa8, 0x02, 0xaa, 0x44, 0xab, 0x86, 0xae, 0xc8, 0xaf, 0x0a, 0xad, 0x4c, 0xac, 0x8e, 0xa7, 0xd0, 0xa6, 0x12, 0xa4, 0x54, 0xa5, 0x96, 0xa0, 0xd8, 0xa1, 0x1a, 0xa3, 0x5c, 0xa2, 0x9e, 0xb5, 0xe0, 0xb4, 0x22, 0xb6, 0x64, 0xb7, 0xa6, 0xb2, 0xe8, 0xb3, 0x2a, 0xb1, 0x6c, 0xb0, 0xae, 0xbb, 0xf0, 0xba, 0x32, 0xb8, 0x74, 0xb9, 0xb6, 0xbc, 0xf8, 0xbd, 0x3a, 0xbf, 0x7c, 0xbe, 0xbe }; #endif #if defined(LTC_GCM_MODE) || defined(LRW_MODE) #ifndef LTC_FAST /* right shift */ static void gcm_rightshift(unsigned char *a) { int x; for (x = 15; x > 0; x--) { a[x] = (a[x]>>1) | ((a[x-1]<<7)&0x80); } a[0] >>= 1; } /* c = b*a */ static const unsigned char mask[] = { 0x80, 0x40, 0x20, 0x10, 0x08, 0x04, 0x02, 0x01 }; static const unsigned char poly_[] = { 0x00, 0xE1 }; /** GCM GF multiplier (internal use only) bitserial @param a First value @param b Second value @param c Destination for a * b */ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c) { unsigned char Z[16], V[16]; unsigned char x, y, z; zeromem(Z, 16); XMEMCPY(V, a, 16); for (x = 0; x < 128; x++) { if (b[x>>3] & mask[x&7]) { for (y = 0; y < 16; y++) { Z[y] ^= V[y]; } } z = V[15] & 0x01; gcm_rightshift(V); V[0] ^= poly_[z]; } XMEMCPY(c, Z, 16); } #else /* map normal numbers to "ieee" way ... e.g. bit reversed */ #define M(x) ( ((x&8)>>3) | ((x&4)>>1) | ((x&2)<<1) | ((x&1)<<3) ) #define BPD (sizeof(LTC_FAST_TYPE) * 8) #define WPV (1 + (16 / sizeof(LTC_FAST_TYPE))) /** GCM GF multiplier (internal use only) word oriented @param a First value @param b Second value @param c Destination for a * b */ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c) { int i, j, k, u; LTC_FAST_TYPE B[16][WPV], tmp[32 / sizeof(LTC_FAST_TYPE)], pB[16 / sizeof(LTC_FAST_TYPE)], zz, z; unsigned char pTmp[32]; /* create simple tables */ zeromem(B[0], sizeof(B[0])); zeromem(B[M(1)], sizeof(B[M(1)])); #ifdef ENDIAN_32BITWORD for (i = 0; i < 4; i++) { LOAD32H(B[M(1)][i], a + (i<<2)); LOAD32L(pB[i], b + (i<<2)); } #else for (i = 0; i < 2; i++) { LOAD64H(B[M(1)][i], a + (i<<3)); LOAD64L(pB[i], b + (i<<3)); } #endif /* now create 2, 4 and 8 */ B[M(2)][0] = B[M(1)][0] >> 1; B[M(4)][0] = B[M(1)][0] >> 2; B[M(8)][0] = B[M(1)][0] >> 3; for (i = 1; i < (int)WPV; i++) { B[M(2)][i] = (B[M(1)][i-1] << (BPD-1)) | (B[M(1)][i] >> 1); B[M(4)][i] = (B[M(1)][i-1] << (BPD-2)) | (B[M(1)][i] >> 2); B[M(8)][i] = (B[M(1)][i-1] << (BPD-3)) | (B[M(1)][i] >> 3); } /* now all values with two bits which are 3, 5, 6, 9, 10, 12 */ for (i = 0; i < (int)WPV; i++) { B[M(3)][i] = B[M(1)][i] ^ B[M(2)][i]; B[M(5)][i] = B[M(1)][i] ^ B[M(4)][i]; B[M(6)][i] = B[M(2)][i] ^ B[M(4)][i]; B[M(9)][i] = B[M(1)][i] ^ B[M(8)][i]; B[M(10)][i] = B[M(2)][i] ^ B[M(8)][i]; B[M(12)][i] = B[M(8)][i] ^ B[M(4)][i]; /* now all 3 bit values and the only 4 bit value: 7, 11, 13, 14, 15 */ B[M(7)][i] = B[M(3)][i] ^ B[M(4)][i]; B[M(11)][i] = B[M(3)][i] ^ B[M(8)][i]; B[M(13)][i] = B[M(1)][i] ^ B[M(12)][i]; B[M(14)][i] = B[M(6)][i] ^ B[M(8)][i]; B[M(15)][i] = B[M(7)][i] ^ B[M(8)][i]; } zeromem(tmp, sizeof(tmp)); /* compute product four bits of each word at a time */ /* for each nibble */ for (i = (BPD/4)-1; i >= 0; i--) { /* for each word */ for (j = 0; j < (int)(WPV-1); j++) { /* grab the 4 bits recall the nibbles are backwards so it's a shift by (i^1)*4 */ u = (pB[j] >> ((i^1)<<2)) & 15; /* add offset by the word count the table looked up value to the result */ for (k = 0; k < (int)WPV; k++) { tmp[k+j] ^= B[u][k]; } } /* shift result up by 4 bits */ if (i != 0) { for (z = j = 0; j < (int)(32 / sizeof(LTC_FAST_TYPE)); j++) { zz = tmp[j] << (BPD-4); tmp[j] = (tmp[j] >> 4) | z; z = zz; } } } /* store product */ #ifdef ENDIAN_32BITWORD for (i = 0; i < 8; i++) { STORE32H(tmp[i], pTmp + (i<<2)); } #else for (i = 0; i < 4; i++) { STORE64H(tmp[i], pTmp + (i<<3)); } #endif /* reduce by taking most significant byte and adding the appropriate two byte sequence 16 bytes down */ for (i = 31; i >= 16; i--) { pTmp[i-16] ^= gcm_shift_table[((unsigned)pTmp[i]<<1)]; pTmp[i-15] ^= gcm_shift_table[((unsigned)pTmp[i]<<1)+1]; } for (i = 0; i < 16; i++) { c[i] = pTmp[i]; } } #endif #endif /* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c,v $ */ /* $Revision: 1.25 $ */ /* $Date: 2007/05/12 14:32:35 $ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file gcm_add_aad.c GCM implementation, Add AAD data to the stream, by Tom St Denis */ #ifdef LTC_GCM_MODE /** Add AAD to the GCM state @param gcm The GCM state @param adata The additional authentication data to add to the GCM state @param adatalen The length of the AAD data. @return CRYPT_OK on success */ int gcm_add_aad(gcm_state *gcm, const unsigned char *adata, unsigned long adatalen) { unsigned long x; int err; #ifdef LTC_FAST unsigned long y; #endif LTC_ARGCHK(gcm != NULL); if (adatalen > 0) { LTC_ARGCHK(adata != NULL); } if (gcm->buflen > 16 || gcm->buflen < 0) { return CRYPT_INVALID_ARG; } if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { return err; } /* in IV mode? */ if (gcm->mode == LTC_GCM_MODE_IV) { /* let's process the IV */ if (gcm->ivmode || gcm->buflen != 12) { for (x = 0; x < (unsigned long)gcm->buflen; x++) { gcm->X[x] ^= gcm->buf[x]; } if (gcm->buflen) { gcm->totlen += gcm->buflen * CONST64(8); gcm_mult_h(gcm, gcm->X); } /* mix in the length */ zeromem(gcm->buf, 8); STORE64H(gcm->totlen, gcm->buf+8); for (x = 0; x < 16; x++) { gcm->X[x] ^= gcm->buf[x]; } gcm_mult_h(gcm, gcm->X); /* copy counter out */ XMEMCPY(gcm->Y, gcm->X, 16); zeromem(gcm->X, 16); } else { XMEMCPY(gcm->Y, gcm->buf, 12); gcm->Y[12] = 0; gcm->Y[13] = 0; gcm->Y[14] = 0; gcm->Y[15] = 1; } XMEMCPY(gcm->Y_0, gcm->Y, 16); zeromem(gcm->buf, 16); gcm->buflen = 0; gcm->totlen = 0; gcm->mode = LTC_GCM_MODE_AAD; } if (gcm->mode != LTC_GCM_MODE_AAD || gcm->buflen >= 16) { return CRYPT_INVALID_ARG; } x = 0; #ifdef LTC_FAST if (gcm->buflen == 0) { for (x = 0; x < (adatalen & ~15); x += 16) { for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&adata[x + y])); } gcm_mult_h(gcm, gcm->X); gcm->totlen += 128; } adata += x; } #endif /* start adding AAD data to the state */ for (; x < adatalen; x++) { gcm->X[gcm->buflen++] ^= *adata++; if (gcm->buflen == 16) { /* GF mult it */ gcm_mult_h(gcm, gcm->X); gcm->buflen = 0; gcm->totlen += 128; } } return CRYPT_OK; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file gcm_reset.c GCM implementation, reset a used state so it can accept IV data, by Tom St Denis */ #ifdef LTC_GCM_MODE /** Reset a GCM state to as if you just called gcm_init(). This saves the initialization time. @param gcm The GCM state to reset @return CRYPT_OK on success */ int gcm_reset(gcm_state *gcm) { LTC_ARGCHK(gcm != NULL); zeromem(gcm->buf, sizeof(gcm->buf)); zeromem(gcm->X, sizeof(gcm->X)); gcm->mode = LTC_GCM_MODE_IV; gcm->ivmode = 0; gcm->buflen = 0; gcm->totlen = 0; gcm->pttotlen = 0; return CRYPT_OK; } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* LibTomCrypt, modular cryptographic library -- Tom St Denis * * LibTomCrypt is a library that provides various cryptographic * algorithms in a highly modular and flexible manner. * * The library is free for all purposes without any express * guarantee it works. * * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file md5.c LTC_MD5 hash function by Tom St Denis */ #ifdef LTC_MD5 const struct ltc_hash_descriptor md5_desc = { "md5", 3, 16, 64, /* OID */ { 1, 2, 840, 113549, 2, 5, }, 6, &md5_init, &md5_process, &md5_done, &md5_test, NULL }; #define F(x,y,z) (z ^ (x & (y ^ z))) #define G(x,y,z) (y ^ (z & (y ^ x))) #define H(x,y,z) (x^y^z) #define I(x,y,z) (y^(x|(~z))) #ifdef LTC_SMALL_CODE #define FF(a,b,c,d,M,s,t) \ a = (a + F(b,c,d) + M + t); a = ROL(a, s) + b; #define GG(a,b,c,d,M,s,t) \ a = (a + G(b,c,d) + M + t); a = ROL(a, s) + b; #define HH(a,b,c,d,M,s,t) \ a = (a + H(b,c,d) + M + t); a = ROL(a, s) + b; #define II(a,b,c,d,M,s,t) \ a = (a + I(b,c,d) + M + t); a = ROL(a, s) + b; static const unsigned char Worder[64] = { 0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15, 1,6,11,0,5,10,15,4,9,14,3,8,13,2,7,12, 5,8,11,14,1,4,7,10,13,0,3,6,9,12,15,2, 0,7,14,5,12,3,10,1,8,15,6,13,4,11,2,9 }; static const unsigned char Rorder[64] = { 7,12,17,22,7,12,17,22,7,12,17,22,7,12,17,22, 5,9,14,20,5,9,14,20,5,9,14,20,5,9,14,20, 4,11,16,23,4,11,16,23,4,11,16,23,4,11,16,23, 6,10,15,21,6,10,15,21,6,10,15,21,6,10,15,21 }; static const ulong32 Korder[64] = { 0xd76aa478UL, 0xe8c7b756UL, 0x242070dbUL, 0xc1bdceeeUL, 0xf57c0fafUL, 0x4787c62aUL, 0xa8304613UL, 0xfd469501UL, 0x698098d8UL, 0x8b44f7afUL, 0xffff5bb1UL, 0x895cd7beUL, 0x6b901122UL, 0xfd987193UL, 0xa679438eUL, 0x49b40821UL, 0xf61e2562UL, 0xc040b340UL, 0x265e5a51UL, 0xe9b6c7aaUL, 0xd62f105dUL, 0x02441453UL, 0xd8a1e681UL, 0xe7d3fbc8UL, 0x21e1cde6UL, 0xc33707d6UL, 0xf4d50d87UL, 0x455a14edUL, 0xa9e3e905UL, 0xfcefa3f8UL, 0x676f02d9UL, 0x8d2a4c8aUL, 0xfffa3942UL, 0x8771f681UL, 0x6d9d6122UL, 0xfde5380cUL, 0xa4beea44UL, 0x4bdecfa9UL, 0xf6bb4b60UL, 0xbebfbc70UL, 0x289b7ec6UL, 0xeaa127faUL, 0xd4ef3085UL, 0x04881d05UL, 0xd9d4d039UL, 0xe6db99e5UL, 0x1fa27cf8UL, 0xc4ac5665UL, 0xf4292244UL, 0x432aff97UL, 0xab9423a7UL, 0xfc93a039UL, 0x655b59c3UL, 0x8f0ccc92UL, 0xffeff47dUL, 0x85845dd1UL, 0x6fa87e4fUL, 0xfe2ce6e0UL, 0xa3014314UL, 0x4e0811a1UL, 0xf7537e82UL, 0xbd3af235UL, 0x2ad7d2bbUL, 0xeb86d391UL }; #else #define FF(a,b,c,d,M,s,t) \ a = (a + F(b,c,d) + M + t); a = ROLc(a, s) + b; #define GG(a,b,c,d,M,s,t) \ a = (a + G(b,c,d) + M + t); a = ROLc(a, s) + b; #define HH(a,b,c,d,M,s,t) \ a = (a + H(b,c,d) + M + t); a = ROLc(a, s) + b; #define II(a,b,c,d,M,s,t) \ a = (a + I(b,c,d) + M + t); a = ROLc(a, s) + b; #endif #ifdef LTC_CLEAN_STACK static int _md5_compress(hash_state *md, unsigned char *buf) #else static int md5_compress(hash_state *md, unsigned char *buf) #endif { ulong32 i, W[16], a, b, c, d; #ifdef LTC_SMALL_CODE ulong32 t; #endif /* copy the state into 512-bits into W[0..15] */ for (i = 0; i < 16; i++) { LOAD32L(W[i], buf + (4*i)); } /* copy state */ a = md->md5.state[0]; b = md->md5.state[1]; c = md->md5.state[2]; d = md->md5.state[3]; #ifdef LTC_SMALL_CODE for (i = 0; i < 16; ++i) { FF(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); t = d; d = c; c = b; b = a; a = t; } for (; i < 32; ++i) { GG(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); t = d; d = c; c = b; b = a; a = t; } for (; i < 48; ++i) { HH(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); t = d; d = c; c = b; b = a; a = t; } for (; i < 64; ++i) { II(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); t = d; d = c; c = b; b = a; a = t; } #else FF(a,b,c,d,W[0],7,0xd76aa478UL) FF(d,a,b,c,W[1],12,0xe8c7b756UL) FF(c,d,a,b,W[2],17,0x242070dbUL) FF(b,c,d,a,W[3],22,0xc1bdceeeUL) FF(a,b,c,d,W[4],7,0xf57c0fafUL) FF(d,a,b,c,W[5],12,0x4787c62aUL) FF(c,d,a,b,W[6],17,0xa8304613UL) FF(b,c,d,a,W[7],22,0xfd469501UL) FF(a,b,c,d,W[8],7,0x698098d8UL) FF(d,a,b,c,W[9],12,0x8b44f7afUL) FF(c,d,a,b,W[10],17,0xffff5bb1UL) FF(b,c,d,a,W[11],22,0x895cd7beUL) FF(a,b,c,d,W[12],7,0x6b901122UL) FF(d,a,b,c,W[13],12,0xfd987193UL) FF(c,d,a,b,W[14],17,0xa679438eUL) FF(b,c,d,a,W[15],22,0x49b40821UL) GG(a,b,c,d,W[1],5,0xf61e2562UL) GG(d,a,b,c,W[6],9,0xc040b340UL) GG(c,d,a,b,W[11],14,0x265e5a51UL) GG(b,c,d,a,W[0],20,0xe9b6c7aaUL) GG(a,b,c,d,W[5],5,0xd62f105dUL) GG(d,a,b,c,W[10],9,0x02441453UL) GG(c,d,a,b,W[15],14,0xd8a1e681UL) GG(b,c,d,a,W[4],20,0xe7d3fbc8UL) GG(a,b,c,d,W[9],5,0x21e1cde6UL) GG(d,a,b,c,W[14],9,0xc33707d6UL) GG(c,d,a,b,W[3],14,0xf4d50d87UL) GG(b,c,d,a,W[8],20,0x455a14edUL) GG(a,b,c,d,W[13],5,0xa9e3e905UL) GG(d,a,b,c,W[2],9,0xfcefa3f8UL) GG(c,d,a,b,W[7],14,0x676f02d9UL) GG(b,c,d,a,W[12],20,0x8d2a4c8aUL) HH(a,b,c,d,W[5],4,0xfffa3942UL) HH(d,a,b,c,W[8],11,0x8771f681UL) HH(c,d,a,b,W[11],16,0x6d9d6122UL) HH(b,c,d,a,W[14],23,0xfde5380cUL) HH(a,b,c,d,W[1],4,0xa4beea44UL) HH(d,a,b,c,W[4],11,0x4bdecfa9UL) HH(c,d,a,b,W[7],16,0xf6bb4b60UL) HH(b,c,d,a,W[10],23,0xbebfbc70UL) HH(a,b,c,d,W[13],4,0x289b7ec6UL) HH(d,a,b,c,W[0],11,0xeaa127faUL) HH(c,d,a,b,W[3],16,0xd4ef3085UL) HH(b,c,d,a,W[6],23,0x04881d05UL) HH(a,b,c,d,W[9],4,0xd9d4d039UL) HH(d,a,b,c,W[12],11,0xe6db99e5UL) HH(c,d,a,b,W[15],16,0x1fa27cf8UL) HH(b,c,d,a,W[2],23,0xc4ac5665UL) II(a,b,c,d,W[0],6,0xf4292244UL) II(d,a,b,c,W[7],10,0x432aff97UL) II(c,d,a,b,W[14],15,0xab9423a7UL) II(b,c,d,a,W[5],21,0xfc93a039UL) II(a,b,c,d,W[12],6,0x655b59c3UL) II(d,a,b,c,W[3],10,0x8f0ccc92UL) II(c,d,a,b,W[10],15,0xffeff47dUL) II(b,c,d,a,W[1],21,0x85845dd1UL) II(a,b,c,d,W[8],6,0x6fa87e4fUL) II(d,a,b,c,W[15],10,0xfe2ce6e0UL) II(c,d,a,b,W[6],15,0xa3014314UL) II(b,c,d,a,W[13],21,0x4e0811a1UL) II(a,b,c,d,W[4],6,0xf7537e82UL) II(d,a,b,c,W[11],10,0xbd3af235UL) II(c,d,a,b,W[2],15,0x2ad7d2bbUL) II(b,c,d,a,W[9],21,0xeb86d391UL) #endif md->md5.state[0] = md->md5.state[0] + a; md->md5.state[1] = md->md5.state[1] + b; md->md5.state[2] = md->md5.state[2] + c; md->md5.state[3] = md->md5.state[3] + d; return CRYPT_OK; } #ifdef LTC_CLEAN_STACK static int md5_compress(hash_state *md, unsigned char *buf) { int err; err = _md5_compress(md, buf); burn_stack(sizeof(ulong32) * 21); return err; } #endif /** Initialize the hash state @param md The hash state you wish to initialize @return CRYPT_OK if successful */ int md5_init(hash_state * md) { LTC_ARGCHK(md != NULL); md->md5.state[0] = 0x67452301UL; md->md5.state[1] = 0xefcdab89UL; md->md5.state[2] = 0x98badcfeUL; md->md5.state[3] = 0x10325476UL; md->md5.curlen = 0; md->md5.length = 0; return CRYPT_OK; } /** Process a block of memory though the hash @param md The hash state @param in The data to hash @param inlen The length of the data (octets) @return CRYPT_OK if successful */ HASH_PROCESS(md5_process, md5_compress, md5, 64) /** Terminate the hash to get the digest @param md The hash state @param out [out] The destination of the hash (16 bytes) @return CRYPT_OK if successful */ int md5_done(hash_state * md, unsigned char *out) { int i; LTC_ARGCHK(md != NULL); LTC_ARGCHK(out != NULL); if (md->md5.curlen >= sizeof(md->md5.buf)) { return CRYPT_INVALID_ARG; } /* increase the length of the message */ md->md5.length += md->md5.curlen * 8; /* append the '1' bit */ md->md5.buf[md->md5.curlen++] = (unsigned char)0x80; /* if the length is currently above 56 bytes we append zeros * then compress. Then we can fall back to padding zeros and length * encoding like normal. */ if (md->md5.curlen > 56) { while (md->md5.curlen < 64) { md->md5.buf[md->md5.curlen++] = (unsigned char)0; } md5_compress(md, md->md5.buf); md->md5.curlen = 0; } /* pad upto 56 bytes of zeroes */ while (md->md5.curlen < 56) { md->md5.buf[md->md5.curlen++] = (unsigned char)0; } /* store length */ STORE64L(md->md5.length, md->md5.buf+56); md5_compress(md, md->md5.buf); /* copy output */ for (i = 0; i < 4; i++) { STORE32L(md->md5.state[i], out+(4*i)); } #ifdef LTC_CLEAN_STACK zeromem(md, sizeof(hash_state)); #endif return CRYPT_OK; } /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled */ int md5_test(void) { #ifndef LTC_TEST return CRYPT_NOP; #else static const struct { char *msg; unsigned char hash[16]; } tests[] = { { "", { 0xd4, 0x1d, 0x8c, 0xd9, 0x8f, 0x00, 0xb2, 0x04, 0xe9, 0x80, 0x09, 0x98, 0xec, 0xf8, 0x42, 0x7e } }, { "a", {0x0c, 0xc1, 0x75, 0xb9, 0xc0, 0xf1, 0xb6, 0xa8, 0x31, 0xc3, 0x99, 0xe2, 0x69, 0x77, 0x26, 0x61 } }, { "abc", { 0x90, 0x01, 0x50, 0x98, 0x3c, 0xd2, 0x4f, 0xb0, 0xd6, 0x96, 0x3f, 0x7d, 0x28, 0xe1, 0x7f, 0x72 } }, { "message digest", { 0xf9, 0x6b, 0x69, 0x7d, 0x7c, 0xb7, 0x93, 0x8d, 0x52, 0x5a, 0x2f, 0x31, 0xaa, 0xf1, 0x61, 0xd0 } }, { "abcdefghijklmnopqrstuvwxyz", { 0xc3, 0xfc, 0xd3, 0xd7, 0x61, 0x92, 0xe4, 0x00, 0x7d, 0xfb, 0x49, 0x6c, 0xca, 0x67, 0xe1, 0x3b } }, { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", { 0xd1, 0x74, 0xab, 0x98, 0xd2, 0x77, 0xd9, 0xf5, 0xa5, 0x61, 0x1c, 0x2c, 0x9f, 0x41, 0x9d, 0x9f } }, { "12345678901234567890123456789012345678901234567890123456789012345678901234567890", { 0x57, 0xed, 0xf4, 0xa2, 0x2b, 0xe3, 0xc9, 0x55, 0xac, 0x49, 0xda, 0x2e, 0x21, 0x07, 0xb6, 0x7a } }, { NULL, { 0 } } }; int i; unsigned char tmp[16]; hash_state md; for (i = 0; tests[i].msg != NULL; i++) { md5_init(&md); md5_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); md5_done(&md, tmp); if (XMEMCMP(tmp, tests[i].hash, 16) != 0) { return CRYPT_FAIL_TESTVECTOR; } } return CRYPT_OK; #endif } #endif /* $Source$ */ /* $Revision$ */ /* $Date$ */ /* ------------------------------------------------------------------------------ END libtomcrypt.c ------------------------------------------------------------------------------ */ #endif /* HTTPS_NO_LIBTOMCRYPT */ /* ------------------------------------------------------------------------------ BEGIN tlse readme ------------------------------------------------------------------------------ */ /* # TLSe Single C file TLS 1.3, 1.2, 1.1 and 1.0(without the weak ciphers) implementation, using [libtomcrypt](https://github.com/libtom/libtomcrypt "libtomcrypt") as crypto library. It also supports DTLS 1.2 and 1.0. Before using tlse.c you may want to download and compile tomcrypt; alternatively you may use libtomcrypt.c (see Compiling). I'm working at an alternative efficient RSA signing, DH and Curve25519 implementation, to allow the compilation, alternatively, without tomcrypt, on devices where memory and code size is an issue. **Note**: It does not implement 0-RTT. Client-side TLS 1.3 support is experimental. Like this project ? You may donate Bitcoin for this project at 14LqvMzFfaJ82C7wY5iavvTf9HPELYWsax ![](https://raw.githubusercontent.com/eduardsui/edwork/master/bwallet.png) Compiling ---------- Simple TLS client: `$ gcc tlshello.c -o tlshello -ltomcrypt -ltommath -DLTM_DESC` For debuging tls connections, the DEBUG flag must be set (-DDEBUG). Simple TLS server: `$ gcc tlsserverhello.c -o tlsserverhello -ltomcrypt -ltommath -DLTM_DESC` The entire library is a single c file that you just include in your source. The library may also use the libtomcrypt.c amalgamation. In this case, the client may be compiled: `$ gcc tlshello.c -o tlshello -DTLS_AMALGAMATION` and the server: `$ gcc tlsserverhello.c -o tlsserverhello -DTLS_AMALGAMATION` tlse.h is optional (is safe to just include tlse.c). Alternatively, you may include tlse.h and add tlse.c to your makefile (useful when linking against C++). If thread-safety is needed, you need to call `tls_init()` before letting any other threads in, and not use the same object from multiple threads without a mutex. Other than that, TLSe and libtomcrypt are thread-safe. Also, you may want to define LTC_PTHREAD if you're using libtomcrypt. TLSe supports KTLS on linux kernel 4.13 or higher. KTLS is a TLS implementation in the linux kernel. If TLS_RX is not defined, KTLS is send-only (you may use send/sendfile to send data, but you may not use recv). Also, the negotiation must be handled by TLSe. If KTLS support is needed, define WITH_KTLS (compile with -DWITH_KTLS). Note that is not clear which header should be included for linux structure, you may need to check these structures and constants: https://github.com/torvalds/linux/blob/master/Documentation/networking/tls.txt. Usage ---------- You just `#include "tlse.c"` in your code. Everything is a single file. Features ---------- The main feature of this implementation is the ability to serialize TLS context, via tls_export_context and re-import it, via tls_import_context in another pre-forked worker process (socket descriptor may be sent via sendmsg). For now it supports TLS 1.2, TLS 1.1 + 1.0 (when TLS_LEGACY_SUPPORT is defined / default is on), RSA, ECDSA, DHE, ECDHE ciphers: ``TLS_DHE_RSA_WITH_AES_128_CBC_SHA, TLS_DHE_RSA_WITH_AES_256_CBC_SHA, TLS_DHE_RSA_WITH_AES_128_CBC_SHA256, TLS_DHE_RSA_WITH_AES_256_CBC_SHA256, TLS_DHE_RSA_WITH_AES_128_GCM_SHA256, TLS_DHE_RSA_WITH_AES_256_GCM_SHA384, TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA, TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA, TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256, TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256, TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384, TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA, TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA, TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256, TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA384, TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256` and `TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384``. The following ciphers are supported but disabled by default: ``TLS_RSA_WITH_AES_128_CBC_SHA, TLS_RSA_WITH_AES_256_CBC_SHA, TLS_RSA_WITH_AES_128_CBC_SHA256, TLS_RSA_WITH_AES_256_CBC_SHA256, TLS_RSA_WITH_AES_128_GCM_SHA256, TLS_RSA_WITH_AES_256_GCM_SHA384``. To enable these ciphers, TLSe must be compiled with ``-DNO_TLS_ROBOT_MITIGATION``. ROBOT attack is mitigated by default, but it is recommended to disable RSA encryption to avoid future vulnerabilities. TLSe now supports ChaCha20/Poly1305 ciphers: `TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256`, `TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256` and `TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256`. These ciphers are enabled by default. It has a low level interface, efficient for non-blocking, asynchronous sockets, and a blocking, libssl-style interface. It implements all that is needed for the TLS protocol version 1.2 and a pem/der parser. From tomcrypt it uses RSA, ECDSA and AES(GCM and CBC) encryption/decryption, SHA1, SHA256, SHA384, SHA512 and HMAC functions. Now it supports client certificate. To request a client certificate, call ``tls_request_client_certificate(TLSContext *)`` following ``tls_accept(TLSContext *)``. It implements SNI extension (Server Name Indication). To get the SNI string call ``tls_sni(TLSContext *)``. It also implements SCSV and ALPN (see ``tls_add_alpn(struct TLSContext *, const char *)`` and ``const char *tls_alpn(struct TLSContext *)``. The library supports certificate validation by using ``tls_certificate_chain_is_valid``, ``tls_certificate_chain_is_valid_root``, ``tls_certificate_valid_subject`` and ``tls_certificate_is_valid``(checks not before/not after). Note that certificates fed to ``tls_certificate_chain_is_valid`` must be in correct order (certificate 2 signs certificate 1, certificate 3 signs certificate 2 and so on; also certificate 1 (first) is the certificate to be used in key exchange). This library was written to be used by my other projects [Concept Applications Server](https://github.com/Devronium/ConceptApplicationServer "Concept Application Server") and [Concept Native Client](https://github.com/Devronium/ConceptClientQT "Concept Client QT") Examples ---------- 1. [examples/tlsclienthello.c](https://github.com/eduardsui/tlslayer/blob/master/examples/tlsclienthello.c) simple client example 2. [examples/tlshelloworld.c](https://github.com/eduardsui/tlslayer/blob/master/examples/tlshelloworld.c) simple server example 3. [examples/tlssimple.c](https://github.com/eduardsui/tlslayer/blob/master/examples/tlssimple.c) simple blocking client using libssl-ish API 4. [examples/tlssimpleserver.c](https://github.com/eduardsui/tlslayer/blob/master/examples/tlssimpleserver.c) simple blocking server using libssl-ish API After compiling the examples, in the working directory, you should put fullchain.pem and privkey.pem in a directory called testcert for running the server examples. I've used [letsencrypt](https://github.com/letsencrypt/letsencrypt) for certificate generation (is free!). Important security note ---------- Note that for DTLS, it doesn't implement a state machine, so using this DTLS implementation with UDP (server) may expose your server to DoS attack. License ---------- Public domain, BSD, MIT. Choose one. */ /* ------------------------------------------------------------------------------ END tlse readme ------------------------------------------------------------------------------ */ /* ------------------------------------------------------------------------------ BEGIN tlse.h ------------------------------------------------------------------------------ */ #ifndef TLSE_H #define TLSE_H // #define DEBUG // define TLS_LEGACY_SUPPORT to support TLS 1.1/1.0 (legacy) // legacy support it will use an additional 272 bytes / context #ifndef NO_TLS_LEGACY_SUPPORT #define TLS_LEGACY_SUPPORT #endif // SSL_* style blocking APIs #ifndef NO_SSL_COMPATIBLE_INTERFACE #define SSL_COMPATIBLE_INTERFACE #endif // support ChaCha20/Poly1305 #if !defined(__BIG_ENDIAN__) && ((!defined(__BYTE_ORDER)) || (__BYTE_ORDER == __LITTLE_ENDIAN)) // not working on big endian machines #ifndef NO_TLS_WITH_CHACHA20_POLY1305 #define TLS_WITH_CHACHA20_POLY1305 #endif #endif #ifndef NO_TLS_13 #define WITH_TLS_13 #endif // support forward secrecy (Diffie-Hellman ephemeral) #ifndef NO_TLS_FORWARD_SECRECY #define TLS_FORWARD_SECRECY #endif // support client-side ECDHE #ifndef NO_TLS_CLIENT_ECDHE #define TLS_CLIENT_ECDHE #endif // suport ecdsa #ifndef NO_TLS_ECDSA_SUPPORTED #define TLS_ECDSA_SUPPORTED #endif // suport ecdsa client-side // #define TLS_CLIENT_ECDSA // TLS renegotiation is disabled by default (secured or not) // do not uncomment next line! // #define TLS_ACCEPT_SECURE_RENEGOTIATION // basic superficial X509v1 certificate support #ifndef NO_TLS_X509_V1_SUPPORT #define TLS_X509_V1_SUPPORT #endif // disable TLS_RSA_WITH_* ciphers #ifndef NO_TLS_ROBOT_MITIGATION #define TLS_ROBOT_MITIGATION #endif #define SSL_V30 0x0300 #define TLS_V10 0x0301 #define TLS_V11 0x0302 #define TLS_V12 0x0303 #define TLS_V13 0x0304 #define DTLS_V10 0xFEFF #define DTLS_V12 0xFEFD #define DTLS_V13 0xFEFC #define TLS_NEED_MORE_DATA 0 #define TLS_GENERIC_ERROR -1 #define TLS_BROKEN_PACKET -2 #define TLS_NOT_UNDERSTOOD -3 #define TLS_NOT_SAFE -4 #define TLS_NO_COMMON_CIPHER -5 #define TLS_UNEXPECTED_MESSAGE -6 #define TLS_CLOSE_CONNECTION -7 #define TLS_COMPRESSION_NOT_SUPPORTED -8 #define TLS_NO_MEMORY -9 #define TLS_NOT_VERIFIED -10 #define TLS_INTEGRITY_FAILED -11 #define TLS_ERROR_ALERT -12 #define TLS_BROKEN_CONNECTION -13 #define TLS_BAD_CERTIFICATE -14 #define TLS_UNSUPPORTED_CERTIFICATE -15 #define TLS_NO_RENEGOTIATION -16 #define TLS_FEATURE_NOT_SUPPORTED -17 #define TLS_DECRYPTION_FAILED -20 #define TLS_AES_128_GCM_SHA256 0x1301 #define TLS_AES_256_GCM_SHA384 0x1302 #define TLS_CHACHA20_POLY1305_SHA256 0x1303 #define TLS_AES_128_CCM_SHA256 0x1304 #define TLS_AES_128_CCM_8_SHA256 0x1305 #define TLS_RSA_WITH_AES_128_CBC_SHA 0x002F #define TLS_RSA_WITH_AES_256_CBC_SHA 0x0035 #define TLS_RSA_WITH_AES_128_CBC_SHA256 0x003C #define TLS_RSA_WITH_AES_256_CBC_SHA256 0x003D #define TLS_RSA_WITH_AES_128_GCM_SHA256 0x009C #define TLS_RSA_WITH_AES_256_GCM_SHA384 0x009D // forward secrecy #define TLS_DHE_RSA_WITH_AES_128_CBC_SHA 0x0033 #define TLS_DHE_RSA_WITH_AES_256_CBC_SHA 0x0039 #define TLS_DHE_RSA_WITH_AES_128_CBC_SHA256 0x0067 #define TLS_DHE_RSA_WITH_AES_256_CBC_SHA256 0x006B #define TLS_DHE_RSA_WITH_AES_128_GCM_SHA256 0x009E #define TLS_DHE_RSA_WITH_AES_256_GCM_SHA384 0x009F #define TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA 0xC013 #define TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA 0xC014 #define TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256 0xC027 #define TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256 0xC02F #define TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384 0xC030 #define TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA 0xC009 #define TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA 0xC00A #define TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256 0xC023 #define TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA384 0xC024 #define TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256 0xC02B #define TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384 0xC02C #define TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256 0xCCA8 #define TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256 0xCCA9 #define TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256 0xCCAA #define TLS_FALLBACK_SCSV 0x5600 #define TLS_UNSUPPORTED_ALGORITHM 0x00 #define TLS_RSA_SIGN_RSA 0x01 #define TLS_RSA_SIGN_MD5 0x04 #define TLS_RSA_SIGN_SHA1 0x05 #define TLS_RSA_SIGN_SHA256 0x0B #define TLS_RSA_SIGN_SHA384 0x0C #define TLS_RSA_SIGN_SHA512 0x0D #define TLS_ECDSA_SIGN_SHA256 0x0E #define TLS_EC_PUBLIC_KEY 0x11 #define TLS_EC_prime192v1 0x12 #define TLS_EC_prime192v2 0x13 #define TLS_EC_prime192v3 0x14 #define TLS_EC_prime239v1 0x15 #define TLS_EC_prime239v2 0x16 #define TLS_EC_prime239v3 0x17 #define TLS_EC_prime256v1 0x18 #define TLS_EC_secp224r1 21 #define TLS_EC_secp256r1 23 #define TLS_EC_secp384r1 24 #define TLS_EC_secp521r1 25 #define TLS_ALERT_WARNING 0x01 #define TLS_ALERT_CRITICAL 0x02 #ifdef TLS_ROBOT_MITIGATION #define TLS_CIPHERS_SIZE(n, mitigated) n * 2 #else #define TLS_CIPHERS_SIZE(n, mitigated) (n + mitigated) * 2 #endif #ifdef __cplusplus extern "C" { #endif typedef enum { close_notify = 0, unexpected_message = 10, bad_record_mac = 20, decryption_failed_RESERVED = 21, record_overflow = 22, decompression_failure = 30, handshake_failure = 40, no_certificate_RESERVED = 41, bad_certificate = 42, unsupported_certificate = 43, certificate_revoked = 44, certificate_expired = 45, certificate_unknown = 46, illegal_parameter = 47, unknown_ca = 48, access_denied = 49, decode_error = 50, decrypt_error = 51, export_restriction_RESERVED = 60, protocol_version = 70, insufficient_security = 71, internal_error = 80, inappropriate_fallback = 86, user_canceled = 90, no_renegotiation = 100, unsupported_extension = 110, no_error = 255 } TLSAlertDescription; // forward declarations struct TLSPacket; struct TLSCertificate; struct TLSContext; struct ECCCurveParameters; typedef struct TLSContext TLS; typedef struct TLSCertificate Certificate; typedef int (*tls_validation_function)(struct TLSContext *context, struct TLSCertificate **certificate_chain, int len); /* Global initialization. Optional, as it will be called automatically; however, the initialization is not thread-safe, so if you intend to use TLSe from multiple threads, you'll need to call tls_init() once, from a single thread, before using the library. */ void tls_init(); unsigned char *tls_pem_decode(const unsigned char *data_in, unsigned int input_length, int cert_index, unsigned int *output_len); struct TLSCertificate *tls_create_certificate(); int tls_certificate_valid_subject(struct TLSCertificate *cert, const char *subject); int tls_certificate_valid_subject_name(const unsigned char *cert_subject, const char *subject); int tls_certificate_is_valid(struct TLSCertificate *cert); void tls_certificate_set_copy(unsigned char **member, const unsigned char *val, int len); void tls_certificate_set_copy_date(unsigned char **member, const unsigned char *val, int len); void tls_certificate_set_key(struct TLSCertificate *cert, const unsigned char *val, int len); void tls_certificate_set_priv(struct TLSCertificate *cert, const unsigned char *val, int len); void tls_certificate_set_sign_key(struct TLSCertificate *cert, const unsigned char *val, int len); char *tls_certificate_to_string(struct TLSCertificate *cert, char *buffer, int len); void tls_certificate_set_exponent(struct TLSCertificate *cert, const unsigned char *val, int len); void tls_certificate_set_serial(struct TLSCertificate *cert, const unsigned char *val, int len); void tls_certificate_set_algorithm(struct TLSContext *context, unsigned int *algorithm, const unsigned char *val, int len); void tls_destroy_certificate(struct TLSCertificate *cert); struct TLSPacket *tls_create_packet(struct TLSContext *context, unsigned char type, unsigned short version, int payload_size_hint); void tls_destroy_packet(struct TLSPacket *packet); void tls_packet_update(struct TLSPacket *packet); int tls_packet_append(struct TLSPacket *packet, const unsigned char *buf, unsigned int len); int tls_packet_uint8(struct TLSPacket *packet, unsigned char i); int tls_packet_uint16(struct TLSPacket *packet, unsigned short i); int tls_packet_uint32(struct TLSPacket *packet, unsigned int i); int tls_packet_uint24(struct TLSPacket *packet, unsigned int i); int tls_random(unsigned char *key, int len); /* Get encrypted data to write, if any. Once you've sent all of it, call tls_buffer_clear(). */ const unsigned char *tls_get_write_buffer(struct TLSContext *context, unsigned int *outlen); void tls_buffer_clear(struct TLSContext *context); /* Returns 1 for established, 0 for not established yet, and -1 for a critical error. */ int tls_established(struct TLSContext *context); /* Discards any unread decrypted data not consumed by tls_read(). */ void tls_read_clear(struct TLSContext *context); /* Reads any unread decrypted data (see tls_consume_stream). If you don't read all of it, the remainder will be left in the internal buffers for next tls_read(). Returns -1 for fatal error, 0 for no more data, or otherwise the number of bytes copied into the buffer (up to a maximum of the given size). */ int tls_read(struct TLSContext *context, unsigned char *buf, unsigned int size); struct TLSContext *tls_create_context(unsigned char is_server, unsigned short version); const struct ECCCurveParameters *tls_set_curve(struct TLSContext *context, const struct ECCCurveParameters *curve); /* Create a context for a given client, from a server context. Returns NULL on error. */ struct TLSContext *tls_accept(struct TLSContext *context); int tls_set_default_dhe_pg(struct TLSContext *context, const char *p_hex_str, const char *g_hex_str); void tls_destroy_context(struct TLSContext *context); int tls_cipher_supported(struct TLSContext *context, unsigned short cipher); int tls_cipher_is_fs(struct TLSContext *context, unsigned short cipher); int tls_choose_cipher(struct TLSContext *context, const unsigned char *buf, int buf_len, int *scsv_set); int tls_cipher_is_ephemeral(struct TLSContext *context); const char *tls_cipher_name(struct TLSContext *context); int tls_is_ecdsa(struct TLSContext *context); struct TLSPacket *tls_build_client_key_exchange(struct TLSContext *context); struct TLSPacket *tls_build_server_key_exchange(struct TLSContext *context, int method); struct TLSPacket *tls_build_hello(struct TLSContext *context, int tls13_downgrade); struct TLSPacket *tls_certificate_request(struct TLSContext *context); struct TLSPacket *tls_build_verify_request(struct TLSContext *context); int tls_parse_hello(struct TLSContext *context, const unsigned char *buf, int buf_len, unsigned int *write_packets, unsigned int *dtls_verified); int tls_parse_certificate(struct TLSContext *context, const unsigned char *buf, int buf_len, int is_client); int tls_parse_server_key_exchange(struct TLSContext *context, const unsigned char *buf, int buf_len); int tls_parse_client_key_exchange(struct TLSContext *context, const unsigned char *buf, int buf_len); int tls_parse_server_hello_done(struct TLSContext *context, const unsigned char *buf, int buf_len); int tls_parse_finished(struct TLSContext *context, const unsigned char *buf, int buf_len, unsigned int *write_packets); int tls_parse_verify(struct TLSContext *context, const unsigned char *buf, int buf_len); int tls_parse_payload(struct TLSContext *context, const unsigned char *buf, int buf_len, tls_validation_function certificate_verify); int tls_parse_message(struct TLSContext *context, unsigned char *buf, int buf_len, tls_validation_function certificate_verify); int tls_certificate_verify_signature(struct TLSCertificate *cert, struct TLSCertificate *parent); int tls_certificate_chain_is_valid(struct TLSCertificate **certificates, int len); int tls_certificate_chain_is_valid_root(struct TLSContext *context, struct TLSCertificate **certificates, int len); /* Add a certificate or a certificate chain to the given context, in PEM form. Returns a negative value (TLS_GENERIC_ERROR etc.) on error, 0 if there were no certificates in the buffer, or the number of loaded certificates on success. */ int tls_load_certificates(struct TLSContext *context, const unsigned char *pem_buffer, int pem_size); /* Add a private key to the given context, in PEM form. Returns a negative value (TLS_GENERIC_ERROR etc.) on error, 0 if there was no private key in the buffer, or 1 on success. */ int tls_load_private_key(struct TLSContext *context, const unsigned char *pem_buffer, int pem_size); struct TLSPacket *tls_build_certificate(struct TLSContext *context); struct TLSPacket *tls_build_finished(struct TLSContext *context); struct TLSPacket *tls_build_change_cipher_spec(struct TLSContext *context); struct TLSPacket *tls_build_done(struct TLSContext *context); struct TLSPacket *tls_build_message(struct TLSContext *context, const unsigned char *data, unsigned int len); int tls_client_connect(struct TLSContext *context); int tls_write(struct TLSContext *context, const unsigned char *data, unsigned int len); struct TLSPacket *tls_build_alert(struct TLSContext *context, char critical, unsigned char code); /* Process a given number of input bytes from a socket. If the other side just presented a certificate and certificate_verify is not NULL, it will be called. Returns 0 if there's no data ready yet, a negative value (see TLS_GENERIC_ERROR etc.) for an error, or a positive value (the number of bytes used from buf) if one or more complete TLS messages were received. The data is copied into an internal buffer even if not all of it was consumed, so you should not re-send it the next time. Decrypted data, if any, should be read back with tls_read(). Can change the status of tls_established(). If the library has anything to send back on the socket (e.g. as part of the handshake), tls_get_write_buffer() will return non-NULL. */ int tls_consume_stream(struct TLSContext *context, const unsigned char *buf, int buf_len, tls_validation_function certificate_verify); void tls_close_notify(struct TLSContext *context); void tls_alert(struct TLSContext *context, unsigned char critical, int code); /* Whether tls_consume_stream() has data in its buffer that is not processed yet. */ int tls_pending(struct TLSContext *context); /* Set the context as serializable or not. Must be called before negotiation. Exportable contexts use a bit more memory, to be able to hold the keys. Note that imported keys are not reexportable unless TLS_REEXPORTABLE is set. */ void tls_make_exportable(struct TLSContext *context, unsigned char exportable_flag); int tls_export_context(struct TLSContext *context, unsigned char *buffer, unsigned int buf_len, unsigned char small_version); struct TLSContext *tls_import_context(const unsigned char *buffer, unsigned int buf_len); int tls_is_broken(struct TLSContext *context); int tls_request_client_certificate(struct TLSContext *context); int tls_client_verified(struct TLSContext *context); const char *tls_sni(struct TLSContext *context); int tls_sni_set(struct TLSContext *context, const char *sni); int tls_load_root_certificates(struct TLSContext *context, const unsigned char *pem_buffer, int pem_size); int tls_default_verify(struct TLSContext *context, struct TLSCertificate **certificate_chain, int len); void tls_print_certificate(const char *fname); int tls_add_alpn(struct TLSContext *context, const char *alpn); int tls_alpn_contains(struct TLSContext *context, const char *alpn, unsigned char alpn_size); const char *tls_alpn(struct TLSContext *context); // useful when renewing certificates for servers, without the need to restart the server int tls_clear_certificates(struct TLSContext *context); int tls_make_ktls(struct TLSContext *context, int socket); int tls_unmake_ktls(struct TLSContext *context, int socket); /* Creates a new DTLS random cookie secret to be used in HelloVerifyRequest (server-side). It is recommended to call this function from time to time, to protect against some DoS attacks. */ void dtls_reset_cookie_secret(); int tls_remote_error(struct TLSContext *context); #ifdef SSL_COMPATIBLE_INTERFACE #define SSL_SERVER_RSA_CERT 1 #define SSL_SERVER_RSA_KEY 2 typedef struct TLSContext SSL_CTX; typedef struct TLSContext SSL; #define SSL_FILETYPE_PEM 1 #define SSL_VERIFY_NONE 0 #define SSL_VERIFY_PEER 1 #define SSL_VERIFY_FAIL_IF_NO_PEER_CERT 2 #define SSL_VERIFY_CLIENT_ONCE 3 typedef struct { int fd; tls_validation_function certificate_verify; void *recv; void *send; void *user_data; } SSLUserData; int SSL_library_init(); void SSL_load_error_strings(); void OpenSSL_add_all_algorithms(); void OpenSSL_add_all_ciphers(); void OpenSSL_add_all_digests(); void EVP_cleanup(); int SSLv3_server_method(); int SSLv3_client_method(); struct TLSContext *SSL_new(struct TLSContext *context); int SSL_CTX_use_certificate_file(struct TLSContext *context, const char *filename, int dummy); int SSL_CTX_use_PrivateKey_file(struct TLSContext *context, const char *filename, int dummy); int SSL_CTX_check_private_key(struct TLSContext *context); struct TLSContext *SSL_CTX_new(int method); void SSL_free(struct TLSContext *context); void SSL_CTX_free(struct TLSContext *context); int SSL_get_error(struct TLSContext *context, int ret); int SSL_set_fd(struct TLSContext *context, int socket); void *SSL_set_userdata(struct TLSContext *context, void *data); void *SSL_userdata(struct TLSContext *context); int SSL_CTX_root_ca(struct TLSContext *context, const char *pem_filename); void SSL_CTX_set_verify(struct TLSContext *context, int mode, tls_validation_function verify_callback); int SSL_accept(struct TLSContext *context); int SSL_connect(struct TLSContext *context); int SSL_shutdown(struct TLSContext *context); int SSL_write(struct TLSContext *context, const void *buf, unsigned int len); int SSL_read(struct TLSContext *context, void *buf, unsigned int len); int SSL_pending(struct TLSContext *context); int SSL_set_io(struct TLSContext *context, void *recv, void *send); #endif #ifdef TLS_SRTP struct SRTPContext; #define SRTP_NULL 0 #define SRTP_AES_CM 1 #define SRTP_AUTH_NULL 0 #define SRTP_AUTH_HMAC_SHA1 1 struct SRTPContext *srtp_init(unsigned char mode, unsigned char auth_mode); int srtp_key(struct SRTPContext *context, const void *key, int keylen, const void *salt, int saltlen, int tag_bits); int srtp_inline(struct SRTPContext *context, const char *b64, int tag_bits); int srtp_encrypt(struct SRTPContext *context, const unsigned char *pt_header, int pt_len, const unsigned char *payload, unsigned int payload_len, unsigned char *out, int *out_buffer_len); int srtp_decrypt(struct SRTPContext *context, const unsigned char *pt_header, int pt_len, const unsigned char *payload, unsigned int payload_len, unsigned char *out, int *out_buffer_len); void srtp_destroy(struct SRTPContext *context); #endif #ifdef __cplusplus } // extern "C" #endif #endif /* ------------------------------------------------------------------------------ END tlse.h ------------------------------------------------------------------------------ */ #ifndef HTTPS_NO_TLSE /* ------------------------------------------------------------------------------ BEGIN tlse.c ------------------------------------------------------------------------------ */ /******************************************************************************** Copyright (c) 2016-2023, Eduard Suica All rights reserved. Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: 1. Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. 2. Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. ********************************************************************************/ #ifndef TLSE_C #define TLSE_C #include #include #include #include #include #ifdef _WIN32 #ifdef SSL_COMPATIBLE_INTERFACE #include #endif #include #include #ifndef strcasecmp #define strcasecmp stricmp #endif #else // hton* and ntoh* functions #include #include #include #endif #ifdef TLS_AMALGAMATION #ifdef I #pragma push_macro("I") #define TLS_I_MACRO #undef I #endif //#include "libtomcrypt.c" #ifdef TLS_I_MACRO #pragma pop_macro("I") #undef TLS_I_MACRO #endif #else //#include #endif #if (CRYPT <= 0x0117) #define LTC_PKCS_1_EMSA LTC_LTC_PKCS_1_EMSA #define LTC_PKCS_1_V1_5 LTC_LTC_PKCS_1_V1_5 #define LTC_PKCS_1_PSS LTC_LTC_PKCS_1_PSS #endif #ifdef WITH_KTLS #include #include #include // should get /usr/include/linux/tls.h (linux headers) // rename it to ktls.h and add it to your project #include "ktls.h" // or just include tls.h instead of ktls.h // #include "linux/tls.h" #endif //#include "tlse.h" #ifdef TLS_CURVE25519 #include "curve25519.c" #endif // using ChaCha20 implementation by D. J. Bernstein #ifndef TLS_FORWARD_SECRECY #undef TLS_ECDSA_SUPPORTED #endif #ifndef TLS_ECDSA_SUPPORTED // disable client ECDSA if not supported #undef TLS_CLIENT_ECDSA #endif #define TLS_DH_DEFAULT_P "87A8E61DB4B6663CFFBBD19C651959998CEEF608660DD0F25D2CEED4435E3B00E00DF8F1D61957D4FAF7DF4561B2AA3016C3D91134096FAA3BF4296D830E9A7C209E0C6497517ABD5A8A9D306BCF67ED91F9E6725B4758C022E0B1EF4275BF7B6C5BFC11D45F9088B941F54EB1E59BB8BC39A0BF12307F5C4FDB70C581B23F76B63ACAE1CAA6B7902D52526735488A0EF13C6D9A51BFA4AB3AD8347796524D8EF6A167B5A41825D967E144E5140564251CCACB83E6B486F6B3CA3F7971506026C0B857F689962856DED4010ABD0BE621C3A3960A54E710C375F26375D7014103A4B54330C198AF126116D2276E11715F693877FAD7EF09CADB094AE91E1A1597" #define TLS_DH_DEFAULT_G "3FB32C9B73134D0B2E77506660EDBD484CA7B18F21EF205407F4793A1A0BA12510DBC15077BE463FFF4FED4AAC0BB555BE3A6C1B0C6B47B1BC3773BF7E8C6F62901228F8C28CBB18A55AE31341000A650196F931C77A57F2DDF463E5E9EC144B777DE62AAAB8A8628AC376D282D6ED3864E67982428EBC831D14348F6F2F9193B5045AF2767164E1DFC967C1FB3F2E55A4BD1BFFE83B9C80D052B985D182EA0ADB2A3B7313D3FE14C8484B1E052588B9B7D2BBD2DF016199ECD06E1557CD0915B3353BBB64E0EC377FD028370DF92B52C7891428CDC67EB6184B523D1DB246C32F63078490F00EF8D647D148D47954515E2327CFEF98C582664B4C0F6CC41659" #define TLS_DHE_KEY_SIZE 2048 // you should never use weak DH groups (1024 bits) // but if you have old devices (like grandstream ip phones) // that can't handle 2048bit DHE, uncomment next lines // and define TLS_WEAK_DH_LEGACY_DEVICES // #ifdef TLS_WEAK_DH_LEGACY_DEVICES // #define TLS_DH_DEFAULT_P "B10B8F96A080E01DDE92DE5EAE5D54EC52C99FBCFB06A3C69A6A9DCA52D23B616073E28675A23D189838EF1E2EE652C013ECB4AEA906112324975C3CD49B83BFACCBDD7D90C4BD7098488E9C219A73724EFFD6FAE5644738FAA31A4FF55BCCC0A151AF5F0DC8B4BD45BF37DF365C1A65E68CFDA76D4DA708DF1FB2BC2E4A4371" // #define TLS_DH_DEFAULT_G "A4D1CBD5C3FD34126765A442EFB99905F8104DD258AC507FD6406CFF14266D31266FEA1E5C41564B777E690F5504F213160217B4B01B886A5E91547F9E2749F4D7FBD7D3B9A92EE1909D0D2263F80A76A6A24C087A091F531DBF0A0169B6A28AD662A4D18E73AFA32D779D5918D08BC8858F4DCEF97C2A24855E6EEB22B3B2E5" // #define TLS_DHE_KEY_SIZE 1024 // #endif #ifndef TLS_MALLOC #define TLS_MALLOC MALLOC //< @r-lyeh #endif #ifndef TLS_REALLOC #define TLS_REALLOC REALLOC //< @r-lyeh #endif #ifndef TLS_FREE #define TLS_FREE FREE //< @r-lyeh #endif #define TLS_ERROR(err, statement) if (err) statement; #ifdef DEBUG #define DEBUG_PRINT(...) fprintf(stderr, __VA_ARGS__) #define DEBUG_DUMP_HEX(buf, len) {if (buf) { int _i_; for (_i_ = 0; _i_ < len; _i_++) { DEBUG_PRINT("%02X ", (unsigned int)(buf)[_i_]); } } else { fprintf(stderr, "(null)"); } } #define DEBUG_INDEX(fields) print_index(fields) #define DEBUG_DUMP(buf, length) fwrite(buf, 1, length, stderr); #define DEBUG_DUMP_HEX_LABEL(title, buf, len) {fprintf(stderr, "%s (%i): ", title, (int)len); DEBUG_DUMP_HEX(buf, len); fprintf(stderr, "\n");} #else #define DEBUG_PRINT(...) { } #define DEBUG_DUMP_HEX(buf, len) { } #define DEBUG_INDEX(fields) { } #define DEBUG_DUMP(buf, length) { } #define DEBUG_DUMP_HEX_LABEL(title, buf, len) { } #endif #ifndef htonll #define htonll(x) ((1==htonl(1)) ? (x) : ((uint64_t)htonl((x) & 0xFFFFFFFF) << 32) | htonl((x) >> 32)) #endif #ifndef ntohll #define ntohll(x) ((1==ntohl(1)) ? (x) : ((uint64_t)ntohl((x) & 0xFFFFFFFF) << 32) | ntohl((x) >> 32)) #endif #define TLS_CHANGE_CIPHER 0x14 #define TLS_ALERT 0x15 #define TLS_HANDSHAKE 0x16 #define TLS_APPLICATION_DATA 0x17 #define TLS_SERIALIZED_OBJECT 0xFE #define TLS_CLIENT_HELLO_MINSIZE 41 #define TLS_CLIENT_RANDOM_SIZE 32 #define TLS_SERVER_RANDOM_SIZE 32 #define TLS_MAX_SESSION_ID 32 #define TLS_SHA256_MAC_SIZE 32 #define TLS_SHA1_MAC_SIZE 20 #define TLS_SHA384_MAC_SIZE 48 #define TLS_MAX_MAC_SIZE TLS_SHA384_MAC_SIZE // 160 #define TLS_MAX_KEY_EXPANSION_SIZE 192 // 512bits (sha256) = 64 bytes #define TLS_MAX_HASH_LEN 64 #define TLS_AES_IV_LENGTH 16 #define TLS_AES_BLOCK_SIZE 16 #define TLS_AES_GCM_IV_LENGTH 4 #define TLS_13_AES_GCM_IV_LENGTH 12 #define TLS_GCM_TAG_LEN 16 #define TLS_MAX_TAG_LEN 16 #define TLS_MIN_FINISHED_OPAQUE_LEN 12 #define TLS_BLOB_INCREMENT 0xFFF #define TLS_ASN1_MAXLEVEL 0xFF #define DTLS_COOKIE_SIZE 32 #define TLS_MAX_SHA_SIZE 48 // 16(md5) + 20(sha1) #define TLS_V11_HASH_SIZE 36 #define TLS_MAX_HASH_SIZE TLS_MAX_SHA_SIZE // 16(md5) + 20(sha1) #define TLS_MAX_RSA_KEY 2048 #define TLS_MAXTLS_APP_SIZE 0x4000 // max 1 second sleep #define TLS_MAX_ERROR_SLEEP_uS 1000000 // max 5 seconds context sleep #define TLS_MAX_ERROR_IDLE_S 5 #define TLS_V13_MAX_KEY_SIZE 32 #define TLS_V13_MAX_IV_SIZE 12 #define VERSION_SUPPORTED(version, err) if ((version != TLS_V13) && (version != TLS_V12) && (version != TLS_V11) && (version != TLS_V10) && (version != DTLS_V13) && (version != DTLS_V12) && (version != DTLS_V10)) { if ((version == SSL_V30) && (context->connection_status == 0)) { version = TLS_V12; } else { DEBUG_PRINT("UNSUPPORTED TLS VERSION %x\n", (int)version); return err;} } #define CHECK_SIZE(size, buf_size, err) if (((int)(size) > (int)(buf_size)) || ((int)(buf_size) < 0)) return err; #define TLS_IMPORT_CHECK_SIZE(buf_pos, size, buf_size) if (((int)size > (int)buf_size - buf_pos) || ((int)buf_pos > (int)buf_size)) { DEBUG_PRINT("IMPORT ELEMENT SIZE ERROR\n"); tls_destroy_context(context); return NULL; } #define CHECK_HANDSHAKE_STATE(context, n, limit) { if (context->hs_messages[n] >= limit) { DEBUG_PRINT("* UNEXPECTED MESSAGE (%i)\n", (int)n); payload_res = TLS_UNEXPECTED_MESSAGE; break; } context->hs_messages[n]++; } #if CRYPT > 0x0118 #define TLS_TOMCRYPT_PRIVATE_DP(key) ((key).dp) #define TLS_TOMCRYPT_PRIVATE_SET_INDEX(key, k_idx) #else #define TLS_TOMCRYPT_PRIVATE_DP(key) ((key)->dp) #define TLS_TOMCRYPT_PRIVATE_SET_INDEX(key, k_idx) key->idx = k_idx #endif #ifdef TLS_WITH_CHACHA20_POLY1305 #define TLS_CHACHA20_IV_LENGTH 12 // ChaCha20 implementation by D. J. Bernstein // Public domain. #define CHACHA_MINKEYLEN 16 #define CHACHA_NONCELEN 8 #define CHACHA_NONCELEN_96 12 #define CHACHA_CTRLEN 8 #define CHACHA_CTRLEN_96 4 #define CHACHA_STATELEN (CHACHA_NONCELEN+CHACHA_CTRLEN) #define CHACHA_BLOCKLEN 64 #define POLY1305_MAX_AAD 32 #define POLY1305_KEYLEN 32 #define POLY1305_TAGLEN 16 #define u_int unsigned int #define uint8_t unsigned char #define u_char unsigned char #ifndef NULL #define NULL (void *)0 #endif #if (CRYPT >= 0x0117) && (0) // to do: use ltc chacha/poly1305 implementation (working on big-endian machines) #define chacha_ctx chacha20poly1305_state #define poly1305_context poly1305_state #define _private_tls_poly1305_init(ctx, key, len) poly1305_init(ctx, key, len) #define _private_tls_poly1305_update(ctx, in, len) poly1305_process(ctx, in, len) #define _private_tls_poly1305_finish(ctx, mac) poly1305_done(ctx, mac, 16) #else struct chacha_ctx { u_int input[16]; uint8_t ks[CHACHA_BLOCKLEN]; uint8_t unused; }; static inline void chacha_keysetup(struct chacha_ctx *x, const u_char *k, u_int kbits); static inline void chacha_ivsetup(struct chacha_ctx *x, const u_char *iv, const u_char *ctr); static inline void chacha_ivsetup_96bitnonce(struct chacha_ctx *x, const u_char *iv, const u_char *ctr); static inline void chacha_encrypt_bytes(struct chacha_ctx *x, const u_char *m, u_char *c, u_int bytes); static inline int poly1305_generate_key(unsigned char *key256, unsigned char *nonce, unsigned int noncelen, unsigned char *poly_key, unsigned int counter); #define poly1305_block_size 16 #define poly1305_context poly1305_state_internal_t //========== ChaCha20 from D. J. Bernstein ========= // // Source available at https://cr.yp.to/chacha.html // typedef unsigned char u8; typedef unsigned int u32; typedef struct chacha_ctx chacha_ctx; #define U8C(v) (v##U) #define U32C(v) (v##U) #define U8V(v) ((u8)(v) & U8C(0xFF)) #define U32V(v) ((u32)(v) & U32C(0xFFFFFFFF)) #define ROTL32(v, n) \ (U32V((v) << (n)) | ((v) >> (32 - (n)))) #define _private_tls_U8TO32_LITTLE(p) \ (((u32)((p)[0])) | \ ((u32)((p)[1]) << 8) | \ ((u32)((p)[2]) << 16) | \ ((u32)((p)[3]) << 24)) #define _private_tls_U32TO8_LITTLE(p, v) \ do { \ (p)[0] = U8V((v)); \ (p)[1] = U8V((v) >> 8); \ (p)[2] = U8V((v) >> 16); \ (p)[3] = U8V((v) >> 24); \ } while (0) #define ROTATE(v,c) (ROTL32(v,c)) #define XOR(v,w) ((v) ^ (w)) #define PLUS(v,w) (U32V((v) + (w))) #define PLUSONE(v) (PLUS((v),1)) #define QUARTERROUND(a,b,c,d) \ a = PLUS(a,b); d = ROTATE(XOR(d,a),16); \ c = PLUS(c,d); b = ROTATE(XOR(b,c),12); \ a = PLUS(a,b); d = ROTATE(XOR(d,a), 8); \ c = PLUS(c,d); b = ROTATE(XOR(b,c), 7); static const char sigma[] = "expand 32-byte k"; static const char tau[] = "expand 16-byte k"; static inline void chacha_keysetup(chacha_ctx *x, const u8 *k, u32 kbits) { const char *constants; x->input[4] = _private_tls_U8TO32_LITTLE(k + 0); x->input[5] = _private_tls_U8TO32_LITTLE(k + 4); x->input[6] = _private_tls_U8TO32_LITTLE(k + 8); x->input[7] = _private_tls_U8TO32_LITTLE(k + 12); if (kbits == 256) { /* recommended */ k += 16; constants = sigma; } else { /* kbits == 128 */ constants = tau; } x->input[8] = _private_tls_U8TO32_LITTLE(k + 0); x->input[9] = _private_tls_U8TO32_LITTLE(k + 4); x->input[10] = _private_tls_U8TO32_LITTLE(k + 8); x->input[11] = _private_tls_U8TO32_LITTLE(k + 12); x->input[0] = _private_tls_U8TO32_LITTLE(constants + 0); x->input[1] = _private_tls_U8TO32_LITTLE(constants + 4); x->input[2] = _private_tls_U8TO32_LITTLE(constants + 8); x->input[3] = _private_tls_U8TO32_LITTLE(constants + 12); } static inline void chacha_key(chacha_ctx *x, u8 *k) { _private_tls_U32TO8_LITTLE(k, x->input[4]); _private_tls_U32TO8_LITTLE(k + 4, x->input[5]); _private_tls_U32TO8_LITTLE(k + 8, x->input[6]); _private_tls_U32TO8_LITTLE(k + 12, x->input[7]); _private_tls_U32TO8_LITTLE(k + 16, x->input[8]); _private_tls_U32TO8_LITTLE(k + 20, x->input[9]); _private_tls_U32TO8_LITTLE(k + 24, x->input[10]); _private_tls_U32TO8_LITTLE(k + 28, x->input[11]); } static inline void chacha_nonce(chacha_ctx *x, u8 *nonce) { _private_tls_U32TO8_LITTLE(nonce + 0, x->input[13]); _private_tls_U32TO8_LITTLE(nonce + 4, x->input[14]); _private_tls_U32TO8_LITTLE(nonce + 8, x->input[15]); } static inline void chacha_ivsetup(chacha_ctx *x, const u8 *iv, const u8 *counter) { x->input[12] = counter == NULL ? 0 : _private_tls_U8TO32_LITTLE(counter + 0); x->input[13] = counter == NULL ? 0 : _private_tls_U8TO32_LITTLE(counter + 4); if (iv) { x->input[14] = _private_tls_U8TO32_LITTLE(iv + 0); x->input[15] = _private_tls_U8TO32_LITTLE(iv + 4); } } static inline void chacha_ivsetup_96bitnonce(chacha_ctx *x, const u8 *iv, const u8 *counter) { x->input[12] = counter == NULL ? 0 : _private_tls_U8TO32_LITTLE(counter + 0); if (iv) { x->input[13] = _private_tls_U8TO32_LITTLE(iv + 0); x->input[14] = _private_tls_U8TO32_LITTLE(iv + 4); x->input[15] = _private_tls_U8TO32_LITTLE(iv + 8); } } static inline void chacha_ivupdate(chacha_ctx *x, const u8 *iv, const u8 *aad, const u8 *counter) { x->input[12] = counter == NULL ? 0 : _private_tls_U8TO32_LITTLE(counter + 0); x->input[13] = _private_tls_U8TO32_LITTLE(iv + 0); x->input[14] = _private_tls_U8TO32_LITTLE(iv + 4) ^ _private_tls_U8TO32_LITTLE(aad); x->input[15] = _private_tls_U8TO32_LITTLE(iv + 8) ^ _private_tls_U8TO32_LITTLE(aad + 4); } static inline void chacha_encrypt_bytes(chacha_ctx *x, const u8 *m, u8 *c, u32 bytes) { u32 x0, x1, x2, x3, x4, x5, x6, x7; u32 x8, x9, x10, x11, x12, x13, x14, x15; u32 j0, j1, j2, j3, j4, j5, j6, j7; u32 j8, j9, j10, j11, j12, j13, j14, j15; u8 *ctarget = NULL; u8 tmp[64]; u_int i; if (!bytes) return; j0 = x->input[0]; j1 = x->input[1]; j2 = x->input[2]; j3 = x->input[3]; j4 = x->input[4]; j5 = x->input[5]; j6 = x->input[6]; j7 = x->input[7]; j8 = x->input[8]; j9 = x->input[9]; j10 = x->input[10]; j11 = x->input[11]; j12 = x->input[12]; j13 = x->input[13]; j14 = x->input[14]; j15 = x->input[15]; for (;;) { if (bytes < 64) { for (i = 0; i < bytes; ++i) tmp[i] = m[i]; m = tmp; ctarget = c; c = tmp; } x0 = j0; x1 = j1; x2 = j2; x3 = j3; x4 = j4; x5 = j5; x6 = j6; x7 = j7; x8 = j8; x9 = j9; x10 = j10; x11 = j11; x12 = j12; x13 = j13; x14 = j14; x15 = j15; for (i = 20; i > 0; i -= 2) { QUARTERROUND(x0, x4, x8, x12) QUARTERROUND(x1, x5, x9, x13) QUARTERROUND(x2, x6, x10, x14) QUARTERROUND(x3, x7, x11, x15) QUARTERROUND(x0, x5, x10, x15) QUARTERROUND(x1, x6, x11, x12) QUARTERROUND(x2, x7, x8, x13) QUARTERROUND(x3, x4, x9, x14) } x0 = PLUS(x0, j0); x1 = PLUS(x1, j1); x2 = PLUS(x2, j2); x3 = PLUS(x3, j3); x4 = PLUS(x4, j4); x5 = PLUS(x5, j5); x6 = PLUS(x6, j6); x7 = PLUS(x7, j7); x8 = PLUS(x8, j8); x9 = PLUS(x9, j9); x10 = PLUS(x10, j10); x11 = PLUS(x11, j11); x12 = PLUS(x12, j12); x13 = PLUS(x13, j13); x14 = PLUS(x14, j14); x15 = PLUS(x15, j15); if (bytes < 64) { _private_tls_U32TO8_LITTLE(x->ks + 0, x0); _private_tls_U32TO8_LITTLE(x->ks + 4, x1); _private_tls_U32TO8_LITTLE(x->ks + 8, x2); _private_tls_U32TO8_LITTLE(x->ks + 12, x3); _private_tls_U32TO8_LITTLE(x->ks + 16, x4); _private_tls_U32TO8_LITTLE(x->ks + 20, x5); _private_tls_U32TO8_LITTLE(x->ks + 24, x6); _private_tls_U32TO8_LITTLE(x->ks + 28, x7); _private_tls_U32TO8_LITTLE(x->ks + 32, x8); _private_tls_U32TO8_LITTLE(x->ks + 36, x9); _private_tls_U32TO8_LITTLE(x->ks + 40, x10); _private_tls_U32TO8_LITTLE(x->ks + 44, x11); _private_tls_U32TO8_LITTLE(x->ks + 48, x12); _private_tls_U32TO8_LITTLE(x->ks + 52, x13); _private_tls_U32TO8_LITTLE(x->ks + 56, x14); _private_tls_U32TO8_LITTLE(x->ks + 60, x15); } x0 = XOR(x0, _private_tls_U8TO32_LITTLE(m + 0)); x1 = XOR(x1, _private_tls_U8TO32_LITTLE(m + 4)); x2 = XOR(x2, _private_tls_U8TO32_LITTLE(m + 8)); x3 = XOR(x3, _private_tls_U8TO32_LITTLE(m + 12)); x4 = XOR(x4, _private_tls_U8TO32_LITTLE(m + 16)); x5 = XOR(x5, _private_tls_U8TO32_LITTLE(m + 20)); x6 = XOR(x6, _private_tls_U8TO32_LITTLE(m + 24)); x7 = XOR(x7, _private_tls_U8TO32_LITTLE(m + 28)); x8 = XOR(x8, _private_tls_U8TO32_LITTLE(m + 32)); x9 = XOR(x9, _private_tls_U8TO32_LITTLE(m + 36)); x10 = XOR(x10, _private_tls_U8TO32_LITTLE(m + 40)); x11 = XOR(x11, _private_tls_U8TO32_LITTLE(m + 44)); x12 = XOR(x12, _private_tls_U8TO32_LITTLE(m + 48)); x13 = XOR(x13, _private_tls_U8TO32_LITTLE(m + 52)); x14 = XOR(x14, _private_tls_U8TO32_LITTLE(m + 56)); x15 = XOR(x15, _private_tls_U8TO32_LITTLE(m + 60)); j12 = PLUSONE(j12); if (!j12) { j13 = PLUSONE(j13); /* * Stopping at 2^70 bytes per nonce is the user's * responsibility. */ } _private_tls_U32TO8_LITTLE(c + 0, x0); _private_tls_U32TO8_LITTLE(c + 4, x1); _private_tls_U32TO8_LITTLE(c + 8, x2); _private_tls_U32TO8_LITTLE(c + 12, x3); _private_tls_U32TO8_LITTLE(c + 16, x4); _private_tls_U32TO8_LITTLE(c + 20, x5); _private_tls_U32TO8_LITTLE(c + 24, x6); _private_tls_U32TO8_LITTLE(c + 28, x7); _private_tls_U32TO8_LITTLE(c + 32, x8); _private_tls_U32TO8_LITTLE(c + 36, x9); _private_tls_U32TO8_LITTLE(c + 40, x10); _private_tls_U32TO8_LITTLE(c + 44, x11); _private_tls_U32TO8_LITTLE(c + 48, x12); _private_tls_U32TO8_LITTLE(c + 52, x13); _private_tls_U32TO8_LITTLE(c + 56, x14); _private_tls_U32TO8_LITTLE(c + 60, x15); if (bytes <= 64) { if (bytes < 64) { for (i = 0; i < bytes; ++i) ctarget[i] = c[i]; } x->input[12] = j12; x->input[13] = j13; x->unused = 64 - bytes; return; } bytes -= 64; c += 64; m += 64; } } static inline void chacha20_block(chacha_ctx *x, unsigned char *c, u_int len) { u_int i; unsigned int state[16]; for (i = 0; i < 16; i++) state[i] = x->input[i]; for (i = 20; i > 0; i -= 2) { QUARTERROUND(state[0], state[4], state[8], state[12]) QUARTERROUND(state[1], state[5], state[9], state[13]) QUARTERROUND(state[2], state[6], state[10], state[14]) QUARTERROUND(state[3], state[7], state[11], state[15]) QUARTERROUND(state[0], state[5], state[10], state[15]) QUARTERROUND(state[1], state[6], state[11], state[12]) QUARTERROUND(state[2], state[7], state[8], state[13]) QUARTERROUND(state[3], state[4], state[9], state[14]) } for (i = 0; i < 16; i++) x->input[i] = PLUS(x->input[i], state[i]); for (i = 0; i < len; i += 4) { _private_tls_U32TO8_LITTLE(c + i, x->input[i/4]); } } static inline int poly1305_generate_key(unsigned char *key256, unsigned char *nonce, unsigned int noncelen, unsigned char *poly_key, unsigned int counter) { struct chacha_ctx ctx; uint64_t ctr; memset(&ctx, 0, sizeof(ctx)); chacha_keysetup(&ctx, key256, 256); switch (noncelen) { case 8: ctr = counter; chacha_ivsetup(&ctx, nonce, (unsigned char *)&ctr); break; case 12: chacha_ivsetup_96bitnonce(&ctx, nonce, (unsigned char *)&counter); break; default: return -1; } chacha20_block(&ctx, poly_key, POLY1305_KEYLEN); return 0; } /* 17 + sizeof(size_t) + 14*sizeof(unsigned long) */ typedef struct poly1305_state_internal_t { unsigned long r[5]; unsigned long h[5]; unsigned long pad[4]; size_t leftover; unsigned char buffer[poly1305_block_size]; unsigned char final; } poly1305_state_internal_t; /* interpret four 8 bit unsigned integers as a 32 bit unsigned integer in little endian */ static unsigned long _private_tls_U8TO32(const unsigned char *p) { return (((unsigned long)(p[0] & 0xff) ) | ((unsigned long)(p[1] & 0xff) << 8) | ((unsigned long)(p[2] & 0xff) << 16) | ((unsigned long)(p[3] & 0xff) << 24)); } /* store a 32 bit unsigned integer as four 8 bit unsigned integers in little endian */ static void _private_tls_U32TO8(unsigned char *p, unsigned long v) { p[0] = (v ) & 0xff; p[1] = (v >> 8) & 0xff; p[2] = (v >> 16) & 0xff; p[3] = (v >> 24) & 0xff; } void _private_tls_poly1305_init(poly1305_context *ctx, const unsigned char key[32]) { poly1305_state_internal_t *st = (poly1305_state_internal_t *)ctx; /* r &= 0xffffffc0ffffffc0ffffffc0fffffff */ st->r[0] = (_private_tls_U8TO32(&key[ 0]) ) & 0x3ffffff; st->r[1] = (_private_tls_U8TO32(&key[ 3]) >> 2) & 0x3ffff03; st->r[2] = (_private_tls_U8TO32(&key[ 6]) >> 4) & 0x3ffc0ff; st->r[3] = (_private_tls_U8TO32(&key[ 9]) >> 6) & 0x3f03fff; st->r[4] = (_private_tls_U8TO32(&key[12]) >> 8) & 0x00fffff; /* h = 0 */ st->h[0] = 0; st->h[1] = 0; st->h[2] = 0; st->h[3] = 0; st->h[4] = 0; /* save pad for later */ st->pad[0] = _private_tls_U8TO32(&key[16]); st->pad[1] = _private_tls_U8TO32(&key[20]); st->pad[2] = _private_tls_U8TO32(&key[24]); st->pad[3] = _private_tls_U8TO32(&key[28]); st->leftover = 0; st->final = 0; } static void _private_tls_poly1305_blocks(poly1305_state_internal_t *st, const unsigned char *m, size_t bytes) { const unsigned long hibit = (st->final) ? 0 : (1UL << 24); /* 1 << 128 */ unsigned long r0,r1,r2,r3,r4; unsigned long s1,s2,s3,s4; unsigned long h0,h1,h2,h3,h4; unsigned long long d0,d1,d2,d3,d4; unsigned long c; r0 = st->r[0]; r1 = st->r[1]; r2 = st->r[2]; r3 = st->r[3]; r4 = st->r[4]; s1 = r1 * 5; s2 = r2 * 5; s3 = r3 * 5; s4 = r4 * 5; h0 = st->h[0]; h1 = st->h[1]; h2 = st->h[2]; h3 = st->h[3]; h4 = st->h[4]; while (bytes >= poly1305_block_size) { /* h += m[i] */ h0 += (_private_tls_U8TO32(m+ 0) ) & 0x3ffffff; h1 += (_private_tls_U8TO32(m+ 3) >> 2) & 0x3ffffff; h2 += (_private_tls_U8TO32(m+ 6) >> 4) & 0x3ffffff; h3 += (_private_tls_U8TO32(m+ 9) >> 6) & 0x3ffffff; h4 += (_private_tls_U8TO32(m+12) >> 8) | hibit; /* h *= r */ d0 = ((unsigned long long)h0 * r0) + ((unsigned long long)h1 * s4) + ((unsigned long long)h2 * s3) + ((unsigned long long)h3 * s2) + ((unsigned long long)h4 * s1); d1 = ((unsigned long long)h0 * r1) + ((unsigned long long)h1 * r0) + ((unsigned long long)h2 * s4) + ((unsigned long long)h3 * s3) + ((unsigned long long)h4 * s2); d2 = ((unsigned long long)h0 * r2) + ((unsigned long long)h1 * r1) + ((unsigned long long)h2 * r0) + ((unsigned long long)h3 * s4) + ((unsigned long long)h4 * s3); d3 = ((unsigned long long)h0 * r3) + ((unsigned long long)h1 * r2) + ((unsigned long long)h2 * r1) + ((unsigned long long)h3 * r0) + ((unsigned long long)h4 * s4); d4 = ((unsigned long long)h0 * r4) + ((unsigned long long)h1 * r3) + ((unsigned long long)h2 * r2) + ((unsigned long long)h3 * r1) + ((unsigned long long)h4 * r0); /* (partial) h %= p */ c = (unsigned long)(d0 >> 26); h0 = (unsigned long)d0 & 0x3ffffff; d1 += c; c = (unsigned long)(d1 >> 26); h1 = (unsigned long)d1 & 0x3ffffff; d2 += c; c = (unsigned long)(d2 >> 26); h2 = (unsigned long)d2 & 0x3ffffff; d3 += c; c = (unsigned long)(d3 >> 26); h3 = (unsigned long)d3 & 0x3ffffff; d4 += c; c = (unsigned long)(d4 >> 26); h4 = (unsigned long)d4 & 0x3ffffff; h0 += c * 5; c = (h0 >> 26); h0 = h0 & 0x3ffffff; h1 += c; m += poly1305_block_size; bytes -= poly1305_block_size; } st->h[0] = h0; st->h[1] = h1; st->h[2] = h2; st->h[3] = h3; st->h[4] = h4; } void _private_tls_poly1305_finish(poly1305_context *ctx, unsigned char mac[16]) { poly1305_state_internal_t *st = (poly1305_state_internal_t *)ctx; unsigned long h0,h1,h2,h3,h4,c; unsigned long g0,g1,g2,g3,g4; unsigned long long f; unsigned long mask; /* process the remaining block */ if (st->leftover) { size_t i = st->leftover; st->buffer[i++] = 1; for (; i < poly1305_block_size; i++) st->buffer[i] = 0; st->final = 1; _private_tls_poly1305_blocks(st, st->buffer, poly1305_block_size); } /* fully carry h */ h0 = st->h[0]; h1 = st->h[1]; h2 = st->h[2]; h3 = st->h[3]; h4 = st->h[4]; c = h1 >> 26; h1 = h1 & 0x3ffffff; h2 += c; c = h2 >> 26; h2 = h2 & 0x3ffffff; h3 += c; c = h3 >> 26; h3 = h3 & 0x3ffffff; h4 += c; c = h4 >> 26; h4 = h4 & 0x3ffffff; h0 += c * 5; c = h0 >> 26; h0 = h0 & 0x3ffffff; h1 += c; /* compute h + -p */ g0 = h0 + 5; c = g0 >> 26; g0 &= 0x3ffffff; g1 = h1 + c; c = g1 >> 26; g1 &= 0x3ffffff; g2 = h2 + c; c = g2 >> 26; g2 &= 0x3ffffff; g3 = h3 + c; c = g3 >> 26; g3 &= 0x3ffffff; g4 = h4 + c - (1UL << 26); /* select h if h < p, or h + -p if h >= p */ mask = (g4 >> ((sizeof(unsigned long) * 8) - 1)) - 1; g0 &= mask; g1 &= mask; g2 &= mask; g3 &= mask; g4 &= mask; mask = ~mask; h0 = (h0 & mask) | g0; h1 = (h1 & mask) | g1; h2 = (h2 & mask) | g2; h3 = (h3 & mask) | g3; h4 = (h4 & mask) | g4; /* h = h % (2^128) */ h0 = ((h0 ) | (h1 << 26)) & 0xffffffff; h1 = ((h1 >> 6) | (h2 << 20)) & 0xffffffff; h2 = ((h2 >> 12) | (h3 << 14)) & 0xffffffff; h3 = ((h3 >> 18) | (h4 << 8)) & 0xffffffff; /* mac = (h + pad) % (2^128) */ f = (unsigned long long)h0 + st->pad[0] ; h0 = (unsigned long)f; f = (unsigned long long)h1 + st->pad[1] + (f >> 32); h1 = (unsigned long)f; f = (unsigned long long)h2 + st->pad[2] + (f >> 32); h2 = (unsigned long)f; f = (unsigned long long)h3 + st->pad[3] + (f >> 32); h3 = (unsigned long)f; _private_tls_U32TO8(mac + 0, h0); _private_tls_U32TO8(mac + 4, h1); _private_tls_U32TO8(mac + 8, h2); _private_tls_U32TO8(mac + 12, h3); /* zero out the state */ st->h[0] = 0; st->h[1] = 0; st->h[2] = 0; st->h[3] = 0; st->h[4] = 0; st->r[0] = 0; st->r[1] = 0; st->r[2] = 0; st->r[3] = 0; st->r[4] = 0; st->pad[0] = 0; st->pad[1] = 0; st->pad[2] = 0; st->pad[3] = 0; } void _private_tls_poly1305_update(poly1305_context *ctx, const unsigned char *m, size_t bytes) { poly1305_state_internal_t *st = (poly1305_state_internal_t *)ctx; size_t i; /* handle leftover */ if (st->leftover) { size_t want = (poly1305_block_size - st->leftover); if (want > bytes) want = bytes; for (i = 0; i < want; i++) st->buffer[st->leftover + i] = m[i]; bytes -= want; m += want; st->leftover += want; if (st->leftover < poly1305_block_size) return; _private_tls_poly1305_blocks(st, st->buffer, poly1305_block_size); st->leftover = 0; } /* process full blocks */ if (bytes >= poly1305_block_size) { size_t want = (bytes & ~(poly1305_block_size - 1)); _private_tls_poly1305_blocks(st, m, want); m += want; bytes -= want; } /* store leftover */ if (bytes) { for (i = 0; i < bytes; i++) st->buffer[st->leftover + i] = m[i]; st->leftover += bytes; } } int poly1305_verify(const unsigned char mac1[16], const unsigned char mac2[16]) { size_t i; unsigned int dif = 0; for (i = 0; i < 16; i++) dif |= (mac1[i] ^ mac2[i]); dif = (dif - 1) >> ((sizeof(unsigned int) * 8) - 1); return (dif & 1); } void chacha20_poly1305_key(struct chacha_ctx *ctx, unsigned char *poly1305_key) { unsigned char key[32]; unsigned char nonce[12]; chacha_key(ctx, key); chacha_nonce(ctx, nonce); poly1305_generate_key(key, nonce, sizeof(nonce), poly1305_key, 0); } int chacha20_poly1305_aead(struct chacha_ctx *ctx, unsigned char *pt, unsigned int len, unsigned char *aad, unsigned int aad_len, unsigned char *poly_key, unsigned char *out) { static unsigned char zeropad[] = {0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0}; if (aad_len > POLY1305_MAX_AAD) return -1; unsigned int counter = 1; chacha_ivsetup_96bitnonce(ctx, NULL, (unsigned char *)&counter); chacha_encrypt_bytes(ctx, pt, out, len); poly1305_context aead_ctx; _private_tls_poly1305_init(&aead_ctx, poly_key); _private_tls_poly1305_update(&aead_ctx, aad, aad_len); int rem = aad_len % 16; if (rem) _private_tls_poly1305_update(&aead_ctx, zeropad, 16 - rem); _private_tls_poly1305_update(&aead_ctx, out, len); rem = len % 16; if (rem) _private_tls_poly1305_update(&aead_ctx, zeropad, 16 - rem); unsigned char trail[16]; _private_tls_U32TO8(trail, aad_len); *(int *)(trail + 4) = 0; _private_tls_U32TO8(trail + 8, len); *(int *)(trail + 12) = 0; _private_tls_poly1305_update(&aead_ctx, trail, 16); _private_tls_poly1305_finish(&aead_ctx, out + len); return len + POLY1305_TAGLEN; } #endif #endif typedef enum { KEA_dhe_dss, KEA_dhe_rsa, KEA_dh_anon, KEA_rsa, KEA_dh_dss, KEA_dh_rsa, KEA_ec_diffie_hellman } KeyExchangeAlgorithm; typedef enum { rsa_sign = 1, dss_sign = 2, rsa_fixed_dh = 3, dss_fixed_dh = 4, rsa_ephemeral_dh_RESERVED = 5, dss_ephemeral_dh_RESERVED = 6, fortezza_dms_RESERVED = 20, ecdsa_sign = 64, rsa_fixed_ecdh = 65, ecdsa_fixed_ecdh = 66 } TLSClientCertificateType; typedef enum { none = 0, md5 = 1, sha1 = 2, sha224 = 3, sha256 = 4, sha384 = 5, sha512 = 6, _md5_sha1 = 255 } TLSHashAlgorithm; typedef enum { anonymous = 0, rsa = 1, dsa = 2, ecdsa = 3 } TLSSignatureAlgorithm; struct _private_OID_chain { void *top; unsigned char *oid; }; struct TLSCertificate { unsigned short version; unsigned int algorithm; unsigned int key_algorithm; unsigned int ec_algorithm; unsigned char *exponent; unsigned int exponent_len; unsigned char *pk; unsigned int pk_len; unsigned char *priv; unsigned int priv_len; unsigned char *issuer_country; unsigned char *issuer_state; unsigned char *issuer_location; unsigned char *issuer_entity; unsigned char *issuer_subject; unsigned char *not_before; unsigned char *not_after; unsigned char *country; unsigned char *state; unsigned char *location; unsigned char *entity; unsigned char *subject; unsigned char **san; unsigned short san_length; unsigned char *ocsp; unsigned char *serial_number; unsigned int serial_len; unsigned char *sign_key; unsigned int sign_len; unsigned char *fingerprint; unsigned char *der_bytes; unsigned int der_len; unsigned char *bytes; unsigned int len; }; typedef struct { union { symmetric_CBC aes_local; gcm_state aes_gcm_local; #ifdef TLS_WITH_CHACHA20_POLY1305 chacha_ctx chacha_local; #endif } ctx_local; union { symmetric_CBC aes_remote; gcm_state aes_gcm_remote; #ifdef TLS_WITH_CHACHA20_POLY1305 chacha_ctx chacha_remote; #endif } ctx_remote; union { unsigned char local_mac[TLS_MAX_MAC_SIZE]; unsigned char local_aead_iv[TLS_AES_GCM_IV_LENGTH]; #ifdef WITH_TLS_13 unsigned char local_iv[TLS_13_AES_GCM_IV_LENGTH]; #endif #ifdef TLS_WITH_CHACHA20_POLY1305 unsigned char local_nonce[TLS_CHACHA20_IV_LENGTH]; #endif } ctx_local_mac; union { unsigned char remote_aead_iv[TLS_AES_GCM_IV_LENGTH]; unsigned char remote_mac[TLS_MAX_MAC_SIZE]; #ifdef WITH_TLS_13 unsigned char remote_iv[TLS_13_AES_GCM_IV_LENGTH]; #endif #ifdef TLS_WITH_CHACHA20_POLY1305 unsigned char remote_nonce[TLS_CHACHA20_IV_LENGTH]; #endif } ctx_remote_mac; unsigned char created; } TLSCipher; typedef struct { hash_state hash32; hash_state hash48; #ifdef TLS_LEGACY_SUPPORT hash_state hash2; #endif unsigned char created; } TLSHash; #ifdef TLS_FORWARD_SECRECY #define mp_init(a) ltc_mp.init(a) #define mp_init_multi ltc_init_multi #define mp_clear(a) ltc_mp.deinit(a) #define mp_clear_multi ltc_deinit_multi #define mp_count_bits(a) ltc_mp.count_bits(a) #define mp_read_radix(a, b, c) ltc_mp.read_radix(a, b, c) #define mp_unsigned_bin_size(a) ltc_mp.unsigned_size(a) #define mp_to_unsigned_bin(a, b) ltc_mp.unsigned_write(a, b) #define mp_read_unsigned_bin(a, b, c) ltc_mp.unsigned_read(a, b, c) #define mp_exptmod(a, b, c, d) ltc_mp.exptmod(a, b, c, d) #define mp_add(a, b, c) ltc_mp.add(a, b, c) #define mp_mul(a, b, c) ltc_mp.mul(a, b, c) #define mp_cmp(a, b) ltc_mp.compare(a, b) #define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) #define mp_sqr(a, b) ltc_mp.sqr(a, b) #define mp_mod(a, b, c) ltc_mp.mpdiv(a, b, NULL, c) #define mp_sub(a, b, c) ltc_mp.sub(a, b, c) #define mp_set(a, b) ltc_mp.set_int(a, b) typedef struct { int iana; void *x; void *y; void *p; void *g; } DHKey; #ifdef WITH_TLS_13 static DHKey ffdhe2048 = { 0x0100, NULL, NULL, (void *)"FFFFFFFFFFFFFFFFADF85458A2BB4A9AAFDC5620273D3CF1D8B9C583CE2D3695A9E13641146433FBCC939DCE249B3EF97D2FE363630C75D8F681B202AEC4617AD3DF1ED5D5FD65612433F51F5F066ED0856365553DED1AF3B557135E7F57C935984F0C70E0E68B77E2A689DAF3EFE8721DF158A136ADE73530ACCA4F483A797ABC0AB182B324FB61D108A94BB2C8E3FBB96ADAB760D7F4681D4F42A3DE394DF4AE56EDE76372BB190B07A7C8EE0A6D709E02FCE1CDF7E2ECC03404CD28342F619172FE9CE98583FF8E4F1232EEF28183C3FE3B1B4C6FAD733BB5FCBC2EC22005C58EF1837D1683B2C6F34A26C1B2EFFA886B423861285C97FFFFFFFFFFFFFFFF", (void *)"00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000002" }; static DHKey ffdhe3072 = { 0x0101, NULL, NULL, (void *)"FFFFFFFFFFFFFFFFADF85458A2BB4A9AAFDC5620273D3CF1D8B9C583CE2D3695A9E13641146433FBCC939DCE249B3EF97D2FE363630C75D8F681B202AEC4617AD3DF1ED5D5FD65612433F51F5F066ED0856365553DED1AF3B557135E7F57C935984F0C70E0E68B77E2A689DAF3EFE8721DF158A136ADE73530ACCA4F483A797ABC0AB182B324FB61D108A94BB2C8E3FBB96ADAB760D7F4681D4F42A3DE394DF4AE56EDE76372BB190B07A7C8EE0A6D709E02FCE1CDF7E2ECC03404CD28342F619172FE9CE98583FF8E4F1232EEF28183C3FE3B1B4C6FAD733BB5FCBC2EC22005C58EF1837D1683B2C6F34A26C1B2EFFA886B4238611FCFDCDE355B3B6519035BBC34F4DEF99C023861B46FC9D6E6C9077AD91D2691F7F7EE598CB0FAC186D91CAEFE130985139270B4130C93BC437944F4FD4452E2D74DD364F2E21E71F54BFF5CAE82AB9C9DF69EE86D2BC522363A0DABC521979B0DEADA1DBF9A42D5C4484E0ABCD06BFA53DDEF3C1B20EE3FD59D7C25E41D2B66C62E37FFFFFFFFFFFFFFFF", (void *)"000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000002" }; static DHKey ffdhe4096 = { 0x0102, NULL, NULL, (void *)"FFFFFFFFFFFFFFFFADF85458A2BB4A9AAFDC5620273D3CF1D8B9C583CE2D3695A9E13641146433FBCC939DCE249B3EF97D2FE363630C75D8F681B202AEC4617AD3DF1ED5D5FD65612433F51F5F066ED0856365553DED1AF3B557135E7F57C935984F0C70E0E68B77E2A689DAF3EFE8721DF158A136ADE73530ACCA4F483A797ABC0AB182B324FB61D108A94BB2C8E3FBB96ADAB760D7F4681D4F42A3DE394DF4AE56EDE76372BB190B07A7C8EE0A6D709E02FCE1CDF7E2ECC03404CD28342F619172FE9CE98583FF8E4F1232EEF28183C3FE3B1B4C6FAD733BB5FCBC2EC22005C58EF1837D1683B2C6F34A26C1B2EFFA886B4238611FCFDCDE355B3B6519035BBC34F4DEF99C023861B46FC9D6E6C9077AD91D2691F7F7EE598CB0FAC186D91CAEFE130985139270B4130C93BC437944F4FD4452E2D74DD364F2E21E71F54BFF5CAE82AB9C9DF69EE86D2BC522363A0DABC521979B0DEADA1DBF9A42D5C4484E0ABCD06BFA53DDEF3C1B20EE3FD59D7C25E41D2B669E1EF16E6F52C3164DF4FB7930E9E4E58857B6AC7D5F42D69F6D187763CF1D5503400487F55BA57E31CC7A7135C886EFB4318AED6A1E012D9E6832A907600A918130C46DC778F971AD0038092999A333CB8B7A1A1DB93D7140003C2A4ECEA9F98D0ACC0A8291CDCEC97DCF8EC9B55A7F88A46B4DB5A851F44182E1C68A007E5E655F6AFFFFFFFFFFFFFFFF", (void *)"0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000002" }; static DHKey ffdhe6144 = { 0x0103, NULL, NULL, (void *)"FFFFFFFFFFFFFFFFADF85458A2BB4A9AAFDC5620273D3CF1D8B9C583CE2D3695A9E13641146433FBCC939DCE249B3EF97D2FE363630C75D8F681B202AEC4617AD3DF1ED5D5FD65612433F51F5F066ED0856365553DED1AF3B557135E7F57C935984F0C70E0E68B77E2A689DAF3EFE8721DF158A136ADE73530ACCA4F483A797ABC0AB182B324FB61D108A94BB2C8E3FBB96ADAB760D7F4681D4F42A3DE394DF4AE56EDE76372BB190B07A7C8EE0A6D709E02FCE1CDF7E2ECC03404CD28342F619172FE9CE98583FF8E4F1232EEF28183C3FE3B1B4C6FAD733BB5FCBC2EC22005C58EF1837D1683B2C6F34A26C1B2EFFA886B4238611FCFDCDE355B3B6519035BBC34F4DEF99C023861B46FC9D6E6C9077AD91D2691F7F7EE598CB0FAC186D91CAEFE130985139270B4130C93BC437944F4FD4452E2D74DD364F2E21E71F54BFF5CAE82AB9C9DF69EE86D2BC522363A0DABC521979B0DEADA1DBF9A42D5C4484E0ABCD06BFA53DDEF3C1B20EE3FD59D7C25E41D2B669E1EF16E6F52C3164DF4FB7930E9E4E58857B6AC7D5F42D69F6D187763CF1D5503400487F55BA57E31CC7A7135C886EFB4318AED6A1E012D9E6832A907600A918130C46DC778F971AD0038092999A333CB8B7A1A1DB93D7140003C2A4ECEA9F98D0ACC0A8291CDCEC97DCF8EC9B55A7F88A46B4DB5A851F44182E1C68A007E5E0DD9020BFD64B645036C7A4E677D2C38532A3A23BA4442CAF53EA63BB454329B7624C8917BDD64B1C0FD4CB38E8C334C701C3ACDAD0657FCCFEC719B1F5C3E4E46041F388147FB4CFDB477A52471F7A9A96910B855322EDB6340D8A00EF092350511E30ABEC1FFF9E3A26E7FB29F8C183023C3587E38DA0077D9B4763E4E4B94B2BBC194C6651E77CAF992EEAAC0232A281BF6B3A739C1226116820AE8DB5847A67CBEF9C9091B462D538CD72B03746AE77F5E62292C311562A846505DC82DB854338AE49F5235C95B91178CCF2DD5CACEF403EC9D1810C6272B045B3B71F9DC6B80D63FDD4A8E9ADB1E6962A69526D43161C1A41D570D7938DAD4A40E329CD0E40E65FFFFFFFFFFFFFFFF", (void *)"000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000002" }; static DHKey ffdhe8192 = { 0x0104, NULL, NULL, (void *)"FFFFFFFFFFFFFFFFADF85458A2BB4A9AAFDC5620273D3CF1D8B9C583CE2D3695A9E13641146433FBCC939DCE249B3EF97D2FE363630C75D8F681B202AEC4617AD3DF1ED5D5FD65612433F51F5F066ED0856365553DED1AF3B557135E7F57C935984F0C70E0E68B77E2A689DAF3EFE8721DF158A136ADE73530ACCA4F483A797ABC0AB182B324FB61D108A94BB2C8E3FBB96ADAB760D7F4681D4F42A3DE394DF4AE56EDE76372BB190B07A7C8EE0A6D709E02FCE1CDF7E2ECC03404CD28342F619172FE9CE98583FF8E4F1232EEF28183C3FE3B1B4C6FAD733BB5FCBC2EC22005C58EF1837D1683B2C6F34A26C1B2EFFA886B4238611FCFDCDE355B3B6519035BBC34F4DEF99C023861B46FC9D6E6C9077AD91D2691F7F7EE598CB0FAC186D91CAEFE130985139270B4130C93BC437944F4FD4452E2D74DD364F2E21E71F54BFF5CAE82AB9C9DF69EE86D2BC522363A0DABC521979B0DEADA1DBF9A42D5C4484E0ABCD06BFA53DDEF3C1B20EE3FD59D7C25E41D2B669E1EF16E6F52C3164DF4FB7930E9E4E58857B6AC7D5F42D69F6D187763CF1D5503400487F55BA57E31CC7A7135C886EFB4318AED6A1E012D9E6832A907600A918130C46DC778F971AD0038092999A333CB8B7A1A1DB93D7140003C2A4ECEA9F98D0ACC0A8291CDCEC97DCF8EC9B55A7F88A46B4DB5A851F44182E1C68A007E5E0DD9020BFD64B645036C7A4E677D2C38532A3A23BA4442CAF53EA63BB454329B7624C8917BDD64B1C0FD4CB38E8C334C701C3ACDAD0657FCCFEC719B1F5C3E4E46041F388147FB4CFDB477A52471F7A9A96910B855322EDB6340D8A00EF092350511E30ABEC1FFF9E3A26E7FB29F8C183023C3587E38DA0077D9B4763E4E4B94B2BBC194C6651E77CAF992EEAAC0232A281BF6B3A739C1226116820AE8DB5847A67CBEF9C9091B462D538CD72B03746AE77F5E62292C311562A846505DC82DB854338AE49F5235C95B91178CCF2DD5CACEF403EC9D1810C6272B045B3B71F9DC6B80D63FDD4A8E9ADB1E6962A69526D43161C1A41D570D7938DAD4A40E329CCFF46AAA36AD004CF600C8381E425A31D951AE64FDB23FCEC9509D43687FEB69EDD1CC5E0B8CC3BDF64B10EF86B63142A3AB8829555B2F747C932665CB2C0F1CC01BD70229388839D2AF05E454504AC78B7582822846C0BA35C35F5C59160CC046FD8251541FC68C9C86B022BB7099876A460E7451A8A93109703FEE1C217E6C3826E52C51AA691E0E423CFC99E9E31650C1217B624816CDAD9A95F9D5B8019488D9C0A0A1FE3075A577E23183F81D4A3F2FA4571EFC8CE0BA8A4FE8B6855DFE72B0A66EDED2FBABFBE58A30FAFABE1C5D71A87E2F741EF8C1FE86FEA6BBFDE530677F0D97D11D49F7A8443D0822E506A9F4614E011E2A94838FF88CD68C8BB7C5C6424CFFFFFFFFFFFFFFFF", (void *)"00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000002" }; #endif struct ECCCurveParameters { int size; int iana; const char *name; const char *P; const char *A; const char *B; const char *Gx; const char *Gy; const char *order; ltc_ecc_set_type dp; }; static struct ECCCurveParameters secp192r1 = { 24, 19, "secp192r1", "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF", // P "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFC", // A "64210519E59C80E70FA7E9AB72243049FEB8DEECC146B9B1", // B "188DA80EB03090F67CBF20EB43A18800F4FF0AFD82FF1012", // Gx "07192B95FFC8DA78631011ED6B24CDD573F977A11E794811", // Gy "FFFFFFFFFFFFFFFFFFFFFFFF99DEF836146BC9B1B4D22831" // order (n) }; static struct ECCCurveParameters secp224r1 = { 28, 21, "secp224r1", "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF000000000000000000000001", // P "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFE", // A "B4050A850C04B3ABF54132565044B0B7D7BFD8BA270B39432355FFB4", // B "B70E0CBD6BB4BF7F321390B94A03C1D356C21122343280D6115C1D21", // Gx "BD376388B5F723FB4C22DFE6CD4375A05A07476444D5819985007E34", // Gy "FFFFFFFFFFFFFFFFFFFFFFFFFFFF16A2E0B8F03E13DD29455C5C2A3D" // order (n) }; static struct ECCCurveParameters secp224k1 = { 28, 20, "secp224k1", "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFE56D", // P "00000000000000000000000000000000000000000000000000000000", // A "00000000000000000000000000000000000000000000000000000005", // B "A1455B334DF099DF30FC28A169A467E9E47075A90F7E650EB6B7A45C", // Gx "7E089FED7FBA344282CAFBD6F7E319F7C0B0BD59E2CA4BDB556D61A5", // Gy "0000000000000000000000000001DCE8D2EC6184CAF0A971769FB1F7" // order (n) }; static struct ECCCurveParameters secp256r1 = { 32, 23, "secp256r1", "FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFF", // P "FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFC", // A "5AC635D8AA3A93E7B3EBBD55769886BC651D06B0CC53B0F63BCE3C3E27D2604B", // B "6B17D1F2E12C4247F8BCE6E563A440F277037D812DEB33A0F4A13945D898C296", // Gx "4FE342E2FE1A7F9B8EE7EB4A7C0F9E162BCE33576B315ECECBB6406837BF51F5", // Gy "FFFFFFFF00000000FFFFFFFFFFFFFFFFBCE6FAADA7179E84F3B9CAC2FC632551" // order (n) }; static struct ECCCurveParameters secp256k1 = { 32, 22, "secp256k1", "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFC2F", // P "0000000000000000000000000000000000000000000000000000000000000000", // A "0000000000000000000000000000000000000000000000000000000000000007", // B "79BE667EF9DCBBAC55A06295CE870B07029BFCDB2DCE28D959F2815B16F81798", // Gx "483ADA7726A3C4655DA4FBFC0E1108A8FD17B448A68554199C47D08FFB10D4B8", // Gy "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEBAAEDCE6AF48A03BBFD25E8CD0364141" // order (n) }; static struct ECCCurveParameters secp384r1 = { 48, 24, "secp384r1", "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFF0000000000000000FFFFFFFF", // P "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFF0000000000000000FFFFFFFC", // A "B3312FA7E23EE7E4988E056BE3F82D19181D9C6EFE8141120314088F5013875AC656398D8A2ED19D2A85C8EDD3EC2AEF", // B "AA87CA22BE8B05378EB1C71EF320AD746E1D3B628BA79B9859F741E082542A385502F25DBF55296C3A545E3872760AB7", // Gx "3617DE4A96262C6F5D9E98BF9292DC29F8F41DBD289A147CE9DA3113B5F0B8C00A60B1CE1D7E819D7A431D7C90EA0E5F", // Gy "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC7634D81F4372DDF581A0DB248B0A77AECEC196ACCC52973" // order (n) }; static struct ECCCurveParameters secp521r1 = { 66, 25, "secp521r1", "01FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF", // P "01FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC", // A "0051953EB9618E1C9A1F929A21A0B68540EEA2DA725B99B315F3B8B489918EF109E156193951EC7E937B1652C0BD3BB1BF073573DF883D2C34F1EF451FD46B503F00", // B "00C6858E06B70404E9CD9E3ECB662395B4429C648139053FB521F828AF606B4D3DBAA14B5E77EFE75928FE1DC127A2FFA8DE3348B3C1856A429BF97E7E31C2E5BD66", // Gx "011839296A789A3BC0045C8A5FB42C7D1BD998F54449579B446817AFBD17273E662C97EE72995EF42640C550B9013FAD0761353C7086A272C24088BE94769FD16650", // Gy "01FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFA51868783BF2F966B7FCC0148F709A5D03BB5C9B8899C47AEBB6FB71E91386409" // order (n) }; #ifdef TLS_CURVE25519 // dummy static struct ECCCurveParameters x25519 = { 32, 29, "x25519", "7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFED", // P "0000000000000000000000000000000000000000000000000000000000076D06", // A "0000000000000000000000000000000000000000000000000000000000000000", // B "0000000000000000000000000000000000000000000000000000000000000009", // Gx "20AE19A1B8A086B4E01EDD2C7748D14C923D4D7E6D7C61B229E9C5A27ECED3D9", // Gy "1000000000000000000000000000000014DEF9DEA2F79CD65812631A5CF5D3ED" // order (n) }; #endif static struct ECCCurveParameters * const default_curve = &secp256r1; void init_curve(struct ECCCurveParameters *curve) { curve->dp.size = curve->size; curve->dp.name = (char *)curve->name; curve->dp.B = (char *)curve->B; curve->dp.prime = (char *)curve->P; curve->dp.Gx = (char *)curve->Gx; curve->dp.Gy = (char *)curve->Gy; curve->dp.order = (char *)curve->order; } void init_curves() { init_curve(&secp192r1); init_curve(&secp224r1); init_curve(&secp224k1); init_curve(&secp256r1); init_curve(&secp256k1); init_curve(&secp384r1); init_curve(&secp521r1); } #endif struct TLSContext { unsigned char remote_random[TLS_CLIENT_RANDOM_SIZE]; unsigned char local_random[TLS_SERVER_RANDOM_SIZE]; unsigned char session[TLS_MAX_SESSION_ID]; unsigned char session_size; unsigned short cipher; unsigned short version; unsigned char is_server; struct TLSCertificate **certificates; struct TLSCertificate *private_key; #ifdef TLS_ECDSA_SUPPORTED struct TLSCertificate *ec_private_key; #endif #ifdef TLS_FORWARD_SECRECY DHKey *dhe; ecc_key *ecc_dhe; char *default_dhe_p; char *default_dhe_g; const struct ECCCurveParameters *curve; #endif struct TLSCertificate **client_certificates; unsigned int certificates_count; unsigned int client_certificates_count; unsigned char *master_key; unsigned int master_key_len; unsigned char *premaster_key; unsigned int premaster_key_len; unsigned char cipher_spec_set; TLSCipher crypto; TLSHash *handshake_hash; unsigned char *message_buffer; unsigned int message_buffer_len; uint64_t remote_sequence_number; uint64_t local_sequence_number; unsigned char connection_status; unsigned char critical_error; unsigned char error_code; unsigned char *tls_buffer; unsigned int tls_buffer_len; unsigned char *application_buffer; unsigned int application_buffer_len; unsigned char is_child; unsigned char exportable; unsigned char *exportable_keys; unsigned char exportable_size; char *sni; unsigned char request_client_certificate; unsigned char dtls; unsigned short dtls_epoch_local; unsigned short dtls_epoch_remote; unsigned char *dtls_cookie; unsigned char dtls_cookie_len; unsigned char dtls_seq; unsigned char *cached_handshake; unsigned int cached_handshake_len; unsigned char client_verified; // handshake messages flags unsigned char hs_messages[11]; void *user_data; struct TLSCertificate **root_certificates; unsigned int root_count; #ifdef TLS_ACCEPT_SECURE_RENEGOTIATION unsigned char *verify_data; unsigned char verify_len; #endif #ifdef WITH_TLS_13 unsigned char *finished_key; unsigned char *remote_finished_key; unsigned char *server_finished_hash; #endif #ifdef TLS_CURVE25519 unsigned char *client_secret; #endif char **alpn; unsigned char alpn_count; char *negotiated_alpn; unsigned int sleep_until; unsigned short tls13_version; #ifdef TLS_12_FALSE_START unsigned char false_start; #endif }; struct TLSPacket { unsigned char *buf; unsigned int len; unsigned int size; unsigned char broken; struct TLSContext *context; }; #ifdef SSL_COMPATIBLE_INTERFACE typedef int (*SOCKET_RECV_CALLBACK)(int socket, void *buffer, size_t length, int flags); typedef int (*SOCKET_SEND_CALLBACK)(int socket, const void *buffer, size_t length, int flags); #ifndef _WIN32 #include #endif #endif static const unsigned int version_id[] = {1, 1, 1, 0}; static const unsigned int pk_id[] = {1, 1, 7, 0}; static const unsigned int serial_id[] = {1, 1, 2, 1, 0}; static const unsigned int issurer_id[] = {1, 1, 4, 0}; static const unsigned int owner_id[] = {1, 1, 6, 0}; static const unsigned int validity_id[] = {1, 1, 5, 0}; static const unsigned int algorithm_id[] = {1, 1, 3, 0}; static const unsigned int sign_id[] = {1, 3, 2, 1, 0}; static const unsigned int priv_id[] = {1, 4, 0}; static const unsigned int priv_der_id[] = {1, 3, 1, 0}; static const unsigned int ecc_priv_id[] = {1, 2, 0}; static const unsigned char country_oid[] = {0x55, 0x04, 0x06, 0x00}; static const unsigned char state_oid[] = {0x55, 0x04, 0x08, 0x00}; static const unsigned char location_oid[] = {0x55, 0x04, 0x07, 0x00}; static const unsigned char entity_oid[] = {0x55, 0x04, 0x0A, 0x00}; static const unsigned char subject_oid[] = {0x55, 0x04, 0x03, 0x00}; static const unsigned char san_oid[] = {0x55, 0x1D, 0x11, 0x00}; static const unsigned char ocsp_oid[] = {0x2B, 0x06, 0x01, 0x05, 0x05, 0x07, 0x30, 0x01, 0x00}; static const unsigned char TLS_RSA_SIGN_RSA_OID[] = {0x2A, 0x86, 0x48, 0x86, 0xF7, 0x0D, 0x01, 0x01, 0x01, 0x00}; static const unsigned char TLS_RSA_SIGN_MD5_OID[] = {0x2A, 0x86, 0x48, 0x86, 0xF7, 0x0D, 0x01, 0x01, 0x04, 0x00}; static const unsigned char TLS_RSA_SIGN_SHA1_OID[] = {0x2A, 0x86, 0x48, 0x86, 0xF7, 0x0D, 0x01, 0x01, 0x05, 0x00}; static const unsigned char TLS_RSA_SIGN_SHA256_OID[] = {0x2A, 0x86, 0x48, 0x86, 0xF7, 0x0D, 0x01, 0x01, 0x0B, 0x00}; static const unsigned char TLS_RSA_SIGN_SHA384_OID[] = {0x2A, 0x86, 0x48, 0x86, 0xF7, 0x0D, 0x01, 0x01, 0x0C, 0x00}; static const unsigned char TLS_RSA_SIGN_SHA512_OID[] = {0x2A, 0x86, 0x48, 0x86, 0xF7, 0x0D, 0x01, 0x01, 0x0D, 0x00}; // static const unsigned char TLS_ECDSA_SIGN_SHA1_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x04, 0x01, 0x05, 0x00, 0x00}; // static const unsigned char TLS_ECDSA_SIGN_SHA224_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x04, 0x03, 0x01, 0x05, 0x00, 0x00}; static const unsigned char TLS_ECDSA_SIGN_SHA256_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x04, 0x03, 0x02, 0x05, 0x00, 0x00}; // static const unsigned char TLS_ECDSA_SIGN_SHA384_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x04, 0x03, 0x03, 0x05, 0x00, 0x00}; // static const unsigned char TLS_ECDSA_SIGN_SHA512_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x04, 0x03, 0x04, 0x05, 0x00, 0x00}; static const unsigned char TLS_EC_PUBLIC_KEY_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x02, 0x01, 0x00}; static const unsigned char TLS_EC_prime192v1_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x03, 0x01, 0x01, 0x00}; static const unsigned char TLS_EC_prime192v2_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x03, 0x01, 0x02, 0x00}; static const unsigned char TLS_EC_prime192v3_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x03, 0x01, 0x03, 0x00}; static const unsigned char TLS_EC_prime239v1_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x03, 0x01, 0x04, 0x00}; static const unsigned char TLS_EC_prime239v2_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x03, 0x01, 0x05, 0x00}; static const unsigned char TLS_EC_prime239v3_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x03, 0x01, 0x06, 0x00}; static const unsigned char TLS_EC_prime256v1_OID[] = {0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x03, 0x01, 0x07, 0x00}; #define TLS_EC_secp256r1_OID TLS_EC_prime256v1_OID static const unsigned char TLS_EC_secp224r1_OID[] = {0x2B, 0x81, 0x04, 0x00, 0x21, 0x00}; static const unsigned char TLS_EC_secp384r1_OID[] = {0x2B, 0x81, 0x04, 0x00, 0x22, 0x00}; static const unsigned char TLS_EC_secp521r1_OID[] = {0x2B, 0x81, 0x04, 0x00, 0x23, 0x00}; struct TLSCertificate *asn1_parse(struct TLSContext *context, const unsigned char *buffer, unsigned int size, int client_cert); int _private_tls_update_hash(struct TLSContext *context, const unsigned char *in, unsigned int len); struct TLSPacket *tls_build_finished(struct TLSContext *context); unsigned int _private_tls_hmac_message(unsigned char local, struct TLSContext *context, const unsigned char *buf, int buf_len, const unsigned char *buf2, int buf_len2, unsigned char *out, unsigned int outlen, uint64_t remote_sequence_number); int tls_random(unsigned char *key, int len); void tls_destroy_packet(struct TLSPacket *packet); struct TLSPacket *tls_build_hello(struct TLSContext *context, int tls13_downgrade); struct TLSPacket *tls_build_certificate(struct TLSContext *context); struct TLSPacket *tls_build_done(struct TLSContext *context); struct TLSPacket *tls_build_alert(struct TLSContext *context, char critical, unsigned char code); struct TLSPacket *tls_build_change_cipher_spec(struct TLSContext *context); struct TLSPacket *tls_build_verify_request(struct TLSContext *context); int _private_tls_crypto_create(struct TLSContext *context, int key_length, unsigned char *localkey, unsigned char *localiv, unsigned char *remotekey, unsigned char *remoteiv); int _private_tls_get_hash(struct TLSContext *context, unsigned char *hout); int _private_tls_done_hash(struct TLSContext *context, unsigned char *hout); int _private_tls_get_hash_idx(struct TLSContext *context); int _private_tls_build_random(struct TLSPacket *packet); unsigned int _private_tls_mac_length(struct TLSContext *context); void _private_dtls_handshake_data(struct TLSContext *context, struct TLSPacket *packet, unsigned int dataframe); #ifdef TLS_FORWARD_SECRECY void _private_tls_dhe_free(struct TLSContext *context); void _private_tls_ecc_dhe_free(struct TLSContext *context); void _private_tls_dh_clear_key(DHKey *key); #endif #ifdef WITH_TLS_13 struct TLSPacket *tls_build_encrypted_extensions(struct TLSContext *context); struct TLSPacket *tls_build_certificate_verify(struct TLSContext *context); #endif // dtls base secret static unsigned char dtls_secret[32]; static unsigned char dependecies_loaded = 0; // not supported // static unsigned char TLS_DSA_SIGN_SHA1_OID[] = {0x2A, 0x86, 0x52, 0xCE, 0x38, 0x04, 0x03, 0x00}; // base64 stuff static const char cd64[] = "|$$$}rstuvwxyz{$$$$$$$>?@ABCDEFGHIJKLMNOPQRSTUVW$$$$$$XYZ[\\]^_`abcdefghijklmnopq"; void _private_b64_decodeblock(unsigned char in[4], unsigned char out[3]) { out[0] = (unsigned char )(in[0] << 2 | in[1] >> 4); out[1] = (unsigned char )(in[1] << 4 | in[2] >> 2); out[2] = (unsigned char )(((in[2] << 6) & 0xc0) | in[3]); } int _private_b64_decode(const char *in_buffer, int in_buffer_size, unsigned char *out_buffer) { unsigned char in[4], out[3], v; int i, len; const char *ptr = in_buffer; char *out_ptr = (char *)out_buffer; while (ptr <= in_buffer + in_buffer_size) { for (len = 0, i = 0; i < 4 && (ptr <= in_buffer + in_buffer_size); i++) { v = 0; while ((ptr <= in_buffer + in_buffer_size) && v == 0) { v = (unsigned char)ptr[0]; ptr++; v = (unsigned char)((v < 43 || v > 122) ? 0 : cd64[v - 43]); if (v) v = (unsigned char)((v == '$') ? 0 : v - 61); } if (ptr <= in_buffer + in_buffer_size) { len++; if (v) in[i] = (unsigned char)(v - 1); } else { in[i] = 0; } } if (len) { _private_b64_decodeblock(in, out); for (i = 0; i < len - 1; i++) { out_ptr[0] = out[i]; out_ptr++; } } } return (int)((intptr_t)out_ptr - (intptr_t)out_buffer); } void dtls_reset_cookie_secret() { tls_random(dtls_secret, sizeof(dtls_secret)); } void tls_init() { if (dependecies_loaded) return; DEBUG_PRINT("Initializing dependencies\n"); dependecies_loaded = 1; #ifdef LTM_DESC ltc_mp = ltm_desc; #else #ifdef TFM_DESC ltc_mp = tfm_desc; #else #ifdef GMP_DESC ltc_mp = gmp_desc; #endif #endif #endif register_prng(&sprng_desc); register_hash(&sha256_desc); register_hash(&sha1_desc); register_hash(&sha384_desc); register_hash(&sha512_desc); register_hash(&md5_desc); register_cipher(&aes_desc); #ifdef TLS_FORWARD_SECRECY init_curves(); #endif dtls_reset_cookie_secret(); } #ifdef TLS_FORWARD_SECRECY int _private_tls_dh_shared_secret(DHKey *private_key, DHKey *public_key, unsigned char *out, unsigned long *outlen) { void *tmp; unsigned long x; int err; if ((!private_key) || (!public_key) || (!out) || (!outlen)) return TLS_GENERIC_ERROR; /* compute y^x mod p */ if ((err = mp_init(&tmp)) != CRYPT_OK) return err; if ((err = mp_exptmod(public_key->y, private_key->x, private_key->p, tmp)) != CRYPT_OK) { mp_clear(tmp); return err; } x = (unsigned long)mp_unsigned_bin_size(tmp); if (*outlen < x) { err = CRYPT_BUFFER_OVERFLOW; mp_clear(tmp); return err; } if ((err = mp_to_unsigned_bin(tmp, out)) != CRYPT_OK) { mp_clear(tmp); return err; } *outlen = x; mp_clear(tmp); return 0; } unsigned char *_private_tls_decrypt_dhe(struct TLSContext *context, const unsigned char *buffer, unsigned int len, unsigned int *size, int clear_key) { *size = 0; if ((!len) || (!context) || (!context->dhe)) { DEBUG_PRINT("No private DHE key set\n"); return NULL; } unsigned long out_size = len; void *Yc = NULL; if (mp_init(&Yc)) { DEBUG_PRINT("ERROR CREATING Yc\n"); return NULL; } if (mp_read_unsigned_bin(Yc, (unsigned char *)buffer, len)) { DEBUG_PRINT("ERROR LOADING DHE Yc\n"); mp_clear(Yc); return NULL; } unsigned char *out = (unsigned char *)TLS_MALLOC(len); DHKey client_key; memset(&client_key, 0, sizeof(DHKey)); client_key.p = context->dhe->p; client_key.g = context->dhe->g; client_key.y = Yc; int err = _private_tls_dh_shared_secret(context->dhe, &client_key, out, &out_size); // don't delete p and g client_key.p = NULL; client_key.g = NULL; _private_tls_dh_clear_key(&client_key); // not needing the dhe key anymore if (clear_key) _private_tls_dhe_free(context); if (err) { DEBUG_PRINT("DHE DECRYPT ERROR %i\n", err); TLS_FREE(out); return NULL; } DEBUG_PRINT("OUT_SIZE: %lu\n", out_size); DEBUG_DUMP_HEX_LABEL("DHE", out, out_size); *size = (unsigned int)out_size; return out; } unsigned char *_private_tls_decrypt_ecc_dhe(struct TLSContext *context, const unsigned char *buffer, unsigned int len, unsigned int *size, int clear_key) { *size = 0; if ((!len) || (!context) || (!context->ecc_dhe)) { DEBUG_PRINT("No private ECC DHE key set\n"); return NULL; } const struct ECCCurveParameters *curve; if (context->curve) curve = context->curve; else curve = default_curve; ltc_ecc_set_type *dp = (ltc_ecc_set_type *)&curve->dp; ecc_key client_key; memset(&client_key, 0, sizeof(client_key)); if (ecc_ansi_x963_import_ex(buffer, len, &client_key, dp)) { DEBUG_PRINT("Error importing ECC DHE key\n"); return NULL; } unsigned char *out = (unsigned char *)TLS_MALLOC(len); unsigned long out_size = len; int err = ecc_shared_secret(context->ecc_dhe, &client_key, out, &out_size); ecc_free(&client_key); if (clear_key) _private_tls_ecc_dhe_free(context); if (err) { DEBUG_PRINT("ECC DHE DECRYPT ERROR %i\n", err); TLS_FREE(out); return NULL; } DEBUG_PRINT("OUT_SIZE: %lu\n", out_size); DEBUG_DUMP_HEX_LABEL("ECC DHE", out, out_size); *size = (unsigned int)out_size; return out; } #endif unsigned char *_private_tls_decrypt_rsa(struct TLSContext *context, const unsigned char *buffer, unsigned int len, unsigned int *size) { *size = 0; if ((!len) || (!context) || (!context->private_key) || (!context->private_key->der_bytes) || (!context->private_key->der_len)) { DEBUG_PRINT("No private key set\n"); return NULL; } tls_init(); rsa_key key; int err; err = rsa_import(context->private_key->der_bytes, context->private_key->der_len, &key); if (err) { DEBUG_PRINT("Error importing RSA key (code: %i)\n", err); return NULL; } unsigned char *out = (unsigned char *)TLS_MALLOC(len); unsigned long out_size = len; int res = 0; err = rsa_decrypt_key_ex(buffer, len, out, &out_size, NULL, 0, -1, LTC_PKCS_1_V1_5, &res, &key); rsa_free(&key); if ((err) || (out_size != 48) || (ntohs(*(unsigned short *)out) != context->version)) { // generate a random secret and continue (ROBOT fix) // silently ignore and generate a random secret out_size = 48; tls_random(out, out_size); *(unsigned short *)out = htons(context->version); } *size = (unsigned int)out_size; return out; } unsigned char *_private_tls_encrypt_rsa(struct TLSContext *context, const unsigned char *buffer, unsigned int len, unsigned int *size) { *size = 0; if ((!len) || (!context) || (!context->certificates) || (!context->certificates_count) || (!context->certificates[0]) || (!context->certificates[0]->der_bytes) || (!context->certificates[0]->der_len)) { DEBUG_PRINT("No certificate set\n"); return NULL; } tls_init(); rsa_key key; int err; err = rsa_import(context->certificates[0]->der_bytes, context->certificates[0]->der_len, &key); if (err) { DEBUG_PRINT("Error importing RSA certificate (code: %i)\n", err); return NULL; } unsigned long out_size = TLS_MAX_RSA_KEY; unsigned char *out = (unsigned char *)TLS_MALLOC(out_size); int hash_idx = find_hash("sha256"); int prng_idx = find_prng("sprng"); err = rsa_encrypt_key_ex(buffer, len, out, &out_size, (unsigned char *)"Concept", 7, NULL, prng_idx, hash_idx, LTC_PKCS_1_V1_5, &key); rsa_free(&key); if ((err) || (!out_size)) { TLS_FREE(out); return NULL; } *size = (unsigned int)out_size; return out; } #ifdef TLS_LEGACY_SUPPORT int _private_rsa_verify_hash_md5sha1(const unsigned char *sig, unsigned long siglen, unsigned char *hash, unsigned long hashlen, int *stat, rsa_key *key) { unsigned long modulus_bitlen, modulus_bytelen, x; int err; unsigned char *tmpbuf = NULL; if ((hash == NULL) || (sig == NULL) || (stat == NULL) || (key == NULL) || (!siglen) || (!hashlen)) return TLS_GENERIC_ERROR; *stat = 0; modulus_bitlen = mp_count_bits((key->N)); modulus_bytelen = mp_unsigned_bin_size((key->N)); if (modulus_bytelen != siglen) return TLS_GENERIC_ERROR; tmpbuf = (unsigned char *)TLS_MALLOC(siglen); if (!tmpbuf) return TLS_GENERIC_ERROR; x = siglen; if ((err = ltc_mp.rsa_me(sig, siglen, tmpbuf, &x, PK_PUBLIC, key)) != CRYPT_OK) { TLS_FREE(tmpbuf); return err; } if (x != siglen) { TLS_FREE(tmpbuf); return CRYPT_INVALID_PACKET; } unsigned long out_len = siglen; unsigned char *out = (unsigned char *)TLS_MALLOC(siglen); if (!out) { TLS_FREE(tmpbuf); return TLS_GENERIC_ERROR; } int decoded = 0; err = pkcs_1_v1_5_decode(tmpbuf, x, LTC_PKCS_1_EMSA, modulus_bitlen, out, &out_len, &decoded); if (decoded) { if (out_len == hashlen) { if (!memcmp(out, hash, hashlen)) *stat = 1; } } TLS_FREE(tmpbuf); TLS_FREE(out); return err; } #endif int _private_tls_verify_rsa(struct TLSContext *context, unsigned int hash_type, const unsigned char *buffer, unsigned int len, const unsigned char *message, unsigned int message_len) { tls_init(); rsa_key key; int err; if (context->is_server) { if ((!len) || (!context->client_certificates) || (!context->client_certificates_count) || (!context->client_certificates[0]) || (!context->client_certificates[0]->der_bytes) || (!context->client_certificates[0]->der_len)) { DEBUG_PRINT("No client certificate set\n"); return TLS_GENERIC_ERROR; } err = rsa_import(context->client_certificates[0]->der_bytes, context->client_certificates[0]->der_len, &key); } else { if ((!len) || (!context->certificates) || (!context->certificates_count) || (!context->certificates[0]) || (!context->certificates[0]->der_bytes) || (!context->certificates[0]->der_len)) { DEBUG_PRINT("No server certificate set\n"); return TLS_GENERIC_ERROR; } err = rsa_import(context->certificates[0]->der_bytes, context->certificates[0]->der_len, &key); } if (err) { DEBUG_PRINT("Error importing RSA certificate (code: %i)\n", err); return TLS_GENERIC_ERROR; } int hash_idx = -1; unsigned char hash[TLS_MAX_HASH_LEN]; unsigned int hash_len = 0; hash_state state; switch (hash_type) { case md5: hash_idx = find_hash("md5"); err = md5_init(&state); TLS_ERROR(err, break); err = md5_process(&state, message, message_len); TLS_ERROR(err, break); err = md5_done(&state, hash); TLS_ERROR(err, break); hash_len = 16; break; case sha1: hash_idx = find_hash("sha1"); err = sha1_init(&state); TLS_ERROR(err, break) err = sha1_process(&state, message, message_len); TLS_ERROR(err, break) err = sha1_done(&state, hash); TLS_ERROR(err, break) hash_len = 20; break; case sha256: hash_idx = find_hash("sha256"); err = sha256_init(&state); TLS_ERROR(err, break) err = sha256_process(&state, message, message_len); TLS_ERROR(err, break) err = sha256_done(&state, hash); TLS_ERROR(err, break) hash_len = 32; break; case sha384: hash_idx = find_hash("sha384"); err = sha384_init(&state); TLS_ERROR(err, break) err = sha384_process(&state, message, message_len); TLS_ERROR(err, break) err = sha384_done(&state, hash); TLS_ERROR(err, break) hash_len = 48; break; case sha512: hash_idx = find_hash("sha512"); err = sha512_init(&state); TLS_ERROR(err, break) err = sha512_process(&state, message, message_len); TLS_ERROR(err, break) err = sha512_done(&state, hash); TLS_ERROR(err, break) hash_len = 64; break; #ifdef TLS_LEGACY_SUPPORT case _md5_sha1: hash_idx = find_hash("md5"); err = md5_init(&state); TLS_ERROR(err, break) err = md5_process(&state, message, message_len); TLS_ERROR(err, break) err = md5_done(&state, hash); TLS_ERROR(err, break) hash_idx = find_hash("sha1"); err = sha1_init(&state); TLS_ERROR(err, break) err = sha1_process(&state, message, message_len); TLS_ERROR(err, break) err = sha1_done(&state, hash + 16); TLS_ERROR(err, break) hash_len = 36; err = sha1_init(&state); TLS_ERROR(err, break) err = sha1_process(&state, message, message_len); TLS_ERROR(err, break) err = sha1_done(&state, hash + 16); TLS_ERROR(err, break) hash_len = 36; break; #endif } if ((hash_idx < 0) || (err)) { DEBUG_PRINT("Unsupported hash type: %i\n", hash_type); return TLS_GENERIC_ERROR; } int rsa_stat = 0; #ifdef TLS_LEGACY_SUPPORT if (hash_type == _md5_sha1) err = _private_rsa_verify_hash_md5sha1(buffer, len, hash, hash_len, &rsa_stat, &key); else #endif #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) err = rsa_verify_hash_ex(buffer, len, hash, hash_len, LTC_PKCS_1_PSS, hash_idx, 0, &rsa_stat, &key); else #endif err = rsa_verify_hash_ex(buffer, len, hash, hash_len, LTC_PKCS_1_V1_5, hash_idx, 0, &rsa_stat, &key); rsa_free(&key); if (err) return 0; return rsa_stat; } #ifdef TLS_LEGACY_SUPPORT int _private_rsa_sign_hash_md5sha1(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, rsa_key *key) { unsigned long modulus_bitlen, modulus_bytelen, x; int err; if ((in == NULL) || (out == NULL) || (outlen == NULL) || (key == NULL)) return TLS_GENERIC_ERROR; modulus_bitlen = mp_count_bits((key->N)); modulus_bytelen = mp_unsigned_bin_size((key->N)); if (modulus_bytelen > *outlen) { *outlen = modulus_bytelen; return CRYPT_BUFFER_OVERFLOW; } x = modulus_bytelen; err = pkcs_1_v1_5_encode(in, inlen, LTC_PKCS_1_EMSA, modulus_bitlen, NULL, 0, out, &x); if (err != CRYPT_OK) return err; return ltc_mp.rsa_me(out, x, out, outlen, PK_PRIVATE, key); } #endif int _private_tls_sign_rsa(struct TLSContext *context, unsigned int hash_type, const unsigned char *message, unsigned int message_len, unsigned char *out, unsigned long *outlen) { if ((!outlen) || (!context) || (!out) || (!outlen) || (!context->private_key) || (!context->private_key->der_bytes) || (!context->private_key->der_len)) { DEBUG_PRINT("No private key set\n"); return TLS_GENERIC_ERROR; } tls_init(); rsa_key key; int err; err = rsa_import(context->private_key->der_bytes, context->private_key->der_len, &key); if (err) { DEBUG_PRINT("Error importing RSA certificate (code: %i)\n", err); return TLS_GENERIC_ERROR; } int hash_idx = -1; unsigned char hash[TLS_MAX_HASH_LEN]; unsigned int hash_len = 0; hash_state state; switch (hash_type) { case md5: hash_idx = find_hash("md5"); err = md5_init(&state); TLS_ERROR(err, break) err = md5_process(&state, message, message_len); TLS_ERROR(err, break) err = md5_done(&state, hash); TLS_ERROR(err, break) hash_len = 16; break; case sha1: hash_idx = find_hash("sha1"); err = sha1_init(&state); TLS_ERROR(err, break) err = sha1_process(&state, message, message_len); TLS_ERROR(err, break) err = sha1_done(&state, hash); TLS_ERROR(err, break) hash_len = 20; break; case sha256: hash_idx = find_hash("sha256"); err = sha256_init(&state); TLS_ERROR(err, break) err = sha256_process(&state, message, message_len); TLS_ERROR(err, break) err = sha256_done(&state, hash); TLS_ERROR(err, break) hash_len = 32; break; case sha384: hash_idx = find_hash("sha384"); err = sha384_init(&state); TLS_ERROR(err, break) err = sha384_process(&state, message, message_len); TLS_ERROR(err, break) err = sha384_done(&state, hash); TLS_ERROR(err, break) hash_len = 48; break; case sha512: hash_idx = find_hash("sha512"); err = sha512_init(&state); TLS_ERROR(err, break) err = sha512_process(&state, message, message_len); TLS_ERROR(err, break) err = sha512_done(&state, hash); TLS_ERROR(err, break) hash_len = 64; break; case _md5_sha1: hash_idx = find_hash("md5"); err = md5_init(&state); TLS_ERROR(err, break) err = md5_process(&state, message, message_len); TLS_ERROR(err, break) err = md5_done(&state, hash); TLS_ERROR(err, break) hash_idx = find_hash("sha1"); err = sha1_init(&state); TLS_ERROR(err, break) err = sha1_process(&state, message, message_len); TLS_ERROR(err, break) err = sha1_done(&state, hash + 16); TLS_ERROR(err, break) hash_len = 36; err = sha1_init(&state); TLS_ERROR(err, break) err = sha1_process(&state, message, message_len); TLS_ERROR(err, break) err = sha1_done(&state, hash + 16); TLS_ERROR(err, break) hash_len = 36; break; } #ifdef TLS_LEGACY_SUPPORT if (hash_type == _md5_sha1) { if (err) { DEBUG_PRINT("Unsupported hash type: %i\n", hash_type); return TLS_GENERIC_ERROR; } err = _private_rsa_sign_hash_md5sha1(hash, hash_len, out, outlen, &key); } else #endif { if ((hash_idx < 0) || (err)) { DEBUG_PRINT("Unsupported hash type: %i\n", hash_type); return TLS_GENERIC_ERROR; } #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) err = rsa_sign_hash_ex(hash, hash_len, out, outlen, LTC_PKCS_1_PSS, NULL, find_prng("sprng"), hash_idx, hash_type == sha256 ? 32 : 48, &key); else #endif err = rsa_sign_hash_ex(hash, hash_len, out, outlen, LTC_PKCS_1_V1_5, NULL, find_prng("sprng"), hash_idx, 0, &key); } rsa_free(&key); if (err) return 0; return 1; } #ifdef TLS_ECDSA_SUPPORTED static int _private_tls_is_point(ecc_key *key) { void *prime, *b, *t1, *t2; int err; if ((err = mp_init_multi(&prime, &b, &t1, &t2, NULL)) != CRYPT_OK) { return err; } /* load prime and b */ if ((err = mp_read_radix(prime, TLS_TOMCRYPT_PRIVATE_DP(key)->prime, 16)) != CRYPT_OK) { goto error; } if ((err = mp_read_radix(b, TLS_TOMCRYPT_PRIVATE_DP(key)->B, 16)) != CRYPT_OK) { goto error; } /* compute y^2 */ if ((err = mp_sqr(key->pubkey.y, t1)) != CRYPT_OK) { goto error; } /* compute x^3 */ if ((err = mp_sqr(key->pubkey.x, t2)) != CRYPT_OK) { goto error; } if ((err = mp_mod(t2, prime, t2)) != CRYPT_OK) { goto error; } if ((err = mp_mul(key->pubkey.x, t2, t2)) != CRYPT_OK) { goto error; } /* compute y^2 - x^3 */ if ((err = mp_sub(t1, t2, t1)) != CRYPT_OK) { goto error; } /* compute y^2 - x^3 + 3x */ if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } if ((err = mp_mod(t1, prime, t1)) != CRYPT_OK) { goto error; } while (mp_cmp_d(t1, 0) == LTC_MP_LT) { if ((err = mp_add(t1, prime, t1)) != CRYPT_OK) { goto error; } } while (mp_cmp(t1, prime) != LTC_MP_LT) { if ((err = mp_sub(t1, prime, t1)) != CRYPT_OK) { goto error; } } /* compare to b */ if (mp_cmp(t1, b) != LTC_MP_EQ) { err = CRYPT_INVALID_PACKET; } else { err = CRYPT_OK; } error: mp_clear_multi(prime, b, t1, t2, NULL); return err; } int _private_tls_ecc_import_key(const unsigned char *private_key, int private_len, const unsigned char *public_key, int public_len, ecc_key *key, const ltc_ecc_set_type *dp) { int err; if ((!key) || (!ltc_mp.name)) return CRYPT_MEM; key->type = PK_PRIVATE; if (mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, NULL) != CRYPT_OK) return CRYPT_MEM; if ((public_len) && (!public_key[0])) { public_key++; public_len--; } if ((err = mp_read_unsigned_bin(key->pubkey.x, (unsigned char *)public_key + 1, (public_len - 1) >> 1)) != CRYPT_OK) { mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); return err; } if ((err = mp_read_unsigned_bin(key->pubkey.y, (unsigned char *)public_key + 1 + ((public_len - 1) >> 1), (public_len - 1) >> 1)) != CRYPT_OK) { mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); return err; } if ((err = mp_read_unsigned_bin(key->k, (unsigned char *)private_key, private_len)) != CRYPT_OK) { mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); return err; } TLS_TOMCRYPT_PRIVATE_SET_INDEX(key, -1); TLS_TOMCRYPT_PRIVATE_DP(key) = dp; /* set z */ if ((err = mp_set(key->pubkey.z, 1)) != CRYPT_OK) { mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); return err; } /* is it a point on the curve? */ if ((err = _private_tls_is_point(key)) != CRYPT_OK) { DEBUG_PRINT("KEY IS NOT ON CURVE\n"); mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); return err; } /* we're good */ return CRYPT_OK; } int _private_tls_sign_ecdsa(struct TLSContext *context, unsigned int hash_type, const unsigned char *message, unsigned int message_len, unsigned char *out, unsigned long *outlen) { if ((!outlen) || (!context) || (!out) || (!outlen) || (!context->ec_private_key) || (!context->ec_private_key->priv) || (!context->ec_private_key->priv_len) || (!context->ec_private_key->pk) || (!context->ec_private_key->pk_len)) { DEBUG_PRINT("No private ECDSA key set\n"); return TLS_GENERIC_ERROR; } const struct ECCCurveParameters *curve = NULL; switch (context->ec_private_key->ec_algorithm) { case 19: curve = &secp192r1; break; case 20: curve = &secp224k1; break; case 21: curve = &secp224r1; break; case 22: curve = &secp256k1; break; case 23: curve = &secp256r1; break; case 24: curve = &secp384r1; break; case 25: curve = &secp521r1; break; default: DEBUG_PRINT("UNSUPPORTED CURVE\n"); } if (!curve) return TLS_GENERIC_ERROR; tls_init(); ecc_key key; int err; ltc_ecc_set_type *dp = (ltc_ecc_set_type *)&curve->dp; // broken ... fix this err = _private_tls_ecc_import_key(context->ec_private_key->priv, context->ec_private_key->priv_len, context->ec_private_key->pk, context->ec_private_key->pk_len, &key, dp); if (err) { DEBUG_PRINT("Error importing ECC certificate (code: %i)\n", (int)err); return TLS_GENERIC_ERROR; } unsigned char hash[TLS_MAX_HASH_LEN]; unsigned int hash_len = 0; hash_state state; switch (hash_type) { case md5: err = md5_init(&state); TLS_ERROR(err, break) err = md5_process(&state, message, message_len); TLS_ERROR(err, break) err = md5_done(&state, hash); TLS_ERROR(err, break) hash_len = 16; break; case sha1: err = sha1_init(&state); TLS_ERROR(err, break) err = sha1_process(&state, message, message_len); TLS_ERROR(err, break) err = sha1_done(&state, hash); TLS_ERROR(err, break) hash_len = 20; break; case sha256: err = sha256_init(&state); TLS_ERROR(err, break) err = sha256_process(&state, message, message_len); TLS_ERROR(err, break) err = sha256_done(&state, hash); TLS_ERROR(err, break) hash_len = 32; break; case sha384: err = sha384_init(&state); TLS_ERROR(err, break) err = sha384_process(&state, message, message_len); TLS_ERROR(err, break) err = sha384_done(&state, hash); TLS_ERROR(err, break) hash_len = 48; break; case sha512: err = sha512_init(&state); TLS_ERROR(err, break) err = sha512_process(&state, message, message_len); TLS_ERROR(err, break) err = sha512_done(&state, hash); TLS_ERROR(err, break) hash_len = 64; break; case _md5_sha1: err = md5_init(&state); TLS_ERROR(err, break) err = md5_process(&state, message, message_len); TLS_ERROR(err, break) err = md5_done(&state, hash); TLS_ERROR(err, break) err = sha1_init(&state); TLS_ERROR(err, break) err = sha1_process(&state, message, message_len); TLS_ERROR(err, break) err = sha1_done(&state, hash + 16); TLS_ERROR(err, break) hash_len = 36; err = sha1_init(&state); TLS_ERROR(err, break) err = sha1_process(&state, message, message_len); TLS_ERROR(err, break) err = sha1_done(&state, hash + 16); TLS_ERROR(err, break) hash_len = 36; break; } if (err) { DEBUG_PRINT("Unsupported hash type: %i\n", hash_type); return TLS_GENERIC_ERROR; } // "Let z be the Ln leftmost bits of e, where Ln is the bit length of the group order n." if (hash_len > (unsigned int)curve->size) hash_len = (unsigned int)curve->size; err = ecc_sign_hash(hash, hash_len, out, outlen, NULL, find_prng("sprng"), &key); DEBUG_DUMP_HEX_LABEL("ECC SIGNATURE", out, *outlen); ecc_free(&key); if (err) return 0; return 1; } #if defined(TLS_CLIENT_ECDSA) || defined(WITH_TLS_13) int _private_tls_ecc_import_pk(const unsigned char *public_key, int public_len, ecc_key *key, const ltc_ecc_set_type *dp) { int err; if ((!key) || (!ltc_mp.name)) return CRYPT_MEM; key->type = PK_PUBLIC; if (mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, NULL) != CRYPT_OK) return CRYPT_MEM; if ((public_len) && (!public_key[0])) { public_key++; public_len--; } if ((err = mp_read_unsigned_bin(key->pubkey.x, (unsigned char *)public_key + 1, (public_len - 1) >> 1)) != CRYPT_OK) { mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); return err; } if ((err = mp_read_unsigned_bin(key->pubkey.y, (unsigned char *)public_key + 1 + ((public_len - 1) >> 1), (public_len - 1) >> 1)) != CRYPT_OK) { mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); return err; } TLS_TOMCRYPT_PRIVATE_SET_INDEX(key, -1); TLS_TOMCRYPT_PRIVATE_DP(key) = dp; /* set z */ if ((err = mp_set(key->pubkey.z, 1)) != CRYPT_OK) { mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); return err; } /* is it a point on the curve? */ if ((err = _private_tls_is_point(key)) != CRYPT_OK) { DEBUG_PRINT("KEY IS NOT ON CURVE\n"); mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); return err; } /* we're good */ return CRYPT_OK; } int _private_tls_verify_ecdsa(struct TLSContext *context, unsigned int hash_type, const unsigned char *buffer, unsigned int len, const unsigned char *message, unsigned int message_len, const struct ECCCurveParameters *curve_hint) { tls_init(); ecc_key key; int err; if (!curve_hint) curve_hint = context->curve; if (context->is_server) { if ((!len) || (!context->client_certificates) || (!context->client_certificates_count) || (!context->client_certificates[0]) || (!context->client_certificates[0]->pk) || (!context->client_certificates[0]->pk_len) || (!curve_hint)) { DEBUG_PRINT("No client certificate set\n"); return TLS_GENERIC_ERROR; } err = _private_tls_ecc_import_pk(context->client_certificates[0]->pk, context->client_certificates[0]->pk_len, &key, (ltc_ecc_set_type *)&curve_hint->dp); } else { if ((!len) || (!context->certificates) || (!context->certificates_count) || (!context->certificates[0]) || (!context->certificates[0]->pk) || (!context->certificates[0]->pk_len) || (!curve_hint)) { DEBUG_PRINT("No server certificate set\n"); return TLS_GENERIC_ERROR; } err = _private_tls_ecc_import_pk(context->certificates[0]->pk, context->certificates[0]->pk_len, &key, (ltc_ecc_set_type *)&curve_hint->dp); } if (err) { DEBUG_PRINT("Error importing ECC certificate (code: %i)", err); return TLS_GENERIC_ERROR; } int hash_idx = -1; unsigned char hash[TLS_MAX_HASH_LEN]; unsigned int hash_len = 0; hash_state state; switch (hash_type) { case md5: hash_idx = find_hash("md5"); err = md5_init(&state); if (!err) { err = md5_process(&state, message, message_len); if (!err) err = md5_done(&state, hash); } hash_len = 16; break; case sha1: hash_idx = find_hash("sha1"); err = sha1_init(&state); if (!err) { err = sha1_process(&state, message, message_len); if (!err) err = sha1_done(&state, hash); } hash_len = 20; break; case sha256: hash_idx = find_hash("sha256"); err = sha256_init(&state); if (!err) { err = sha256_process(&state, message, message_len); if (!err) err = sha256_done(&state, hash); } hash_len = 32; break; case sha384: hash_idx = find_hash("sha384"); err = sha384_init(&state); if (!err) { err = sha384_process(&state, message, message_len); if (!err) err = sha384_done(&state, hash); } hash_len = 48; break; case sha512: hash_idx = find_hash("sha512"); err = sha512_init(&state); if (!err) { err = sha512_process(&state, message, message_len); if (!err) err = sha512_done(&state, hash); } hash_len = 64; break; #ifdef TLS_LEGACY_SUPPORT case _md5_sha1: hash_idx = find_hash("md5"); err = md5_init(&state); if (!err) { err = md5_process(&state, message, message_len); if (!err) err = md5_done(&state, hash); } hash_idx = find_hash("sha1"); err = sha1_init(&state); if (!err) { err = sha1_process(&state, message, message_len); if (!err) err = sha1_done(&state, hash + 16); } hash_len = 36; err = sha1_init(&state); if (!err) { err = sha1_process(&state, message, message_len); if (!err) err = sha1_done(&state, hash + 16); } hash_len = 36; break; #endif } if ((hash_idx < 0) || (err)) { DEBUG_PRINT("Unsupported hash type: %i\n", hash_type); return TLS_GENERIC_ERROR; } int ecc_stat = 0; err = ecc_verify_hash(buffer, len, hash, hash_len, &ecc_stat, &key); ecc_free(&key); if (err) return 0; return ecc_stat; } #endif #endif unsigned int _private_tls_random_int(int limit) { unsigned int res = 0; tls_random((unsigned char *)&res, sizeof(int)); if (limit) res %= limit; return res; } void _private_tls_sleep(unsigned int microseconds) { #ifdef _WIN32 Sleep(microseconds/1000); #else struct timespec ts; ts.tv_sec = (unsigned int) (microseconds / 1000000); ts.tv_nsec = (unsigned int) (microseconds % 1000000) * 1000ul; nanosleep(&ts, NULL); #endif } void _private_random_sleep(struct TLSContext *context, int max_microseconds) { if (context) context->sleep_until = (unsigned int)time(NULL) + _private_tls_random_int(max_microseconds/1000000 * TLS_MAX_ERROR_IDLE_S); else _private_tls_sleep(_private_tls_random_int(max_microseconds)); } void _private_tls_prf_helper(int hash_idx, unsigned long dlen, unsigned char *output, unsigned int outlen, const unsigned char *secret, const unsigned int secret_len, const unsigned char *label, unsigned int label_len, unsigned char *seed, unsigned int seed_len, unsigned char *seed_b, unsigned int seed_b_len) { unsigned char digest_out0[TLS_MAX_HASH_LEN]; unsigned char digest_out1[TLS_MAX_HASH_LEN]; unsigned int i; hmac_state hmac; hmac_init(&hmac, hash_idx, secret, secret_len); hmac_process(&hmac, label, label_len); hmac_process(&hmac, seed, seed_len); if ((seed_b) && (seed_b_len)) hmac_process(&hmac, seed_b, seed_b_len); hmac_done(&hmac, digest_out0, &dlen); int idx = 0; while (outlen) { hmac_init(&hmac, hash_idx, secret, secret_len); hmac_process(&hmac, digest_out0, dlen); hmac_process(&hmac, label, label_len); hmac_process(&hmac, seed, seed_len); if ((seed_b) && (seed_b_len)) hmac_process(&hmac, seed_b, seed_b_len); hmac_done(&hmac, digest_out1, &dlen); unsigned int copylen = outlen; if (copylen > dlen) copylen = dlen; for (i = 0; i < copylen; i++) { output[idx++] ^= digest_out1[i]; outlen--; } if (!outlen) break; hmac_init(&hmac, hash_idx, secret, secret_len); hmac_process(&hmac, digest_out0, dlen); hmac_done(&hmac, digest_out0, &dlen); } } #ifdef WITH_TLS_13 int _private_tls_hkdf_label(const char *label, unsigned char label_len, const unsigned char *data, unsigned char data_len, unsigned char *hkdflabel, unsigned short length, const char *prefix) { *(unsigned short *)hkdflabel = htons(length); int prefix_len; if (prefix) { prefix_len = (int)strlen(prefix); memcpy(&hkdflabel[3], prefix, prefix_len); } else { memcpy(&hkdflabel[3], "tls13 ", 6); prefix_len = 6; } hkdflabel[2] = (unsigned char)prefix_len + label_len; memcpy(&hkdflabel[3 + prefix_len], label, label_len); hkdflabel[3 + prefix_len + label_len] = (unsigned char)data_len; if (data_len) memcpy(&hkdflabel[4 + prefix_len + label_len], data, data_len); return 4 + prefix_len + label_len + data_len; } int _private_tls_hkdf_extract(unsigned int mac_length, unsigned char *output, unsigned int outlen, const unsigned char *salt, unsigned int salt_len, const unsigned char *ikm, unsigned char ikm_len) { unsigned long dlen = outlen; static unsigned char dummy_label[1] = { 0 }; if ((!salt) || (salt_len == 0)) { salt_len = 1; salt = dummy_label; } int hash_idx; if (mac_length == TLS_SHA384_MAC_SIZE) { hash_idx = find_hash("sha384"); dlen = mac_length; } else hash_idx = find_hash("sha256"); hmac_state hmac; hmac_init(&hmac, hash_idx, salt, salt_len); hmac_process(&hmac, ikm, ikm_len); hmac_done(&hmac, output, &dlen); DEBUG_DUMP_HEX_LABEL("EXTRACT", output, dlen); return dlen; } void _private_tls_hkdf_expand(unsigned int mac_length, unsigned char *output, unsigned int outlen, const unsigned char *secret, unsigned int secret_len, const unsigned char *info, unsigned char info_len) { unsigned char digest_out[TLS_MAX_HASH_LEN]; unsigned long dlen = 32; int hash_idx; if (mac_length == TLS_SHA384_MAC_SIZE) { hash_idx = find_hash("sha384"); dlen = mac_length; } else hash_idx = find_hash("sha256"); unsigned int i; unsigned int idx = 0; hmac_state hmac; unsigned char i2 = 0; while (outlen) { hmac_init(&hmac, hash_idx, secret, secret_len); if (i2) hmac_process(&hmac, digest_out, dlen); if ((info) && (info_len)) hmac_process(&hmac, info, info_len); i2++; hmac_process(&hmac, &i2, 1); hmac_done(&hmac, digest_out, &dlen); unsigned int copylen = outlen; if (copylen > dlen) copylen = (unsigned int)dlen; for (i = 0; i < copylen; i++) { output[idx++] = digest_out[i]; outlen--; } if (!outlen) break; } } void _private_tls_hkdf_expand_label(unsigned int mac_length, unsigned char *output, unsigned int outlen, const unsigned char *secret, unsigned int secret_len, const char *label, unsigned char label_len, const unsigned char *data, unsigned char data_len) { unsigned char hkdf_label[512]; int len = _private_tls_hkdf_label(label, label_len, data, data_len, hkdf_label, outlen, NULL); DEBUG_DUMP_HEX_LABEL("INFO", hkdf_label, len); _private_tls_hkdf_expand(mac_length, output, outlen, secret, secret_len, hkdf_label, len); } #endif void _private_tls_prf(struct TLSContext *context, unsigned char *output, unsigned int outlen, const unsigned char *secret, const unsigned int secret_len, const unsigned char *label, unsigned int label_len, unsigned char *seed, unsigned int seed_len, unsigned char *seed_b, unsigned int seed_b_len) { if ((!secret) || (!secret_len)) { DEBUG_PRINT("NULL SECRET\n"); return; } if ((context->version != TLS_V12) && (context->version != DTLS_V12)) { int md5_hash_idx = find_hash("md5"); int sha1_hash_idx = find_hash("sha1"); int half_secret = (secret_len + 1) / 2; memset(output, 0, outlen); _private_tls_prf_helper(md5_hash_idx, 16, output, outlen, secret, half_secret, label, label_len, seed, seed_len, seed_b, seed_b_len); _private_tls_prf_helper(sha1_hash_idx, 20, output, outlen, secret + (secret_len - half_secret), secret_len - half_secret, label, label_len, seed, seed_len, seed_b, seed_b_len); } else { // sha256_hmac unsigned char digest_out0[TLS_MAX_HASH_LEN]; unsigned char digest_out1[TLS_MAX_HASH_LEN]; unsigned long dlen = 32; int hash_idx; unsigned int mac_length = _private_tls_mac_length(context); if (mac_length == TLS_SHA384_MAC_SIZE) { hash_idx = find_hash("sha384"); dlen = mac_length; } else hash_idx = find_hash("sha256"); unsigned int i; hmac_state hmac; hmac_init(&hmac, hash_idx, secret, secret_len); hmac_process(&hmac, label, label_len); hmac_process(&hmac, seed, seed_len); if ((seed_b) && (seed_b_len)) hmac_process(&hmac, seed_b, seed_b_len); hmac_done(&hmac, digest_out0, &dlen); int idx = 0; while (outlen) { hmac_init(&hmac, hash_idx, secret, secret_len); hmac_process(&hmac, digest_out0, dlen); hmac_process(&hmac, label, label_len); hmac_process(&hmac, seed, seed_len); if ((seed_b) && (seed_b_len)) hmac_process(&hmac, seed_b, seed_b_len); hmac_done(&hmac, digest_out1, &dlen); unsigned int copylen = outlen; if (copylen > dlen) copylen = (unsigned int)dlen; for (i = 0; i < copylen; i++) { output[idx++] = digest_out1[i]; outlen--; } if (!outlen) break; hmac_init(&hmac, hash_idx, secret, secret_len); hmac_process(&hmac, digest_out0, dlen); hmac_done(&hmac, digest_out0, &dlen); } } } int _private_tls_key_length(struct TLSContext *context) { switch (context->cipher) { case TLS_RSA_WITH_AES_128_CBC_SHA: case TLS_RSA_WITH_AES_128_CBC_SHA256: case TLS_RSA_WITH_AES_128_GCM_SHA256: case TLS_DHE_RSA_WITH_AES_128_CBC_SHA: case TLS_DHE_RSA_WITH_AES_128_CBC_SHA256: case TLS_DHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA: case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256: case TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA: case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: case TLS_AES_128_GCM_SHA256: return 16; case TLS_RSA_WITH_AES_256_CBC_SHA: case TLS_RSA_WITH_AES_256_CBC_SHA256: case TLS_RSA_WITH_AES_256_GCM_SHA384: case TLS_DHE_RSA_WITH_AES_256_CBC_SHA: case TLS_DHE_RSA_WITH_AES_256_CBC_SHA256: case TLS_DHE_RSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA: case TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA384: case TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256: case TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256: case TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256: case TLS_AES_256_GCM_SHA384: case TLS_CHACHA20_POLY1305_SHA256: return 32; } return 0; } int _private_tls_is_aead(struct TLSContext *context) { switch (context->cipher) { case TLS_RSA_WITH_AES_128_GCM_SHA256: case TLS_RSA_WITH_AES_256_GCM_SHA384: case TLS_DHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_DHE_RSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384: case TLS_AES_128_GCM_SHA256: case TLS_AES_256_GCM_SHA384: return 1; case TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256: case TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256: case TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256: case TLS_CHACHA20_POLY1305_SHA256: return 2; } return 0; } unsigned int _private_tls_mac_length(struct TLSContext *context) { switch (context->cipher) { case TLS_RSA_WITH_AES_128_CBC_SHA: case TLS_RSA_WITH_AES_256_CBC_SHA: case TLS_DHE_RSA_WITH_AES_128_CBC_SHA: case TLS_DHE_RSA_WITH_AES_256_CBC_SHA: case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA: case TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA: case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA: return TLS_SHA1_MAC_SIZE; case TLS_RSA_WITH_AES_128_CBC_SHA256: case TLS_RSA_WITH_AES_256_CBC_SHA256: case TLS_RSA_WITH_AES_128_GCM_SHA256: case TLS_DHE_RSA_WITH_AES_128_CBC_SHA256: case TLS_DHE_RSA_WITH_AES_256_CBC_SHA256: case TLS_DHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256: case TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256: case TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256: case TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256: #ifdef WITH_TLS_13 case TLS_AES_128_GCM_SHA256: case TLS_CHACHA20_POLY1305_SHA256: case TLS_AES_128_CCM_SHA256: case TLS_AES_128_CCM_8_SHA256: #endif return TLS_SHA256_MAC_SIZE; case TLS_RSA_WITH_AES_256_GCM_SHA384: case TLS_DHE_RSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA384: case TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384: #ifdef WITH_TLS_13 case TLS_AES_256_GCM_SHA384: #endif return TLS_SHA384_MAC_SIZE; } return 0; } #ifdef WITH_TLS_13 int _private_tls13_key(struct TLSContext *context, int handshake) { tls_init(); int key_length = _private_tls_key_length(context); unsigned int mac_length = _private_tls_mac_length(context); if ((!context->premaster_key) || (!context->premaster_key_len)) return 0; if ((!key_length) || (!mac_length)) { DEBUG_PRINT("KEY EXPANSION FAILED, KEY LENGTH: %i, MAC LENGTH: %i\n", key_length, mac_length); return 0; } unsigned char *clientkey = NULL; unsigned char *serverkey = NULL; unsigned char *clientiv = NULL; unsigned char *serveriv = NULL; int is_aead = _private_tls_is_aead(context); unsigned char local_keybuffer[TLS_V13_MAX_KEY_SIZE]; unsigned char local_ivbuffer[TLS_V13_MAX_IV_SIZE]; unsigned char remote_keybuffer[TLS_V13_MAX_KEY_SIZE]; unsigned char remote_ivbuffer[TLS_V13_MAX_IV_SIZE]; unsigned char prk[TLS_MAX_HASH_SIZE]; unsigned char hash[TLS_MAX_HASH_SIZE]; static unsigned char earlysecret[TLS_MAX_HASH_SIZE]; const char *server_key = "s ap traffic"; const char *client_key = "c ap traffic"; if (handshake) { server_key = "s hs traffic"; client_key = "c hs traffic"; } unsigned char salt[TLS_MAX_HASH_SIZE]; hash_state md; if (mac_length == TLS_SHA384_MAC_SIZE) { sha384_init(&md); sha384_done(&md, hash); } else { sha256_init(&md); sha256_done(&md, hash); } // extract secret "early" if ((context->master_key) && (context->master_key_len) && (!handshake)) { DEBUG_DUMP_HEX_LABEL("USING PREVIOUS SECRET", context->master_key, context->master_key_len); _private_tls_hkdf_expand_label(mac_length, salt, mac_length, context->master_key, context->master_key_len, "derived", 7, hash, mac_length); DEBUG_DUMP_HEX_LABEL("salt", salt, mac_length); _private_tls_hkdf_extract(mac_length, prk, mac_length, salt, mac_length, earlysecret, mac_length); } else { _private_tls_hkdf_extract(mac_length, prk, mac_length, NULL, 0, earlysecret, mac_length); // derive secret for handshake "tls13 derived": DEBUG_DUMP_HEX_LABEL("null hash", hash, mac_length); _private_tls_hkdf_expand_label(mac_length, salt, mac_length, prk, mac_length, "derived", 7, hash, mac_length); // extract secret "handshake": DEBUG_DUMP_HEX_LABEL("salt", salt, mac_length); _private_tls_hkdf_extract(mac_length, prk, mac_length, salt, mac_length, context->premaster_key, context->premaster_key_len); } if (!is_aead) { DEBUG_PRINT("KEY EXPANSION FAILED, NON AEAD CIPHER\n"); return 0; } unsigned char secret[TLS_MAX_MAC_SIZE]; unsigned char hs_secret[TLS_MAX_HASH_SIZE]; int hash_size; if (handshake) hash_size = _private_tls_get_hash(context, hash); else hash_size = _private_tls_done_hash(context, hash); DEBUG_DUMP_HEX_LABEL("messages hash", hash, hash_size); if (context->is_server) { _private_tls_hkdf_expand_label(mac_length, hs_secret, mac_length, prk, mac_length, server_key, 12, context->server_finished_hash ? context->server_finished_hash : hash, hash_size); DEBUG_DUMP_HEX_LABEL(server_key, hs_secret, mac_length); serverkey = local_keybuffer; serveriv = local_ivbuffer; clientkey = remote_keybuffer; clientiv = remote_ivbuffer; } else { _private_tls_hkdf_expand_label(mac_length, hs_secret, mac_length, prk, mac_length, client_key, 12, context->server_finished_hash ? context->server_finished_hash : hash, hash_size); DEBUG_DUMP_HEX_LABEL(client_key, hs_secret, mac_length); serverkey = remote_keybuffer; serveriv = remote_ivbuffer; clientkey = local_keybuffer; clientiv = local_ivbuffer; } int iv_length = TLS_13_AES_GCM_IV_LENGTH; #ifdef TLS_WITH_CHACHA20_POLY1305 if (is_aead == 2) iv_length = TLS_CHACHA20_IV_LENGTH; #endif _private_tls_hkdf_expand_label(mac_length, local_keybuffer, key_length, hs_secret, mac_length, "key", 3, NULL, 0); _private_tls_hkdf_expand_label(mac_length, local_ivbuffer, iv_length, hs_secret, mac_length, "iv", 2, NULL, 0); if (context->is_server) _private_tls_hkdf_expand_label(mac_length, secret, mac_length, prk, mac_length, client_key, 12, context->server_finished_hash ? context->server_finished_hash : hash, hash_size); else _private_tls_hkdf_expand_label(mac_length, secret, mac_length, prk, mac_length, server_key, 12, context->server_finished_hash ? context->server_finished_hash : hash, hash_size); _private_tls_hkdf_expand_label(mac_length, remote_keybuffer, key_length, secret, mac_length, "key", 3, NULL, 0); _private_tls_hkdf_expand_label(mac_length, remote_ivbuffer, iv_length, secret, mac_length, "iv", 2, NULL, 0); DEBUG_DUMP_HEX_LABEL("CLIENT KEY", clientkey, key_length) DEBUG_DUMP_HEX_LABEL("CLIENT IV", clientiv, iv_length) DEBUG_DUMP_HEX_LABEL("SERVER KEY", serverkey, key_length) DEBUG_DUMP_HEX_LABEL("SERVER IV", serveriv, iv_length) TLS_FREE(context->finished_key); TLS_FREE(context->remote_finished_key); if (handshake) { context->finished_key = (unsigned char *)TLS_MALLOC(mac_length); context->remote_finished_key = (unsigned char *)TLS_MALLOC(mac_length); if (context->finished_key) { _private_tls_hkdf_expand_label(mac_length, context->finished_key, mac_length, hs_secret, mac_length, "finished", 8, NULL, 0); DEBUG_DUMP_HEX_LABEL("FINISHED", context->finished_key, mac_length) } if (context->remote_finished_key) { _private_tls_hkdf_expand_label(mac_length, context->remote_finished_key, mac_length, secret, mac_length, "finished", 8, NULL, 0); DEBUG_DUMP_HEX_LABEL("REMOTE FINISHED", context->remote_finished_key, mac_length) } } else { context->finished_key = NULL; context->remote_finished_key = NULL; TLS_FREE(context->server_finished_hash); context->server_finished_hash = NULL; } if (context->is_server) { #ifdef TLS_WITH_CHACHA20_POLY1305 if (is_aead == 2) { memcpy(context->crypto.ctx_remote_mac.remote_nonce, clientiv, iv_length); memcpy(context->crypto.ctx_local_mac.local_nonce, serveriv, iv_length); } else #endif if (is_aead) { memcpy(context->crypto.ctx_remote_mac.remote_iv, clientiv, iv_length); memcpy(context->crypto.ctx_local_mac.local_iv, serveriv, iv_length); } if (_private_tls_crypto_create(context, key_length, serverkey, serveriv, clientkey, clientiv)) return 0; } else { #ifdef TLS_WITH_CHACHA20_POLY1305 if (is_aead == 2) { memcpy(context->crypto.ctx_local_mac.local_nonce, clientiv, iv_length); memcpy(context->crypto.ctx_remote_mac.remote_nonce, serveriv, iv_length); } else #endif if (is_aead) { memcpy(context->crypto.ctx_local_mac.local_iv, clientiv, iv_length); memcpy(context->crypto.ctx_remote_mac.remote_iv, serveriv, iv_length); } if (_private_tls_crypto_create(context, key_length, clientkey, clientiv, serverkey, serveriv)) return 0; } context->crypto.created = 1 + is_aead; if (context->exportable) { TLS_FREE(context->exportable_keys); context->exportable_keys = (unsigned char *)TLS_MALLOC(key_length * 2); if (context->exportable_keys) { if (context->is_server) { memcpy(context->exportable_keys, serverkey, key_length); memcpy(context->exportable_keys + key_length, clientkey, key_length); } else { memcpy(context->exportable_keys, clientkey, key_length); memcpy(context->exportable_keys + key_length, serverkey, key_length); } context->exportable_size = key_length * 2; } } TLS_FREE(context->master_key); context->master_key = (unsigned char *)TLS_MALLOC(mac_length); if (context->master_key) { memcpy(context->master_key, prk, mac_length); context->master_key_len = mac_length; } context->local_sequence_number = 0; context->remote_sequence_number = 0; // extract client_mac_key(mac_key_length) // extract server_mac_key(mac_key_length) // extract client_key(enc_key_length) // extract server_key(enc_key_length) // extract client_iv(fixed_iv_lengh) // extract server_iv(fixed_iv_length) return 1; } #endif int _private_tls_expand_key(struct TLSContext *context) { unsigned char key[TLS_MAX_KEY_EXPANSION_SIZE]; #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) return 0; #endif if ((!context->master_key) || (!context->master_key_len)) return 0; int key_length = _private_tls_key_length(context); int mac_length = _private_tls_mac_length(context); if ((!key_length) || (!mac_length)) { DEBUG_PRINT("KEY EXPANSION FAILED, KEY LENGTH: %i, MAC LENGTH: %i\n", key_length, mac_length); return 0; } unsigned char *clientkey = NULL; unsigned char *serverkey = NULL; unsigned char *clientiv = NULL; unsigned char *serveriv = NULL; int iv_length = TLS_AES_IV_LENGTH; int is_aead = _private_tls_is_aead(context); if (context->is_server) _private_tls_prf(context, key, sizeof(key), context->master_key, context->master_key_len, (unsigned char *)"key expansion", 13, context->local_random, TLS_SERVER_RANDOM_SIZE, context->remote_random, TLS_CLIENT_RANDOM_SIZE); else _private_tls_prf(context, key, sizeof(key), context->master_key, context->master_key_len, (unsigned char *)"key expansion", 13, context->remote_random, TLS_SERVER_RANDOM_SIZE, context->local_random, TLS_CLIENT_RANDOM_SIZE); DEBUG_DUMP_HEX_LABEL("LOCAL RANDOM ", context->local_random, TLS_SERVER_RANDOM_SIZE); DEBUG_DUMP_HEX_LABEL("REMOTE RANDOM", context->remote_random, TLS_CLIENT_RANDOM_SIZE); DEBUG_PRINT("\n=========== EXPANSION ===========\n"); DEBUG_DUMP_HEX(key, TLS_MAX_KEY_EXPANSION_SIZE); DEBUG_PRINT("\n"); int pos = 0; #ifdef TLS_WITH_CHACHA20_POLY1305 if (is_aead == 2) { iv_length = TLS_CHACHA20_IV_LENGTH; } else #endif if (is_aead) { iv_length = TLS_AES_GCM_IV_LENGTH; } else { if (context->is_server) { memcpy(context->crypto.ctx_remote_mac.remote_mac, &key[pos], mac_length); pos += mac_length; memcpy(context->crypto.ctx_local_mac.local_mac, &key[pos], mac_length); pos += mac_length; } else { memcpy(context->crypto.ctx_local_mac.local_mac, &key[pos], mac_length); pos += mac_length; memcpy(context->crypto.ctx_remote_mac.remote_mac, &key[pos], mac_length); pos += mac_length; } } clientkey = &key[pos]; pos += key_length; serverkey = &key[pos]; pos += key_length; clientiv = &key[pos]; pos += iv_length; serveriv = &key[pos]; pos += iv_length; DEBUG_PRINT("EXPANSION %i/%i\n", (int)pos, (int)TLS_MAX_KEY_EXPANSION_SIZE); DEBUG_DUMP_HEX_LABEL("CLIENT KEY", clientkey, key_length) DEBUG_DUMP_HEX_LABEL("CLIENT IV", clientiv, iv_length) DEBUG_DUMP_HEX_LABEL("CLIENT MAC KEY", context->is_server ? context->crypto.ctx_remote_mac.remote_mac : context->crypto.ctx_local_mac.local_mac, mac_length) DEBUG_DUMP_HEX_LABEL("SERVER KEY", serverkey, key_length) DEBUG_DUMP_HEX_LABEL("SERVER IV", serveriv, iv_length) DEBUG_DUMP_HEX_LABEL("SERVER MAC KEY", context->is_server ? context->crypto.ctx_local_mac.local_mac : context->crypto.ctx_remote_mac.remote_mac, mac_length) if (context->is_server) { #ifdef TLS_WITH_CHACHA20_POLY1305 if (is_aead == 2) { memcpy(context->crypto.ctx_remote_mac.remote_nonce, clientiv, iv_length); memcpy(context->crypto.ctx_local_mac.local_nonce, serveriv, iv_length); } else #endif if (is_aead) { memcpy(context->crypto.ctx_remote_mac.remote_aead_iv, clientiv, iv_length); memcpy(context->crypto.ctx_local_mac.local_aead_iv, serveriv, iv_length); } if (_private_tls_crypto_create(context, key_length, serverkey, serveriv, clientkey, clientiv)) return 0; } else { #ifdef TLS_WITH_CHACHA20_POLY1305 if (is_aead == 2) { memcpy(context->crypto.ctx_local_mac.local_nonce, clientiv, iv_length); memcpy(context->crypto.ctx_remote_mac.remote_nonce, serveriv, iv_length); } else #endif if (is_aead) { memcpy(context->crypto.ctx_local_mac.local_aead_iv, clientiv, iv_length); memcpy(context->crypto.ctx_remote_mac.remote_aead_iv, serveriv, iv_length); } if (_private_tls_crypto_create(context, key_length, clientkey, clientiv, serverkey, serveriv)) return 0; } if (context->exportable) { TLS_FREE(context->exportable_keys); context->exportable_keys = (unsigned char *)TLS_MALLOC(key_length * 2); if (context->exportable_keys) { if (context->is_server) { memcpy(context->exportable_keys, serverkey, key_length); memcpy(context->exportable_keys + key_length, clientkey, key_length); } else { memcpy(context->exportable_keys, clientkey, key_length); memcpy(context->exportable_keys + key_length, serverkey, key_length); } context->exportable_size = key_length * 2; } } // extract client_mac_key(mac_key_length) // extract server_mac_key(mac_key_length) // extract client_key(enc_key_length) // extract server_key(enc_key_length) // extract client_iv(fixed_iv_lengh) // extract server_iv(fixed_iv_length) return 1; } int _private_tls_compute_key(struct TLSContext *context, unsigned int key_len) { #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) return 0; #endif if ((!context->premaster_key) || (!context->premaster_key_len) || (key_len < 48)) { DEBUG_PRINT("CANNOT COMPUTE MASTER SECRET\n"); return 0; } unsigned char master_secret_label[] = "master secret"; #ifdef TLS_CHECK_PREMASTER_KEY if (!tls_cipher_is_ephemeral(context)) { unsigned short version = ntohs(*(unsigned short *)context->premaster_key); // this check is not true for DHE/ECDHE ciphers if (context->version > version) { DEBUG_PRINT("Mismatch protocol version 0x(%x)\n", version); return 0; } } #endif TLS_FREE(context->master_key); context->master_key_len = 0; context->master_key = NULL; if ((context->version == TLS_V13) || (context->version == TLS_V12) || (context->version == TLS_V11) || (context->version == TLS_V10) || (context->version == DTLS_V13) || (context->version == DTLS_V12) || (context->version == DTLS_V10)) { context->master_key = (unsigned char *)TLS_MALLOC(key_len); if (!context->master_key) return 0; context->master_key_len = key_len; if (context->is_server) { _private_tls_prf(context, context->master_key, context->master_key_len, context->premaster_key, context->premaster_key_len, master_secret_label, 13, context->remote_random, TLS_CLIENT_RANDOM_SIZE, context->local_random, TLS_SERVER_RANDOM_SIZE ); } else { _private_tls_prf(context, context->master_key, context->master_key_len, context->premaster_key, context->premaster_key_len, master_secret_label, 13, context->local_random, TLS_CLIENT_RANDOM_SIZE, context->remote_random, TLS_SERVER_RANDOM_SIZE ); } TLS_FREE(context->premaster_key); context->premaster_key = NULL; context->premaster_key_len = 0; DEBUG_PRINT("\n=========== Master key ===========\n"); DEBUG_DUMP_HEX(context->master_key, context->master_key_len); DEBUG_PRINT("\n"); _private_tls_expand_key(context); return 1; } return 0; } unsigned char *tls_pem_decode(const unsigned char *data_in, unsigned int input_length, int cert_index, unsigned int *output_len) { unsigned int i; *output_len = 0; int alloc_len = input_length / 4 * 3; unsigned char *output = (unsigned char *)TLS_MALLOC(alloc_len); if (!output) return NULL; unsigned int start_at = 0; unsigned int idx = 0; for (i = 0; i < input_length; i++) { if ((data_in[i] == '\n') || (data_in[i] == '\r')) continue; if (data_in[i] != '-') { // read entire line while ((i < input_length) && (data_in[i] != '\n')) i++; continue; } if (data_in[i] == '-') { unsigned int end_idx = i; //read until end of line while ((i < input_length) && (data_in[i] != '\n')) i++; if (start_at) { if (cert_index > 0) { cert_index--; start_at = 0; } else { idx = _private_b64_decode((const char *)&data_in[start_at], end_idx - start_at, output); break; } } else start_at = i + 1; } } *output_len = idx; if (!idx) { TLS_FREE(output); return NULL; } return output; } int _is_oid(const unsigned char *oid, const unsigned char *compare_to, int compare_to_len) { int i = 0; while ((oid[i]) && (i < compare_to_len)) { if (oid[i] != compare_to[i]) return 0; i++; } return 1; } int _is_oid2(const unsigned char *oid, const unsigned char *compare_to, int compare_to_len, int oid_len) { int i = 0; if (oid_len < compare_to_len) compare_to_len = oid_len; while (i < compare_to_len) { if (oid[i] != compare_to[i]) return 0; i++; } return 1; } struct TLSCertificate *tls_create_certificate() { struct TLSCertificate *cert = (struct TLSCertificate *)TLS_MALLOC(sizeof(struct TLSCertificate)); if (cert) memset(cert, 0, sizeof(struct TLSCertificate)); return cert; } int tls_certificate_valid_subject_name(const unsigned char *cert_subject, const char *subject) { // no subjects ... if (((!cert_subject) || (!cert_subject[0])) && ((!subject) || (!subject[0]))) return 0; if ((!subject) || (!subject[0])) return bad_certificate; if ((!cert_subject) || (!cert_subject[0])) return bad_certificate; // exact match if (!strcmp((const char *)cert_subject, subject)) return 0; const char *wildcard = strchr((const char *)cert_subject, '*'); if (wildcard) { // 6.4.3 (1) The client SHOULD NOT attempt to match a presented identifier in // which the wildcard character comprises a label other than the left-most label if (!wildcard[1]) { // subject is [*] // or // subject is [something*] .. invalid return bad_certificate; } wildcard++; const char *match = strstr(subject, wildcard); if ((!match) && (wildcard[0] == '.')) { // check *.domain.com agains domain.com wildcard++; if (!strcasecmp(subject, wildcard)) return 0; } if (match) { uintptr_t offset = (uintptr_t)match - (uintptr_t)subject; if (offset) { // check for foo.*.domain.com against *.domain.com (invalid) if (memchr(subject, '.', offset)) return bad_certificate; } // check if exact match if (!strcasecmp(match, wildcard)) return 0; } } return bad_certificate; } int tls_certificate_valid_subject(struct TLSCertificate *cert, const char *subject) { int i; if (!cert) return certificate_unknown; int err = tls_certificate_valid_subject_name(cert->subject, subject); if ((err) && (cert->san)) { for (i = 0; i < cert->san_length; i++) { err = tls_certificate_valid_subject_name(cert->san[i], subject); if (!err) return err; } } return err; } int tls_certificate_is_valid(struct TLSCertificate *cert) { if (!cert) return certificate_unknown; if (!cert->not_before) return certificate_unknown; if (!cert->not_after) return certificate_unknown; //20160224182300Z// char current_time[16]; time_t t = time(NULL); struct tm *utct = gmtime(&t); if (utct) { current_time[0] = 0; snprintf(current_time, sizeof(current_time), "%04d%02d%02d%02d%02d%02dZ", 1900 + utct->tm_year, utct->tm_mon + 1, utct->tm_mday, utct->tm_hour, utct->tm_min, utct->tm_sec); if (strcasecmp((char *)cert->not_before, current_time) > 0) { DEBUG_PRINT("Certificate is not yer valid, now: %s (validity: %s - %s)\n", current_time, cert->not_before, cert->not_after); return certificate_expired; } if (strcasecmp((char *)cert->not_after, current_time) < 0) { DEBUG_PRINT("Expired certificate, now: %s (validity: %s - %s)\n", current_time, cert->not_before, cert->not_after); return certificate_expired; } DEBUG_PRINT("Valid certificate, now: %s (validity: %s - %s)\n", current_time, cert->not_before, cert->not_after); } return 0; } void tls_certificate_set_copy(unsigned char **member, const unsigned char *val, int len) { if (!member) return; TLS_FREE(*member); if (len) { *member = (unsigned char *)TLS_MALLOC(len + 1); if (*member) { memcpy(*member, val, len); (*member)[len] = 0; } } else *member = NULL; } void tls_certificate_set_copy_date(unsigned char **member, const unsigned char *val, int len) { if (!member) return; TLS_FREE(*member); if (len > 4) { *member = (unsigned char *)TLS_MALLOC(len + 3); if (*member) { if (val[0] == '9') { (*member)[0]='1'; (*member)[1]='9'; } else { (*member)[0]='2'; (*member)[1]='0'; } memcpy(*member + 2, val, len); (*member)[len] = 0; } } else *member = NULL; } void tls_certificate_set_key(struct TLSCertificate *cert, const unsigned char *val, int len) { if ((!val[0]) && (len % 2)) { val++; len--; } tls_certificate_set_copy(&cert->pk, val, len); if (cert->pk) cert->pk_len = len; } void tls_certificate_set_priv(struct TLSCertificate *cert, const unsigned char *val, int len) { tls_certificate_set_copy(&cert->priv, val, len); if (cert->priv) cert->priv_len = len; } void tls_certificate_set_sign_key(struct TLSCertificate *cert, const unsigned char *val, int len) { if ((!val[0]) && (len % 2)) { val++; len--; } tls_certificate_set_copy(&cert->sign_key, val, len); if (cert->sign_key) cert->sign_len = len; } char *tls_certificate_to_string(struct TLSCertificate *cert, char *buffer, int len) { unsigned int i; if (!buffer) return NULL; buffer[0] = 0; if (cert->version) { int res = snprintf(buffer, len, "X.509v%i certificate\n Issued by: [%s]%s (%s)\n Issued to: [%s]%s (%s, %s)\n Subject: %s\n Validity: %s - %s\n OCSP: %s\n Serial number: ", (int)cert->version, cert->issuer_country, cert->issuer_entity, cert->issuer_subject, cert->country, cert->entity, cert->state, cert->location, cert->subject, cert->not_before, cert->not_after, cert->ocsp ); if (res > 0) { for (i = 0; i < cert->serial_len; i++) res += snprintf(buffer + res, len - res, "%02x", (int)cert->serial_number[i]); } if ((cert->san) && (cert->san_length)) { res += snprintf(buffer + res, len - res, "\n Alternative subjects: "); for (i = 0; i < cert->san_length; i++) { if (i) res += snprintf(buffer + res, len - res, ", %s", cert->san[i]); else res += snprintf(buffer + res, len - res, "%s", cert->san[i]); } } res += snprintf(buffer + res, len - res, "\n Key (%i bits, ", cert->pk_len * 8); if (res > 0) { switch (cert->key_algorithm) { case TLS_RSA_SIGN_RSA: res += snprintf(buffer + res, len - res, "RSA_SIGN_RSA"); break; case TLS_RSA_SIGN_MD5: res += snprintf(buffer + res, len - res, "RSA_SIGN_MD5"); break; case TLS_RSA_SIGN_SHA1: res += snprintf(buffer + res, len - res, "RSA_SIGN_SHA1"); break; case TLS_RSA_SIGN_SHA256: res += snprintf(buffer + res, len - res, "RSA_SIGN_SHA256"); break; case TLS_RSA_SIGN_SHA384: res += snprintf(buffer + res, len - res, "RSA_SIGN_SHA384"); break; case TLS_RSA_SIGN_SHA512: res += snprintf(buffer + res, len - res, "RSA_SIGN_SHA512"); break; case TLS_ECDSA_SIGN_SHA256: res += snprintf(buffer + res, len - res, "ECDSA_SIGN_SHA512"); break; case TLS_EC_PUBLIC_KEY: res += snprintf(buffer + res, len - res, "EC_PUBLIC_KEY"); break; default: res += snprintf(buffer + res, len - res, "not supported (%i)", (int)cert->key_algorithm); } } if ((res > 0) && (cert->ec_algorithm)) { switch (cert->ec_algorithm) { case TLS_EC_prime192v1: res += snprintf(buffer + res, len - res, " prime192v1"); break; case TLS_EC_prime192v2: res += snprintf(buffer + res, len - res, " prime192v2"); break; case TLS_EC_prime192v3: res += snprintf(buffer + res, len - res, " prime192v3"); break; case TLS_EC_prime239v2: res += snprintf(buffer + res, len - res, " prime239v2"); break; case TLS_EC_secp256r1: res += snprintf(buffer + res, len - res, " EC_secp256r1"); break; case TLS_EC_secp224r1: res += snprintf(buffer + res, len - res, " EC_secp224r1"); break; case TLS_EC_secp384r1: res += snprintf(buffer + res, len - res, " EC_secp384r1"); break; case TLS_EC_secp521r1: res += snprintf(buffer + res, len - res, " EC_secp521r1"); break; default: res += snprintf(buffer + res, len - res, " unknown(%i)", (int)cert->ec_algorithm); } } res += snprintf(buffer + res, len - res, "):\n"); if (res > 0) { for (i = 0; i < cert->pk_len; i++) res += snprintf(buffer + res, len - res, "%02x", (int)cert->pk[i]); res += snprintf(buffer + res, len - res, "\n Signature (%i bits, ", cert->sign_len * 8); switch (cert->algorithm) { case TLS_RSA_SIGN_RSA: res += snprintf(buffer + res, len - res, "RSA_SIGN_RSA):\n"); break; case TLS_RSA_SIGN_MD5: res += snprintf(buffer + res, len - res, "RSA_SIGN_MD5):\n"); break; case TLS_RSA_SIGN_SHA1: res += snprintf(buffer + res, len - res, "RSA_SIGN_SHA1):\n"); break; case TLS_RSA_SIGN_SHA256: res += snprintf(buffer + res, len - res, "RSA_SIGN_SHA256):\n"); break; case TLS_RSA_SIGN_SHA384: res += snprintf(buffer + res, len - res, "RSA_SIGN_SHA384):\n"); break; case TLS_RSA_SIGN_SHA512: res += snprintf(buffer + res, len - res, "RSA_SIGN_SHA512):\n"); break; case TLS_EC_PUBLIC_KEY: res += snprintf(buffer + res, len - res, "EC_PUBLIC_KEY):\n"); break; default: res += snprintf(buffer + res, len - res, "not supported):\n"); } for (i = 0; i < cert->sign_len; i++) res += snprintf(buffer + res, len - res, "%02x", (int)cert->sign_key[i]); } } else if ((cert->priv) && (cert->priv_len)) { int res = snprintf(buffer, len, "X.509 private key\n"); res += snprintf(buffer + res, len - res, " Private Key: "); if (res > 0) { for (i = 0; i < cert->priv_len; i++) res += snprintf(buffer + res, len - res, "%02x", (int)cert->priv[i]); } } else snprintf(buffer, len, "Empty ASN1 file"); return buffer; } void tls_certificate_set_exponent(struct TLSCertificate *cert, const unsigned char *val, int len) { tls_certificate_set_copy(&cert->exponent, val, len); if (cert->exponent) cert->exponent_len = len; } void tls_certificate_set_serial(struct TLSCertificate *cert, const unsigned char *val, int len) { tls_certificate_set_copy(&cert->serial_number, val, len); if (cert->serial_number) cert->serial_len = len; } void tls_certificate_set_algorithm(struct TLSContext *context, unsigned int *algorithm, const unsigned char *val, int len) { if ((len == 7) && (_is_oid(val, TLS_EC_PUBLIC_KEY_OID, 7))) { *algorithm = TLS_EC_PUBLIC_KEY; return; } if (len == 8) { if (_is_oid(val, TLS_EC_prime192v1_OID, len)) { *algorithm = TLS_EC_prime192v1; return; } if (_is_oid(val, TLS_EC_prime192v2_OID, len)) { *algorithm = TLS_EC_prime192v2; return; } if (_is_oid(val, TLS_EC_prime192v3_OID, len)) { *algorithm = TLS_EC_prime192v3; return; } if (_is_oid(val, TLS_EC_prime239v1_OID, len)) { *algorithm = TLS_EC_prime239v1; return; } if (_is_oid(val, TLS_EC_prime239v2_OID, len)) { *algorithm = TLS_EC_prime239v2; return; } if (_is_oid(val, TLS_EC_prime239v3_OID, len)) { *algorithm = TLS_EC_prime239v3; return; } if (_is_oid(val, TLS_EC_prime256v1_OID, len)) { *algorithm = TLS_EC_prime256v1; return; } } if (len == 5) { if (_is_oid2(val, TLS_EC_secp224r1_OID, len, sizeof(TLS_EC_secp224r1_OID) - 1)) { *algorithm = TLS_EC_secp224r1; return; } if (_is_oid2(val, TLS_EC_secp384r1_OID, len, sizeof(TLS_EC_secp384r1_OID) - 1)) { *algorithm = TLS_EC_secp384r1; return; } if (_is_oid2(val, TLS_EC_secp521r1_OID, len, sizeof(TLS_EC_secp521r1_OID) - 1)) { *algorithm = TLS_EC_secp521r1; return; } } if (len != 9) return; if (_is_oid(val, TLS_RSA_SIGN_SHA256_OID, 9)) { *algorithm = TLS_RSA_SIGN_SHA256; return; } if (_is_oid(val, TLS_RSA_SIGN_RSA_OID, 9)) { *algorithm = TLS_RSA_SIGN_RSA; return; } if (_is_oid(val, TLS_RSA_SIGN_SHA1_OID, 9)) { *algorithm = TLS_RSA_SIGN_SHA1; return; } if (_is_oid(val, TLS_RSA_SIGN_SHA512_OID, 9)) { *algorithm = TLS_RSA_SIGN_SHA512; return; } if (_is_oid(val, TLS_RSA_SIGN_SHA384_OID, 9)) { *algorithm = TLS_RSA_SIGN_SHA384; return; } if (_is_oid(val, TLS_RSA_SIGN_MD5_OID, 9)) { *algorithm = TLS_RSA_SIGN_MD5; return; } if (_is_oid(val, TLS_ECDSA_SIGN_SHA256_OID, 9)) { *algorithm = TLS_ECDSA_SIGN_SHA256; return; } // client should fail on unsupported signature if (!context->is_server) { DEBUG_PRINT("UNSUPPORTED SIGNATURE ALGORITHM\n"); context->critical_error = 1; } } void tls_destroy_certificate(struct TLSCertificate *cert) { if (cert) { int i; TLS_FREE(cert->exponent); TLS_FREE(cert->pk); TLS_FREE(cert->issuer_country); TLS_FREE(cert->issuer_state); TLS_FREE(cert->issuer_location); TLS_FREE(cert->issuer_entity); TLS_FREE(cert->issuer_subject); TLS_FREE(cert->country); TLS_FREE(cert->state); TLS_FREE(cert->location); TLS_FREE(cert->subject); for (i = 0; i < cert->san_length; i++) { TLS_FREE(cert->san[i]); } TLS_FREE(cert->san); TLS_FREE(cert->ocsp); TLS_FREE(cert->serial_number); TLS_FREE(cert->entity); TLS_FREE(cert->not_before); TLS_FREE(cert->not_after); TLS_FREE(cert->sign_key); TLS_FREE(cert->priv); TLS_FREE(cert->der_bytes); TLS_FREE(cert->bytes); TLS_FREE(cert->fingerprint); TLS_FREE(cert); } } struct TLSPacket *tls_create_packet(struct TLSContext *context, unsigned char type, unsigned short version, int payload_size_hint) { struct TLSPacket *packet = (struct TLSPacket *)TLS_MALLOC(sizeof(struct TLSPacket)); if (!packet) return NULL; packet->broken = 0; if (payload_size_hint > 0) packet->size = payload_size_hint + 10; else packet->size = TLS_BLOB_INCREMENT; packet->buf = (unsigned char *)TLS_MALLOC(packet->size); packet->context = context; if (!packet->buf) { TLS_FREE(packet); return NULL; } if ((context) && (context->dtls)) packet->len = 13; else packet->len = 5; packet->buf[0] = type; #ifdef WITH_TLS_13 switch (version) { case TLS_V13: // check if context is not null. If null, is a tls_export_context call if (context) *(unsigned short *)(packet->buf + 1) = 0x0303; // no need to reorder (same bytes) else *(unsigned short *)(packet->buf + 1) = htons(version); break; case DTLS_V13: *(unsigned short *)(packet->buf + 1) = htons(DTLS_V13); break; default: *(unsigned short *)(packet->buf + 1) = htons(version); } #else *(unsigned short *)(packet->buf + 1) = htons(version); #endif return packet; } void tls_destroy_packet(struct TLSPacket *packet) { if (packet) { if (packet->buf) TLS_FREE(packet->buf); TLS_FREE(packet); } } int _private_tls_crypto_create(struct TLSContext *context, int key_length, unsigned char *localkey, unsigned char *localiv, unsigned char *remotekey, unsigned char *remoteiv) { if (context->crypto.created) { if (context->crypto.created == 1) { cbc_done(&context->crypto.ctx_remote.aes_remote); cbc_done(&context->crypto.ctx_local.aes_local); } else { #ifdef TLS_WITH_CHACHA20_POLY1305 if (context->crypto.created == 2) { #endif unsigned char dummy_buffer[32]; unsigned long tag_len = 0; gcm_done(&context->crypto.ctx_remote.aes_gcm_remote, dummy_buffer, &tag_len); gcm_done(&context->crypto.ctx_local.aes_gcm_local, dummy_buffer, &tag_len); #ifdef TLS_WITH_CHACHA20_POLY1305 } #endif } context->crypto.created = 0; } tls_init(); int is_aead = _private_tls_is_aead(context); int cipherID = find_cipher("aes"); DEBUG_PRINT("Using cipher ID: %x\n", (int)context->cipher); #ifdef TLS_WITH_CHACHA20_POLY1305 if (is_aead == 2) { unsigned int counter = 1; chacha_keysetup(&context->crypto.ctx_local.chacha_local, localkey, key_length * 8); chacha_ivsetup_96bitnonce(&context->crypto.ctx_local.chacha_local, localiv, (unsigned char *)&counter); chacha_keysetup(&context->crypto.ctx_remote.chacha_remote, remotekey, key_length * 8); chacha_ivsetup_96bitnonce(&context->crypto.ctx_remote.chacha_remote, remoteiv, (unsigned char *)&counter); context->crypto.created = 3; } else #endif if (is_aead) { int res1 = gcm_init(&context->crypto.ctx_local.aes_gcm_local, cipherID, localkey, key_length); int res2 = gcm_init(&context->crypto.ctx_remote.aes_gcm_remote, cipherID, remotekey, key_length); if ((res1) || (res2)) return TLS_GENERIC_ERROR; context->crypto.created = 2; } else { int res1 = cbc_start(cipherID, localiv, localkey, key_length, 0, &context->crypto.ctx_local.aes_local); int res2 = cbc_start(cipherID, remoteiv, remotekey, key_length, 0, &context->crypto.ctx_remote.aes_remote); if ((res1) || (res2)) return TLS_GENERIC_ERROR; context->crypto.created = 1; } return 0; } int _private_tls_crypto_encrypt(struct TLSContext *context, unsigned char *buf, unsigned char *ct, unsigned int len) { if (context->crypto.created == 1) return cbc_encrypt(buf, ct, len, &context->crypto.ctx_local.aes_local); memset(ct, 0, len); return TLS_GENERIC_ERROR; } int _private_tls_crypto_decrypt(struct TLSContext *context, unsigned char *buf, unsigned char *pt, unsigned int len) { if (context->crypto.created == 1) return cbc_decrypt(buf, pt, len, &context->crypto.ctx_remote.aes_remote); memset(pt, 0, len); return TLS_GENERIC_ERROR; } void _private_tls_crypto_done(struct TLSContext *context) { unsigned char dummy_buffer[32]; unsigned long tag_len = 0; switch (context->crypto.created) { case 1: cbc_done(&context->crypto.ctx_remote.aes_remote); cbc_done(&context->crypto.ctx_local.aes_local); break; case 2: gcm_done(&context->crypto.ctx_remote.aes_gcm_remote, dummy_buffer, &tag_len); gcm_done(&context->crypto.ctx_local.aes_gcm_local, dummy_buffer, &tag_len); break; } context->crypto.created = 0; } void tls_packet_update(struct TLSPacket *packet) { if ((packet) && (!packet->broken)) { int footer_size = 0; #ifdef WITH_TLS_13 if ((packet->context) && ((packet->context->version == TLS_V13) || (packet->context->version == DTLS_V13)) && (packet->context->cipher_spec_set) && (packet->context->crypto.created)) { // type tls_packet_uint8(packet, packet->buf[0]); // no padding // tls_packet_uint8(packet, 0); footer_size = 1; } #endif unsigned int header_size = 5; if ((packet->context) && (packet->context->dtls)) { header_size = 13; *(unsigned short *)(packet->buf + 3) = htons(packet->context->dtls_epoch_local); uint64_t sequence_number = packet->context->local_sequence_number; packet->buf[5] = (unsigned char)(sequence_number / 0x10000000000LL); sequence_number %= 0x10000000000LL; packet->buf[6] = (unsigned char)(sequence_number / 0x100000000LL); sequence_number %= 0x100000000LL; packet->buf[7] = (unsigned char)(sequence_number / 0x1000000); sequence_number %= 0x1000000; packet->buf[8] = (unsigned char)(sequence_number / 0x10000); sequence_number %= 0x10000; packet->buf[9] = (unsigned char)(sequence_number / 0x100); sequence_number %= 0x100; packet->buf[10] = (unsigned char)sequence_number; *(unsigned short *)(packet->buf + 11) = htons(packet->len - header_size); } else *(unsigned short *)(packet->buf + 3) = htons(packet->len - header_size); if (packet->context) { if (packet->buf[0] != TLS_CHANGE_CIPHER) { if ((packet->buf[0] == TLS_HANDSHAKE) && (packet->len > header_size)) { unsigned char handshake_type = packet->buf[header_size]; if ((handshake_type != 0x00) && (handshake_type != 0x03)) _private_tls_update_hash(packet->context, packet->buf + header_size, packet->len - header_size - footer_size); } #ifdef TLS_12_FALSE_START if (((packet->context->cipher_spec_set) || (packet->context->false_start)) && (packet->context->crypto.created)) { #else if ((packet->context->cipher_spec_set) && (packet->context->crypto.created)) { #endif int block_size = TLS_AES_BLOCK_SIZE; int mac_size = 0; unsigned int length = 0; unsigned char padding = 0; unsigned int pt_length = packet->len - header_size; if (packet->context->crypto.created == 1) { mac_size = _private_tls_mac_length(packet->context); #ifdef TLS_LEGACY_SUPPORT if (packet->context->version == TLS_V10) length = packet->len - header_size + mac_size; else #endif length = packet->len - header_size + TLS_AES_IV_LENGTH + mac_size; padding = block_size - length % block_size; length += padding; #ifdef TLS_WITH_CHACHA20_POLY1305 } else if (packet->context->crypto.created == 3) { mac_size = POLY1305_TAGLEN; length = packet->len - header_size + mac_size; #endif } else { mac_size = TLS_GCM_TAG_LEN; length = packet->len - header_size + 8 + mac_size; } if (packet->context->crypto.created == 1) { unsigned char *buf = (unsigned char *)TLS_MALLOC(length); if (buf) { unsigned char *ct = (unsigned char *)TLS_MALLOC(length + header_size); if (ct) { unsigned int buf_pos = 0; memcpy(ct, packet->buf, header_size - 2); *(unsigned short *)&ct[header_size - 2] = htons(length); #ifdef TLS_LEGACY_SUPPORT if (packet->context->version != TLS_V10) #endif { tls_random(buf, TLS_AES_IV_LENGTH); buf_pos += TLS_AES_IV_LENGTH; } // copy payload memcpy(buf + buf_pos, packet->buf + header_size, packet->len - header_size); buf_pos += packet->len - header_size; if (packet->context->dtls) { unsigned char temp_buf[5]; memcpy(temp_buf, packet->buf, 3); *(unsigned short *)(temp_buf + 3) = *(unsigned short *)&packet->buf[header_size - 2]; uint64_t dtls_sequence_number = ntohll(*(uint64_t *)&packet->buf[3]); _private_tls_hmac_message(1, packet->context, temp_buf, 5, packet->buf + header_size, packet->len - header_size, buf + buf_pos, mac_size, dtls_sequence_number); } else _private_tls_hmac_message(1, packet->context, packet->buf, packet->len, NULL, 0, buf + buf_pos, mac_size, 0); buf_pos += mac_size; memset(buf + buf_pos, padding - 1, padding); buf_pos += padding; //DEBUG_DUMP_HEX_LABEL("PT BUFFER", buf, length); _private_tls_crypto_encrypt(packet->context, buf, ct + header_size, length); TLS_FREE(packet->buf); packet->buf = ct; packet->len = length + header_size; packet->size = packet->len; } else { // invalidate packet memset(packet->buf, 0, packet->len); } TLS_FREE(buf); } else { // invalidate packet memset(packet->buf, 0, packet->len); } } else #ifdef TLS_WITH_CHACHA20_POLY1305 if (packet->context->crypto.created >= 2) { #else if (packet->context->crypto.created == 2) { #endif // + 1 = type int ct_size = length + header_size + 12 + TLS_MAX_TAG_LEN + 1; unsigned char *ct = (unsigned char *)TLS_MALLOC(ct_size); if (ct) { memset(ct, 0, ct_size); // AEAD // sequence number (8 bytes) // content type (1 byte) // version (2 bytes) // length (2 bytes) unsigned char aad[13]; int aad_size = sizeof(aad); unsigned char *sequence = aad; #ifdef WITH_TLS_13 if ((packet->context->version == TLS_V13) || (packet->context->version == DTLS_V13)) { aad[0] = TLS_APPLICATION_DATA; aad[1] = packet->buf[1]; aad[2] = packet->buf[2]; #ifdef TLS_WITH_CHACHA20_POLY1305 if (packet->context->crypto.created == 3) *((unsigned short *)(aad + 3)) = htons(packet->len + POLY1305_TAGLEN - header_size); else #endif *((unsigned short *)(aad + 3)) = htons(packet->len + TLS_GCM_TAG_LEN - header_size); aad_size = 5; sequence = aad + 5; if (packet->context->dtls) *((uint64_t *)sequence) = *(uint64_t *)&packet->buf[3]; else *((uint64_t *)sequence) = htonll(packet->context->local_sequence_number); } else { #endif if (packet->context->dtls) *((uint64_t *)aad) = *(uint64_t *)&packet->buf[3]; else *((uint64_t *)aad) = htonll(packet->context->local_sequence_number); aad[8] = packet->buf[0]; aad[9] = packet->buf[1]; aad[10] = packet->buf[2]; *((unsigned short *)(aad + 11)) = htons(packet->len - header_size); #ifdef WITH_TLS_13 } #endif int ct_pos = header_size; #ifdef TLS_WITH_CHACHA20_POLY1305 if (packet->context->crypto.created == 3) { unsigned int counter = 1; unsigned char poly1305_key[POLY1305_KEYLEN]; chacha_ivupdate(&packet->context->crypto.ctx_local.chacha_local, packet->context->crypto.ctx_local_mac.local_aead_iv, sequence, (u8 *)&counter); chacha20_poly1305_key(&packet->context->crypto.ctx_local.chacha_local, poly1305_key); ct_pos += chacha20_poly1305_aead(&packet->context->crypto.ctx_local.chacha_local, packet->buf + header_size, pt_length, aad, aad_size, poly1305_key, ct + ct_pos); } else { #endif unsigned char iv[TLS_13_AES_GCM_IV_LENGTH]; #ifdef WITH_TLS_13 if ((packet->context->version == TLS_V13) || (packet->context->version == DTLS_V13)) { memcpy(iv, packet->context->crypto.ctx_local_mac.local_iv, TLS_13_AES_GCM_IV_LENGTH); int i; int offset = TLS_13_AES_GCM_IV_LENGTH - 8; for (i = 0; i < 8; i++) iv[offset + i] = packet->context->crypto.ctx_local_mac.local_iv[offset + i] ^ sequence[i]; } else { #endif memcpy(iv, packet->context->crypto.ctx_local_mac.local_aead_iv, TLS_AES_GCM_IV_LENGTH); tls_random(iv + TLS_AES_GCM_IV_LENGTH, 8); memcpy(ct + ct_pos, iv + TLS_AES_GCM_IV_LENGTH, 8); ct_pos += 8; #ifdef WITH_TLS_13 } #endif gcm_reset(&packet->context->crypto.ctx_local.aes_gcm_local); gcm_add_iv(&packet->context->crypto.ctx_local.aes_gcm_local, iv, 12); gcm_add_aad(&packet->context->crypto.ctx_local.aes_gcm_local, aad, aad_size); gcm_process(&packet->context->crypto.ctx_local.aes_gcm_local, packet->buf + header_size, pt_length, ct + ct_pos, GCM_ENCRYPT); ct_pos += pt_length; unsigned long taglen = TLS_GCM_TAG_LEN; gcm_done(&packet->context->crypto.ctx_local.aes_gcm_local, ct + ct_pos, &taglen); ct_pos += taglen; #ifdef TLS_WITH_CHACHA20_POLY1305 } #endif #ifdef WITH_TLS_13 if ((packet->context->version == TLS_V13) || (packet->context->version == DTLS_V13)) { ct[0] = TLS_APPLICATION_DATA; *(unsigned short *)&ct[1] = htons(packet->context->version == TLS_V13 ? TLS_V12 : DTLS_V12); // is dtls ? if (header_size != 5) memcpy(ct, packet->buf + 3, header_size - 2); } else #endif memcpy(ct, packet->buf, header_size - 2); *(unsigned short *)&ct[header_size - 2] = htons(ct_pos - header_size); TLS_FREE(packet->buf); packet->buf = ct; packet->len = ct_pos; packet->size = ct_pos; } else { // invalidate packet memset(packet->buf, 0, packet->len); } } else { // invalidate packet (never reached) memset(packet->buf, 0, packet->len); } } } else packet->context->dtls_epoch_local++; packet->context->local_sequence_number++; } } } int tls_packet_append(struct TLSPacket *packet, const unsigned char *buf, unsigned int len) { if ((!packet) || (packet->broken)) return -1; if (!len) return 0; unsigned int new_len = packet->len + len; if (new_len > packet->size) { packet->size = (new_len / TLS_BLOB_INCREMENT + 1) * TLS_BLOB_INCREMENT; packet->buf = (unsigned char *)TLS_REALLOC(packet->buf, packet->size); if (!packet->buf) { packet->size = 0; packet->len = 0; packet->broken = 1; return -1; } } memcpy(packet->buf + packet->len, buf, len); packet->len = new_len; return new_len; } int tls_packet_uint8(struct TLSPacket *packet, unsigned char i) { return tls_packet_append(packet, &i, 1); } int tls_packet_uint16(struct TLSPacket *packet, unsigned short i) { unsigned short ni = htons(i); return tls_packet_append(packet, (unsigned char *)&ni, 2); } int tls_packet_uint32(struct TLSPacket *packet, unsigned int i) { unsigned int ni = htonl(i); return tls_packet_append(packet, (unsigned char *)&ni, 4); } int tls_packet_uint24(struct TLSPacket *packet, unsigned int i) { unsigned char buf[3]; buf[0] = i / 0x10000; i %= 0x10000; buf[1] = i / 0x100; i %= 0x100; buf[2] = i; return tls_packet_append(packet, buf, 3); } int tls_random(unsigned char *key, int len) { #ifdef TLS_USE_RANDOM_SOURCE TLS_USE_RANDOM_SOURCE(key, len); #else #ifdef __APPLE__ for (int i = 0; i < len; i++) { unsigned int v = arc4random() % 0x100; key[i] = (char)v; } return 1; #else #ifdef _WIN32 HCRYPTPROV hProvider = 0; if (CryptAcquireContext(&hProvider, 0, 0, PROV_RSA_FULL, CRYPT_VERIFYCONTEXT | CRYPT_SILENT)) { if (CryptGenRandom(hProvider, len, (BYTE *)key)) { CryptReleaseContext(hProvider, 0); return 1; } CryptReleaseContext(hProvider, 0); } #else FILE *fp = fopen("/dev/urandom", "r"); if (fp) { int key_len = fread(key, 1, len, fp); fclose(fp); if (key_len == len) return 1; } #endif #endif #endif return 0; } TLSHash *_private_tls_ensure_hash(struct TLSContext *context) { TLSHash *hash = context->handshake_hash; if (!hash) { hash = (TLSHash *)TLS_MALLOC(sizeof(TLSHash)); if (hash) memset(hash, 0, sizeof(TLSHash)); context->handshake_hash = hash; } return hash; } void _private_tls_destroy_hash(struct TLSContext *context) { if (context) { TLS_FREE(context->handshake_hash); context->handshake_hash = NULL; } } void _private_tls_create_hash(struct TLSContext *context) { if (!context) return; TLSHash *hash = _private_tls_ensure_hash(context); if ((context->version == TLS_V12) || (context->version == DTLS_V12) || (context->version == TLS_V13) || (context->version == DTLS_V13)) { int hash_size = _private_tls_mac_length(context); if (hash->created) { unsigned char temp[TLS_MAX_SHA_SIZE]; sha384_done(&hash->hash32, temp); sha256_done(&hash->hash48, temp); } sha384_init(&hash->hash48); sha256_init(&hash->hash32); hash->created = 1; } else { #ifdef TLS_LEGACY_SUPPORT // TLS_V11 if (hash->created) { unsigned char temp[TLS_V11_HASH_SIZE]; md5_done(&hash->hash32, temp); sha1_done(&hash->hash2, temp); } md5_init(&hash->hash32); sha1_init(&hash->hash2); hash->created = 1; #endif } } int _private_tls_update_hash(struct TLSContext *context, const unsigned char *in, unsigned int len) { if (!context) return 0; TLSHash *hash = _private_tls_ensure_hash(context); if ((context->version == TLS_V12) || (context->version == DTLS_V12) || (context->version == TLS_V13) || (context->version == DTLS_V13)) { if (!hash->created) { _private_tls_create_hash(context); #ifdef TLS_LEGACY_SUPPORT // cache first hello in case of protocol downgrade if ((!context->is_server) && (!context->cached_handshake) && (!context->request_client_certificate) && (len)) { context->cached_handshake = (unsigned char *)TLS_MALLOC(len); if (context->cached_handshake) { memcpy(context->cached_handshake, in, len); context->cached_handshake_len = len; } } #endif } int hash_size = _private_tls_mac_length(context); sha256_process(&hash->hash32, in, len); sha384_process(&hash->hash48, in, len); if (!hash_size) hash_size = TLS_SHA256_MAC_SIZE; } else { #ifdef TLS_LEGACY_SUPPORT if (!hash->created) _private_tls_create_hash(context); md5_process(&hash->hash32, in, len); sha1_process(&hash->hash2, in, len); #endif } if ((context->request_client_certificate) && (len)) { // cache all messages for verification int new_len = context->cached_handshake_len + len; context->cached_handshake = (unsigned char *)TLS_REALLOC(context->cached_handshake, new_len); if (context->cached_handshake) { memcpy(context->cached_handshake + context->cached_handshake_len, in, len); context->cached_handshake_len = new_len; } else context->cached_handshake_len = 0; } return 0; } #ifdef TLS_LEGACY_SUPPORT int _private_tls_change_hash_type(struct TLSContext *context) { if (!context) return 0; TLSHash *hash = _private_tls_ensure_hash(context); if ((hash) && (hash->created) && (context->cached_handshake) && (context->cached_handshake_len)) { _private_tls_destroy_hash(context); int res = _private_tls_update_hash(context, context->cached_handshake, context->cached_handshake_len); TLS_FREE(context->cached_handshake); context->cached_handshake = NULL; context->cached_handshake_len = 0; return res; } return 0; } #endif int _private_tls_done_hash(struct TLSContext *context, unsigned char *hout) { if (!context) return 0; TLSHash *hash = _private_tls_ensure_hash(context); if (!hash->created) return 0; int hash_size = 0; if ((context->version == TLS_V12) || (context->version == DTLS_V12) || (context->version == TLS_V13) || (context->version == DTLS_V13)) { unsigned char temp[TLS_MAX_SHA_SIZE]; if (!hout) hout = temp; //TLS_HASH_DONE(&hash->hash, hout); hash_size = _private_tls_mac_length(context); if (hash_size == TLS_SHA384_MAC_SIZE) { sha256_done(&hash->hash32, temp); sha384_done(&hash->hash48, hout); } else { sha256_done(&hash->hash32, hout); sha384_done(&hash->hash48, temp); hash_size = TLS_SHA256_MAC_SIZE; } } else { #ifdef TLS_LEGACY_SUPPORT // TLS_V11 unsigned char temp[TLS_V11_HASH_SIZE]; if (!hout) hout = temp; md5_done(&hash->hash32, hout); sha1_done(&hash->hash2, hout + 16); hash_size = TLS_V11_HASH_SIZE; #endif } hash->created = 0; if (context->cached_handshake) { // not needed anymore TLS_FREE(context->cached_handshake); context->cached_handshake = NULL; context->cached_handshake_len = 0; } return hash_size; } int _private_tls_get_hash_idx(struct TLSContext *context) { if (!context) return -1; switch (_private_tls_mac_length(context)) { case TLS_SHA256_MAC_SIZE: return find_hash("sha256"); case TLS_SHA384_MAC_SIZE: return find_hash("sha384"); case TLS_SHA1_MAC_SIZE: return find_hash("sha1"); } return -1; } int _private_tls_get_hash(struct TLSContext *context, unsigned char *hout) { if (!context) return 0; TLSHash *hash = _private_tls_ensure_hash(context); if (!hash->created) return 0; int hash_size = 0; if ((context->version == TLS_V12) || (context->version == DTLS_V12) || (context->version == TLS_V13) || (context->version == DTLS_V13)) { hash_size = _private_tls_mac_length(context); hash_state prec; if (hash_size == TLS_SHA384_MAC_SIZE) { memcpy(&prec, &hash->hash48, sizeof(hash_state)); sha384_done(&hash->hash48, hout); memcpy(&hash->hash48, &prec, sizeof(hash_state)); } else { memcpy(&prec, &hash->hash32, sizeof(hash_state)); hash_size = TLS_SHA256_MAC_SIZE; sha256_done(&hash->hash32, hout); memcpy(&hash->hash32, &prec, sizeof(hash_state)); } } else { #ifdef TLS_LEGACY_SUPPORT // TLS_V11 hash_state prec; memcpy(&prec, &hash->hash32, sizeof(hash_state)); md5_done(&hash->hash32, hout); memcpy(&hash->hash32, &prec, sizeof(hash_state)); memcpy(&prec, &hash->hash2, sizeof(hash_state)); sha1_done(&hash->hash2, hout + 16); memcpy(&hash->hash2, &prec, sizeof(hash_state)); hash_size = TLS_V11_HASH_SIZE; #endif } return hash_size; } int _private_tls_write_packet(struct TLSPacket *packet) { if (!packet) return -1; struct TLSContext *context = packet->context; if (!context) return -1; if (context->tls_buffer) { int len = context->tls_buffer_len + packet->len; context->tls_buffer = (unsigned char *)TLS_REALLOC(context->tls_buffer, len); if (!context->tls_buffer) { context->tls_buffer_len = 0; return -1; } memcpy(context->tls_buffer + context->tls_buffer_len, packet->buf, packet->len); context->tls_buffer_len = len; int written = packet->len; tls_destroy_packet(packet); return written; } context->tls_buffer_len = packet->len; context->tls_buffer = packet->buf; packet->buf = NULL; packet->len = 0; packet->size = 0; tls_destroy_packet(packet); return context->tls_buffer_len; } int _private_tls_write_app_data(struct TLSContext *context, const unsigned char *buf, unsigned int buf_len) { if (!context) return -1; if ((!buf) || (!buf_len)) return 0; int len = context->application_buffer_len + buf_len; context->application_buffer = (unsigned char *)TLS_REALLOC(context->application_buffer, len); if (!context->application_buffer) { context->application_buffer_len = 0; return -1; } memcpy(context->application_buffer + context->application_buffer_len, buf, buf_len); context->application_buffer_len = len; return buf_len; } const unsigned char *tls_get_write_buffer(struct TLSContext *context, unsigned int *outlen) { if (!outlen) return NULL; if (!context) { *outlen = 0; return NULL; } // check if any error if (context->sleep_until) { if (context->sleep_until < time(NULL)) { *outlen = 0; return NULL; } context->sleep_until = 0; } *outlen = context->tls_buffer_len; return context->tls_buffer; } const unsigned char *tls_get_message(struct TLSContext *context, unsigned int *outlen, unsigned int offset) { if (!outlen) return NULL; if ((!context) || (!context->tls_buffer)) { *outlen = 0; return NULL; } if (offset >= context->tls_buffer_len) { *outlen = 0; return NULL; } // check if any error if (context->sleep_until) { if (context->sleep_until < time(NULL)) { *outlen = 0; return NULL; } context->sleep_until = 0; } unsigned char *tls_buffer = &context->tls_buffer[offset]; unsigned int tls_buffer_len = context->tls_buffer_len - offset; unsigned int len = 0; if (context->dtls) { if (tls_buffer_len < 13) { *outlen = 0; return NULL; } len = ntohs(*(unsigned short *)&tls_buffer[11]) + 13; } else { if (tls_buffer_len < 5) { *outlen = 0; return NULL; } len = ntohs(*(unsigned short *)&tls_buffer[3]) + 5; } if (len > tls_buffer_len) { *outlen = 0; return NULL; } *outlen = len; return tls_buffer; } void tls_buffer_clear(struct TLSContext *context) { if ((context) && (context->tls_buffer)) { TLS_FREE(context->tls_buffer); context->tls_buffer = NULL; context->tls_buffer_len = 0; } } int tls_established(struct TLSContext *context) { if (context) { if (context->critical_error) return -1; if (context->connection_status == 0xFF) return 1; #ifdef TLS_12_FALSE_START // allow false start if ((!context->is_server) && (context->version == TLS_V12) && (context->false_start)) return 1; #endif } return 0; } void tls_read_clear(struct TLSContext *context) { if ((context) && (context->application_buffer)) { TLS_FREE(context->application_buffer); context->application_buffer = NULL; context->application_buffer_len = 0; } } int tls_read(struct TLSContext *context, unsigned char *buf, unsigned int size) { if (!context) return -1; if ((context->application_buffer) && (context->application_buffer_len)) { if (context->application_buffer_len < size) size = context->application_buffer_len; memcpy(buf, context->application_buffer, size); if (context->application_buffer_len == size) { TLS_FREE(context->application_buffer); context->application_buffer = NULL; context->application_buffer_len = 0; return size; } context->application_buffer_len -= size; memmove(context->application_buffer, context->application_buffer + size, context->application_buffer_len); return size; } return 0; } struct TLSContext *tls_create_context(unsigned char is_server, unsigned short version) { struct TLSContext *context = (struct TLSContext *)TLS_MALLOC(sizeof(struct TLSContext)); if (context) { memset(context, 0, sizeof(struct TLSContext)); context->is_server = is_server; if ((version == DTLS_V13) || (version == DTLS_V12) || (version == DTLS_V10)) context->dtls = 1; context->version = version; } return context; } #ifdef TLS_FORWARD_SECRECY const struct ECCCurveParameters *tls_set_curve(struct TLSContext *context, const struct ECCCurveParameters *curve) { if (!context->is_server) return NULL; const struct ECCCurveParameters *old_curve = context->curve; context->curve = curve; return old_curve; } #endif struct TLSContext *tls_accept(struct TLSContext *context) { if ((!context) || (!context->is_server)) return NULL; struct TLSContext *child = (struct TLSContext *)TLS_MALLOC(sizeof(struct TLSContext)); if (child) { memset(child, 0, sizeof(struct TLSContext)); child->is_server = 1; child->is_child = 1; child->dtls = context->dtls; child->version = context->version; child->certificates = context->certificates; child->certificates_count = context->certificates_count; child->private_key = context->private_key; #ifdef TLS_ECDSA_SUPPORTED child->ec_private_key = context->ec_private_key; #endif child->exportable = context->exportable; child->root_certificates = context->root_certificates; child->root_count = context->root_count; #ifdef TLS_FORWARD_SECRECY child->default_dhe_p = context->default_dhe_p; child->default_dhe_g = context->default_dhe_g; child->curve = context->curve; #endif child->alpn = context->alpn; child->alpn_count = context->alpn_count; } return child; } #ifdef TLS_FORWARD_SECRECY void _private_tls_dhe_free(struct TLSContext *context) { if (context->dhe) { _private_tls_dh_clear_key(context->dhe); TLS_FREE(context->dhe); context->dhe = NULL; } } void _private_tls_dhe_create(struct TLSContext *context) { _private_tls_dhe_free(context); context->dhe = (DHKey *)TLS_MALLOC(sizeof(DHKey)); if (context->dhe) memset(context->dhe, 0, sizeof(DHKey)); } void _private_tls_ecc_dhe_free(struct TLSContext *context) { if (context->ecc_dhe) { ecc_free(context->ecc_dhe); TLS_FREE(context->ecc_dhe); context->ecc_dhe = NULL; } } void _private_tls_ecc_dhe_create(struct TLSContext *context) { _private_tls_ecc_dhe_free(context); context->ecc_dhe = (ecc_key *)TLS_MALLOC(sizeof(ecc_key)); memset(context->ecc_dhe, 0, sizeof(ecc_key)); } int tls_set_default_dhe_pg(struct TLSContext *context, const char *p_hex_str, const char *g_hex_str) { if ((!context) || (context->is_child) || (!context->is_server) || (!p_hex_str) || (!g_hex_str)) return 0; TLS_FREE(context->default_dhe_p); TLS_FREE(context->default_dhe_g); context->default_dhe_p = NULL; context->default_dhe_g = NULL; size_t p_len = strlen(p_hex_str); size_t g_len = strlen(g_hex_str); if ((p_len <= 0) || (g_len <= 0)) return 0; context->default_dhe_p = (char *)TLS_MALLOC(p_len + 1); if (!context->default_dhe_p) return 0; context->default_dhe_g = (char *)TLS_MALLOC(g_len + 1); if (!context->default_dhe_g) return 0; memcpy(context->default_dhe_p, p_hex_str, p_len); context->default_dhe_p[p_len] = 0; memcpy(context->default_dhe_g, g_hex_str, g_len); context->default_dhe_g[g_len] = 0; return 1; } #endif const char *tls_alpn(struct TLSContext *context) { if (!context) return NULL; return context->negotiated_alpn; } int tls_add_alpn(struct TLSContext *context, const char *alpn) { if ((!context) || (!alpn) || (!alpn[0]) || ((context->is_server) && (context->is_child))) return TLS_GENERIC_ERROR; int len = strlen(alpn); if (tls_alpn_contains(context, alpn, len)) return 0; context->alpn = (char **)TLS_REALLOC(context->alpn, (context->alpn_count + 1) * sizeof(char *)); if (!context->alpn) { context->alpn_count = 0; return TLS_NO_MEMORY; } char *alpn_ref = (char *)TLS_MALLOC(len+1); context->alpn[context->alpn_count] = alpn_ref; if (alpn_ref) { memcpy(alpn_ref, alpn, len); alpn_ref[len] = 0; context->alpn_count++; } else return TLS_NO_MEMORY; return 0; } int tls_alpn_contains(struct TLSContext *context, const char *alpn, unsigned char alpn_size) { if ((!context) || (!alpn) || (!alpn_size)) return 0; if (context->alpn) { int i; for (i = 0; i < context->alpn_count; i++) { const char *alpn_local = context->alpn[i]; if (alpn_local) { int len = strlen(alpn_local); if (alpn_size == len) { if (!memcmp(alpn_local, alpn, alpn_size)) return 1; } } } } return 0; } void tls_destroy_context(struct TLSContext *context) { unsigned int i; if (!context) return; if (!context->is_child) { if (context->certificates) { for (i = 0; i < context->certificates_count; i++) tls_destroy_certificate(context->certificates[i]); } if (context->root_certificates) { for (i = 0; i < context->root_count; i++) tls_destroy_certificate(context->root_certificates[i]); TLS_FREE(context->root_certificates); context->root_certificates = NULL; } if (context->private_key) tls_destroy_certificate(context->private_key); #ifdef TLS_ECDSA_SUPPORTED if (context->ec_private_key) tls_destroy_certificate(context->ec_private_key); #endif TLS_FREE(context->certificates); #ifdef TLS_FORWARD_SECRECY TLS_FREE(context->default_dhe_p); TLS_FREE(context->default_dhe_g); #endif if (context->alpn) { for (i = 0; i < context->alpn_count; i++) TLS_FREE(context->alpn[i]); TLS_FREE(context->alpn); } } if (context->client_certificates) { for (i = 0; i < context->client_certificates_count; i++) tls_destroy_certificate(context->client_certificates[i]); TLS_FREE(context->client_certificates); } context->client_certificates = NULL; TLS_FREE(context->master_key); TLS_FREE(context->premaster_key); if (context->crypto.created) _private_tls_crypto_done(context); TLS_FREE(context->message_buffer); _private_tls_done_hash(context, NULL); _private_tls_destroy_hash(context); TLS_FREE(context->tls_buffer); TLS_FREE(context->application_buffer); // zero out the keys before free if ((context->exportable_keys) && (context->exportable_size)) memset(context->exportable_keys, 0, context->exportable_size); TLS_FREE(context->exportable_keys); TLS_FREE(context->sni); TLS_FREE(context->dtls_cookie); TLS_FREE(context->cached_handshake); #ifdef TLS_FORWARD_SECRECY _private_tls_dhe_free(context); _private_tls_ecc_dhe_free(context); #endif #ifdef TLS_ACCEPT_SECURE_RENEGOTIATION TLS_FREE(context->verify_data); #endif TLS_FREE(context->negotiated_alpn); #ifdef WITH_TLS_13 TLS_FREE(context->finished_key); TLS_FREE(context->remote_finished_key); TLS_FREE(context->server_finished_hash); #endif #ifdef TLS_CURVE25519 TLS_FREE(context->client_secret); #endif TLS_FREE(context); } #ifdef TLS_ACCEPT_SECURE_RENEGOTIATION void _private_tls_reset_context(struct TLSContext *context) { unsigned int i; if (!context) return; if (!context->is_child) { if (context->certificates) { for (i = 0; i < context->certificates_count; i++) tls_destroy_certificate(context->certificates[i]); } context->certificates = NULL; if (context->private_key) { tls_destroy_certificate(context->private_key); context->private_key = NULL; } #ifdef TLS_ECDSA_SUPPORTED if (context->ec_private_key) { tls_destroy_certificate(context->ec_private_key); context->ec_private_key = NULL; } #endif TLS_FREE(context->certificates); context->certificates = NULL; #ifdef TLS_FORWARD_SECRECY TLS_FREE(context->default_dhe_p); TLS_FREE(context->default_dhe_g); context->default_dhe_p = NULL; context->default_dhe_g = NULL; #endif } if (context->client_certificates) { for (i = 0; i < context->client_certificates_count; i++) tls_destroy_certificate(context->client_certificates[i]); TLS_FREE(context->client_certificates); } context->client_certificates = NULL; TLS_FREE(context->master_key); context->master_key = NULL; TLS_FREE(context->premaster_key); context->premaster_key = NULL; if (context->crypto.created) _private_tls_crypto_done(context); _private_tls_done_hash(context, NULL); _private_tls_destroy_hash(context); TLS_FREE(context->application_buffer); context->application_buffer = NULL; // zero out the keys before free if ((context->exportable_keys) && (context->exportable_size)) memset(context->exportable_keys, 0, context->exportable_size); TLS_FREE(context->exportable_keys); context->exportable_keys = NULL; TLS_FREE(context->sni); context->sni = NULL; TLS_FREE(context->dtls_cookie); context->dtls_cookie = NULL; TLS_FREE(context->cached_handshake); context->cached_handshake = NULL; context->connection_status = 0; #ifdef TLS_FORWARD_SECRECY _private_tls_dhe_free(context); _private_tls_ecc_dhe_free(context); #endif } #endif int tls_cipher_supported(struct TLSContext *context, unsigned short cipher) { if (!context) return 0; switch (cipher) { #ifdef WITH_TLS_13 case TLS_AES_128_GCM_SHA256: case TLS_AES_256_GCM_SHA384: case TLS_CHACHA20_POLY1305_SHA256: if ((context->version == TLS_V13) || (context->version == DTLS_V13)) return 1; return 0; #endif #ifdef TLS_FORWARD_SECRECY #ifdef TLS_ECDSA_SUPPORTED case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA: #ifdef TLS_CLIENT_ECDSA if ((context) && (((context->certificates) && (context->certificates_count) && (context->ec_private_key)) || (!context->is_server))) #else if ((context) && (context->certificates) && (context->certificates_count) && (context->ec_private_key)) #endif return 1; return 0; case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA384: case TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384: #ifdef TLS_WITH_CHACHA20_POLY1305 case TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256: #endif if ((context->version == TLS_V12) || (context->version == DTLS_V12)) { #ifdef TLS_CLIENT_ECDSA if ((context) && (((context->certificates) && (context->certificates_count) && (context->ec_private_key)) || (!context->is_server))) #else if ((context) && (context->certificates) && (context->certificates_count) && (context->ec_private_key)) #endif return 1; } return 0; #endif case TLS_DHE_RSA_WITH_AES_128_CBC_SHA: case TLS_DHE_RSA_WITH_AES_256_CBC_SHA: case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA: case TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA: #endif case TLS_RSA_WITH_AES_128_CBC_SHA: case TLS_RSA_WITH_AES_256_CBC_SHA: return 1; #ifdef TLS_FORWARD_SECRECY case TLS_DHE_RSA_WITH_AES_128_CBC_SHA256: case TLS_DHE_RSA_WITH_AES_256_CBC_SHA256: case TLS_DHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_DHE_RSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256: case TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384: #ifdef TLS_WITH_CHACHA20_POLY1305 case TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256: case TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256: #endif #endif case TLS_RSA_WITH_AES_128_GCM_SHA256: case TLS_RSA_WITH_AES_128_CBC_SHA256: case TLS_RSA_WITH_AES_256_CBC_SHA256: case TLS_RSA_WITH_AES_256_GCM_SHA384: if ((context->version == TLS_V12) || (context->version == DTLS_V12)) return 1; return 0; } return 0; } int tls_cipher_is_fs(struct TLSContext *context, unsigned short cipher) { if (!context) return 0; #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { switch (cipher) { case TLS_AES_128_GCM_SHA256: case TLS_AES_256_GCM_SHA384: case TLS_CHACHA20_POLY1305_SHA256: return 1; } return 0; } #endif switch (cipher) { #ifdef TLS_ECDSA_SUPPORTED case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA: #ifdef TLS_WITH_CHACHA20_POLY1305 case TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256: #endif if ((context) && (context->certificates) && (context->certificates_count) && (context->ec_private_key)) return 1; return 0; case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA384: case TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384: if ((context->version == TLS_V12) || (context->version == DTLS_V12)) { if ((context) && (context->certificates) && (context->certificates_count) && (context->ec_private_key)) return 1; } return 0; #endif case TLS_DHE_RSA_WITH_AES_128_CBC_SHA: case TLS_DHE_RSA_WITH_AES_256_CBC_SHA: case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA: case TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA: return 1; case TLS_DHE_RSA_WITH_AES_128_CBC_SHA256: case TLS_DHE_RSA_WITH_AES_256_CBC_SHA256: case TLS_DHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_DHE_RSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256: case TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384: #ifdef TLS_WITH_CHACHA20_POLY1305 case TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256: case TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256: #endif if ((context->version == TLS_V12) || (context->version == DTLS_V12)) return 1; break; } return 0; } #ifdef WITH_KTLS int _private_tls_prefer_ktls(struct TLSContext *context, unsigned short cipher) { if ((context->version == TLS_V13) || (context->version == DTLS_V13) || ((context->version != TLS_V12) && (context->version != DTLS_V12))) return 0; switch (cipher) { case TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: if ((context->version == TLS_V13) || (context->version == DTLS_V13) || (context->version == TLS_V12) || (context->version == DTLS_V12)) { if ((context->certificates) && (context->certificates_count) && (context->ec_private_key)) return 1; } break; case TLS_DHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256: return 1; } return 0; } #endif int tls_choose_cipher(struct TLSContext *context, const unsigned char *buf, int buf_len, int *scsv_set) { int i; if (scsv_set) *scsv_set = 0; if (!context) return 0; int selected_cipher = TLS_NO_COMMON_CIPHER; #ifdef TLS_FORWARD_SECRECY #ifdef WITH_KTLS for (i = 0; i < buf_len; i+=2) { unsigned short cipher = ntohs(*(unsigned short *)&buf[i]); if (_private_tls_prefer_ktls(context, cipher)) { selected_cipher = cipher; break; } } #endif if (selected_cipher == TLS_NO_COMMON_CIPHER) { for (i = 0; i < buf_len; i+=2) { unsigned short cipher = ntohs(*(unsigned short *)&buf[i]); if (tls_cipher_is_fs(context, cipher)) { selected_cipher = cipher; break; } } } #endif for (i = 0; i < buf_len; i+=2) { unsigned short cipher = ntohs(*(unsigned short *)&buf[i]); if (cipher == TLS_FALLBACK_SCSV) { if (scsv_set) *scsv_set = 1; if (selected_cipher != TLS_NO_COMMON_CIPHER) break; } #ifndef TLS_ROBOT_MITIGATION else if ((selected_cipher == TLS_NO_COMMON_CIPHER) && (tls_cipher_supported(context, cipher))) selected_cipher = cipher; #endif } return selected_cipher; } int tls_cipher_is_ephemeral(struct TLSContext *context) { if (context) { switch (context->cipher) { case TLS_DHE_RSA_WITH_AES_128_CBC_SHA: case TLS_DHE_RSA_WITH_AES_256_CBC_SHA: case TLS_DHE_RSA_WITH_AES_128_CBC_SHA256: case TLS_DHE_RSA_WITH_AES_256_CBC_SHA256: case TLS_DHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_DHE_RSA_WITH_AES_256_GCM_SHA384: case TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256: return 1; case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA: case TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA: case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256: case TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA: case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA384: case TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256: return 2; #ifdef WITH_TLS_13 case TLS_AES_128_GCM_SHA256: case TLS_CHACHA20_POLY1305_SHA256: case TLS_AES_128_CCM_SHA256: case TLS_AES_128_CCM_8_SHA256: case TLS_AES_256_GCM_SHA384: if (context->dhe) return 1; return 2; #endif } } return 0; } const char *tls_cipher_name(struct TLSContext *context) { if (context) { switch (context->cipher) { case TLS_RSA_WITH_AES_128_CBC_SHA: return "RSA-AES128CBC-SHA"; case TLS_RSA_WITH_AES_256_CBC_SHA: return "RSA-AES256CBC-SHA"; case TLS_RSA_WITH_AES_128_CBC_SHA256: return "RSA-AES128CBC-SHA256"; case TLS_RSA_WITH_AES_256_CBC_SHA256: return "RSA-AES256CBC-SHA256"; case TLS_RSA_WITH_AES_128_GCM_SHA256: return "RSA-AES128GCM-SHA256"; case TLS_RSA_WITH_AES_256_GCM_SHA384: return "RSA-AES256GCM-SHA384"; case TLS_DHE_RSA_WITH_AES_128_CBC_SHA: return "DHE-RSA-AES128CBC-SHA"; case TLS_DHE_RSA_WITH_AES_256_CBC_SHA: return "DHE-RSA-AES256CBC-SHA"; case TLS_DHE_RSA_WITH_AES_128_CBC_SHA256: return "DHE-RSA-AES128CBC-SHA256"; case TLS_DHE_RSA_WITH_AES_256_CBC_SHA256: return "DHE-RSA-AES256CBC-SHA256"; case TLS_DHE_RSA_WITH_AES_128_GCM_SHA256: return "DHE-RSA-AES128GCM-SHA256"; case TLS_DHE_RSA_WITH_AES_256_GCM_SHA384: return "DHE-RSA-AES256GCM-SHA384"; case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA: return "ECDHE-RSA-AES128CBC-SHA"; case TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA: return "ECDHE-RSA-AES256CBC-SHA"; case TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256: return "ECDHE-RSA-AES128CBC-SHA256"; case TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256: return "ECDHE-RSA-AES128GCM-SHA256"; case TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384: return "ECDHE-RSA-AES256GCM-SHA384"; case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA: return "ECDHE-ECDSA-AES128CBC-SHA"; case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA: return "ECDHE-ECDSA-AES256CBC-SHA"; case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256: return "ECDHE-ECDSA-AES128CBC-SHA256"; case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA384: return "ECDHE-ECDSA-AES256CBC-SHA384"; case TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: return "ECDHE-ECDSA-AES128GCM-SHA256"; case TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384: return "ECDHE-ECDSA-AES256GCM-SHA384"; case TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256: return "ECDHE-RSA-CHACHA20-POLY1305-SHA256"; case TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256: return "ECDHE-ECDSA-CHACHA20-POLY1305-SHA256"; case TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256: return "ECDHE-DHE-CHACHA20-POLY1305-SHA256"; case TLS_AES_128_GCM_SHA256: return "TLS-AES-128-GCM-SHA256"; case TLS_AES_256_GCM_SHA384: return "TLS-AES-256-GCM-SHA384"; case TLS_CHACHA20_POLY1305_SHA256: return "TLS-CHACHA20-POLY1305-SHA256"; case TLS_AES_128_CCM_SHA256: return "TLS-AES-128-CCM-SHA256"; case TLS_AES_128_CCM_8_SHA256: return "TLS-AES-128-CCM-8-SHA256"; } } return "UNKNOWN"; } #ifdef TLS_FORWARD_SECRECY int _private_tls_dh_export_Y(unsigned char *Ybuf, unsigned long *Ylen, DHKey *key) { unsigned long len; if ((Ybuf == NULL) || (Ylen == NULL) || (key == NULL)) return TLS_GENERIC_ERROR; len = mp_unsigned_bin_size(key->y); if (len > *Ylen) return TLS_GENERIC_ERROR; *Ylen = len; return 0; } int _private_tls_dh_export_pqY(unsigned char *pbuf, unsigned long *plen, unsigned char *gbuf, unsigned long *glen, unsigned char *Ybuf, unsigned long *Ylen, DHKey *key) { unsigned long len; int err; if ((pbuf == NULL) || (plen == NULL) || (gbuf == NULL) || (glen == NULL) || (Ybuf == NULL) || (Ylen == NULL) || (key == NULL)) return TLS_GENERIC_ERROR; len = mp_unsigned_bin_size(key->y); if (len > *Ylen) return TLS_GENERIC_ERROR; if ((err = mp_to_unsigned_bin(key->y, Ybuf)) != CRYPT_OK) return err; *Ylen = len; len = mp_unsigned_bin_size(key->p); if (len > *plen) return TLS_GENERIC_ERROR; if ((err = mp_to_unsigned_bin(key->p, pbuf)) != CRYPT_OK) return err; *plen = len; len = mp_unsigned_bin_size(key->g); if (len > *glen) return TLS_GENERIC_ERROR; if ((err = mp_to_unsigned_bin(key->g, gbuf)) != CRYPT_OK) return err; *glen = len; return 0; } void _private_tls_dh_clear_key(DHKey *key) { mp_clear_multi(key->g, key->p, key->x, key->y, NULL); key->g = NULL; key->p = NULL; key->x = NULL; key->y = NULL; } int _private_tls_dh_make_key(int keysize, DHKey *key, const char *pbuf, const char *gbuf, int pbuf_len, int gbuf_len) { unsigned char *buf; int err; if (!key) return TLS_GENERIC_ERROR; static prng_state prng; int wprng = find_prng("sprng"); if ((err = prng_is_valid(wprng)) != CRYPT_OK) return err; buf = (unsigned char *)TLS_MALLOC(keysize); if (!buf) return TLS_NO_MEMORY; if (rng_make_prng(keysize, wprng, &prng, NULL) != CRYPT_OK) { TLS_FREE(buf); return TLS_GENERIC_ERROR; } if (prng_descriptor[wprng].read(buf, keysize, &prng) != (unsigned long)keysize) { TLS_FREE(buf); return TLS_GENERIC_ERROR; } if ((err = mp_init_multi(&key->g, &key->p, &key->x, &key->y, NULL)) != CRYPT_OK) { TLS_FREE(buf); return TLS_GENERIC_ERROR; } if (gbuf_len <= 0) { if ((err = mp_read_radix(key->g, gbuf, 16)) != CRYPT_OK) { TLS_FREE(buf); _private_tls_dh_clear_key(key); return TLS_GENERIC_ERROR; } } else { if ((err = mp_read_unsigned_bin(key->g, (unsigned char *)gbuf, gbuf_len)) != CRYPT_OK) { TLS_FREE(buf); _private_tls_dh_clear_key(key); return TLS_GENERIC_ERROR; } } if (pbuf_len <= 0) { if ((err = mp_read_radix(key->p, pbuf, 16)) != CRYPT_OK) { TLS_FREE(buf); _private_tls_dh_clear_key(key); return TLS_GENERIC_ERROR; } } else { if ((err = mp_read_unsigned_bin(key->p, (unsigned char *)pbuf, pbuf_len)) != CRYPT_OK) { TLS_FREE(buf); _private_tls_dh_clear_key(key); return TLS_GENERIC_ERROR; } } if ((err = mp_read_unsigned_bin(key->x, buf, keysize)) != CRYPT_OK) { TLS_FREE(buf); _private_tls_dh_clear_key(key); return TLS_GENERIC_ERROR; } if ((err = mp_exptmod(key->g, key->x, key->p, key->y)) != CRYPT_OK) { TLS_FREE(buf); _private_tls_dh_clear_key(key); return TLS_GENERIC_ERROR; } TLS_FREE(buf); return 0; } #endif int tls_is_ecdsa(struct TLSContext *context) { if (!context) return 0; switch (context->cipher) { case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA: case TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA384: case TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384: #ifdef TLS_WITH_CHACHA20_POLY1305 case TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256: #endif return 1; } #ifdef WITH_TLS_13 if (context->ec_private_key) return 1; #endif return 0; } struct TLSPacket *tls_build_client_key_exchange(struct TLSContext *context) { if (context->is_server) { DEBUG_PRINT("CANNOT BUILD CLIENT KEY EXCHANGE MESSAGE FOR SERVERS\n"); return NULL; } struct TLSPacket *packet = tls_create_packet(context, TLS_HANDSHAKE, context->version, 0); tls_packet_uint8(packet, 0x10); #ifdef TLS_FORWARD_SECRECY int ephemeral = tls_cipher_is_ephemeral(context); if ((ephemeral) && (context->premaster_key) && (context->premaster_key_len)) { if (ephemeral == 1) { unsigned char dh_Ys[0xFFF]; unsigned char dh_p[0xFFF]; unsigned char dh_g[0xFFF]; unsigned long dh_p_len = sizeof(dh_p); unsigned long dh_g_len = sizeof(dh_g); unsigned long dh_Ys_len = sizeof(dh_Ys); if (_private_tls_dh_export_pqY(dh_p, &dh_p_len, dh_g, &dh_g_len, dh_Ys, &dh_Ys_len, context->dhe)) { DEBUG_PRINT("ERROR EXPORTING DHE KEY %p\n", context->dhe); TLS_FREE(packet); _private_tls_dhe_free(context); return NULL; } _private_tls_dhe_free(context); DEBUG_DUMP_HEX_LABEL("Yc", dh_Ys, dh_Ys_len); tls_packet_uint24(packet, dh_Ys_len + 2); if (context->dtls) _private_dtls_handshake_data(context, packet, dh_Ys_len + 2); tls_packet_uint16(packet, dh_Ys_len); tls_packet_append(packet, dh_Ys, dh_Ys_len); } else if (context->ecc_dhe) { unsigned char out[TLS_MAX_RSA_KEY]; unsigned long out_len = TLS_MAX_RSA_KEY; if (ecc_ansi_x963_export(context->ecc_dhe, out, &out_len)) { DEBUG_PRINT("Error exporting ECC key\n"); TLS_FREE(packet); return NULL; } _private_tls_ecc_dhe_free(context); tls_packet_uint24(packet, out_len + 1); if (context->dtls) { _private_dtls_handshake_data(context, packet, out_len + 1); context->dtls_seq++; } tls_packet_uint8(packet, out_len); tls_packet_append(packet, out, out_len); } #ifdef TLS_CURVE25519 else if ((context->curve == &x25519) && (context->client_secret)) { static const unsigned char basepoint[32] = {9}; unsigned char shared_key[32]; curve25519(shared_key, context->client_secret, basepoint); tls_packet_uint24(packet, 32 + 1); tls_packet_uint8(packet, 32); tls_packet_append(packet, shared_key, 32); TLS_FREE(context->client_secret); context->client_secret = NULL; } #endif _private_tls_compute_key(context, 48); } else #endif _private_tls_build_random(packet); context->connection_status = 2; tls_packet_update(packet); return packet; } void _private_dtls_handshake_data(struct TLSContext *context, struct TLSPacket *packet, unsigned int framelength) { // message seq tls_packet_uint16(packet, context->dtls_seq); // fragment offset tls_packet_uint24(packet, 0); // fragment length tls_packet_uint24(packet, framelength); } void _private_dtls_handshake_copyframesize(struct TLSPacket *packet) { packet->buf[22] = packet->buf[14]; packet->buf[23] = packet->buf[15]; packet->buf[24] = packet->buf[16]; } struct TLSPacket *tls_build_server_key_exchange(struct TLSContext *context, int method) { if (!context->is_server) { DEBUG_PRINT("CANNOT BUILD SERVER KEY EXCHANGE MESSAGE FOR CLIENTS\n"); return NULL; } struct TLSPacket *packet = tls_create_packet(context, TLS_HANDSHAKE, context->version, 0); tls_packet_uint8(packet, 0x0C); unsigned char dummy[3]; tls_packet_append(packet, dummy, 3); if (context->dtls) _private_dtls_handshake_data(context, packet, 0); int start_len = packet->len; #ifdef TLS_FORWARD_SECRECY if (method == KEA_dhe_rsa) { tls_init(); _private_tls_dhe_create(context); const char *default_dhe_p = context->default_dhe_p; const char *default_dhe_g = context->default_dhe_g; int key_size; if ((!default_dhe_p) || (!default_dhe_g)) { default_dhe_p = TLS_DH_DEFAULT_P; default_dhe_g = TLS_DH_DEFAULT_G; key_size = TLS_DHE_KEY_SIZE / 8; } else { key_size = strlen(default_dhe_p); } if (_private_tls_dh_make_key(key_size, context->dhe, default_dhe_p, default_dhe_g, 0, 0)) { DEBUG_PRINT("ERROR CREATING DHE KEY\n"); TLS_FREE(packet); TLS_FREE(context->dhe); context->dhe = NULL; return NULL; } unsigned char dh_Ys[0xFFF]; unsigned char dh_p[0xFFF]; unsigned char dh_g[0xFFF]; unsigned long dh_p_len = sizeof(dh_p); unsigned long dh_g_len = sizeof(dh_g); unsigned long dh_Ys_len = sizeof(dh_Ys); if (_private_tls_dh_export_pqY(dh_p, &dh_p_len, dh_g, &dh_g_len, dh_Ys, &dh_Ys_len, context->dhe)) { DEBUG_PRINT("ERROR EXPORTING DHE KEY\n"); TLS_FREE(packet); return NULL; } DEBUG_PRINT("LEN: %lu (%lu, %lu)\n", dh_Ys_len, dh_p_len, dh_g_len); DEBUG_DUMP_HEX_LABEL("DHE PK", dh_Ys, dh_Ys_len); DEBUG_DUMP_HEX_LABEL("DHE P", dh_p, dh_p_len); DEBUG_DUMP_HEX_LABEL("DHE G", dh_g, dh_g_len); tls_packet_uint16(packet, dh_p_len); tls_packet_append(packet, dh_p, dh_p_len); tls_packet_uint16(packet, dh_g_len); tls_packet_append(packet, dh_g, dh_g_len); tls_packet_uint16(packet, dh_Ys_len); tls_packet_append(packet, dh_Ys, dh_Ys_len); //dh_p //dh_g //dh_Ys } else if (method == KEA_ec_diffie_hellman) { // 3 = named curve if (!context->curve) context->curve = default_curve; tls_packet_uint8(packet, 3); tls_packet_uint16(packet, context->curve->iana); tls_init(); _private_tls_ecc_dhe_create(context); ltc_ecc_set_type *dp = (ltc_ecc_set_type *)&context->curve->dp; if (ecc_make_key_ex(NULL, find_prng("sprng"), context->ecc_dhe, dp)) { TLS_FREE(context->ecc_dhe); context->ecc_dhe = NULL; DEBUG_PRINT("Error generating ECC key\n"); TLS_FREE(packet); return NULL; } unsigned char out[TLS_MAX_RSA_KEY]; unsigned long out_len = TLS_MAX_RSA_KEY; if (ecc_ansi_x963_export(context->ecc_dhe, out, &out_len)) { DEBUG_PRINT("Error exporting ECC key\n"); TLS_FREE(packet); return NULL; } tls_packet_uint8(packet, out_len); tls_packet_append(packet, out, out_len); } else #endif { TLS_FREE(packet); DEBUG_PRINT("Unsupported ephemeral method: %i\n", method); return NULL; } // signature unsigned int params_len = packet->len - start_len; unsigned int message_len = params_len + TLS_CLIENT_RANDOM_SIZE + TLS_SERVER_RANDOM_SIZE; unsigned char *message = (unsigned char *)TLS_MALLOC(message_len); if (message) { unsigned char out[TLS_MAX_RSA_KEY]; unsigned long out_len = TLS_MAX_RSA_KEY; int hash_algorithm; if ((context->version != TLS_V13) && (context->version != DTLS_V13) && (context->version != TLS_V12) && (context->version != DTLS_V12)) { hash_algorithm = _md5_sha1; } else { if ((context->version == TLS_V13) || (context->version == DTLS_V13) || (context->version == TLS_V12) || (context->version == DTLS_V12)) hash_algorithm = sha256; else hash_algorithm = sha1; #ifdef TLS_ECDSA_SUPPORTED if (tls_is_ecdsa(context)) { if ((context->version == TLS_V13) || (context->version == DTLS_V13) || (context->version == TLS_V12) || (context->version == DTLS_V12)) hash_algorithm = sha512; tls_packet_uint8(packet, hash_algorithm); tls_packet_uint8(packet, ecdsa); } else #endif { tls_packet_uint8(packet, hash_algorithm); tls_packet_uint8(packet, rsa_sign); } } memcpy(message, context->remote_random, TLS_CLIENT_RANDOM_SIZE); memcpy(message + TLS_CLIENT_RANDOM_SIZE, context->local_random, TLS_SERVER_RANDOM_SIZE); memcpy(message + TLS_CLIENT_RANDOM_SIZE + TLS_SERVER_RANDOM_SIZE, packet->buf + start_len, params_len); #ifdef TLS_ECDSA_SUPPORTED if (tls_is_ecdsa(context)) { if (_private_tls_sign_ecdsa(context, hash_algorithm, message, message_len, out, &out_len) == 1) { DEBUG_PRINT("Signing OK! (ECDSA, length %lu)\n", out_len); tls_packet_uint16(packet, out_len); tls_packet_append(packet, out, out_len); } } else #endif if (_private_tls_sign_rsa(context, hash_algorithm, message, message_len, out, &out_len) == 1) { DEBUG_PRINT("Signing OK! (length %lu)\n", out_len); tls_packet_uint16(packet, out_len); tls_packet_append(packet, out, out_len); } TLS_FREE(message); } if ((!packet->broken) && (packet->buf)) { int remaining = packet->len - start_len; int payload_pos = 6; if (context->dtls) payload_pos = 14; packet->buf[payload_pos] = remaining / 0x10000; remaining %= 0x10000; packet->buf[payload_pos + 1] = remaining / 0x100; remaining %= 0x100; packet->buf[payload_pos + 2] = remaining; if (context->dtls) { _private_dtls_handshake_copyframesize(packet); context->dtls_seq++; } } tls_packet_update(packet); return packet; } void _private_tls_set_session_id(struct TLSContext *context) { if (((context->version == TLS_V13) || (context->version == DTLS_V13)) && (context->session_size == TLS_MAX_SESSION_ID)) return; if (tls_random(context->session, TLS_MAX_SESSION_ID)) context->session_size = TLS_MAX_SESSION_ID; else context->session_size = 0; } struct TLSPacket *tls_build_hello(struct TLSContext *context, int tls13_downgrade) { tls_init(); #ifdef WITH_TLS_13 if (context->connection_status == 4) { static unsigned char sha256_helloretryrequest[] = {0xCF, 0x21, 0xAD, 0x74, 0xE5, 0x9A, 0x61, 0x11, 0xBE, 0x1D, 0x8C, 0x02, 0x1E, 0x65, 0xB8, 0x91, 0xC2, 0xA2, 0x11, 0x16, 0x7A, 0xBB, 0x8C, 0x5E, 0x07, 0x9E, 0x09, 0xE2, 0xC8, 0xA8, 0x33, 0x9C}; memcpy(context->local_random, sha256_helloretryrequest, 32); unsigned char header[4] = {0xFE, 0, 0, 0}; unsigned char hash[TLS_MAX_SHA_SIZE ]; int hash_len = _private_tls_done_hash(context, hash); header[3] = (unsigned char)hash_len; _private_tls_update_hash(context, header, sizeof(header)); _private_tls_update_hash(context, hash, hash_len); } else if ((!context->is_server) || ((context->version != TLS_V13) && (context->version != DTLS_V13))) #endif if (!tls_random(context->local_random, context->is_server ? TLS_SERVER_RANDOM_SIZE : TLS_CLIENT_RANDOM_SIZE)) return NULL; if (!context->is_server) *(unsigned int *)context->local_random = htonl((unsigned int)time(NULL)); if ((context->is_server) && (tls13_downgrade)) { if ((tls13_downgrade == TLS_V12) || (tls13_downgrade == DTLS_V12)) memcpy(context->local_random + TLS_SERVER_RANDOM_SIZE - 8, "DOWNGRD\x01", 8); else memcpy(context->local_random + TLS_SERVER_RANDOM_SIZE - 8, "DOWNGRD\x00", 8); } unsigned short packet_version = context->version; unsigned short version = context->version; #ifdef WITH_TLS_13 if (context->version == TLS_V13) version = TLS_V12; else if (context->version == DTLS_V13) version = DTLS_V12; #endif struct TLSPacket *packet = tls_create_packet(context, TLS_HANDSHAKE, version, 0); if (packet) { // hello if (context->is_server) tls_packet_uint8(packet, 0x02); else tls_packet_uint8(packet, 0x01); unsigned char dummy[3]; tls_packet_append(packet, dummy, 3); if (context->dtls) _private_dtls_handshake_data(context, packet, 0); int start_len = packet->len; tls_packet_uint16(packet, version); if (context->is_server) tls_packet_append(packet, context->local_random, TLS_SERVER_RANDOM_SIZE); else tls_packet_append(packet, context->local_random, TLS_CLIENT_RANDOM_SIZE); #ifdef IGNORE_SESSION_ID // session size tls_packet_uint8(packet, 0); #else _private_tls_set_session_id(context); // session size tls_packet_uint8(packet, context->session_size); if (context->session_size) tls_packet_append(packet, context->session, context->session_size); #endif int extension_len = 0; int alpn_len = 0; int alpn_negotiated_len = 0; int i; #ifdef WITH_TLS_13 unsigned char shared_key[TLS_MAX_RSA_KEY]; unsigned long shared_key_len = TLS_MAX_RSA_KEY; unsigned short shared_key_short = 0; int selected_group = 0; if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { if (context->connection_status == 4) { // connection_status == 4 => hello retry request extension_len += 6; } else if (context->is_server) { #ifdef TLS_CURVE25519 if (context->curve == &x25519) { extension_len += 8 + 32; shared_key_short = (unsigned short)32; if (context->finished_key) { memcpy(shared_key, context->finished_key, 32); TLS_FREE(context->finished_key); context->finished_key = NULL; } selected_group = context->curve->iana; // make context->curve NULL (x25519 is a different implementation) context->curve = NULL; } else #endif if (context->ecc_dhe) { if (ecc_ansi_x963_export(context->ecc_dhe, shared_key, &shared_key_len)) { DEBUG_PRINT("Error exporting ECC DHE key\n"); tls_destroy_packet(packet); return tls_build_alert(context, 1, internal_error); } _private_tls_ecc_dhe_free(context); extension_len += 8 + shared_key_len; shared_key_short = (unsigned short)shared_key_len; if (context->curve) selected_group = context->curve->iana; } else if (context->dhe) { selected_group = context->dhe->iana; _private_tls_dh_export_Y(shared_key, &shared_key_len, context->dhe); _private_tls_dhe_free(context); extension_len += 8 + shared_key_len; shared_key_short = (unsigned short)shared_key_len; } } // supported versions if (context->is_server) extension_len += 6; else extension_len += 9; } if ((context->is_server) && (context->negotiated_alpn) && (context->version != TLS_V13) && (context->version != DTLS_V13)) { #else if ((context->is_server) && (context->negotiated_alpn)) { #endif alpn_negotiated_len = strlen(context->negotiated_alpn); alpn_len = alpn_negotiated_len + 1; extension_len += alpn_len + 6; } else if ((!context->is_server) && (context->alpn_count)) { for (i = 0; i < context->alpn_count;i++) { if (context->alpn[i]) { int len = strlen(context->alpn[i]); if (len) alpn_len += len + 1; } } if (alpn_len) extension_len += alpn_len + 6; } // ciphers if (context->is_server) { // fallback ... this should never happen if (!context->cipher) context->cipher = TLS_DHE_RSA_WITH_AES_128_CBC_SHA; tls_packet_uint16(packet, context->cipher); // no compression tls_packet_uint8(packet, 0); #ifndef STRICT_TLS if ((context->version == TLS_V13) || (context->version == DTLS_V13) || (context->version == TLS_V12) || (context->version == DTLS_V12)) { // extensions size #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { tls_packet_uint16(packet, extension_len); } else #endif { tls_packet_uint16(packet, 5 + extension_len); // secure renegotation // advertise it, but refuse renegotiation tls_packet_uint16(packet, 0xff01); #ifdef TLS_ACCEPT_SECURE_RENEGOTIATION // a little defensive if ((context->verify_len) && (!context->verify_data)) context->verify_len = 0; tls_packet_uint16(packet, context->verify_len + 1); tls_packet_uint8(packet, context->verify_len); if (context->verify_len) tls_packet_append(packet, (unsigned char *)context->verify_data, context->verify_len); #else tls_packet_uint16(packet, 1); tls_packet_uint8(packet, 0); #endif } if (alpn_len) { tls_packet_uint16(packet, 0x10); tls_packet_uint16(packet, alpn_len + 2); tls_packet_uint16(packet, alpn_len); tls_packet_uint8(packet, alpn_negotiated_len); tls_packet_append(packet, (unsigned char *)context->negotiated_alpn, alpn_negotiated_len); } } #endif } else { if (context->dtls) { tls_packet_uint8(packet, context->dtls_cookie_len); if (context->dtls_cookie_len) tls_packet_append(packet, context->dtls_cookie, context->dtls_cookie_len); } #ifndef STRICT_TLS #ifdef WITH_TLS_13 #ifdef TLS_FORWARD_SECRECY if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { #ifdef TLS_WITH_CHACHA20_POLY1305 tls_packet_uint16(packet, TLS_CIPHERS_SIZE(9, 0)); tls_packet_uint16(packet, TLS_AES_128_GCM_SHA256); tls_packet_uint16(packet, TLS_AES_256_GCM_SHA384); tls_packet_uint16(packet, TLS_CHACHA20_POLY1305_SHA256); #else tls_packet_uint16(packet, TLS_CIPHERS_SIZE(8, 0)); tls_packet_uint16(packet, TLS_AES_128_GCM_SHA256); tls_packet_uint16(packet, TLS_AES_256_GCM_SHA384); #endif #ifdef TLS_PREFER_CHACHA20 tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256); tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256); tls_packet_uint16(packet, TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256); tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256); tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256); tls_packet_uint16(packet, TLS_DHE_RSA_WITH_AES_128_GCM_SHA256); #else tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256); tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256); tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256); tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256); tls_packet_uint16(packet, TLS_DHE_RSA_WITH_AES_128_GCM_SHA256); tls_packet_uint16(packet, TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256); #endif } else #endif #endif if ((context->version == TLS_V12) || (context->version == DTLS_V12)) { #endif #ifdef TLS_FORWARD_SECRECY #ifdef TLS_CLIENT_ECDHE #ifdef TLS_WITH_CHACHA20_POLY1305 #ifdef TLS_CLIENT_ECDSA tls_packet_uint16(packet, TLS_CIPHERS_SIZE(16, 5)); #ifdef TLS_PREFER_CHACHA20 tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256); #endif tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256); #ifndef TLS_PREFER_CHACHA20 tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256); #endif tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256); tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA); tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA); #else // sizeof ciphers (16 ciphers * 2 bytes) tls_packet_uint16(packet, TLS_CIPHERS_SIZE(11, 5)); #endif #else #ifdef TLS_CLIENT_ECDSA tls_packet_uint16(packet, TLS_CIPHERS_SIZE(13, 5)); tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256); tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256); tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA); tls_packet_uint16(packet, TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA); #else // sizeof ciphers (14 ciphers * 2 bytes) tls_packet_uint16(packet, TLS_CIPHERS_SIZE(9, 5)); #endif #endif #ifdef TLS_WITH_CHACHA20_POLY1305 #ifdef TLS_PREFER_CHACHA20 tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256); #endif #endif tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256); tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA); tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA); tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256); #ifdef TLS_WITH_CHACHA20_POLY1305 #ifndef TLS_PREFER_CHACHA20 tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256); #endif #endif #else #ifdef TLS_WITH_CHACHA20_POLY1305 // sizeof ciphers (11 ciphers * 2 bytes) tls_packet_uint16(packet, TLS_CIPHERS_SIZE(6, 5)); #else // sizeof ciphers (10 ciphers * 2 bytes) tls_packet_uint16(packet, TLS_CIPHERS_SIZE(5, 5)); #endif #endif // not yet supported, because the first message sent (this one) // is already hashed by the client with sha256 (sha384 not yet supported client-side) // but is fully suported server-side // tls_packet_uint16(packet, TLS_DHE_RSA_WITH_AES_256_GCM_SHA384); tls_packet_uint16(packet, TLS_DHE_RSA_WITH_AES_128_GCM_SHA256); tls_packet_uint16(packet, TLS_DHE_RSA_WITH_AES_256_CBC_SHA256); tls_packet_uint16(packet, TLS_DHE_RSA_WITH_AES_128_CBC_SHA256); tls_packet_uint16(packet, TLS_DHE_RSA_WITH_AES_256_CBC_SHA); tls_packet_uint16(packet, TLS_DHE_RSA_WITH_AES_128_CBC_SHA); #ifdef TLS_WITH_CHACHA20_POLY1305 tls_packet_uint16(packet, TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256); #endif #else tls_packet_uint16(packet, TLS_CIPHERS_SIZE(0, 5)); #endif // tls_packet_uint16(packet, TLS_RSA_WITH_AES_256_GCM_SHA384); #ifndef TLS_ROBOT_MITIGATION tls_packet_uint16(packet, TLS_RSA_WITH_AES_128_GCM_SHA256); tls_packet_uint16(packet, TLS_RSA_WITH_AES_256_CBC_SHA256); tls_packet_uint16(packet, TLS_RSA_WITH_AES_128_CBC_SHA256); tls_packet_uint16(packet, TLS_RSA_WITH_AES_256_CBC_SHA); tls_packet_uint16(packet, TLS_RSA_WITH_AES_128_CBC_SHA); #endif #ifndef STRICT_TLS } else { #ifdef TLS_FORWARD_SECRECY #ifdef TLS_CLIENT_ECDHE tls_packet_uint16(packet, TLS_CIPHERS_SIZE(5, 2)); tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA); tls_packet_uint16(packet, TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA); #else tls_packet_uint16(packet, TLS_CIPHERS_SIZE(3, 2)); #endif tls_packet_uint16(packet, TLS_DHE_RSA_WITH_AES_256_CBC_SHA); tls_packet_uint16(packet, TLS_DHE_RSA_WITH_AES_256_CBC_SHA); tls_packet_uint16(packet, TLS_DHE_RSA_WITH_AES_128_CBC_SHA); #else tls_packet_uint16(packet, TLS_CIPHERS_SIZE(0, 2)); #endif #ifndef TLS_ROBOT_MITIGATION tls_packet_uint16(packet, TLS_RSA_WITH_AES_256_CBC_SHA); tls_packet_uint16(packet, TLS_RSA_WITH_AES_128_CBC_SHA); #endif } #endif // compression tls_packet_uint8(packet, 1); // no compression tls_packet_uint8(packet, 0); if ((context->version == TLS_V12) || (context->version == DTLS_V12) || (context->version == TLS_V13) || (context->version == DTLS_V13)) { int sni_len = 0; if (context->sni) sni_len = strlen(context->sni); #ifdef TLS_CLIENT_ECDHE extension_len += 12; #endif if (sni_len) extension_len += sni_len + 9; #ifdef WITH_TLS_13 if ((!context->is_server) && ((context->version == TLS_V13) || (context->version == DTLS_V13))) { #ifdef TLS_CURVE25519 extension_len += 70; #else // secp256r1 produces 65 bytes export extension_len += 103; #endif } #endif tls_packet_uint16(packet, extension_len); if (sni_len) { // sni extension tls_packet_uint16(packet, 0x00); // sni extension len tls_packet_uint16(packet, sni_len + 5); // sni len tls_packet_uint16(packet, sni_len + 3); // sni type tls_packet_uint8(packet, 0); // sni host len tls_packet_uint16(packet, sni_len); tls_packet_append(packet, (unsigned char *)context->sni, sni_len); } #ifdef TLS_FORWARD_SECRECY #ifdef TLS_CLIENT_ECDHE // supported groups tls_packet_uint16(packet, 0x0A); tls_packet_uint16(packet, 8); // 3 curves x 2 bytes tls_packet_uint16(packet, 6); tls_packet_uint16(packet, secp256r1.iana); tls_packet_uint16(packet, secp384r1.iana); #ifdef TLS_CURVE25519 tls_packet_uint16(packet, x25519.iana); #else tls_packet_uint16(packet, secp224r1.iana); #endif #endif #endif if (alpn_len) { tls_packet_uint16(packet, 0x10); tls_packet_uint16(packet, alpn_len + 2); tls_packet_uint16(packet, alpn_len); for (i = 0; i < context->alpn_count;i++) { if (context->alpn[i]) { int len = strlen(context->alpn[i]); if (len) { tls_packet_uint8(packet, len); tls_packet_append(packet, (unsigned char *)context->alpn[i], len); } } } } } } #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { // supported versions tls_packet_uint16(packet, 0x2B); if (context->is_server) { tls_packet_uint16(packet, 2); if (context->version == TLS_V13) tls_packet_uint16(packet, context->tls13_version ? context->tls13_version : TLS_V13); else tls_packet_uint16(packet, context->version); } else { tls_packet_uint16(packet, 5); tls_packet_uint8(packet, 4); tls_packet_uint16(packet, TLS_V13); tls_packet_uint16(packet, 0x7F1C); } if (context->connection_status == 4) { // fallback to the mandatory secp256r1 tls_packet_uint16(packet, 0x33); tls_packet_uint16(packet, 2); tls_packet_uint16(packet, (unsigned short)secp256r1.iana); } if (((shared_key_short) && (selected_group)) || (!context->is_server)) { // key share tls_packet_uint16(packet, 0x33); if (context->is_server) { tls_packet_uint16(packet, shared_key_short + 4); tls_packet_uint16(packet, (unsigned short)selected_group); tls_packet_uint16(packet, shared_key_short); tls_packet_append(packet, (unsigned char *)shared_key, shared_key_short); } else { #ifdef TLS_CURVE25519 // make key shared_key_short = 32; tls_packet_uint16(packet, shared_key_short + 6); tls_packet_uint16(packet, shared_key_short + 4); TLS_FREE(context->client_secret); context->client_secret = (unsigned char *)TLS_MALLOC(32); if (!context->client_secret) { DEBUG_PRINT("ERROR IN TLS_MALLOC"); TLS_FREE(packet); return NULL; } static const unsigned char basepoint[32] = {9}; tls_random(context->client_secret, 32); context->client_secret[0] &= 248; context->client_secret[31] &= 127; context->client_secret[31] |= 64; curve25519(shared_key, context->client_secret, basepoint); tls_packet_uint16(packet, (unsigned short)x25519.iana); tls_packet_uint16(packet, shared_key_short); tls_packet_append(packet, (unsigned char *)shared_key, shared_key_short); #else // make key shared_key_short = 65; tls_packet_uint16(packet, shared_key_short + 6); tls_packet_uint16(packet, shared_key_short + 4); _private_tls_ecc_dhe_create(context); ltc_ecc_set_type *dp = (ltc_ecc_set_type *)&secp256r1.dp; if (ecc_make_key_ex(NULL, find_prng("sprng"), context->ecc_dhe, dp)) { TLS_FREE(context->ecc_dhe); context->ecc_dhe = NULL; DEBUG_PRINT("Error generating ECC key\n"); TLS_FREE(packet); return NULL; } unsigned char out[TLS_MAX_RSA_KEY]; unsigned long out_len = shared_key_short; if (ecc_ansi_x963_export(context->ecc_dhe, out, &out_len)) { DEBUG_PRINT("Error exporting ECC key\n"); TLS_FREE(packet); return NULL; } tls_packet_uint16(packet, (unsigned short)secp256r1.iana); tls_packet_uint16(packet, out_len); tls_packet_append(packet, (unsigned char *)out, shared_key_short); #endif } } if (!context->is_server) { // signature algorithms tls_packet_uint16(packet, 0x0D); tls_packet_uint16(packet, 24); tls_packet_uint16(packet, 22); tls_packet_uint16(packet, 0x0403); tls_packet_uint16(packet, 0x0503); tls_packet_uint16(packet, 0x0603); tls_packet_uint16(packet, 0x0804); tls_packet_uint16(packet, 0x0805); tls_packet_uint16(packet, 0x0806); tls_packet_uint16(packet, 0x0401); tls_packet_uint16(packet, 0x0501); tls_packet_uint16(packet, 0x0601); tls_packet_uint16(packet, 0x0203); tls_packet_uint16(packet, 0x0201); } } #endif if ((!packet->broken) && (packet->buf)) { int remaining = packet->len - start_len; int payload_pos = 6; if (context->dtls) payload_pos = 14; packet->buf[payload_pos] = remaining / 0x10000; remaining %= 0x10000; packet->buf[payload_pos + 1] = remaining / 0x100; remaining %= 0x100; packet->buf[payload_pos + 2] = remaining; if (context->dtls) { _private_dtls_handshake_copyframesize(packet); context->dtls_seq++; } } tls_packet_update(packet); } return packet; } struct TLSPacket *tls_certificate_request(struct TLSContext *context) { if ((!context) || (!context->is_server)) return NULL; unsigned short packet_version = context->version; struct TLSPacket *packet = tls_create_packet(context, TLS_HANDSHAKE, packet_version, 0); if (packet) { // certificate request tls_packet_uint8(packet, 0x0D); unsigned char dummy[3]; tls_packet_append(packet, dummy, 3); if (context->dtls) _private_dtls_handshake_data(context, packet, 0); int start_len = packet->len; #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { // certificate request context tls_packet_uint8(packet, 0); // extensions tls_packet_uint16(packet, 18); // signature algorithms tls_packet_uint16(packet, 0x0D); tls_packet_uint16(packet, 14); tls_packet_uint16(packet, 12); // rsa_pkcs1_sha256 // tls_packet_uint16(packet, 0x0401); // rsa_pkcs1_sha384 // tls_packet_uint16(packet, 0x0501); // rsa_pkcs1_sha512 // tls_packet_uint16(packet, 0x0601); // ecdsa_secp256r1_sha256 tls_packet_uint16(packet, 0x0403); // ecdsa_secp384r1_sha384 tls_packet_uint16(packet, 0x0503); // ecdsa_secp521r1_sha512 tls_packet_uint16(packet, 0x0604); // rsa_pss_rsae_sha256 tls_packet_uint16(packet, 0x0804); // rsa_pss_rsae_sha384 tls_packet_uint16(packet, 0x0805); // rsa_pss_rsae_sha512 tls_packet_uint16(packet, 0x0806); } else #endif { tls_packet_uint8(packet, 1); tls_packet_uint8(packet, rsa_sign); if ((context->version == TLS_V12) || (context->version == DTLS_V12)) { // 10 pairs or 2 bytes tls_packet_uint16(packet, 10); tls_packet_uint8(packet, sha256); tls_packet_uint8(packet, rsa); tls_packet_uint8(packet, sha1); tls_packet_uint8(packet, rsa); tls_packet_uint8(packet, sha384); tls_packet_uint8(packet, rsa); tls_packet_uint8(packet, sha512); tls_packet_uint8(packet, rsa); tls_packet_uint8(packet, md5); tls_packet_uint8(packet, rsa); } // no DistinguishedName yet tls_packet_uint16(packet, 0); } if (!packet->broken) { int remaining = packet->len - start_len; int payload_pos = 6; if (context->dtls) payload_pos = 14; packet->buf[payload_pos] = remaining / 0x10000; remaining %= 0x10000; packet->buf[payload_pos + 1] = remaining / 0x100; remaining %= 0x100; packet->buf[payload_pos + 2] = remaining; if (context->dtls) { _private_dtls_handshake_copyframesize(packet); context->dtls_seq++; } } tls_packet_update(packet); } return packet; } int _private_dtls_build_cookie(struct TLSContext *context) { if ((!context->dtls_cookie) || (!context->dtls_cookie_len)) { context->dtls_cookie = (unsigned char *)TLS_MALLOC(DTLS_COOKIE_SIZE); if (!context->dtls_cookie) return 0; #ifdef WITH_RANDOM_DLTS_COOKIE if (!tls_random(context->dtls_cookie, DTLS_COOKIE_SIZE)) { TLS_FREE(context->dtls_cookie); context->dtls_cookie = NULL; return 0; } context->dtls_cookie_len = DTLS_COOKIE_SIZE; #else hmac_state hmac; hmac_init(&hmac, find_hash("sha256"), dtls_secret, sizeof(dtls_secret)); hmac_process(&hmac, context->remote_random, TLS_CLIENT_RANDOM_SIZE); unsigned long out_size = DTLS_COOKIE_SIZE; hmac_done(&hmac, context->dtls_cookie, &out_size); #endif } return 1; } struct TLSPacket *tls_build_verify_request(struct TLSContext *context) { if ((!context->is_server) || (!context->dtls)) return NULL; if ((!context->dtls_cookie) || (!context->dtls_cookie_len)) { if (!_private_dtls_build_cookie(context)) return NULL; } unsigned short packet_version = context->version; struct TLSPacket *packet = tls_create_packet(context, TLS_HANDSHAKE, packet_version, 0); if (packet) { // verify request tls_packet_uint8(packet, 0x03); // 24-bit length tls_packet_uint24(packet, context->dtls_cookie_len + 3); // 16-bit message_sequence tls_packet_uint16(packet, 0); // 24-bit fragment_offset tls_packet_uint24(packet, 0); // 24-bit fragment_offset tls_packet_uint24(packet, context->dtls_cookie_len + 3); // server_version tls_packet_uint16(packet, context->version); tls_packet_uint8(packet, context->dtls_cookie_len); tls_packet_append(packet, context->dtls_cookie, context->dtls_cookie_len); tls_packet_update(packet); } return packet; } int _private_dtls_check_packet(const unsigned char *buf, int buf_len) { CHECK_SIZE(11, buf_len, TLS_NEED_MORE_DATA) unsigned int bytes_to_follow = buf[0] * 0x10000 + buf[1] * 0x100 + buf[2]; // not used: unsigned short message_seq = ntohs(*(unsigned short *)&buf[3]); unsigned int fragment_offset = buf[5] * 0x10000 + buf[6] * 0x100 + buf[7]; unsigned int fragment_length = buf[8] * 0x10000 + buf[9] * 0x100 + buf[10]; if ((fragment_offset) || (fragment_length != bytes_to_follow)) { DEBUG_PRINT("FRAGMENTED PACKETS NOT SUPPORTED\n"); return TLS_FEATURE_NOT_SUPPORTED; } return bytes_to_follow; } void _private_dtls_reset(struct TLSContext *context) { context->dtls_epoch_local = 0; context->dtls_epoch_remote = 0; context->dtls_seq = 0; _private_tls_destroy_hash(context); context->connection_status = 0; } int tls_parse_verify_request(struct TLSContext *context, const unsigned char *buf, int buf_len, unsigned int *write_packets) { *write_packets = 0; if ((context->connection_status != 0) || (!context->dtls)) { DEBUG_PRINT("UNEXPECTED VERIFY REQUEST MESSAGE\n"); return TLS_UNEXPECTED_MESSAGE; } int res = 11; int bytes_to_follow = _private_dtls_check_packet(buf, buf_len); if (bytes_to_follow < 0) return bytes_to_follow; CHECK_SIZE(bytes_to_follow, buf_len - res, TLS_NEED_MORE_DATA) // not used: unsigned short version = ntohs(*(unsigned short *)&buf[res]); res += 2; unsigned char len = buf[res]; res++; TLS_FREE(context->dtls_cookie); context->dtls_cookie_len = 0; if (len) { CHECK_SIZE(len, buf_len - res, TLS_NEED_MORE_DATA) context->dtls_cookie = (unsigned char *)TLS_MALLOC(len); if (!context->dtls_cookie) return TLS_NO_MEMORY; context->dtls_cookie_len = len; memcpy(context->dtls_cookie, &buf[res], len); res += len; *write_packets = 4; } // reset context _private_dtls_reset(context); return res; } void _private_dtls_reset_cookie(struct TLSContext *context) { TLS_FREE(context->dtls_cookie); context->dtls_cookie = NULL; context->dtls_cookie_len = 0; } #ifdef WITH_TLS_13 int _private_tls_parse_key_share(struct TLSContext *context, const unsigned char *buf, int buf_len) { int i = 0; struct ECCCurveParameters *curve = 0; DHKey *dhkey = 0; int dhe_key_size = 0; const unsigned char *buffer = NULL; unsigned char *out2; unsigned long out_size; unsigned short key_size = 0; while (buf_len >= 4) { unsigned short named_group = ntohs(*(unsigned short *)&buf[i]); i += 2; buf_len -= 2; key_size = ntohs(*(unsigned short *)&buf[i]); i += 2; buf_len -= 2; if (key_size > buf_len) return TLS_BROKEN_PACKET; switch (named_group) { case 0x0017: curve = &secp256r1; buffer = &buf[i]; DEBUG_PRINT("KEY SHARE => secp256r1\n"); buf_len = 0; continue; case 0x0018: // secp384r1 curve = &secp384r1; buffer = &buf[i]; DEBUG_PRINT("KEY SHARE => secp384r1\n"); buf_len = 0; continue; case 0x0019: // secp521r1 break; case 0x001D: // x25519 #ifdef TLS_CURVE25519 if (key_size != 32) { DEBUG_PRINT("INVALID x25519 KEY SIZE (%i)\n", key_size); continue; } curve = &x25519; buffer = &buf[i]; DEBUG_PRINT("KEY SHARE => x25519\n"); buf_len = 0; continue; #endif break; case 0x001E: // x448 break; case 0x0100: dhkey = &ffdhe2048; dhe_key_size = 2048; break; case 0x0101: dhkey = &ffdhe3072; dhe_key_size = 3072; break; case 0x0102: dhkey = &ffdhe4096; dhe_key_size = 4096; break; case 0x0103: dhkey = &ffdhe6144; dhe_key_size = 6144; break; case 0x0104: dhkey = &ffdhe8192; dhe_key_size = 8192; break; } i += key_size; buf_len -= key_size; if (!context->is_server) break; } tls_init(); if (curve) { context->curve = curve; #ifdef TLS_CURVE25519 if (curve == &x25519) { if ((context->is_server) && (!tls_random(context->local_random, TLS_SERVER_RANDOM_SIZE))) return TLS_GENERIC_ERROR; unsigned char secret[32]; static const unsigned char basepoint[32] = {9}; if ((context->is_server) || (!context->client_secret)) { tls_random(secret, 32); secret[0] &= 248; secret[31] &= 127; secret[31] |= 64; // use finished key to store public key TLS_FREE(context->finished_key); context->finished_key = (unsigned char *)TLS_MALLOC(32); if (!context->finished_key) return TLS_GENERIC_ERROR; curve25519(context->finished_key, secret, basepoint); TLS_FREE(context->premaster_key); context->premaster_key = (unsigned char *)TLS_MALLOC(32); if (!context->premaster_key) return TLS_GENERIC_ERROR; curve25519(context->premaster_key, secret, buffer); context->premaster_key_len = 32; } else { TLS_FREE(context->premaster_key); context->premaster_key = (unsigned char *)TLS_MALLOC(32); if (!context->premaster_key) return TLS_GENERIC_ERROR; curve25519(context->premaster_key, context->client_secret, buffer); context->premaster_key_len = 32; TLS_FREE(context->client_secret); context->client_secret = NULL; } DEBUG_DUMP_HEX_LABEL("x25519 KEY", context->premaster_key, context->premaster_key_len); return 0; } #endif if (context->is_server) { _private_tls_ecc_dhe_create(context); if (ecc_make_key_ex(NULL, find_prng("sprng"), context->ecc_dhe, (ltc_ecc_set_type *)&context->curve->dp)) { TLS_FREE(context->ecc_dhe); context->ecc_dhe = NULL; DEBUG_PRINT("Error generating ECC DHE key\n"); return TLS_GENERIC_ERROR; } } ltc_ecc_set_type *dp = (ltc_ecc_set_type *)&context->curve->dp; if ((context->is_server) && (!tls_random(context->local_random, TLS_SERVER_RANDOM_SIZE))) return TLS_GENERIC_ERROR; ecc_key client_key; memset(&client_key, 0, sizeof(client_key)); if (ecc_ansi_x963_import_ex(buffer, key_size, &client_key, dp)) { DEBUG_PRINT("Error importing ECC DHE key\n"); return TLS_GENERIC_ERROR; } out2 = (unsigned char *)TLS_MALLOC(key_size); out_size = key_size; int err = ecc_shared_secret(context->ecc_dhe, &client_key, out2, &out_size); ecc_free(&client_key); if (err) { DEBUG_PRINT("ECC DHE DECRYPT ERROR %i\n", err); TLS_FREE(out2); return TLS_GENERIC_ERROR; } DEBUG_PRINT("OUT_SIZE: %lu\n", out_size); DEBUG_DUMP_HEX_LABEL("ECC DHE", out2, out_size); TLS_FREE(context->premaster_key); context->premaster_key = out2; context->premaster_key_len = out_size; return 0; } else if ((dhkey) && (buffer)) { _private_tls_dhe_create(context); if (!tls_random(context->local_random, TLS_SERVER_RANDOM_SIZE)) return TLS_GENERIC_ERROR; if (_private_tls_dh_make_key(dhe_key_size / 8, context->dhe, (const char *)dhkey->p, (const char *)dhkey->g, 0, 0)) { TLS_FREE(context->dhe); context->dhe = NULL; DEBUG_PRINT("Error generating DHE key\n"); return TLS_GENERIC_ERROR; } unsigned int dhe_out_size; out2 = _private_tls_decrypt_dhe(context, buffer, key_size, &dhe_out_size, 0); if (!out2) { DEBUG_PRINT("Error generating DHE shared key\n"); return TLS_GENERIC_ERROR; } TLS_FREE(context->premaster_key); context->premaster_key = out2; context->premaster_key_len = dhe_out_size; if (context->dhe) context->dhe->iana = dhkey->iana; return 0; } DEBUG_PRINT("NO COMMON KEY SHARE SUPPORTED\n"); return TLS_NO_COMMON_CIPHER; } #endif int tls_parse_hello(struct TLSContext *context, const unsigned char *buf, int buf_len, unsigned int *write_packets, unsigned int *dtls_verified) { *write_packets = 0; *dtls_verified = 0; if ((context->connection_status != 0) && (context->connection_status != 4)) { // ignore multiple hello on dtls if (context->dtls) { DEBUG_PRINT("RETRANSMITTED HELLO MESSAGE RECEIVED\n"); return 1; } DEBUG_PRINT("UNEXPECTED HELLO MESSAGE\n"); return TLS_UNEXPECTED_MESSAGE; } int res = 0; int downgraded = 0; int hello_min_size = context->dtls ? TLS_CLIENT_HELLO_MINSIZE + 8 : TLS_CLIENT_HELLO_MINSIZE; CHECK_SIZE(hello_min_size, buf_len, TLS_NEED_MORE_DATA) // big endian unsigned int bytes_to_follow = buf[0] * 0x10000 + buf[1] * 0x100 + buf[2]; res += 3; if (context->dtls) { int dtls_check = _private_dtls_check_packet(buf, buf_len); if (dtls_check < 0) return dtls_check; // 16 bit message seq + 24 bit fragment offset + 24 bit fragment length res += 8; } CHECK_SIZE(bytes_to_follow, buf_len - res, TLS_NEED_MORE_DATA) CHECK_SIZE(2, buf_len - res, TLS_NEED_MORE_DATA) unsigned short version = ntohs(*(unsigned short *)&buf[res]); unsigned short cipher = 0; res += 2; VERSION_SUPPORTED(version, TLS_NOT_SAFE) DEBUG_PRINT("VERSION REQUIRED BY REMOTE %x, VERSION NOW %x\n", (int)version, (int)context->version); #ifdef TLS_LEGACY_SUPPORT // when no legacy support, don't downgrade #ifndef TLS_FORCE_LOCAL_VERSION // downgrade ? if (context->dtls) { // for dlts, newer version has lower id (1.0 = FEFF, 1.2 = FEFD) if (context->version < version) downgraded = 1; } else { if (context->version > version) downgraded = 1; } if (downgraded) { context->version = version; if (!context->is_server) _private_tls_change_hash_type(context); } #endif #endif memcpy(context->remote_random, &buf[res], TLS_CLIENT_RANDOM_SIZE); res += TLS_CLIENT_RANDOM_SIZE; unsigned char session_len = buf[res++]; CHECK_SIZE(session_len, buf_len - res, TLS_NEED_MORE_DATA) if ((session_len) && (session_len <= TLS_MAX_SESSION_ID)) { memcpy(context->session, &buf[res], session_len); context->session_size = session_len; DEBUG_DUMP_HEX_LABEL("REMOTE SESSION ID: ", context->session, context->session_size); } else context->session_size = 0; res += session_len; const unsigned char *cipher_buffer = NULL; unsigned short cipher_len = 0; int scsv_set = 0; if (context->is_server) { if (context->dtls) { CHECK_SIZE(1, buf_len - res, TLS_NEED_MORE_DATA) unsigned char tls_cookie_len = buf[res++]; if (tls_cookie_len) { CHECK_SIZE(tls_cookie_len, buf_len - res, TLS_NEED_MORE_DATA) if ((!context->dtls_cookie_len) || (!context->dtls_cookie)) _private_dtls_build_cookie(context); if ((context->dtls_cookie_len != tls_cookie_len) || (!context->dtls_cookie)) { *dtls_verified = 2; _private_dtls_reset_cookie(context); DEBUG_PRINT("INVALID DTLS COOKIE\n"); return TLS_BROKEN_PACKET; } if (memcmp(context->dtls_cookie, &buf[res], tls_cookie_len)) { *dtls_verified = 3; _private_dtls_reset_cookie(context); DEBUG_PRINT("MISMATCH DTLS COOKIE\n"); return TLS_BROKEN_PACKET; } _private_dtls_reset_cookie(context); context->dtls_seq++; *dtls_verified = 1; res += tls_cookie_len; } else { *write_packets = 2; return buf_len; } } CHECK_SIZE(2, buf_len - res, TLS_NEED_MORE_DATA) cipher_len = ntohs(*(unsigned short *)&buf[res]); res += 2; CHECK_SIZE(cipher_len, buf_len - res, TLS_NEED_MORE_DATA) // faster than cipher_len % 2 if (cipher_len & 1) return TLS_BROKEN_PACKET; cipher_buffer = &buf[res]; res += cipher_len; CHECK_SIZE(1, buf_len - res, TLS_NEED_MORE_DATA) unsigned char compression_list_size = buf[res++]; CHECK_SIZE(compression_list_size, buf_len - res, TLS_NEED_MORE_DATA) // no compression support res += compression_list_size; } else { CHECK_SIZE(2, buf_len - res, TLS_NEED_MORE_DATA) cipher = ntohs(*(unsigned short *)&buf[res]); res += 2; context->cipher = cipher; #ifndef WITH_TLS_13 if (!tls_cipher_supported(context, cipher)) { context->cipher = 0; DEBUG_PRINT("NO CIPHER SUPPORTED\n"); return TLS_NO_COMMON_CIPHER; } DEBUG_PRINT("CIPHER: %s\n", tls_cipher_name(context)); #endif CHECK_SIZE(1, buf_len - res, TLS_NEED_MORE_DATA) unsigned char compression = buf[res++]; if (compression != 0) { DEBUG_PRINT("COMPRESSION NOT SUPPORTED\n"); return TLS_COMPRESSION_NOT_SUPPORTED; } } if (res > 0) { if (context->is_server) *write_packets = 2; if (context->connection_status != 4) context->connection_status = 1; } if (res > 2) res += 2; #ifdef WITH_TLS_13 const unsigned char *key_share = NULL; unsigned short key_size = 0; #endif while (buf_len - res >= 4) { // have extensions unsigned short extension_type = ntohs(*(unsigned short *)&buf[res]); res += 2; unsigned short extension_len = ntohs(*(unsigned short *)&buf[res]); res += 2; DEBUG_PRINT("Extension: 0x0%x (%i), len: %i\n", (int)extension_type, (int)extension_type, (int)extension_len); if (extension_len) { // SNI extension CHECK_SIZE(extension_len, buf_len - res, TLS_NEED_MORE_DATA) if (extension_type == 0x00) { // unsigned short sni_len = ntohs(*(unsigned short *)&buf[res]); // unsigned char sni_type = buf[res + 2]; unsigned short sni_host_len = ntohs(*(unsigned short *)&buf[res + 3]); CHECK_SIZE(sni_host_len, buf_len - res - 5, TLS_NEED_MORE_DATA) if (sni_host_len) { TLS_FREE(context->sni); context->sni = (char *)TLS_MALLOC(sni_host_len + 1); if (context->sni) { memcpy(context->sni, &buf[res + 5], sni_host_len); context->sni[sni_host_len] = 0; DEBUG_PRINT("SNI HOST INDICATOR: [%s]\n", context->sni); } } } else #ifdef TLS_FORWARD_SECRECY if (extension_type == 0x0A) { // supported groups if (buf_len - res > 2) { unsigned short group_len = ntohs(*(unsigned short *)&buf[res]); if (buf_len - res >= group_len + 2) { DEBUG_DUMP_HEX_LABEL("SUPPORTED GROUPS", &buf[res + 2], group_len); int i; int selected = 0; for (i = 0; i < group_len; i += 2) { unsigned short iana_n = ntohs(*(unsigned short *)&buf[res + 2 + i]); switch (iana_n) { case 23: context->curve = &secp256r1; selected = 1; break; case 24: context->curve = &secp384r1; selected = 1; break; #ifdef WITH_TLS_13 // needs different implementation // case 29: // context->curve = &x25519; // selected = 1; // break; #endif // do not use it anymore // case 25: // context->curve = &secp521r1; // selected = 1; // break; } if (selected) { DEBUG_PRINT("SELECTED CURVE %s\n", context->curve->name); break; } } } } } else #endif if ((extension_type == 0x10) && (context->alpn) && (context->alpn_count)) { if (buf_len - res > 2) { unsigned short alpn_len = ntohs(*(unsigned short *)&buf[res]); if ((alpn_len) && (alpn_len <= extension_len - 2)) { unsigned char *alpn = (unsigned char *)&buf[res + 2]; int alpn_pos = 0; while (alpn_pos < alpn_len) { unsigned char alpn_size = alpn[alpn_pos++]; if (alpn_size + alpn_pos >= extension_len) break; if ((alpn_size) && (tls_alpn_contains(context, (char *)&alpn[alpn_pos], alpn_size))) { TLS_FREE(context->negotiated_alpn); context->negotiated_alpn = (char *)TLS_MALLOC(alpn_size + 1); if (context->negotiated_alpn) { memcpy(context->negotiated_alpn, &alpn[alpn_pos], alpn_size); context->negotiated_alpn[alpn_size] = 0; DEBUG_PRINT("NEGOTIATED ALPN: %s\n", context->negotiated_alpn); } break; } alpn_pos += alpn_size; // ServerHello contains just one alpn if (!context->is_server) break; } } } } else if (extension_type == 0x0D) { // supported signatures DEBUG_DUMP_HEX_LABEL("SUPPORTED SIGNATURES", &buf[res], extension_len); } else if (extension_type == 0x0B) { // supported point formats DEBUG_DUMP_HEX_LABEL("SUPPORTED POINT FORMATS", &buf[res], extension_len); } #ifdef WITH_TLS_13 else if (extension_type == 0x2B) { // supported versions if ((context->is_server) && (buf[res] == extension_len - 1)) { if (extension_len > 2) { DEBUG_DUMP_HEX_LABEL("SUPPORTED VERSIONS", &buf[res], extension_len); int i; int limit = (int)buf[res]; if (limit == extension_len - 1) { for (i = 1; i < limit; i += 2) { if ((ntohs(*(unsigned short *)&buf[res + i]) == TLS_V13) || (ntohs(*(unsigned short *)&buf[res + i]) == 0x7F1C)) { context->version = TLS_V13; context->tls13_version = ntohs(*(unsigned short *)&buf[res + i]); DEBUG_PRINT("TLS 1.3 SUPPORTED\n"); break; } } } } } else if ((!context->is_server) && (extension_len == 2)) { if ((ntohs(*(unsigned short *)&buf[res]) == TLS_V13) || (ntohs(*(unsigned short *)&buf[res]) == 0x7F1C)) { context->version = TLS_V13; context->tls13_version = ntohs(*(unsigned short *)&buf[res]); DEBUG_PRINT("TLS 1.3 SUPPORTED\n"); } } } else if (extension_type == 0x2A) { // early data DEBUG_DUMP_HEX_LABEL("EXTENSION, EARLY DATA", &buf[res], extension_len); } else if (extension_type == 0x29) { // pre shared key DEBUG_DUMP_HEX_LABEL("EXTENSION, PRE SHARED KEY", &buf[res], extension_len); } else if (extension_type == 0x33) { // key share if (context->is_server) { key_size = ntohs(*(unsigned short *)&buf[res]); if ((context->is_server) && (key_size > extension_len - 2)) { DEBUG_PRINT("BROKEN KEY SHARE\n"); return TLS_BROKEN_PACKET; } } else { key_size = extension_len; } DEBUG_DUMP_HEX_LABEL("EXTENSION, KEY SHARE", &buf[res], extension_len); if (context->is_server) key_share = &buf[res + 2]; else key_share = &buf[res]; } else if (extension_type == 0x0D) { // signature algorithms DEBUG_DUMP_HEX_LABEL("EXTENSION, SIGNATURE ALGORITHMS", &buf[res], extension_len); } else if (extension_type == 0x2D) { // psk key exchange modes DEBUG_DUMP_HEX_LABEL("EXTENSION, PSK KEY EXCHANGE MODES", &buf[res], extension_len); } #endif res += extension_len; } } if (buf_len != res) return TLS_NEED_MORE_DATA; if ((context->is_server) && (cipher_buffer) && (cipher_len)) { int cipher = tls_choose_cipher(context, cipher_buffer, cipher_len, &scsv_set); if (cipher < 0) { DEBUG_PRINT("NO COMMON CIPHERS\n"); return cipher; } if ((downgraded) && (scsv_set)) { DEBUG_PRINT("NO DOWNGRADE (SCSV SET)\n"); _private_tls_write_packet(tls_build_alert(context, 1, inappropriate_fallback)); context->critical_error = 1; return TLS_NOT_SAFE; } context->cipher = cipher; } #ifdef WITH_TLS_13 if (!context->is_server) { if (!tls_cipher_supported(context, cipher)) { context->cipher = 0; DEBUG_PRINT("NO CIPHER SUPPORTED\n"); return TLS_NO_COMMON_CIPHER; } DEBUG_PRINT("CIPHER: %s\n", tls_cipher_name(context)); } if ((key_share) && (key_size) && ((context->version == TLS_V13) || (context->version == DTLS_V13))) { int key_share_err = _private_tls_parse_key_share(context, key_share, key_size); if (key_share_err) { // request hello retry if (context->connection_status != 4) { *write_packets = 5; context->hs_messages[1] = 0; context->connection_status = 4; return res; } else return key_share_err; } // we have key share if (context->is_server) context->connection_status = 3; else context->connection_status = 2; } #endif return res; } int tls_parse_certificate(struct TLSContext *context, const unsigned char *buf, int buf_len, int is_client) { int res = 0; CHECK_SIZE(3, buf_len, TLS_NEED_MORE_DATA) unsigned int size_of_all_certificates = buf[0] * 0x10000 + buf[1] * 0x100 + buf[2]; if (size_of_all_certificates <= 4) return 3 + size_of_all_certificates; res += 3; if (context->dtls) { int dtls_check = _private_dtls_check_packet(buf, buf_len); if (dtls_check < 0) return dtls_check; res += 8; } #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { int context_size = buf[res]; res++; // must be 0 if (context_size) res += context_size; } #endif CHECK_SIZE(size_of_all_certificates, buf_len - res, TLS_NEED_MORE_DATA); int size = size_of_all_certificates; int idx = 0; int valid_certificate = 0; while (size > 0) { idx++; CHECK_SIZE(3, buf_len - res, TLS_NEED_MORE_DATA); unsigned int certificate_size = buf[res] * 0x10000 + buf[res + 1] * 0x100 + buf[res + 2]; res += 3; CHECK_SIZE(certificate_size, buf_len - res, TLS_NEED_MORE_DATA) // load chain int certificates_in_chain = 0; int res2 = res; unsigned int remaining = certificate_size; do { if (remaining <= 3) break; certificates_in_chain++; unsigned int certificate_size2 = buf[res2] * 0x10000 + buf[res2 + 1] * 0x100 + buf[res2 + 2]; res2 += 3; remaining -= 3; if (certificate_size2 > remaining) { DEBUG_PRINT("Invalid certificate size (%i from %i bytes remaining)\n", certificate_size2, remaining); break; } remaining -= certificate_size2; struct TLSCertificate *cert = asn1_parse(context, &buf[res2], certificate_size2, is_client); if (cert) { if (certificate_size2) { cert->bytes = (unsigned char *)TLS_MALLOC(certificate_size2); if (cert->bytes) { cert->len = certificate_size2; memcpy(cert->bytes, &buf[res2], certificate_size2); } } // valid certificate if (is_client) { valid_certificate = 1; context->client_certificates = (struct TLSCertificate **)TLS_REALLOC(context->client_certificates, (context->client_certificates_count + 1) * sizeof(struct TLSCertificate *)); context->client_certificates[context->client_certificates_count] = cert; context->client_certificates_count++; } else { context->certificates = (struct TLSCertificate **)TLS_REALLOC(context->certificates, (context->certificates_count + 1) * sizeof(struct TLSCertificate *)); context->certificates[context->certificates_count] = cert; context->certificates_count++; if ((cert->pk) || (cert->priv)) valid_certificate = 1; else if (!context->is_server) valid_certificate = 1; } } res2 += certificate_size2; #ifdef WITH_TLS_13 // extension if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { if (remaining >= 2) { // ignore extensions remaining -= 2; unsigned short size = ntohs(*(unsigned short *)&buf[res2]); if ((size) && (size >= remaining)) { res2 += size; remaining -= size; } } } #endif } while (remaining > 0); if (remaining) { DEBUG_PRINT("Extra %i bytes after certificate\n", remaining); } size -= certificate_size + 3; res += certificate_size; } if (!valid_certificate) return TLS_UNSUPPORTED_CERTIFICATE; if (res != buf_len) { DEBUG_PRINT("Warning: %i bytes read from %i byte buffer\n", (int)res, (int)buf_len); } return res; } int _private_tls_parse_dh(const unsigned char *buf, int buf_len, const unsigned char **out, int *out_size) { int res = 0; *out = NULL; *out_size = 0; CHECK_SIZE(2, buf_len, TLS_NEED_MORE_DATA) unsigned short size = ntohs(*(unsigned short *)buf); res += 2; CHECK_SIZE(size, buf_len - res, TLS_NEED_MORE_DATA) DEBUG_DUMP_HEX(&buf[res], size); *out = &buf[res]; *out_size = size; res += size; return res; } int _private_tls_parse_random(struct TLSContext *context, const unsigned char *buf, int buf_len) { int res = 0; int ephemeral = tls_cipher_is_ephemeral(context); unsigned short size; if (ephemeral == 2) { CHECK_SIZE(1, buf_len, TLS_NEED_MORE_DATA) size = buf[0]; res += 1; } else { CHECK_SIZE(2, buf_len, TLS_NEED_MORE_DATA) size = ntohs(*(unsigned short *)buf); res += 2; } CHECK_SIZE(size, buf_len - res, TLS_NEED_MORE_DATA) unsigned int out_len = 0; unsigned char *random = NULL; switch (ephemeral) { #ifdef TLS_FORWARD_SECRECY case 1: random = _private_tls_decrypt_dhe(context, &buf[res], size, &out_len, 1); break; case 2: random = _private_tls_decrypt_ecc_dhe(context, &buf[res], size, &out_len, 1); break; #endif default: random = _private_tls_decrypt_rsa(context, &buf[res], size, &out_len); } if ((random) && (out_len > 2)) { DEBUG_DUMP_HEX_LABEL("PRE MASTER KEY", random, out_len); TLS_FREE(context->premaster_key); context->premaster_key = random; context->premaster_key_len = out_len; _private_tls_compute_key(context, 48); } else { TLS_FREE(random); return 0; } res += size; return res; } int _private_tls_build_random(struct TLSPacket *packet) { int res = 0; unsigned char rand_bytes[48]; int bytes = 48; if (!tls_random(rand_bytes, bytes)) return TLS_GENERIC_ERROR; // max supported version if (packet->context->is_server) *(unsigned short *)rand_bytes = htons(packet->context->version); else if (packet->context->dtls) *(unsigned short *)rand_bytes = htons(DTLS_V12); else *(unsigned short *)rand_bytes = htons(TLS_V12); //DEBUG_DUMP_HEX_LABEL("PREMASTER KEY", rand_bytes, bytes); TLS_FREE(packet->context->premaster_key); packet->context->premaster_key = (unsigned char *)TLS_MALLOC(bytes); if (!packet->context->premaster_key) return TLS_NO_MEMORY; packet->context->premaster_key_len = bytes; memcpy(packet->context->premaster_key, rand_bytes, packet->context->premaster_key_len); unsigned int out_len; unsigned char *random = _private_tls_encrypt_rsa(packet->context, packet->context->premaster_key, packet->context->premaster_key_len, &out_len); _private_tls_compute_key(packet->context, bytes); if ((random) && (out_len > 2)) { tls_packet_uint24(packet, out_len + 2); if (packet->context->dtls) _private_dtls_handshake_data(packet->context, packet, out_len + 2); tls_packet_uint16(packet, out_len); tls_packet_append(packet, random, out_len); } else res = TLS_GENERIC_ERROR; TLS_FREE(random); if (res) return res; return out_len + 2; } const unsigned char *_private_tls_parse_signature(struct TLSContext *context, const unsigned char *buf, int buf_len, int *hash_algorithm, int *sign_algorithm, int *sig_size, int *offset) { int res = 0; CHECK_SIZE(2, buf_len, NULL) *hash_algorithm = _md5_sha1; *sign_algorithm = rsa_sign; *sig_size = 0; if ((context->version == TLS_V12) || (context->version == DTLS_V12) || (context->version == TLS_V13) || (context->version == DTLS_V13)) { *hash_algorithm = buf[res]; res++; *sign_algorithm = buf[res]; res++; } unsigned short size = ntohs(*(unsigned short *)&buf[res]); res += 2; CHECK_SIZE(size, buf_len - res, NULL) DEBUG_DUMP_HEX(&buf[res], size); *sig_size = size; *offset = res + size; return &buf[res]; } int tls_parse_server_key_exchange(struct TLSContext *context, const unsigned char *buf, int buf_len) { int res = 0; int dh_res = 0; CHECK_SIZE(3, buf_len, TLS_NEED_MORE_DATA) unsigned int size = buf[0] * 0x10000 + buf[1] * 0x100 + buf[2]; res += 3; if (context->dtls) { int dtls_check = _private_dtls_check_packet(buf, buf_len); if (dtls_check < 0) return dtls_check; res += 8; } const unsigned char *packet_ref = buf + res; CHECK_SIZE(size, buf_len - res, TLS_NEED_MORE_DATA); if (!size) return res; unsigned char has_ds_params = 0; unsigned int key_size = 0; #ifdef TLS_FORWARD_SECRECY const struct ECCCurveParameters *curve = NULL; const unsigned char *pk_key = NULL; int ephemeral = tls_cipher_is_ephemeral(context); if (ephemeral) { if (ephemeral == 1) { has_ds_params = 1; } else { if (buf[res++] != 3) { // named curve // any other method is not supported return 0; } CHECK_SIZE(3, buf_len - res, TLS_NEED_MORE_DATA); int iana_n = ntohs(*(unsigned short *)&buf[res]); res += 2; key_size = buf[res]; res++; CHECK_SIZE(key_size, buf_len - res, TLS_NEED_MORE_DATA); DEBUG_PRINT("IANA CURVE NUMBER: %i\n", iana_n); switch (iana_n) { case 19: curve = &secp192r1; break; case 20: curve = &secp224k1; break; case 21: curve = &secp224r1; break; case 22: curve = &secp256k1; break; case 23: curve = &secp256r1; break; case 24: curve = &secp384r1; break; case 25: curve = &secp521r1; break; #ifdef TLS_CURVE25519 case 29: curve = &x25519; break; #endif default: DEBUG_PRINT("UNSUPPORTED CURVE\n"); return TLS_GENERIC_ERROR; } pk_key = &buf[res]; res += key_size; context->curve = curve; } } #endif const unsigned char *dh_p = NULL; int dh_p_len = 0; const unsigned char *dh_g = NULL; int dh_g_len = 0; const unsigned char *dh_Ys = NULL; int dh_Ys_len = 0; if (has_ds_params) { DEBUG_PRINT(" dh_p: "); dh_res = _private_tls_parse_dh(&buf[res], buf_len - res, &dh_p, &dh_p_len); if (dh_res <= 0) return TLS_BROKEN_PACKET; res += dh_res; DEBUG_PRINT("\n"); DEBUG_PRINT(" dh_q: "); dh_res = _private_tls_parse_dh(&buf[res], buf_len - res, &dh_g, &dh_g_len); if (dh_res <= 0) return TLS_BROKEN_PACKET; res += dh_res; DEBUG_PRINT("\n"); DEBUG_PRINT(" dh_Ys: "); dh_res = _private_tls_parse_dh(&buf[res], buf_len - res, &dh_Ys, &dh_Ys_len); if (dh_res <= 0) return TLS_BROKEN_PACKET; res += dh_res; DEBUG_PRINT("\n"); } int sign_size; int hash_algorithm; int sign_algorithm; int packet_size = res - 3; if (context->dtls) packet_size -= 8; int offset = 0; DEBUG_PRINT(" SIGNATURE (%i/%i/%i): ", packet_size, dh_res, key_size); const unsigned char *signature = _private_tls_parse_signature(context, &buf[res], buf_len - res, &hash_algorithm, &sign_algorithm, &sign_size, &offset); DEBUG_PRINT("\n"); if ((sign_size <= 0) || (!signature)) return TLS_BROKEN_PACKET; res += offset; // check signature unsigned int message_len = packet_size + TLS_CLIENT_RANDOM_SIZE + TLS_SERVER_RANDOM_SIZE; unsigned char *message = (unsigned char *)TLS_MALLOC(message_len); if (message) { memcpy(message, context->local_random, TLS_CLIENT_RANDOM_SIZE); memcpy(message + TLS_CLIENT_RANDOM_SIZE, context->remote_random, TLS_SERVER_RANDOM_SIZE); memcpy(message + TLS_CLIENT_RANDOM_SIZE + TLS_SERVER_RANDOM_SIZE, packet_ref, packet_size); #ifdef TLS_CLIENT_ECDSA if (tls_is_ecdsa(context)) { if (_private_tls_verify_ecdsa(context, hash_algorithm, signature, sign_size, message, message_len, NULL) != 1) { DEBUG_PRINT("ECC Server signature FAILED!\n"); TLS_FREE(message); return TLS_BROKEN_PACKET; } } else #endif { if (_private_tls_verify_rsa(context, hash_algorithm, signature, sign_size, message, message_len) != 1) { DEBUG_PRINT("Server signature FAILED!\n"); TLS_FREE(message); return TLS_BROKEN_PACKET; } } TLS_FREE(message); } if (buf_len - res) { DEBUG_PRINT("EXTRA %i BYTES AT THE END OF MESSAGE\n", buf_len - res); DEBUG_DUMP_HEX(&buf[res], buf_len - res); DEBUG_PRINT("\n"); } #ifdef TLS_FORWARD_SECRECY if (ephemeral == 1) { _private_tls_dhe_create(context); DEBUG_DUMP_HEX_LABEL("DHP", dh_p, dh_p_len); DEBUG_DUMP_HEX_LABEL("DHG", dh_g, dh_g_len); int dhe_key_size = dh_p_len; if (dh_g_len > dh_p_len) dhe_key_size = dh_g_len; if (_private_tls_dh_make_key(dhe_key_size, context->dhe, (const char *)dh_p, (const char *)dh_g, dh_p_len, dh_g_len)) { DEBUG_PRINT("ERROR CREATING DHE KEY\n"); TLS_FREE(context->dhe); context->dhe = NULL; return TLS_GENERIC_ERROR; } unsigned int dh_key_size = 0; unsigned char *key = _private_tls_decrypt_dhe(context, dh_Ys, dh_Ys_len, &dh_key_size, 0); DEBUG_DUMP_HEX_LABEL("DH COMMON SECRET", key, dh_key_size); if ((key) && (dh_key_size)) { TLS_FREE(context->premaster_key); context->premaster_key = key; context->premaster_key_len = dh_key_size; } } else if ((ephemeral == 2) && (curve) && (pk_key) && (key_size)) { #ifdef TLS_CURVE25519 if (curve == &x25519) { if (key_size != 32) { DEBUG_PRINT("INVALID X25519 PUBLIC SIZE"); return TLS_GENERIC_ERROR; } TLS_FREE(context->client_secret); context->client_secret = (unsigned char *)TLS_MALLOC(32); if (!context->client_secret) { DEBUG_PRINT("ERROR IN TLS_MALLOC"); return TLS_GENERIC_ERROR; } tls_random(context->client_secret, 32); context->client_secret[0] &= 248; context->client_secret[31] &= 127; context->client_secret[31] |= 64; TLS_FREE(context->premaster_key); context->premaster_key = (unsigned char *)TLS_MALLOC(32); if (!context->premaster_key) return TLS_GENERIC_ERROR; curve25519(context->premaster_key, context->client_secret, pk_key); context->premaster_key_len = 32; } else #endif { tls_init(); _private_tls_ecc_dhe_create(context); ltc_ecc_set_type *dp = (ltc_ecc_set_type *)&curve->dp; if (ecc_make_key_ex(NULL, find_prng("sprng"), context->ecc_dhe, dp)) { TLS_FREE(context->ecc_dhe); context->ecc_dhe = NULL; DEBUG_PRINT("Error generating ECC key\n"); return TLS_GENERIC_ERROR; } TLS_FREE(context->premaster_key); context->premaster_key_len = 0; unsigned int out_len = 0; context->premaster_key = _private_tls_decrypt_ecc_dhe(context, pk_key, key_size, &out_len, 0); if (context->premaster_key) context->premaster_key_len = out_len; } } #endif return res; } int tls_parse_client_key_exchange(struct TLSContext *context, const unsigned char *buf, int buf_len) { if (context->connection_status != 1) { DEBUG_PRINT("UNEXPECTED CLIENT KEY EXCHANGE MESSAGE (connections status: %i)\n", (int)context->connection_status); return TLS_UNEXPECTED_MESSAGE; } int res = 0; int dh_res = 0; CHECK_SIZE(3, buf_len, TLS_NEED_MORE_DATA) unsigned int size = buf[0] * 0x10000 + buf[1] * 0x100 + buf[2]; res += 3; if (context->dtls) { int dtls_check = _private_dtls_check_packet(buf, buf_len); if (dtls_check < 0) return dtls_check; res += 8; } CHECK_SIZE(size, buf_len - res, TLS_NEED_MORE_DATA); if (!size) return res; dh_res = _private_tls_parse_random(context, &buf[res], size); if (dh_res <= 0) { DEBUG_PRINT("broken key\n"); return TLS_BROKEN_PACKET; } DEBUG_PRINT("\n"); res += size; context->connection_status = 2; return res; } int tls_parse_server_hello_done(struct TLSContext *context, const unsigned char *buf, int buf_len) { int res = 0; CHECK_SIZE(3, buf_len, TLS_NEED_MORE_DATA) unsigned int size = buf[0] * 0x10000 + buf[1] * 0x100 + buf[2]; res += 3; if (context->dtls) { int dtls_check = _private_dtls_check_packet(buf, buf_len); if (dtls_check < 0) return dtls_check; res += 8; } CHECK_SIZE(size, buf_len - res, TLS_NEED_MORE_DATA); res += size; return res; } int tls_parse_finished(struct TLSContext *context, const unsigned char *buf, int buf_len, unsigned int *write_packets) { if ((context->connection_status < 2) || (context->connection_status == 0xFF)) { DEBUG_PRINT("UNEXPECTED FINISHED MESSAGE\n"); return TLS_UNEXPECTED_MESSAGE; } int res = 0; *write_packets = 0; CHECK_SIZE(3, buf_len, TLS_NEED_MORE_DATA) unsigned int size = buf[0] * 0x10000 + buf[1] * 0x100 + buf[2]; res += 3; if (context->dtls) { int dtls_check = _private_dtls_check_packet(buf, buf_len); if (dtls_check < 0) return dtls_check; res += 8; } if (size < TLS_MIN_FINISHED_OPAQUE_LEN) { DEBUG_PRINT("Invalid finished pachet size: %i\n", size); return TLS_BROKEN_PACKET; } CHECK_SIZE(size, buf_len - res, TLS_NEED_MORE_DATA); unsigned char hash[TLS_MAX_SHA_SIZE]; unsigned int hash_len = _private_tls_get_hash(context, hash); #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { unsigned char hash_out[TLS_MAX_SHA_SIZE]; unsigned long out_size = TLS_MAX_SHA_SIZE; if ((!context->remote_finished_key) || (!hash_len)) { DEBUG_PRINT("NO FINISHED KEY COMPUTED OR NO HANDSHAKE HASH\n"); return TLS_NOT_VERIFIED; } DEBUG_DUMP_HEX_LABEL("HS HASH", hash, hash_len); DEBUG_DUMP_HEX_LABEL("HS FINISH", context->finished_key, hash_len); DEBUG_DUMP_HEX_LABEL("HS REMOTE FINISH", context->remote_finished_key, hash_len); out_size = hash_len; hmac_state hmac; hmac_init(&hmac, _private_tls_get_hash_idx(context), context->remote_finished_key, hash_len); hmac_process(&hmac, hash, hash_len); hmac_done(&hmac, hash_out, &out_size); if ((size != out_size) || (memcmp(hash_out, &buf[res], size))) { DEBUG_PRINT("Finished validation error (sequence number, local: %i, remote: %i)\n", (int)context->local_sequence_number, (int)context->remote_sequence_number); DEBUG_DUMP_HEX_LABEL("FINISHED OPAQUE", &buf[res], size); DEBUG_DUMP_HEX_LABEL("VERIFY", hash_out, out_size); return TLS_NOT_VERIFIED; } if (context->is_server) { context->connection_status = 0xFF; res += size; _private_tls13_key(context, 0); context->local_sequence_number = 0; context->remote_sequence_number = 0; return res; } } else #endif { // verify unsigned char *out = (unsigned char *)TLS_MALLOC(size); if (!out) { DEBUG_PRINT("Error in TLS_MALLOC (%i bytes)\n", (int)size); return TLS_NO_MEMORY; } // server verifies client's message if (context->is_server) _private_tls_prf(context, out, size, context->master_key, context->master_key_len, (unsigned char *)"client finished", 15, hash, hash_len, NULL, 0); else _private_tls_prf(context, out, size, context->master_key, context->master_key_len, (unsigned char *)"server finished", 15, hash, hash_len, NULL, 0); if (memcmp(out, &buf[res], size)) { TLS_FREE(out); DEBUG_PRINT("Finished validation error (sequence number, local: %i, remote: %i)\n", (int)context->local_sequence_number, (int)context->remote_sequence_number); DEBUG_DUMP_HEX_LABEL("FINISHED OPAQUE", &buf[res], size); DEBUG_DUMP_HEX_LABEL("VERIFY", out, size); return TLS_NOT_VERIFIED; } #ifdef TLS_ACCEPT_SECURE_RENEGOTIATION if (size) { if (context->is_server) { TLS_FREE(context->verify_data); context->verify_data = (unsigned char *)TLS_MALLOC(size); if (context->verify_data) { memcpy(context->verify_data, out, size); context->verify_len = size; } } else { // concatenate client verify and server verify context->verify_data = (unsigned char *)TLS_REALLOC(context->verify_data, size); if (context->verify_data) { memcpy(context->verify_data + context->verify_len, out, size); context->verify_len += size; } else context->verify_len = 0; } } #endif TLS_FREE(out); } if (context->is_server) *write_packets = 3; else context->connection_status = 0xFF; res += size; return res; } #ifdef WITH_TLS_13 int tls_parse_verify_tls13(struct TLSContext *context, const unsigned char *buf, int buf_len) { CHECK_SIZE(7, buf_len, TLS_NEED_MORE_DATA) unsigned int size = buf[0] * 0x10000 + buf[1] * 0x100 + buf[2]; if (size < 2) return buf_len; unsigned char signing_data[TLS_MAX_HASH_SIZE + 98]; int signing_data_len; // first 64 bytes to 0x20 (32) memset(signing_data, 0x20, 64); // context string 33 bytes if (context->is_server) memcpy(signing_data + 64, "TLS 1.3, server CertificateVerify", 33); else memcpy(signing_data + 64, "TLS 1.3, client CertificateVerify", 33); // a single 0 byte separator signing_data[97] = 0; signing_data_len = 98; signing_data_len += _private_tls_get_hash(context, signing_data + 98); DEBUG_DUMP_HEX_LABEL("signature data", signing_data, signing_data_len); unsigned short signature = ntohs(*(unsigned short *)&buf[3]); unsigned short signature_size = ntohs(*(unsigned short *)&buf[5]); int valid = 0; CHECK_SIZE(7 + signature_size, buf_len, TLS_NEED_MORE_DATA) switch (signature) { #ifdef TLS_ECDSA_SUPPORTED case 0x0403: // secp256r1 + sha256 valid = _private_tls_verify_ecdsa(context, sha256, buf + 7, signature_size, signing_data, signing_data_len, &secp256r1); break; case 0x0503: // secp384r1 + sha384 valid = _private_tls_verify_ecdsa(context, sha384, buf + 7, signature_size, signing_data, signing_data_len, &secp384r1); break; case 0x0603: // secp521r1 + sha512 valid = _private_tls_verify_ecdsa(context, sha512, buf + 7, signature_size, signing_data, signing_data_len, &secp521r1); break; #endif case 0x0804: valid = _private_tls_verify_rsa(context, sha256, buf + 7, signature_size, signing_data, signing_data_len); break; default: DEBUG_PRINT("Unsupported signature: %x\n", (int)signature); return TLS_UNSUPPORTED_CERTIFICATE; } if (valid != 1) { DEBUG_PRINT("Signature FAILED!\n"); return TLS_DECRYPTION_FAILED; } return buf_len; } #endif int tls_parse_verify(struct TLSContext *context, const unsigned char *buf, int buf_len) { #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) return tls_parse_verify_tls13(context, buf, buf_len); #endif CHECK_SIZE(7, buf_len, TLS_BAD_CERTIFICATE) unsigned int bytes_to_follow = buf[0] * 0x10000 + buf[1] * 0x100 + buf[2]; CHECK_SIZE(bytes_to_follow, buf_len - 3, TLS_BAD_CERTIFICATE) int res = -1; if ((context->version == TLS_V12) || (context->version == DTLS_V12) || (context->version == TLS_V13) || (context->version == DTLS_V13)) { unsigned int hash = buf[3]; unsigned int algorithm = buf[4]; if (algorithm != rsa) return TLS_UNSUPPORTED_CERTIFICATE; unsigned short size = ntohs(*(unsigned short *)&buf[5]); CHECK_SIZE(size, bytes_to_follow - 4, TLS_BAD_CERTIFICATE) DEBUG_PRINT("ALGORITHM %i/%i (%i)\n", hash, algorithm, (int)size); DEBUG_DUMP_HEX_LABEL("VERIFY", &buf[7], bytes_to_follow - 7); res = _private_tls_verify_rsa(context, hash, &buf[7], size, context->cached_handshake, context->cached_handshake_len); } else { #ifdef TLS_LEGACY_SUPPORT unsigned short size = ntohs(*(unsigned short *)&buf[3]); CHECK_SIZE(size, bytes_to_follow - 2, TLS_BAD_CERTIFICATE) res = _private_tls_verify_rsa(context, md5, &buf[5], size, context->cached_handshake, context->cached_handshake_len); #endif } if (context->cached_handshake) { // not needed anymore TLS_FREE(context->cached_handshake); context->cached_handshake = NULL; context->cached_handshake_len = 0; } if (res == 1) { DEBUG_PRINT("Signature OK\n"); context->client_verified = 1; } else { DEBUG_PRINT("Signature FAILED\n"); context->client_verified = 0; } return 1; } int tls_parse_payload(struct TLSContext *context, const unsigned char *buf, int buf_len, tls_validation_function certificate_verify) { int orig_len = buf_len; if (context->connection_status == 0xFF) { #ifndef TLS_ACCEPT_SECURE_RENEGOTIATION // renegotiation disabled (emit warning alert) _private_tls_write_packet(tls_build_alert(context, 0, no_renegotiation)); return 1; #endif } while ((buf_len >= 4) && (!context->critical_error)) { int payload_res = 0; unsigned char update_hash = 1; CHECK_SIZE(1, buf_len, TLS_NEED_MORE_DATA) unsigned char type = buf[0]; unsigned int write_packets = 0; unsigned int dtls_cookie_verified = 0; int certificate_verify_alert = no_error; unsigned int payload_size = buf[1] * 0x10000 + buf[2] * 0x100 + buf[3] + 3; if (context->dtls) payload_size += 8; CHECK_SIZE(payload_size + 1, buf_len, TLS_NEED_MORE_DATA) switch (type) { // hello request case 0x00: CHECK_HANDSHAKE_STATE(context, 0, 1); DEBUG_PRINT(" => HELLO REQUEST (RENEGOTIATION?)\n"); if (context->dtls) context->dtls_seq = 0; if (context->is_server) payload_res = TLS_UNEXPECTED_MESSAGE; else { if (context->connection_status == 0xFF) { // renegotiation #ifdef TLS_ACCEPT_SECURE_RENEGOTIATION if (context->critical_error) payload_res = TLS_UNEXPECTED_MESSAGE; else { _private_tls_reset_context(context); _private_tls_write_packet(tls_build_hello(context, 0)); return 1; } #else payload_res = TLS_NO_RENEGOTIATION; #endif } else payload_res = TLS_UNEXPECTED_MESSAGE; } // no payload break; // client hello case 0x01: CHECK_HANDSHAKE_STATE(context, 1, (context->dtls ? 2 : 1)); DEBUG_PRINT(" => CLIENT HELLO\n"); if (context->is_server) { payload_res = tls_parse_hello(context, buf + 1, payload_size, &write_packets, &dtls_cookie_verified); DEBUG_PRINT(" => DTLS COOKIE VERIFIED: %i (%i)\n", dtls_cookie_verified, payload_res); if ((context->dtls) && (payload_res > 0) && (!dtls_cookie_verified) && (context->connection_status == 1)) { // wait client hello context->connection_status = 3; update_hash = 0; } } else payload_res = TLS_UNEXPECTED_MESSAGE; break; // server hello case 0x02: CHECK_HANDSHAKE_STATE(context, 2, 1); DEBUG_PRINT(" => SERVER HELLO\n"); if (context->is_server) payload_res = TLS_UNEXPECTED_MESSAGE; else payload_res = tls_parse_hello(context, buf + 1, payload_size, &write_packets, &dtls_cookie_verified); break; // hello verify request case 0x03: DEBUG_PRINT(" => VERIFY REQUEST\n"); CHECK_HANDSHAKE_STATE(context, 3, 1); if ((context->dtls) && (!context->is_server)) { payload_res = tls_parse_verify_request(context, buf + 1, payload_size, &write_packets); update_hash = 0; } else payload_res = TLS_UNEXPECTED_MESSAGE; break; // certificate case 0x0B: CHECK_HANDSHAKE_STATE(context, 4, 1); DEBUG_PRINT(" => CERTIFICATE\n"); #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { if (context->connection_status == 2) { payload_res = tls_parse_certificate(context, buf + 1, payload_size, context->is_server); if (context->is_server) { if ((certificate_verify) && (context->client_certificates_count)) certificate_verify_alert = certificate_verify(context, context->client_certificates, context->client_certificates_count); // empty certificates are permitted for client if (payload_res <= 0) payload_res = 1; } else { if ((certificate_verify) && (context->certificates_count)) certificate_verify_alert = certificate_verify(context, context->certificates, context->certificates_count); } } else payload_res = TLS_UNEXPECTED_MESSAGE; } else #endif if (context->connection_status == 1) { if (context->is_server) { // client certificate payload_res = tls_parse_certificate(context, buf + 1, payload_size, 1); if ((certificate_verify) && (context->client_certificates_count)) certificate_verify_alert = certificate_verify(context, context->client_certificates, context->client_certificates_count); // empty certificates are permitted for client if (payload_res <= 0) payload_res = 1; } else { payload_res = tls_parse_certificate(context, buf + 1, payload_size, 0); if ((certificate_verify) && (context->certificates_count)) certificate_verify_alert = certificate_verify(context, context->certificates, context->certificates_count); } } else payload_res = TLS_UNEXPECTED_MESSAGE; break; // server key exchange case 0x0C: CHECK_HANDSHAKE_STATE(context, 5, 1); DEBUG_PRINT(" => SERVER KEY EXCHANGE\n"); if (context->is_server) payload_res = TLS_UNEXPECTED_MESSAGE; else payload_res = tls_parse_server_key_exchange(context, buf + 1, payload_size); break; // certificate request case 0x0D: CHECK_HANDSHAKE_STATE(context, 6, 1); // server to client if (context->is_server) payload_res = TLS_UNEXPECTED_MESSAGE; else context->client_verified = 2; DEBUG_PRINT(" => CERTIFICATE REQUEST\n"); break; // server hello done case 0x0E: CHECK_HANDSHAKE_STATE(context, 7, 1); DEBUG_PRINT(" => SERVER HELLO DONE\n"); if (context->is_server) { payload_res = TLS_UNEXPECTED_MESSAGE; } else { payload_res = tls_parse_server_hello_done(context, buf + 1, payload_size); if (payload_res > 0) write_packets = 1; } break; // certificate verify case 0x0F: CHECK_HANDSHAKE_STATE(context, 8, 1); DEBUG_PRINT(" => CERTIFICATE VERIFY\n"); if (context->connection_status == 2) payload_res = tls_parse_verify(context, buf + 1, payload_size); else payload_res = TLS_UNEXPECTED_MESSAGE; break; // client key exchange case 0x10: CHECK_HANDSHAKE_STATE(context, 9, 1); DEBUG_PRINT(" => CLIENT KEY EXCHANGE\n"); if (context->is_server) payload_res = tls_parse_client_key_exchange(context, buf + 1, payload_size); else payload_res = TLS_UNEXPECTED_MESSAGE; break; // finished case 0x14: if (context->cached_handshake) { TLS_FREE(context->cached_handshake); context->cached_handshake = NULL; context->cached_handshake_len = 0; } CHECK_HANDSHAKE_STATE(context, 10, 1); DEBUG_PRINT(" => FINISHED\n"); payload_res = tls_parse_finished(context, buf + 1, payload_size, &write_packets); if (payload_res > 0) memset(context->hs_messages, 0, sizeof(context->hs_messages)); #ifdef WITH_TLS_13 if ((!context->is_server) && ((context->version == TLS_V13) || (context->version == DTLS_V13))) { update_hash = 0; DEBUG_PRINT("<= SENDING FINISHED\n"); _private_tls_update_hash(context, buf, payload_size + 1); _private_tls_write_packet(tls_build_finished(context)); _private_tls13_key(context, 0); context->connection_status = 0xFF; context->local_sequence_number = 0; context->remote_sequence_number = 0; } #endif break; #ifdef WITH_TLS_13 case 0x08: // encrypted extensions ... ignore it for now break; #endif default: DEBUG_PRINT(" => NOT UNDERSTOOD PAYLOAD TYPE: %x\n", (int)type); return TLS_NOT_UNDERSTOOD; } if ((type != 0x00) && (update_hash)) _private_tls_update_hash(context, buf, payload_size + 1); if (certificate_verify_alert != no_error) { _private_tls_write_packet(tls_build_alert(context, 1, certificate_verify_alert)); context->critical_error = 1; } if (payload_res < 0) { switch (payload_res) { case TLS_UNEXPECTED_MESSAGE: _private_tls_write_packet(tls_build_alert(context, 1, unexpected_message)); break; case TLS_COMPRESSION_NOT_SUPPORTED: _private_tls_write_packet(tls_build_alert(context, 1, decompression_failure)); break; case TLS_BROKEN_PACKET: _private_tls_write_packet(tls_build_alert(context, 1, decode_error)); break; case TLS_NO_MEMORY: _private_tls_write_packet(tls_build_alert(context, 1, internal_error)); break; case TLS_NOT_VERIFIED: _private_tls_write_packet(tls_build_alert(context, 1, bad_record_mac)); break; case TLS_BAD_CERTIFICATE: if (context->is_server) { // bad client certificate, continue _private_tls_write_packet(tls_build_alert(context, 0, bad_certificate)); payload_res = 0; } else _private_tls_write_packet(tls_build_alert(context, 1, bad_certificate)); break; case TLS_UNSUPPORTED_CERTIFICATE: _private_tls_write_packet(tls_build_alert(context, 1, unsupported_certificate)); break; case TLS_NO_COMMON_CIPHER: _private_tls_write_packet(tls_build_alert(context, 1, insufficient_security)); break; case TLS_NOT_UNDERSTOOD: _private_tls_write_packet(tls_build_alert(context, 1, internal_error)); break; case TLS_NO_RENEGOTIATION: _private_tls_write_packet(tls_build_alert(context, 0, no_renegotiation)); payload_res = 0; break; case TLS_DECRYPTION_FAILED: _private_tls_write_packet(tls_build_alert(context, 1, decryption_failed_RESERVED)); break; } if (payload_res < 0) return payload_res; } if (certificate_verify_alert != no_error) payload_res = TLS_BAD_CERTIFICATE; // except renegotiation switch (write_packets) { case 1: if (context->client_verified == 2) { DEBUG_PRINT("<= Building CERTIFICATE \n"); _private_tls_write_packet(tls_build_certificate(context)); context->client_verified = 0; } // client handshake DEBUG_PRINT("<= Building KEY EXCHANGE\n"); _private_tls_write_packet(tls_build_client_key_exchange(context)); DEBUG_PRINT("<= Building CHANGE CIPHER SPEC\n"); _private_tls_write_packet(tls_build_change_cipher_spec(context)); context->cipher_spec_set = 1; context->local_sequence_number = 0; DEBUG_PRINT("<= Building CLIENT FINISHED\n"); _private_tls_write_packet(tls_build_finished(context)); context->cipher_spec_set = 0; #ifdef TLS_12_FALSE_START if ((!context->is_server) && (context->version == TLS_V12)) { // https://tools.ietf.org/html/rfc7918 // 5.1. Symmetric Cipher // Clients MUST NOT use the False Start protocol modification in a // handshake unless the cipher suite uses a symmetric cipher that is // considered cryptographically strong. switch (context->cipher) { case TLS_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: case TLS_DHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_RSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384: case TLS_DHE_RSA_WITH_AES_256_GCM_SHA384: case TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384: context->false_start = 1; break; } } #endif break; case 2: // server handshake if ((context->dtls) && (dtls_cookie_verified == 0)) { _private_tls_write_packet(tls_build_verify_request(context)); _private_dtls_reset(context); } else { DEBUG_PRINT("<= SENDING SERVER HELLO\n"); #ifdef WITH_TLS_13 if (context->connection_status == 3) { context->connection_status = 2; _private_tls_write_packet(tls_build_hello(context, 0)); _private_tls_write_packet(tls_build_change_cipher_spec(context)); _private_tls13_key(context, 1); context->cipher_spec_set = 1; DEBUG_PRINT("<= SENDING ENCRYPTED EXTENSIONS\n"); _private_tls_write_packet(tls_build_encrypted_extensions(context)); if (context->request_client_certificate) { DEBUG_PRINT("<= SENDING CERTIFICATE REQUEST\n"); _private_tls_write_packet(tls_certificate_request(context)); } DEBUG_PRINT("<= SENDING CERTIFICATE\n"); _private_tls_write_packet(tls_build_certificate(context)); DEBUG_PRINT("<= SENDING CERTIFICATE VERIFY\n"); _private_tls_write_packet(tls_build_certificate_verify(context)); DEBUG_PRINT("<= SENDING FINISHED\n"); _private_tls_write_packet(tls_build_finished(context)); // new key TLS_FREE(context->server_finished_hash); context->server_finished_hash = (unsigned char *)TLS_MALLOC(_private_tls_mac_length(context)); if (context->server_finished_hash) _private_tls_get_hash(context, context->server_finished_hash); break; } #endif _private_tls_write_packet(tls_build_hello(context, 0)); DEBUG_PRINT("<= SENDING CERTIFICATE\n"); _private_tls_write_packet(tls_build_certificate(context)); int ephemeral_cipher = tls_cipher_is_ephemeral(context); if (ephemeral_cipher) { DEBUG_PRINT("<= SENDING EPHEMERAL DH KEY\n"); _private_tls_write_packet(tls_build_server_key_exchange(context, ephemeral_cipher == 1 ? KEA_dhe_rsa : KEA_ec_diffie_hellman)); } if (context->request_client_certificate) { DEBUG_PRINT("<= SENDING CERTIFICATE REQUEST\n"); _private_tls_write_packet(tls_certificate_request(context)); } DEBUG_PRINT("<= SENDING DONE\n"); _private_tls_write_packet(tls_build_done(context)); } break; case 3: // finished _private_tls_write_packet(tls_build_change_cipher_spec(context)); _private_tls_write_packet(tls_build_finished(context)); context->connection_status = 0xFF; break; case 4: // dtls only context->dtls_seq = 1; _private_tls_write_packet(tls_build_hello(context, 0)); break; #ifdef WITH_TLS_13 case 5: // hello retry request DEBUG_PRINT("<= SENDING HELLO RETRY REQUEST\n"); _private_tls_write_packet(tls_build_hello(context, 0)); break; #endif } payload_size++; buf += payload_size; buf_len -= payload_size; } return orig_len; } unsigned int _private_tls_hmac_message(unsigned char local, struct TLSContext *context, const unsigned char *buf, int buf_len, const unsigned char *buf2, int buf_len2, unsigned char *out, unsigned int outlen, uint64_t remote_sequence_number) { hmac_state hash; int mac_size = outlen; int hash_idx; if (mac_size == TLS_SHA1_MAC_SIZE) hash_idx = find_hash("sha1"); else if (mac_size == TLS_SHA384_MAC_SIZE) hash_idx = find_hash("sha384"); else hash_idx = find_hash("sha256"); if (hmac_init(&hash, hash_idx, local ? context->crypto.ctx_local_mac.local_mac : context->crypto.ctx_remote_mac.remote_mac, mac_size)) return 0; uint64_t squence_number; if (context->dtls) squence_number = htonll(remote_sequence_number); else if (local) squence_number = htonll(context->local_sequence_number); else squence_number = htonll(context->remote_sequence_number); if (hmac_process(&hash, (unsigned char *)&squence_number, sizeof(uint64_t))) return 0; if (hmac_process(&hash, buf, buf_len)) return 0; if ((buf2) && (buf_len2)) { if (hmac_process(&hash, buf2, buf_len2)) return 0; } unsigned long ref_outlen = outlen; if (hmac_done(&hash, out, &ref_outlen)) return 0; return (unsigned int)ref_outlen; } int tls_parse_message(struct TLSContext *context, unsigned char *buf, int buf_len, tls_validation_function certificate_verify) { int res = 5; if (context->dtls) res = 13; int header_size = res; int payload_res = 0; CHECK_SIZE(res, buf_len, TLS_NEED_MORE_DATA) unsigned char type = *buf; int buf_pos = 1; unsigned short version = ntohs(*(unsigned short *)&buf[buf_pos]); buf_pos += 2; uint64_t dtls_sequence_number = 0; if (context->dtls) { CHECK_SIZE(buf_pos + 8, buf_len, TLS_NEED_MORE_DATA) dtls_sequence_number = ntohll(*(uint64_t *)&buf[buf_pos]); buf_pos += 8; } VERSION_SUPPORTED(version, TLS_NOT_SAFE) unsigned short length; length = ntohs(*(unsigned short *)&buf[buf_pos]); buf_pos += 2; unsigned char *pt = NULL; const unsigned char *ptr = buf + buf_pos; CHECK_SIZE(buf_pos + length, buf_len, TLS_NEED_MORE_DATA) DEBUG_PRINT("Message type: %0x, length: %i\n", (int)type, (int)length); if ((context->cipher_spec_set) && (type != TLS_CHANGE_CIPHER)) { DEBUG_DUMP_HEX_LABEL("encrypted", &buf[header_size], length); if (!context->crypto.created) { DEBUG_PRINT("Encryption context not created\n"); _private_random_sleep(context, TLS_MAX_ERROR_SLEEP_uS); return TLS_BROKEN_PACKET; } pt = (unsigned char *)TLS_MALLOC(length); if (!pt) { DEBUG_PRINT("Error in TLS_MALLOC (%i bytes)\n", (int)length); _private_random_sleep(context, TLS_MAX_ERROR_SLEEP_uS); return TLS_NO_MEMORY; } unsigned char aad[16]; int aad_size = sizeof(aad); unsigned char *sequence = aad; if (context->crypto.created == 2) { int delta = 8; int pt_length; unsigned char iv[TLS_13_AES_GCM_IV_LENGTH]; gcm_reset(&context->crypto.ctx_remote.aes_gcm_remote); #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { aad[0] = TLS_APPLICATION_DATA; aad[1] = 0x03; aad[2] = 0x03; *((unsigned short *)(aad + 3)) = htons(buf_len - header_size); aad_size = 5; sequence = aad + 5; if (context->dtls) *((uint64_t *)sequence) = *(uint64_t *)(buf + 3); else *((uint64_t *)sequence) = htonll(context->remote_sequence_number); memcpy(iv, context->crypto.ctx_remote_mac.remote_iv, TLS_13_AES_GCM_IV_LENGTH); int i; int offset = TLS_13_AES_GCM_IV_LENGTH - 8; for (i = 0; i < 8; i++) iv[offset + i] = context->crypto.ctx_remote_mac.remote_iv[offset + i] ^ sequence[i]; pt_length = buf_len - header_size - TLS_GCM_TAG_LEN; delta = 0; } else { #endif aad_size = 13; pt_length = length - 8 - TLS_GCM_TAG_LEN; // build aad and iv if (context->dtls) *((uint64_t *)aad) = htonll(dtls_sequence_number); else *((uint64_t *)aad) = htonll(context->remote_sequence_number); aad[8] = buf[0]; aad[9] = buf[1]; aad[10] = buf[2]; memcpy(iv, context->crypto.ctx_remote_mac.remote_aead_iv, 4); memcpy(iv + 4, buf + header_size, 8); *((unsigned short *)(aad + 11)) = htons((unsigned short)pt_length); #ifdef WITH_TLS_13 } #endif if (pt_length < 0) { DEBUG_PRINT("Invalid packet length"); TLS_FREE(pt); _private_random_sleep(context, TLS_MAX_ERROR_SLEEP_uS); return TLS_BROKEN_PACKET; } DEBUG_DUMP_HEX_LABEL("aad", aad, aad_size); DEBUG_DUMP_HEX_LABEL("aad iv", iv, 12); int res0 = gcm_add_iv(&context->crypto.ctx_remote.aes_gcm_remote, iv, 12); int res1 = gcm_add_aad(&context->crypto.ctx_remote.aes_gcm_remote, aad, aad_size); memset(pt, 0, length); DEBUG_PRINT("PT SIZE: %i\n", pt_length); int res2 = gcm_process(&context->crypto.ctx_remote.aes_gcm_remote, pt, pt_length, buf + header_size + delta, GCM_DECRYPT); unsigned char tag[32]; unsigned long taglen = 32; int res3 = gcm_done(&context->crypto.ctx_remote.aes_gcm_remote, tag, &taglen); if ((res0) || (res1) || (res2) || (res3) || (taglen != TLS_GCM_TAG_LEN)) { DEBUG_PRINT("ERROR: gcm_add_iv: %i, gcm_add_aad: %i, gcm_process: %i, gcm_done: %i\n", res0, res1, res2, res3); _private_random_sleep(context, TLS_MAX_ERROR_SLEEP_uS); return TLS_BROKEN_PACKET; } DEBUG_DUMP_HEX_LABEL("decrypted", pt, pt_length); DEBUG_DUMP_HEX_LABEL("tag", tag, taglen); // check tag if (memcmp(buf + header_size + delta + pt_length, tag, taglen)) { DEBUG_PRINT("INTEGRITY CHECK FAILED (msg length %i)\n", pt_length); DEBUG_DUMP_HEX_LABEL("TAG RECEIVED", buf + header_size + delta + pt_length, taglen); DEBUG_DUMP_HEX_LABEL("TAG COMPUTED", tag, taglen); TLS_FREE(pt); _private_random_sleep(context, TLS_MAX_ERROR_SLEEP_uS); _private_tls_write_packet(tls_build_alert(context, 1, bad_record_mac)); return TLS_INTEGRITY_FAILED; } ptr = pt; length = (unsigned short)pt_length; #ifdef TLS_WITH_CHACHA20_POLY1305 } else if (context->crypto.created == 3) { int pt_length = length - POLY1305_TAGLEN; unsigned int counter = 1; unsigned char poly1305_key[POLY1305_KEYLEN]; unsigned char trail[16]; unsigned char mac_tag[POLY1305_TAGLEN]; aad_size = 16; if (pt_length < 0) { DEBUG_PRINT("Invalid packet length"); TLS_FREE(pt); _private_random_sleep(context, TLS_MAX_ERROR_SLEEP_uS); return TLS_BROKEN_PACKET; } #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { aad[0] = TLS_APPLICATION_DATA; aad[1] = 0x03; aad[2] = 0x03; *((unsigned short *)(aad + 3)) = htons(buf_len - header_size); aad_size = 5; sequence = aad + 5; if (context->dtls) *((uint64_t *)sequence) = *(uint64_t *)(buf + 3); else *((uint64_t *)sequence) = htonll(context->remote_sequence_number); } else { #endif if (context->dtls) *((uint64_t *)aad) = htonll(dtls_sequence_number); else *((uint64_t *)aad) = htonll(context->remote_sequence_number); aad[8] = buf[0]; aad[9] = buf[1]; aad[10] = buf[2]; *((unsigned short *)(aad + 11)) = htons((unsigned short)pt_length); aad[13] = 0; aad[14] = 0; aad[15] = 0; #ifdef WITH_TLS_13 } #endif chacha_ivupdate(&context->crypto.ctx_remote.chacha_remote, context->crypto.ctx_remote_mac.remote_aead_iv, sequence, (unsigned char *)&counter); chacha_encrypt_bytes(&context->crypto.ctx_remote.chacha_remote, buf + header_size, pt, pt_length); DEBUG_DUMP_HEX_LABEL("decrypted", pt, pt_length); ptr = pt; length = (unsigned short)pt_length; chacha20_poly1305_key(&context->crypto.ctx_remote.chacha_remote, poly1305_key); poly1305_context ctx; _private_tls_poly1305_init(&ctx, poly1305_key); _private_tls_poly1305_update(&ctx, aad, aad_size); static unsigned char zeropad[] = {0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0}; int rem = aad_size % 16; if (rem) _private_tls_poly1305_update(&ctx, zeropad, 16 - rem); _private_tls_poly1305_update(&ctx, buf + header_size, pt_length); rem = pt_length % 16; if (rem) _private_tls_poly1305_update(&ctx, zeropad, 16 - rem); _private_tls_U32TO8(&trail[0], aad_size == 5 ? 5 : 13); *(int *)&trail[4] = 0; _private_tls_U32TO8(&trail[8], pt_length); *(int *)&trail[12] = 0; _private_tls_poly1305_update(&ctx, trail, 16); _private_tls_poly1305_finish(&ctx, mac_tag); if (memcmp(mac_tag, buf + header_size + pt_length, POLY1305_TAGLEN)) { DEBUG_PRINT("INTEGRITY CHECK FAILED (msg length %i)\n", length); DEBUG_DUMP_HEX_LABEL("POLY1305 TAG RECEIVED", buf + header_size + pt_length, POLY1305_TAGLEN); DEBUG_DUMP_HEX_LABEL("POLY1305 TAG COMPUTED", mac_tag, POLY1305_TAGLEN); TLS_FREE(pt); // silently ignore packet for DTLS if (context->dtls) return header_size + length; _private_random_sleep(context, TLS_MAX_ERROR_SLEEP_uS); _private_tls_write_packet(tls_build_alert(context, 1, bad_record_mac)); return TLS_INTEGRITY_FAILED; } #endif } else { int err = _private_tls_crypto_decrypt(context, buf + header_size, pt, length); if (err) { TLS_FREE(pt); DEBUG_PRINT("Decryption error %i\n", (int)err); _private_random_sleep(context, TLS_MAX_ERROR_SLEEP_uS); return TLS_BROKEN_PACKET; } unsigned char padding_byte = pt[length - 1]; unsigned char padding = padding_byte + 1; // poodle check int padding_index = length - padding; if (padding_index > 0) { int i; int limit = length - 1; for (i = length - padding; i < limit; i++) { if (pt[i] != padding_byte) { TLS_FREE(pt); DEBUG_PRINT("BROKEN PACKET (POODLE ?)\n"); _private_random_sleep(context, TLS_MAX_ERROR_SLEEP_uS); _private_tls_write_packet(tls_build_alert(context, 1, decrypt_error)); return TLS_BROKEN_PACKET; } } } unsigned int decrypted_length = length; if (padding < decrypted_length) decrypted_length -= padding; DEBUG_DUMP_HEX_LABEL("decrypted", pt, decrypted_length); ptr = pt; #ifdef TLS_LEGACY_SUPPORT if ((context->version != TLS_V10) && (decrypted_length > TLS_AES_IV_LENGTH)) { decrypted_length -= TLS_AES_IV_LENGTH; ptr += TLS_AES_IV_LENGTH; } #else if (decrypted_length > TLS_AES_IV_LENGTH) { decrypted_length -= TLS_AES_IV_LENGTH; ptr += TLS_AES_IV_LENGTH; } #endif length = decrypted_length; unsigned int mac_size = _private_tls_mac_length(context); if ((length < mac_size) || (!mac_size)) { TLS_FREE(pt); DEBUG_PRINT("BROKEN PACKET\n"); _private_random_sleep(context, TLS_MAX_ERROR_SLEEP_uS); _private_tls_write_packet(tls_build_alert(context, 1, decrypt_error)); return TLS_BROKEN_PACKET; } length -= mac_size; const unsigned char *message_hmac = &ptr[length]; unsigned char hmac_out[TLS_MAX_MAC_SIZE]; unsigned char temp_buf[5]; memcpy(temp_buf, buf, 3); *(unsigned short *)(temp_buf + 3) = htons(length); unsigned int hmac_out_len = _private_tls_hmac_message(0, context, temp_buf, 5, ptr, length, hmac_out, mac_size, dtls_sequence_number); if ((hmac_out_len != mac_size) || (memcmp(message_hmac, hmac_out, mac_size))) { DEBUG_PRINT("INTEGRITY CHECK FAILED (msg length %i)\n", length); DEBUG_DUMP_HEX_LABEL("HMAC RECEIVED", message_hmac, mac_size); DEBUG_DUMP_HEX_LABEL("HMAC COMPUTED", hmac_out, hmac_out_len); TLS_FREE(pt); // silently ignore packet for DTLS if (context->dtls) return header_size + length; _private_random_sleep(context, TLS_MAX_ERROR_SLEEP_uS); _private_tls_write_packet(tls_build_alert(context, 1, bad_record_mac)); return TLS_INTEGRITY_FAILED; } } } context->remote_sequence_number++; #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { if (/*(context->connection_status == 2) && */(type == TLS_APPLICATION_DATA) && (context->crypto.created)) { do { length--; type = ptr[length]; } while (!type); } } #endif switch (type) { // application data case TLS_APPLICATION_DATA: if (context->connection_status != 0xFF) { DEBUG_PRINT("UNEXPECTED APPLICATION DATA MESSAGE\n"); payload_res = TLS_UNEXPECTED_MESSAGE; _private_tls_write_packet(tls_build_alert(context, 1, unexpected_message)); } else { DEBUG_PRINT("APPLICATION DATA MESSAGE (TLS VERSION: %x):\n", (int)context->version); DEBUG_DUMP(ptr, length); DEBUG_PRINT("\n"); _private_tls_write_app_data(context, ptr, length); } break; // handshake case TLS_HANDSHAKE: DEBUG_PRINT("HANDSHAKE MESSAGE\n"); payload_res = tls_parse_payload(context, ptr, length, certificate_verify); break; // change cipher spec case TLS_CHANGE_CIPHER: context->dtls_epoch_remote++; if (context->connection_status != 2) { #ifdef WITH_TLS_13 if (context->connection_status == 4) { DEBUG_PRINT("IGNORING CHANGE CIPHER SPEC MESSAGE (HELLO RETRY REQUEST)\n"); break; } #endif DEBUG_PRINT("UNEXPECTED CHANGE CIPHER SPEC MESSAGE (%i)\n", context->connection_status); _private_tls_write_packet(tls_build_alert(context, 1, unexpected_message)); payload_res = TLS_UNEXPECTED_MESSAGE; } else { DEBUG_PRINT("CHANGE CIPHER SPEC MESSAGE\n"); context->cipher_spec_set = 1; // reset sequence numbers context->remote_sequence_number = 0; } #ifdef WITH_TLS_13 if (!context->is_server) _private_tls13_key(context, 1); #endif break; // alert case TLS_ALERT: DEBUG_PRINT("ALERT MESSAGE\n"); if (length >= 2) { DEBUG_DUMP_HEX(ptr, length); int level = ptr[0]; int code = ptr[1]; if (level == TLS_ALERT_CRITICAL) { context->critical_error = 1; res = TLS_ERROR_ALERT; } context->error_code = code; } break; default: DEBUG_PRINT("NOT UNDERSTOOD MESSAGE TYPE: %x\n", (int)type); TLS_FREE(pt); return TLS_NOT_UNDERSTOOD; } TLS_FREE(pt); if (payload_res < 0) return payload_res; if (res > 0) return header_size + length; return res; } unsigned int asn1_get_len(const unsigned char *buffer, int buf_len, unsigned int *octets) { *octets = 0; if (buf_len < 1) return 0; unsigned char size = buffer[0]; int i; if (size & 0x80) { *octets = size & 0x7F; if ((int)*octets > buf_len - 1) return 0; // max 32 bits unsigned int ref_octets = *octets; if (*octets > 4) ref_octets = 4; if ((int)*octets > buf_len -1) return 0; unsigned int long_size = 0; unsigned int coef = 1; for (i = ref_octets; i > 0; i--) { long_size += buffer[i] * coef; coef *= 0x100; } ++*octets; return long_size; } ++*octets; return size; } void print_index(const unsigned int *fields) { int i = 0; while (fields[i]) { if (i) DEBUG_PRINT("."); DEBUG_PRINT("%i", fields[i]); i++; } while (i < 6) { DEBUG_PRINT(" "); i++; } } int _is_field(const unsigned int *fields, const unsigned int *prefix) { int i = 0; while (prefix[i]) { if (fields[i] != prefix[i]) return 0; i++; } return 1; } int _private_tls_hash_len(int algorithm) { switch (algorithm) { case TLS_RSA_SIGN_MD5: return 16; case TLS_RSA_SIGN_SHA1: return 20; case TLS_RSA_SIGN_SHA256: case TLS_ECDSA_SIGN_SHA256: return 32; case TLS_RSA_SIGN_SHA384: return 48; case TLS_RSA_SIGN_SHA512: return 64; } return 0; } unsigned char *_private_tls_compute_hash(int algorithm, const unsigned char *message, unsigned int message_len) { unsigned char *hash = NULL; if ((!message) || (!message_len)) return hash; int err; hash_state state; switch (algorithm) { case TLS_RSA_SIGN_MD5: DEBUG_PRINT("SIGN MD5\n"); hash = (unsigned char *)TLS_MALLOC(16); if (!hash) return NULL; err = md5_init(&state); if (!err) { err = md5_process(&state, message, message_len); if (!err) err = md5_done(&state, hash); } break; case TLS_RSA_SIGN_SHA1: DEBUG_PRINT("SIGN SHA1\n"); hash = (unsigned char *)TLS_MALLOC(20); if (!hash) return NULL; err = sha1_init(&state); if (!err) { err = sha1_process(&state, message, message_len); if (!err) err = sha1_done(&state, hash); } break; case TLS_RSA_SIGN_SHA256: case TLS_ECDSA_SIGN_SHA256: DEBUG_PRINT("SIGN SHA256\n"); hash = (unsigned char *)TLS_MALLOC(32); if (!hash) return NULL; err = sha256_init(&state); if (!err) { err = sha256_process(&state, message, message_len); if (!err) err = sha256_done(&state, hash); } break; case TLS_RSA_SIGN_SHA384: DEBUG_PRINT("SIGN SHA384\n"); hash = (unsigned char *)TLS_MALLOC(48); if (!hash) return NULL; err = sha384_init(&state); if (!err) { err = sha384_process(&state, message, message_len); if (!err) err = sha384_done(&state, hash); } break; case TLS_RSA_SIGN_SHA512: DEBUG_PRINT("SIGN SHA512\n"); hash = (unsigned char *)TLS_MALLOC(64); if (!hash) return NULL; err = sha512_init(&state); if (!err) { err = sha512_process(&state, message, message_len); if (!err) err = sha512_done(&state, hash); } break; default: DEBUG_PRINT("UNKNOWN SIGNATURE ALGORITHM\n"); } return hash; } int tls_certificate_verify_signature(struct TLSCertificate *cert, struct TLSCertificate *parent) { if ((!cert) || (!parent) || (!cert->sign_key) || (!cert->fingerprint) || (!cert->sign_len) || (!parent->der_bytes) || (!parent->der_len)) { DEBUG_PRINT("CANNOT VERIFY SIGNATURE"); return 0; } tls_init(); int hash_len = _private_tls_hash_len(cert->algorithm); if (hash_len <= 0) return 0; int hash_index = -1; switch (cert->algorithm) { case TLS_RSA_SIGN_MD5: hash_index = find_hash("md5"); break; case TLS_RSA_SIGN_SHA1: hash_index = find_hash("sha1"); break; case TLS_RSA_SIGN_SHA256: case TLS_ECDSA_SIGN_SHA256: hash_index = find_hash("sha256"); break; case TLS_RSA_SIGN_SHA384: hash_index = find_hash("sha384"); break; case TLS_RSA_SIGN_SHA512: hash_index = find_hash("sha512"); break; default: DEBUG_PRINT("UNKNOWN SIGNATURE ALGORITHM\n"); return 0; } #ifdef TLS_ECDSA_SUPPORTED if (cert->algorithm == TLS_ECDSA_SIGN_SHA256) { ecc_key key; int err = ecc_import(parent->der_bytes, parent->der_len, &key); if (err) { DEBUG_PRINT("Error importing ECC certificate (code: %i)\n", err); DEBUG_DUMP_HEX_LABEL("CERTIFICATE", parent->der_bytes, parent->der_len); return 0; } int ecc_stat = 0; unsigned char *signature = cert->sign_key; int signature_len = cert->sign_len; if (!signature[0]) { signature++; signature_len--; } err = ecc_verify_hash(signature, signature_len, cert->fingerprint, hash_len, &ecc_stat, &key); ecc_free(&key); if (err) { DEBUG_PRINT("ECC HASH VERIFY ERROR %i\n", err); return 0; } DEBUG_PRINT("ECC CERTIFICATE VALIDATION: %i\n", ecc_stat); return ecc_stat; } #endif rsa_key key; int err = rsa_import(parent->der_bytes, parent->der_len, &key); if (err) { DEBUG_PRINT("Error importing RSA certificate (code: %i)\n", err); DEBUG_DUMP_HEX_LABEL("CERTIFICATE", parent->der_bytes, parent->der_len); return 0; } int rsa_stat = 0; unsigned char *signature = cert->sign_key; int signature_len = cert->sign_len; if (!signature[0]) { signature++; signature_len--; } err = rsa_verify_hash_ex(signature, signature_len, cert->fingerprint, hash_len, LTC_PKCS_1_V1_5, hash_index, 0, &rsa_stat, &key); rsa_free(&key); if (err) { DEBUG_PRINT("HASH VERIFY ERROR %i\n", err); return 0; } DEBUG_PRINT("CERTIFICATE VALIDATION: %i\n", rsa_stat); return rsa_stat; } int tls_certificate_chain_is_valid(struct TLSCertificate **certificates, int len) { if ((!certificates) || (!len)) return bad_certificate; int i; len--; // expired certificate or not yet valid ? if (tls_certificate_is_valid(certificates[0])) return bad_certificate; // check for (i = 0; i < len; i++) { // certificate in chain is expired ? if (tls_certificate_is_valid(certificates[i+1])) return bad_certificate; if (!tls_certificate_verify_signature(certificates[i], certificates[i+1])) return bad_certificate; } return 0; } int tls_certificate_chain_is_valid_root(struct TLSContext *context, struct TLSCertificate **certificates, int len) { if ((!certificates) || (!len) || (!context->root_certificates) || (!context->root_count)) return bad_certificate; int i; unsigned int j; for (i = 0; i < len; i++) { for (j = 0; j < context->root_count; j++) { // check if root certificate expired if (tls_certificate_is_valid(context->root_certificates[j])) continue; // if any root validates any certificate in the chain, then is root validated if (tls_certificate_verify_signature(certificates[i], context->root_certificates[j])) return 0; } } return bad_certificate; } int _private_is_oid(struct _private_OID_chain *ref_chain, const unsigned char *looked_oid, int looked_oid_len) { while (ref_chain) { if (ref_chain->oid) { if (_is_oid2(ref_chain->oid, looked_oid, 16, looked_oid_len)) return 1; } ref_chain = (struct _private_OID_chain *)ref_chain->top; } return 0; } int _private_asn1_parse(struct TLSContext *context, struct TLSCertificate *cert, const unsigned char *buffer, unsigned int size, int level, unsigned int *fields, unsigned char *has_key, int client_cert, unsigned char *top_oid, struct _private_OID_chain *chain) { struct _private_OID_chain local_chain; local_chain.top = chain; unsigned int pos = 0; // X.690 int idx = 0; unsigned char oid[16]; memset(oid, 0, 16); local_chain.oid = oid; if (has_key) *has_key = 0; unsigned char local_has_key = 0; const unsigned char *cert_data = NULL; unsigned int cert_len = 0; while (pos < size) { unsigned int start_pos = pos; CHECK_SIZE(2, size - pos, TLS_NEED_MORE_DATA) unsigned char first = buffer[pos++]; unsigned char type = first & 0x1F; unsigned char constructed = first & 0x20; unsigned char element_class = first >> 6; unsigned int octets = 0; unsigned int temp; idx++; if (level <= TLS_ASN1_MAXLEVEL) fields[level - 1] = idx; unsigned int length = asn1_get_len((unsigned char *)&buffer[pos], size - pos, &octets); if ((octets > 4) || (octets > size - pos)) { DEBUG_PRINT("CANNOT READ CERTIFICATE\n"); return pos; } pos += octets; CHECK_SIZE(length, size - pos, TLS_NEED_MORE_DATA) //DEBUG_PRINT("FIRST: %x => %x (%i)\n", (int)first, (int)type, length); // sequence //DEBUG_PRINT("%2i: ", level); #ifdef DEBUG DEBUG_INDEX(fields); int i1; for (i1 = 1; i1 < level; i1++) DEBUG_PRINT(" "); #endif if ((length) && (constructed)) { switch (type) { case 0x03: DEBUG_PRINT("CONSTRUCTED BITSTREAM\n"); break; case 0x10: DEBUG_PRINT("SEQUENCE\n"); if ((level == 2) && (idx == 1)) { cert_len = length + (pos - start_pos); cert_data = &buffer[start_pos]; } // private key on server or public key on client if ((!cert->version) && (_is_field(fields, priv_der_id))) { TLS_FREE(cert->der_bytes); temp = length + (pos - start_pos); cert->der_bytes = (unsigned char *)TLS_MALLOC(temp); if (cert->der_bytes) { memcpy(cert->der_bytes, &buffer[start_pos], temp); cert->der_len = temp; } else cert->der_len = 0; } break; case 0x11: DEBUG_PRINT("EMBEDDED PDV\n"); break; case 0x00: if (element_class == 0x02) { DEBUG_PRINT("CONTEXT-SPECIFIC\n"); break; } default: DEBUG_PRINT("CONSTRUCT TYPE %02X\n", (int)type); } local_has_key = 0; _private_asn1_parse(context, cert, &buffer[pos], length, level + 1, fields, &local_has_key, client_cert, top_oid, &local_chain); if ((((local_has_key) && (context) && ((!context->is_server) || (client_cert))) || (!context)) && (_is_field(fields, pk_id))) { TLS_FREE(cert->der_bytes); temp = length + (pos - start_pos); cert->der_bytes = (unsigned char *)TLS_MALLOC(temp); if (cert->der_bytes) { memcpy(cert->der_bytes, &buffer[start_pos], temp); cert->der_len = temp; } else cert->der_len = 0; } } else { switch (type) { case 0x00: // end of content DEBUG_PRINT("END OF CONTENT\n"); return pos; break; case 0x01: // boolean temp = buffer[pos]; DEBUG_PRINT("BOOLEAN: %i\n", temp); break; case 0x02: // integer if (_is_field(fields, pk_id)) { if (has_key) *has_key = 1; if (idx == 1) tls_certificate_set_key(cert, &buffer[pos], length); else if (idx == 2) tls_certificate_set_exponent(cert, &buffer[pos], length); } else if (_is_field(fields, serial_id)) tls_certificate_set_serial(cert, &buffer[pos], length); if (_is_field(fields, version_id)) { if (length == 1) cert->version = buffer[pos]; #ifdef TLS_X509_V1_SUPPORT else cert->version = 0; idx++; #endif } if (level >= 2) { unsigned int fields_temp[3]; fields_temp[0] = fields[level - 2]; fields_temp[1] = fields[level - 1]; fields_temp[2] = 0; if (_is_field(fields_temp, priv_id)) tls_certificate_set_priv(cert, &buffer[pos], length); } DEBUG_PRINT("INTEGER(%i): ", length); DEBUG_DUMP_HEX(&buffer[pos], length); if ((chain) && (length > 2)) { if (_private_is_oid(chain, san_oid, sizeof(san_oid) - 1)) { cert->san = (unsigned char **)TLS_REALLOC(cert->san, sizeof(unsigned char *) * (cert->san_length + 1)); if (cert->san) { cert->san[cert->san_length] = NULL; tls_certificate_set_copy(&cert->san[cert->san_length], &buffer[pos], length); DEBUG_PRINT(" => SUBJECT ALTERNATIVE NAME: %s", cert->san[cert->san_length ]); cert->san_length++; } else cert->san_length = 0; } } DEBUG_PRINT("\n"); break; case 0x03: if (_is_field(fields, pk_id)) { if (has_key) *has_key = 1; } // bitstream DEBUG_PRINT("BITSTREAM(%i): ", length); DEBUG_DUMP_HEX(&buffer[pos], length); DEBUG_PRINT("\n"); if (_is_field(fields, sign_id)) { tls_certificate_set_sign_key(cert, &buffer[pos], length); } else if ((cert->ec_algorithm) && (_is_field(fields, pk_id))) { tls_certificate_set_key(cert, &buffer[pos], length); } else { if ((buffer[pos] == 0x00) && (length > 256)) _private_asn1_parse(context, cert, &buffer[pos]+1, length - 1, level + 1, fields, &local_has_key, client_cert, top_oid, &local_chain); else _private_asn1_parse(context, cert, &buffer[pos], length, level + 1, fields, &local_has_key, client_cert, top_oid, &local_chain); #ifdef TLS_FORWARD_SECRECY #ifdef TLS_ECDSA_SUPPORTED if (top_oid) { if (_is_oid2(top_oid, TLS_EC_prime256v1_OID, sizeof(oid), sizeof(TLS_EC_prime256v1) - 1)) { cert->ec_algorithm = secp256r1.iana; } else if (_is_oid2(top_oid, TLS_EC_secp224r1_OID, sizeof(oid), sizeof(TLS_EC_secp224r1_OID) - 1)) { cert->ec_algorithm = secp224r1.iana; } else if (_is_oid2(top_oid, TLS_EC_secp384r1_OID, sizeof(oid), sizeof(TLS_EC_secp384r1_OID) - 1)) { cert->ec_algorithm = secp384r1.iana; } else if (_is_oid2(top_oid, TLS_EC_secp521r1_OID, sizeof(oid), sizeof(TLS_EC_secp521r1_OID) - 1)) { cert->ec_algorithm = secp521r1.iana; } if ((cert->ec_algorithm) && (!cert->pk)) tls_certificate_set_key(cert, &buffer[pos], length); } #endif #endif } break; case 0x04: if ((top_oid) && (_is_field(fields, ecc_priv_id)) && (!cert->priv)) { DEBUG_PRINT("BINARY STRING(%i): ", length); DEBUG_DUMP_HEX(&buffer[pos], length); DEBUG_PRINT("\n"); tls_certificate_set_priv(cert, &buffer[pos], length); } else _private_asn1_parse(context, cert, &buffer[pos], length, level + 1, fields, &local_has_key, client_cert, top_oid, &local_chain); break; case 0x05: DEBUG_PRINT("NULL\n"); break; case 0x06: // object identifier if (_is_field(fields, pk_id)) { #ifdef TLS_ECDSA_SUPPORTED if ((length == 8) || (length == 5)) tls_certificate_set_algorithm(context, &cert->ec_algorithm, &buffer[pos], length); else #endif tls_certificate_set_algorithm(context, &cert->key_algorithm, &buffer[pos], length); } if (_is_field(fields, algorithm_id)) tls_certificate_set_algorithm(context, &cert->algorithm, &buffer[pos], length); DEBUG_PRINT("OBJECT IDENTIFIER(%i): ", length); DEBUG_DUMP_HEX(&buffer[pos], length); DEBUG_PRINT("\n"); // check previous oid if (_is_oid2(oid, ocsp_oid, 16, sizeof(ocsp_oid) - 1)) tls_certificate_set_copy(&cert->ocsp, &buffer[pos], length); if (length < 16) memcpy(oid, &buffer[pos], length); else memcpy(oid, &buffer[pos], 16); if (top_oid) memcpy(top_oid, oid, 16); break; case 0x09: DEBUG_PRINT("REAL NUMBER(%i): ", length); DEBUG_DUMP_HEX(&buffer[pos], length); DEBUG_PRINT("\n"); break; case 0x17: // utc time DEBUG_PRINT("UTC TIME: ["); DEBUG_DUMP(&buffer[pos], length); DEBUG_PRINT("]\n"); if (_is_field(fields, validity_id)) { if (idx == 1) tls_certificate_set_copy_date(&cert->not_before, &buffer[pos], length); else tls_certificate_set_copy_date(&cert->not_after, &buffer[pos], length); } break; case 0x18: // generalized time DEBUG_PRINT("GENERALIZED TIME: ["); DEBUG_DUMP(&buffer[pos], length); DEBUG_PRINT("]\n"); break; case 0x13: // printable string case 0x0C: case 0x14: case 0x15: case 0x16: case 0x19: case 0x1A: case 0x1B: case 0x1C: case 0x1D: case 0x1E: if (_is_field(fields, issurer_id)) { if (_is_oid(oid, country_oid, 3)) tls_certificate_set_copy(&cert->issuer_country, &buffer[pos], length); else if (_is_oid(oid, state_oid, 3)) tls_certificate_set_copy(&cert->issuer_state, &buffer[pos], length); else if (_is_oid(oid, location_oid, 3)) tls_certificate_set_copy(&cert->issuer_location, &buffer[pos], length); else if (_is_oid(oid, entity_oid, 3)) tls_certificate_set_copy(&cert->issuer_entity, &buffer[pos], length); else if (_is_oid(oid, subject_oid, 3)) tls_certificate_set_copy(&cert->issuer_subject, &buffer[pos], length); } else if (_is_field(fields, owner_id)) { if (_is_oid(oid, country_oid, 3)) tls_certificate_set_copy(&cert->country, &buffer[pos], length); else if (_is_oid(oid, state_oid, 3)) tls_certificate_set_copy(&cert->state, &buffer[pos], length); else if (_is_oid(oid, location_oid, 3)) tls_certificate_set_copy(&cert->location, &buffer[pos], length); else if (_is_oid(oid, entity_oid, 3)) tls_certificate_set_copy(&cert->entity, &buffer[pos], length); else if (_is_oid(oid, subject_oid, 3)) tls_certificate_set_copy(&cert->subject, &buffer[pos], length); } DEBUG_PRINT("STR: ["); DEBUG_DUMP(&buffer[pos], length); DEBUG_PRINT("]\n"); break; case 0x10: DEBUG_PRINT("EMPTY SEQUENCE\n"); break; case 0xA: DEBUG_PRINT("ENUMERATED(%i): ", length); DEBUG_DUMP_HEX(&buffer[pos], length); DEBUG_PRINT("\n"); break; default: DEBUG_PRINT("========> NOT SUPPORTED %x\n", (int)type); // not supported / needed break; } } pos += length; } if ((level == 2) && (cert->sign_key) && (cert->sign_len) && (cert_len) && (cert_data)) { TLS_FREE(cert->fingerprint); cert->fingerprint = _private_tls_compute_hash(cert->algorithm, cert_data, cert_len); #ifdef DEBUG if (cert->fingerprint) { DEBUG_DUMP_HEX_LABEL("FINGERPRINT", cert->fingerprint, _private_tls_hash_len(cert->algorithm)); } #endif } return pos; } struct TLSCertificate *asn1_parse(struct TLSContext *context, const unsigned char *buffer, unsigned int size, int client_cert) { unsigned int fields[TLS_ASN1_MAXLEVEL]; memset(fields, 0, sizeof(int) * TLS_ASN1_MAXLEVEL); struct TLSCertificate *cert = tls_create_certificate(); if (cert) { if (client_cert < 0) { client_cert = 0; // private key unsigned char top_oid[16]; memset(top_oid, 0, sizeof(top_oid)); _private_asn1_parse(context, cert, buffer, size, 1, fields, NULL, client_cert, top_oid, NULL); } else _private_asn1_parse(context, cert, buffer, size, 1, fields, NULL, client_cert, NULL, NULL); } return cert; } int tls_load_certificates(struct TLSContext *context, const unsigned char *pem_buffer, int pem_size) { if (!context) return TLS_GENERIC_ERROR; unsigned int len; int idx = 0; do { unsigned char *data = tls_pem_decode(pem_buffer, pem_size, idx++, &len); if ((!data) || (!len)) break; struct TLSCertificate *cert = asn1_parse(context, data, len, 0); if (cert) { if ((cert->version == 2) #ifdef TLS_X509_V1_SUPPORT || (cert->version == 0) #endif ) { TLS_FREE(cert->der_bytes); cert->der_bytes = data; cert->der_len = len; data = NULL; if (cert->priv) { DEBUG_PRINT("WARNING - parse error (private key encountered in certificate)\n"); TLS_FREE(cert->priv); cert->priv = NULL; cert->priv_len = 0; } if (context->is_server) { context->certificates = (struct TLSCertificate **)TLS_REALLOC(context->certificates, (context->certificates_count + 1) * sizeof(struct TLSCertificate *)); context->certificates[context->certificates_count] = cert; context->certificates_count++; DEBUG_PRINT("Loaded certificate: %i\n", (int)context->certificates_count); } else { context->client_certificates = (struct TLSCertificate **)TLS_REALLOC(context->client_certificates, (context->client_certificates_count + 1) * sizeof(struct TLSCertificate *)); context->client_certificates[context->client_certificates_count] = cert; context->client_certificates_count++; DEBUG_PRINT("Loaded client certificate: %i\n", (int)context->client_certificates_count); } } else { DEBUG_PRINT("WARNING - certificate version error (v%i)\n", (int)cert->version); tls_destroy_certificate(cert); } } TLS_FREE(data); } while (1); return context->certificates_count; } int tls_load_private_key(struct TLSContext *context, const unsigned char *pem_buffer, int pem_size) { if (!context) return TLS_GENERIC_ERROR; unsigned int len; int idx = 0; do { unsigned char *data = tls_pem_decode(pem_buffer, pem_size, idx++, &len); if ((!data) || (!len)) break; struct TLSCertificate *cert = asn1_parse(context, data, len, -1); if (cert) { if (!cert->der_len) { TLS_FREE(cert->der_bytes); cert->der_bytes = data; cert->der_len = len; } else TLS_FREE(data); if ((cert) && (cert->priv) && (cert->priv_len)) { #ifdef TLS_ECDSA_SUPPORTED if (cert->ec_algorithm) { DEBUG_PRINT("Loaded ECC private key\n"); if (context->ec_private_key) tls_destroy_certificate(context->ec_private_key); context->ec_private_key = cert; return 1; } else #endif { DEBUG_PRINT("Loaded private key\n"); if (context->private_key) tls_destroy_certificate(context->private_key); context->private_key = cert; return 1; } } tls_destroy_certificate(cert); } else TLS_FREE(data); } while (1); return 0; } int tls_clear_certificates(struct TLSContext *context) { unsigned int i; if ((!context) || (!context->is_server) || (context->is_child)) return TLS_GENERIC_ERROR; if (context->root_certificates) { for (i = 0; i < context->root_count; i++) tls_destroy_certificate(context->root_certificates[i]); } context->root_certificates = NULL; context->root_count = 0; if (context->private_key) tls_destroy_certificate(context->private_key); context->private_key = NULL; #ifdef TLS_ECDSA_SUPPORTED if (context->ec_private_key) tls_destroy_certificate(context->ec_private_key); context->ec_private_key = NULL; #endif TLS_FREE(context->certificates); context->certificates = NULL; context->certificates_count = 0; return 0; } #ifdef WITH_TLS_13 struct TLSPacket *tls_build_certificate_verify(struct TLSContext *context) { struct TLSPacket *packet = tls_create_packet(context, TLS_HANDSHAKE, context->version, 0); //certificate verify tls_packet_uint8(packet, 0x0F); unsigned int size_offset = packet->len; tls_packet_uint24(packet, 0); unsigned char out[TLS_MAX_RSA_KEY]; #ifdef TLS_ECDSA_SUPPORTED unsigned long out_len = TLS_MAX_RSA_KEY; #endif unsigned char signing_data[TLS_MAX_HASH_SIZE + 98]; int signing_data_len; // first 64 bytes to 0x20 (32) memset(signing_data, 0x20, 64); // context string 33 bytes if (context->is_server) memcpy(signing_data + 64, "TLS 1.3, server CertificateVerify", 33); else memcpy(signing_data + 64, "TLS 1.3, client CertificateVerify", 33); // a single 0 byte separator signing_data[97] = 0; signing_data_len = 98; signing_data_len += _private_tls_get_hash(context, signing_data + 98); DEBUG_DUMP_HEX_LABEL("verify data", signing_data, signing_data_len); int hash_algorithm = sha256; #ifdef TLS_ECDSA_SUPPORTED if (tls_is_ecdsa(context)) { switch (context->ec_private_key->ec_algorithm) { case 23: // secp256r1 + sha256 tls_packet_uint16(packet, 0x0403); break; case 24: // secp384r1 + sha384 tls_packet_uint16(packet, 0x0503); hash_algorithm = sha384; break; case 25: // secp521r1 + sha512 tls_packet_uint16(packet, 0x0603); hash_algorithm = sha512; break; default: DEBUG_PRINT("UNSUPPORTED CURVE (SIGNING)\n"); packet->broken = 1; return packet; } } else #endif { tls_packet_uint16(packet, 0x0804); } int packet_size = 2; #ifdef TLS_ECDSA_SUPPORTED if (tls_is_ecdsa(context)) { if (_private_tls_sign_ecdsa(context, hash_algorithm, signing_data, signing_data_len, out, &out_len) == 1) { DEBUG_PRINT("ECDSA signing OK! (ECDSA, length %lu)\n", out_len); tls_packet_uint16(packet, out_len); tls_packet_append(packet, out, out_len); packet_size += out_len + 2; } } else #endif if (_private_tls_sign_rsa(context, hash_algorithm, signing_data, signing_data_len, out, &out_len) == 1) { DEBUG_PRINT("RSA signing OK! (length %lu)\n", out_len); tls_packet_uint16(packet, out_len); tls_packet_append(packet, out, out_len); packet_size += out_len + 2; } packet->buf[size_offset] = packet_size / 0x10000; packet_size %= 0x10000; packet->buf[size_offset + 1] = packet_size / 0x100; packet_size %= 0x100; packet->buf[size_offset + 2] = packet_size; tls_packet_update(packet); return packet; } #endif struct TLSPacket *tls_build_certificate(struct TLSContext *context) { int i; unsigned int all_certificate_size = 0; int certificates_count; struct TLSCertificate **certificates; if (context->is_server) { certificates_count = context->certificates_count; certificates = context->certificates; } else { certificates_count = context->client_certificates_count; certificates = context->client_certificates; } int delta = 3; #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) delta = 5; #endif #ifdef TLS_ECDSA_SUPPORTED int is_ecdsa = tls_is_ecdsa(context); if (is_ecdsa) { for (i = 0; i < certificates_count; i++) { struct TLSCertificate *cert = certificates[i]; if ((cert) && (cert->der_len) && (cert->ec_algorithm)) all_certificate_size += cert->der_len + delta; } } else { for (i = 0; i < certificates_count; i++) { struct TLSCertificate *cert = certificates[i]; if ((cert) && (cert->der_len) && (!cert->ec_algorithm)) all_certificate_size += cert->der_len + delta; } } #else for (i = 0; i < certificates_count; i++) { struct TLSCertificate *cert = certificates[i]; if ((cert) && (cert->der_len)) all_certificate_size += cert->der_len + delta; } #endif if (!all_certificate_size) { DEBUG_PRINT("NO CERTIFICATE SET\n"); } struct TLSPacket *packet = tls_create_packet(context, TLS_HANDSHAKE, context->version, 0); tls_packet_uint8(packet, 0x0B); if (all_certificate_size) { #ifdef WITH_TLS_13 // context if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { tls_packet_uint24(packet, all_certificate_size + 4); tls_packet_uint8(packet, 0); } else #endif tls_packet_uint24(packet, all_certificate_size + 3); if (context->dtls) _private_dtls_handshake_data(context, packet, all_certificate_size + 3); tls_packet_uint24(packet, all_certificate_size); for (i = 0; i < certificates_count; i++) { struct TLSCertificate *cert = certificates[i]; if ((cert) && (cert->der_len)) { #ifdef TLS_ECDSA_SUPPORTED // is RSA certificate ? if ((is_ecdsa) && (!cert->ec_algorithm)) continue; // is ECC certificate ? if ((!is_ecdsa) && (cert->ec_algorithm)) continue; #endif // 2 times -> one certificate tls_packet_uint24(packet, cert->der_len); tls_packet_append(packet, cert->der_bytes, cert->der_len); #ifdef WITH_TLS_13 // extension if ((context->version == TLS_V13) || (context->version == DTLS_V13)) tls_packet_uint16(packet, 0); #endif } } } else { tls_packet_uint24(packet, all_certificate_size); #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) tls_packet_uint8(packet, 0); #endif if (context->dtls) _private_dtls_handshake_data(context, packet, all_certificate_size); } tls_packet_update(packet); if (context->dtls) context->dtls_seq++; return packet; } #ifdef WITH_TLS_13 struct TLSPacket *tls_build_encrypted_extensions(struct TLSContext *context) { struct TLSPacket *packet = tls_create_packet(context, TLS_HANDSHAKE, context->version, 3); tls_packet_uint8(packet, 0x08); if (context->negotiated_alpn) { int alpn_negotiated_len = strlen(context->negotiated_alpn); int alpn_len = alpn_negotiated_len + 1; tls_packet_uint24(packet, alpn_len + 8); tls_packet_uint16(packet, alpn_len + 6); tls_packet_uint16(packet, 0x10); tls_packet_uint16(packet, alpn_len + 2); tls_packet_uint16(packet, alpn_len); tls_packet_uint8(packet, alpn_negotiated_len); tls_packet_append(packet, (unsigned char *)context->negotiated_alpn, alpn_negotiated_len); } else { tls_packet_uint24(packet, 2); tls_packet_uint16(packet, 0); } tls_packet_update(packet); return packet; } #endif struct TLSPacket *tls_build_finished(struct TLSContext *context) { struct TLSPacket *packet = tls_create_packet(context, TLS_HANDSHAKE, context->version, TLS_MIN_FINISHED_OPAQUE_LEN + 64); tls_packet_uint8(packet, 0x14); #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) tls_packet_uint24(packet, _private_tls_mac_length(context)); else #endif tls_packet_uint24(packet, TLS_MIN_FINISHED_OPAQUE_LEN); if (context->dtls) _private_dtls_handshake_data(context, packet, TLS_MIN_FINISHED_OPAQUE_LEN); // verify unsigned char hash[TLS_MAX_HASH_SIZE]; unsigned long out_size = TLS_MIN_FINISHED_OPAQUE_LEN; #ifdef WITH_TLS_13 unsigned char out[TLS_MAX_HASH_SIZE]; #else unsigned char out[TLS_MIN_FINISHED_OPAQUE_LEN]; #endif unsigned int hash_len; // server verifies client's message if (context->is_server) { #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { hash_len = _private_tls_get_hash(context, hash); if ((!context->finished_key) || (!hash_len)) { DEBUG_PRINT("NO FINISHED KEY COMPUTED OR NO HANDSHAKE HASH\n"); packet->broken = 1; return packet; } DEBUG_DUMP_HEX_LABEL("HS HASH", hash, hash_len); DEBUG_DUMP_HEX_LABEL("HS FINISH", context->finished_key, hash_len); DEBUG_DUMP_HEX_LABEL("HS REMOTE FINISH", context->remote_finished_key, hash_len); out_size = hash_len; hmac_state hmac; hmac_init(&hmac, _private_tls_get_hash_idx(context), context->finished_key, hash_len); hmac_process(&hmac, hash, hash_len); hmac_done(&hmac, out, &out_size); } else #endif { hash_len = _private_tls_done_hash(context, hash); _private_tls_prf(context, out, TLS_MIN_FINISHED_OPAQUE_LEN, context->master_key, context->master_key_len, (unsigned char *)"server finished", 15, hash, hash_len, NULL, 0); _private_tls_destroy_hash(context); } } else { #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { hash_len = _private_tls_get_hash(context, hash); if ((!context->finished_key) || (!hash_len)) { DEBUG_PRINT("NO FINISHED KEY COMPUTED OR NO HANDSHAKE HASH\n"); packet->broken = 1; return packet; } DEBUG_DUMP_HEX_LABEL("HS HASH", hash, hash_len); DEBUG_DUMP_HEX_LABEL("HS FINISH", context->finished_key, hash_len); DEBUG_DUMP_HEX_LABEL("HS REMOTE FINISH", context->remote_finished_key, hash_len); TLS_FREE(context->server_finished_hash); context->server_finished_hash = (unsigned char *)TLS_MALLOC(hash_len); if (context->server_finished_hash) memcpy(context->server_finished_hash, hash, hash_len); out_size = hash_len; hmac_state hmac; hmac_init(&hmac, _private_tls_get_hash_idx(context), context->finished_key, hash_len); hmac_process(&hmac, hash, hash_len); hmac_done(&hmac, out, &out_size); } else { #endif hash_len = _private_tls_get_hash(context, hash); _private_tls_prf(context, out, TLS_MIN_FINISHED_OPAQUE_LEN, context->master_key, context->master_key_len, (unsigned char *)"client finished", 15, hash, hash_len, NULL, 0); #ifdef WITH_TLS_13 } #endif } tls_packet_append(packet, out, out_size); tls_packet_update(packet); DEBUG_DUMP_HEX_LABEL("VERIFY DATA", out, out_size); #ifdef TLS_ACCEPT_SECURE_RENEGOTIATION if (context->is_server) { // concatenate client verify and server verify context->verify_data = (unsigned char *)TLS_REALLOC(context->verify_data, out_size); if (context->verify_data) { memcpy(context->verify_data + context->verify_len, out, out_size); context->verify_len += out_size; } else context->verify_len = 0; } else { TLS_FREE(context->verify_data); context->verify_data = (unsigned char *)TLS_MALLOC(out_size); if (context->verify_data) { memcpy(context->verify_data, out, out_size); context->verify_len = out_size; } } #endif return packet; } struct TLSPacket *tls_build_change_cipher_spec(struct TLSContext *context) { struct TLSPacket *packet = tls_create_packet(context, TLS_CHANGE_CIPHER, context->version, 64); tls_packet_uint8(packet, 1); tls_packet_update(packet); context->local_sequence_number = 0; return packet; } struct TLSPacket *tls_build_done(struct TLSContext *context) { struct TLSPacket *packet = tls_create_packet(context, TLS_HANDSHAKE, context->version, 0); tls_packet_uint8(packet, 0x0E); tls_packet_uint24(packet, 0); if (context->dtls) { _private_dtls_handshake_data(context, packet, 0); context->dtls_seq++; } tls_packet_update(packet); return packet; } struct TLSPacket *tls_build_message(struct TLSContext *context, const unsigned char *data, unsigned int len) { if ((!data) || (!len)) return 0; struct TLSPacket *packet = tls_create_packet(context, TLS_APPLICATION_DATA, context->version, len); tls_packet_append(packet, data, len); tls_packet_update(packet); return packet; } int tls_client_connect(struct TLSContext *context) { if ((context->is_server) || (context->critical_error)) return TLS_UNEXPECTED_MESSAGE; return _private_tls_write_packet(tls_build_hello(context, 0)); } int tls_write(struct TLSContext *context, const unsigned char *data, unsigned int len) { if (!context) return TLS_GENERIC_ERROR; #ifdef TLS_12_FALSE_START if ((context->connection_status != 0xFF) && ((context->is_server) || (context->version != TLS_V12) || (context->critical_error) || (!context->false_start))) return TLS_UNEXPECTED_MESSAGE; #else if (context->connection_status != 0xFF) return TLS_UNEXPECTED_MESSAGE; #endif if (len > TLS_MAXTLS_APP_SIZE) len = TLS_MAXTLS_APP_SIZE; int actually_written = _private_tls_write_packet(tls_build_message(context, data, len)); if (actually_written <= 0) return actually_written; return len; } struct TLSPacket *tls_build_alert(struct TLSContext *context, char critical, unsigned char code) { struct TLSPacket *packet = tls_create_packet(context, TLS_ALERT, context->version, 0); tls_packet_uint8(packet, critical ? TLS_ALERT_CRITICAL : TLS_ALERT_WARNING); if (critical) context->critical_error = 1; tls_packet_uint8(packet, code); tls_packet_update(packet); return packet; } int _private_tls_read_from_file(const char *fname, void *buf, int max_len) { FILE *f = fopen(fname, "rb"); if (f) { int size = (int)fread(buf, 1, max_len, f); fclose(f); return size; } return 0; } int tls_consume_stream(struct TLSContext *context, const unsigned char *buf, int buf_len, tls_validation_function certificate_verify) { if (!context) return TLS_GENERIC_ERROR; if (context->critical_error) return TLS_BROKEN_CONNECTION; if (buf_len <= 0) { DEBUG_PRINT("tls_consume_stream called with buf_len %i\n", buf_len); return 0; } if (!buf) { DEBUG_PRINT("tls_consume_stream called NULL buffer\n"); context->critical_error = 1; return TLS_NO_MEMORY; } unsigned int orig_len = context->message_buffer_len; context->message_buffer_len += buf_len; context->message_buffer = (unsigned char *)TLS_REALLOC(context->message_buffer, context->message_buffer_len); if (!context->message_buffer) { context->message_buffer_len = 0; return TLS_NO_MEMORY; } memcpy(context->message_buffer + orig_len, buf, buf_len); unsigned int index = 0; unsigned int tls_buffer_len = context->message_buffer_len; int err_flag = 0; int tls_header_size; int tls_size_offset; if (context->dtls) { tls_size_offset = 11; tls_header_size = 13; } else { tls_size_offset = 3; tls_header_size = 5; } while (tls_buffer_len >= 5) { unsigned int length = ntohs(*(unsigned short *)&context->message_buffer[index + tls_size_offset]) + tls_header_size; if (length > tls_buffer_len) { DEBUG_PRINT("NEED DATA: %i/%i\n", length, tls_buffer_len); break; } int consumed = tls_parse_message(context, &context->message_buffer[index], length, certificate_verify); DEBUG_PRINT("Consumed %i bytes\n", consumed); if (consumed < 0) { if (!context->critical_error) context->critical_error = 1; err_flag = consumed; break; } index += length; tls_buffer_len -= length; if (context->critical_error) { err_flag = TLS_BROKEN_CONNECTION; break; } } if (err_flag) { DEBUG_PRINT("ERROR IN CONSUME: %i\n", err_flag); context->message_buffer_len = 0; TLS_FREE(context->message_buffer); context->message_buffer = NULL; return err_flag; } if (index) { context->message_buffer_len -= index; if (context->message_buffer_len) { // no realloc here memmove(context->message_buffer, context->message_buffer + index, context->message_buffer_len); } else { TLS_FREE(context->message_buffer); context->message_buffer = NULL; } } return index; } void tls_close_notify(struct TLSContext *context) { if ((!context) || (context->critical_error)) return; context->critical_error = 1; DEBUG_PRINT("CLOSE\n"); _private_tls_write_packet(tls_build_alert(context, 0, close_notify)); } void tls_alert(struct TLSContext *context, unsigned char critical, int code) { if (!context) return; if ((!context->critical_error) && (critical)) context->critical_error = 1; DEBUG_PRINT("ALERT\n"); _private_tls_write_packet(tls_build_alert(context, critical, code)); } int tls_pending(struct TLSContext *context) { if (!context->message_buffer) return 0; return context->message_buffer_len; } void tls_make_exportable(struct TLSContext *context, unsigned char exportable_flag) { context->exportable = exportable_flag; if (!exportable_flag) { // zero the memory if ((context->exportable_keys) && (context->exportable_size)) memset(context->exportable_keys, 0, context->exportable_size); // free the memory, if alocated TLS_FREE(context->exportable_keys); context->exportable_size = 0; } } int tls_export_context(struct TLSContext *context, unsigned char *buffer, unsigned int buf_len, unsigned char small_version) { // only negotiated AND exportable connections may be exported if ((!context) || (context->critical_error) || (context->connection_status != 0xFF) || (!context->exportable) || (!context->exportable_keys) || (!context->exportable_size) || (!context->crypto.created)) { DEBUG_PRINT("CANNOT EXPORT CONTEXT %i\n", (int)context->connection_status); return 0; } struct TLSPacket *packet = tls_create_packet(NULL, TLS_SERIALIZED_OBJECT, context->version, 0); // export buffer version tls_packet_uint8(packet, 0x01); tls_packet_uint8(packet, context->connection_status); tls_packet_uint16(packet, context->cipher); if (context->is_child) tls_packet_uint8(packet, 2); else tls_packet_uint8(packet, context->is_server); if (context->crypto.created == 2) { // aead #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { tls_packet_uint8(packet, TLS_13_AES_GCM_IV_LENGTH); tls_packet_append(packet, context->crypto.ctx_local_mac.local_iv, TLS_13_AES_GCM_IV_LENGTH); tls_packet_append(packet, context->crypto.ctx_remote_mac.remote_iv, TLS_13_AES_GCM_IV_LENGTH); } else { #endif tls_packet_uint8(packet, TLS_AES_GCM_IV_LENGTH); tls_packet_append(packet, context->crypto.ctx_local_mac.local_aead_iv, TLS_AES_GCM_IV_LENGTH); tls_packet_append(packet, context->crypto.ctx_remote_mac.remote_aead_iv, TLS_AES_GCM_IV_LENGTH); #ifdef WITH_TLS_13 } #endif #ifdef TLS_WITH_CHACHA20_POLY1305 } else if (context->crypto.created == 3) { // ChaCha20 tls_packet_uint8(packet, TLS_CHACHA20_IV_LENGTH); tls_packet_append(packet, context->crypto.ctx_local_mac.local_nonce, TLS_CHACHA20_IV_LENGTH); tls_packet_append(packet, context->crypto.ctx_remote_mac.remote_nonce, TLS_CHACHA20_IV_LENGTH); #endif } else { unsigned char iv[TLS_AES_IV_LENGTH]; unsigned long len = TLS_AES_IV_LENGTH; memset(iv, 0, TLS_AES_IV_LENGTH); cbc_getiv(iv, &len, &context->crypto.ctx_local.aes_local); tls_packet_uint8(packet, TLS_AES_IV_LENGTH); tls_packet_append(packet, iv, len); memset(iv, 0, TLS_AES_IV_LENGTH); cbc_getiv(iv, &len, &context->crypto.ctx_remote.aes_remote); tls_packet_append(packet, iv, TLS_AES_IV_LENGTH); } tls_packet_uint8(packet, context->exportable_size); tls_packet_append(packet, context->exportable_keys, context->exportable_size); if (context->crypto.created == 2) { tls_packet_uint8(packet, 0); #ifdef TLS_WITH_CHACHA20_POLY1305 } else if (context->crypto.created == 3) { // ChaCha20 tls_packet_uint8(packet, 0); unsigned int i; for (i = 0; i < 16; i++) tls_packet_uint32(packet, context->crypto.ctx_local.chacha_local.input[i]); for (i = 0; i < 16; i++) tls_packet_uint32(packet, context->crypto.ctx_remote.chacha_remote.input[i]); tls_packet_append(packet, context->crypto.ctx_local.chacha_local.ks, CHACHA_BLOCKLEN); tls_packet_append(packet, context->crypto.ctx_remote.chacha_remote.ks, CHACHA_BLOCKLEN); #endif } else { unsigned char mac_length = (unsigned char)_private_tls_mac_length(context); tls_packet_uint8(packet, mac_length); tls_packet_append(packet, context->crypto.ctx_local_mac.local_mac, mac_length); tls_packet_append(packet, context->crypto.ctx_remote_mac.remote_mac, mac_length); } if (small_version) { tls_packet_uint16(packet, 0); } else { tls_packet_uint16(packet, context->master_key_len); tls_packet_append(packet, context->master_key, context->master_key_len); } uint64_t sequence_number = htonll(context->local_sequence_number); tls_packet_append(packet, (unsigned char *)&sequence_number, sizeof(uint64_t)); sequence_number = htonll(context->remote_sequence_number); tls_packet_append(packet, (unsigned char *)&sequence_number, sizeof(uint64_t)); tls_packet_uint32(packet, context->tls_buffer_len); tls_packet_append(packet, context->tls_buffer, context->tls_buffer_len); tls_packet_uint32(packet, context->message_buffer_len); tls_packet_append(packet, context->message_buffer, context->message_buffer_len); tls_packet_uint32(packet, context->application_buffer_len); tls_packet_append(packet, context->application_buffer, context->application_buffer_len); tls_packet_uint8(packet, context->dtls); if (context->dtls) { tls_packet_uint16(packet, context->dtls_epoch_local); tls_packet_uint16(packet, context->dtls_epoch_remote); } tls_packet_update(packet); unsigned int size = packet->len; if ((buffer) && (buf_len)) { if (size > buf_len) { tls_destroy_packet(packet); DEBUG_PRINT("EXPORT BUFFER TO SMALL\n"); return (int)buf_len - (int)size; } memcpy(buffer, packet->buf, size); } tls_destroy_packet(packet); return size; } struct TLSContext *tls_import_context(const unsigned char *buffer, unsigned int buf_len) { if ((!buffer) || (buf_len < 64) || (buffer[0] != TLS_SERIALIZED_OBJECT) || (buffer[5] != 0x01)) { DEBUG_PRINT("CANNOT IMPORT CONTEXT BUFFER\n"); return NULL; } // create a context object struct TLSContext *context = tls_create_context(0, TLS_V12); if (context) { unsigned char temp[0xFF]; context->version = ntohs(*(unsigned short *)&buffer[1]); unsigned short length = ntohs(*(unsigned short *)&buffer[3]); if (length != buf_len - 5) { DEBUG_PRINT("INVALID IMPORT BUFFER SIZE\n"); tls_destroy_context(context); return NULL; } context->connection_status = buffer[6]; context->cipher = ntohs(*(unsigned short *)&buffer[7]); unsigned char server = buffer[9]; if (server == 2) { context->is_server = 1; context->is_child = 1; } else context->is_server = server; unsigned char local_iv[TLS_AES_IV_LENGTH]; unsigned char remote_iv[TLS_AES_IV_LENGTH]; unsigned char iv_len = buffer[10]; if (iv_len > TLS_AES_IV_LENGTH) { DEBUG_PRINT("INVALID IV LENGTH\n"); tls_destroy_context(context); return NULL; } // get the initialization vectors int buf_pos = 11; memcpy(local_iv, &buffer[buf_pos], iv_len); buf_pos += iv_len; memcpy(remote_iv, &buffer[buf_pos], iv_len); buf_pos += iv_len; unsigned char key_lengths = buffer[buf_pos++]; TLS_IMPORT_CHECK_SIZE(buf_pos, key_lengths, buf_len) memcpy(temp, &buffer[buf_pos], key_lengths); buf_pos += key_lengths; #ifdef TLS_REEXPORTABLE context->exportable = 1; context->exportable_keys = (unsigned char *)TLS_MALLOC(key_lengths); memcpy(context->exportable_keys, temp, key_lengths); context->exportable_size = key_lengths; #else context->exportable = 0; #endif int is_aead = _private_tls_is_aead(context); #ifdef TLS_WITH_CHACHA20_POLY1305 if (is_aead == 2) { // ChaCha20 if (iv_len > TLS_CHACHA20_IV_LENGTH) iv_len = TLS_CHACHA20_IV_LENGTH; memcpy(context->crypto.ctx_local_mac.local_nonce, local_iv, iv_len); memcpy(context->crypto.ctx_remote_mac.remote_nonce, remote_iv, iv_len); } else #endif if (is_aead) { #ifdef WITH_TLS_13 if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { if (iv_len > TLS_13_AES_GCM_IV_LENGTH) iv_len = TLS_13_AES_GCM_IV_LENGTH; memcpy(context->crypto.ctx_local_mac.local_iv, local_iv, iv_len); memcpy(context->crypto.ctx_remote_mac.remote_iv, remote_iv, iv_len); } else { #endif if (iv_len > TLS_AES_GCM_IV_LENGTH) iv_len = TLS_AES_GCM_IV_LENGTH; memcpy(context->crypto.ctx_local_mac.local_aead_iv, local_iv, iv_len); memcpy(context->crypto.ctx_remote_mac.remote_aead_iv, remote_iv, iv_len); #ifdef WITH_TLS_13 } #endif } if (context->is_server) { if (_private_tls_crypto_create(context, key_lengths / 2, temp, local_iv, temp + key_lengths / 2, remote_iv)) { DEBUG_PRINT("ERROR CREATING KEY CONTEXT\n"); tls_destroy_context(context); return NULL; } } else { if (_private_tls_crypto_create(context, key_lengths / 2, temp + key_lengths / 2, remote_iv, temp, local_iv)) { DEBUG_PRINT("ERROR CREATING KEY CONTEXT (CLIENT)\n"); tls_destroy_context(context); return NULL; } } memset(temp, 0, sizeof(temp)); unsigned char mac_length = buffer[buf_pos++]; if (mac_length > TLS_MAX_MAC_SIZE) { DEBUG_PRINT("INVALID MAC SIZE\n"); tls_destroy_context(context); return NULL; } if (mac_length) { TLS_IMPORT_CHECK_SIZE(buf_pos, mac_length, buf_len) memcpy(context->crypto.ctx_local_mac.local_mac, &buffer[buf_pos], mac_length); buf_pos += mac_length; TLS_IMPORT_CHECK_SIZE(buf_pos, mac_length, buf_len) memcpy(context->crypto.ctx_remote_mac.remote_mac, &buffer[buf_pos], mac_length); buf_pos += mac_length; } else #ifdef TLS_WITH_CHACHA20_POLY1305 if (is_aead == 2) { // ChaCha20 unsigned int i; TLS_IMPORT_CHECK_SIZE(buf_pos, 128 + CHACHA_BLOCKLEN * 2, buf_len) for (i = 0; i < 16; i++) { context->crypto.ctx_local.chacha_local.input[i] = ntohl(*(unsigned int *)(buffer + buf_pos)); buf_pos += sizeof(unsigned int); } for (i = 0; i < 16; i++) { context->crypto.ctx_remote.chacha_remote.input[i] = ntohl(*(unsigned int *)(buffer + buf_pos)); buf_pos += sizeof(unsigned int); } memcpy(context->crypto.ctx_local.chacha_local.ks, buffer + buf_pos, CHACHA_BLOCKLEN); buf_pos += CHACHA_BLOCKLEN; memcpy(context->crypto.ctx_remote.chacha_remote.ks, buffer + buf_pos, CHACHA_BLOCKLEN); buf_pos += CHACHA_BLOCKLEN; } #endif TLS_IMPORT_CHECK_SIZE(buf_pos, 2, buf_len) unsigned short master_key_len = ntohs(*(unsigned short *)(buffer + buf_pos)); buf_pos += 2; if (master_key_len) { TLS_IMPORT_CHECK_SIZE(buf_pos, master_key_len, buf_len) context->master_key = (unsigned char *)TLS_MALLOC(master_key_len); if (context->master_key) { memcpy(context->master_key, &buffer[buf_pos], master_key_len); context->master_key_len = master_key_len; } buf_pos += master_key_len; } TLS_IMPORT_CHECK_SIZE(buf_pos, 16, buf_len) context->local_sequence_number = ntohll(*(uint64_t *)&buffer[buf_pos]); buf_pos += 8; context->remote_sequence_number = ntohll(*(uint64_t *)&buffer[buf_pos]); buf_pos += 8; TLS_IMPORT_CHECK_SIZE(buf_pos, 4, buf_len) unsigned int tls_buffer_len = ntohl(*(unsigned int *)&buffer[buf_pos]); buf_pos += 4; TLS_IMPORT_CHECK_SIZE(buf_pos, tls_buffer_len, buf_len) if (tls_buffer_len) { context->tls_buffer = (unsigned char *)TLS_MALLOC(tls_buffer_len); if (context->tls_buffer) { memcpy(context->tls_buffer, &buffer[buf_pos], tls_buffer_len); context->tls_buffer_len = tls_buffer_len; } buf_pos += tls_buffer_len; } TLS_IMPORT_CHECK_SIZE(buf_pos, 4, buf_len) unsigned int message_buffer_len = ntohl(*(unsigned int *)&buffer[buf_pos]); buf_pos += 4; TLS_IMPORT_CHECK_SIZE(buf_pos, message_buffer_len, buf_len) if (message_buffer_len) { context->message_buffer = (unsigned char *)TLS_MALLOC(message_buffer_len); if (context->message_buffer) { memcpy(context->message_buffer, &buffer[buf_pos], message_buffer_len); context->message_buffer_len = message_buffer_len; } buf_pos += message_buffer_len; } TLS_IMPORT_CHECK_SIZE(buf_pos, 4, buf_len) unsigned int application_buffer_len = ntohl(*(unsigned int *)&buffer[buf_pos]); buf_pos += 4; context->cipher_spec_set = 1; TLS_IMPORT_CHECK_SIZE(buf_pos, application_buffer_len, buf_len) if (application_buffer_len) { context->application_buffer = (unsigned char *)TLS_MALLOC(application_buffer_len); if (context->application_buffer) { memcpy(context->application_buffer, &buffer[buf_pos], application_buffer_len); context->application_buffer_len = application_buffer_len; } buf_pos += application_buffer_len; } TLS_IMPORT_CHECK_SIZE(buf_pos, 1, buf_len) context->dtls = buffer[buf_pos]; buf_pos++; if (context->dtls) { TLS_IMPORT_CHECK_SIZE(buf_pos, 4, buf_len) context->dtls_epoch_local = ntohs(*(unsigned short *)&buffer[buf_pos]); buf_pos += 2; context->dtls_epoch_remote = ntohs(*(unsigned short *)&buffer[buf_pos]); } } return context; } int tls_is_broken(struct TLSContext *context) { if ((!context) || (context->critical_error)) return 1; return 0; } int tls_request_client_certificate(struct TLSContext *context) { if ((!context) || (!context->is_server)) return 0; context->request_client_certificate = 1; return 1; } int tls_client_verified(struct TLSContext *context) { if ((!context) || (context->critical_error)) return 0; return (context->client_verified == 1); } const char *tls_sni(struct TLSContext *context) { if (!context) return NULL; return context->sni; } int tls_sni_set(struct TLSContext *context, const char *sni) { if ((!context) || (context->is_server) || (context->critical_error) || (context->connection_status != 0)) return 0; TLS_FREE(context->sni); context->sni = NULL; if (sni) { size_t len = strlen(sni); if (len > 0) { context->sni = (char *)TLS_MALLOC(len + 1); if (context->sni) { context->sni[len] = 0; memcpy(context->sni, sni, len); return 1; } } } return 0; } int tls_load_root_certificates(struct TLSContext *context, const unsigned char *pem_buffer, int pem_size) { if (!context) return TLS_GENERIC_ERROR; unsigned int len; int idx = 0; do { unsigned char *data = tls_pem_decode(pem_buffer, pem_size, idx++, &len); if ((!data) || (!len)) break; struct TLSCertificate *cert = asn1_parse(NULL, data, len, 0); if (cert) { if ((cert->version == 2) #ifdef TLS_X509_V1_SUPPORT || (cert->version == 0) #endif ) { if (cert->priv) { DEBUG_PRINT("WARNING - parse error (private key encountered in certificate)\n"); TLS_FREE(cert->priv); cert->priv = NULL; cert->priv_len = 0; } context->root_certificates = (struct TLSCertificate **)TLS_REALLOC(context->root_certificates, (context->root_count + 1) * sizeof(struct TLSCertificate *)); if (!context->root_certificates) { context->root_count = 0; return TLS_GENERIC_ERROR; } context->root_certificates[context->root_count] = cert; context->root_count++; DEBUG_PRINT("Loaded certificate: %i\n", (int)context->root_count); } else { DEBUG_PRINT("WARNING - certificate version error (v%i)\n", (int)cert->version); tls_destroy_certificate(cert); } } TLS_FREE(data); } while (1); return context->root_count; } int tls_default_verify(struct TLSContext *context, struct TLSCertificate **certificate_chain, int len) { int i; int err; if (certificate_chain) { for (i = 0; i < len; i++) { struct TLSCertificate *certificate = certificate_chain[i]; // check validity date err = tls_certificate_is_valid(certificate); if (err) return err; } } // check if chain is valid err = tls_certificate_chain_is_valid(certificate_chain, len); if (err) return err; // check certificate subject if ((!context->is_server) && (context->sni) && (len > 0) && (certificate_chain)) { err = tls_certificate_valid_subject(certificate_chain[0], context->sni); if (err) return err; } err = tls_certificate_chain_is_valid_root(context, certificate_chain, len); if (err) return err; DEBUG_PRINT("Certificate OK\n"); return no_error; } int tls_unmake_ktls(struct TLSContext *context, int socket) { #ifdef WITH_KTLS struct tls12_crypto_info_aes_gcm_128 crypto_info; socklen_t crypt_info_size = sizeof(crypto_info); if (getsockopt(socket, SOL_TLS, TLS_TX, &crypto_info, &crypt_info_size)) { DEBUG_PRINT("ERROR IN getsockopt\n"); return TLS_GENERIC_ERROR; } memcpy(crypto_info.rec_seq, &context->local_sequence_number, TLS_CIPHER_AES_GCM_128_REC_SEQ_SIZE); context->local_sequence_number = ntohll(context->local_sequence_number); #ifdef TLS_RX crypt_info_size = sizeof(crypto_info); if (getsockopt(socket, SOL_TLS, TLS_RX, &crypto_info, &crypt_info_size)) { DEBUG_PRINT("ERROR IN getsockopt\n"); return TLS_GENERIC_ERROR; } memcpy(crypto_info.rec_seq, &context->remote_sequence_number, TLS_CIPHER_AES_GCM_128_REC_SEQ_SIZE); context->remote_sequence_number = ntohll(context->remote_sequence_number); #endif return 0; #endif DEBUG_PRINT("TLSe COMPILED WITHOUT kTLS SUPPORT\n"); return TLS_FEATURE_NOT_SUPPORTED; } int tls_make_ktls(struct TLSContext *context, int socket) { if ((!context) || (context->critical_error) || (context->connection_status != 0xFF) || (!context->crypto.created)) { DEBUG_PRINT("CANNOT SWITCH TO kTLS\n"); return TLS_GENERIC_ERROR; } if ((!context->exportable) || (!context->exportable_keys)) { DEBUG_PRINT("KEY MUST BE EXPORTABLE TO BE ABLE TO USE kTLS\n"); return TLS_GENERIC_ERROR; } if ((context->version != TLS_V12) && (context->version != DTLS_V12) && (context->version != TLS_V13) && (context->version != DTLS_V13)) { DEBUG_PRINT("kTLS IS SUPPORTED ONLY FOR TLS >= 1.2 AND DTLS >= 1.2\n"); return TLS_FEATURE_NOT_SUPPORTED; } switch (context->cipher) { case TLS_RSA_WITH_AES_128_GCM_SHA256: case TLS_DHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256: case TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: case TLS_AES_128_GCM_SHA256: break; default: DEBUG_PRINT("CIPHER UNSUPPORTED: kTLS SUPPORTS ONLY AES 128 GCM CIPHERS\n"); return TLS_FEATURE_NOT_SUPPORTED; } #ifdef WITH_KTLS if (context->exportable_size < TLS_CIPHER_AES_GCM_128_KEY_SIZE * 2) { DEBUG_PRINT("INVALID KEY SIZE\n"); return TLS_GENERIC_ERROR; } int err; struct tls12_crypto_info_aes_gcm_128 crypto_info; crypto_info.info.cipher_type = TLS_CIPHER_AES_GCM_128; uint64_t local_sequence_number = htonll(context->local_sequence_number); if ((context->version == TLS_V12) || (context->version == DTLS_V12)) { crypto_info.info.version = TLS_1_2_VERSION; memcpy(crypto_info.iv, &local_sequence_number, TLS_CIPHER_AES_GCM_128_IV_SIZE); memcpy(crypto_info.rec_seq, &local_sequence_number, TLS_CIPHER_AES_GCM_128_REC_SEQ_SIZE); memcpy(crypto_info.key, context->exportable_keys, TLS_CIPHER_AES_GCM_128_KEY_SIZE); memcpy(crypto_info.salt, context->crypto.ctx_local_mac.local_aead_iv, TLS_CIPHER_AES_GCM_128_SALT_SIZE); } else if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { crypto_info.info.version = TLS_1_3_VERSION; memcpy(crypto_info.iv, context->crypto.ctx_local_mac.local_iv + 4, TLS_CIPHER_AES_GCM_128_IV_SIZE); memcpy(crypto_info.rec_seq, &local_sequence_number, TLS_CIPHER_AES_GCM_128_REC_SEQ_SIZE); memcpy(crypto_info.key, context->exportable_keys, TLS_CIPHER_AES_GCM_128_KEY_SIZE); memcpy(crypto_info.salt, context->crypto.ctx_local_mac.local_iv, TLS_CIPHER_AES_GCM_128_SALT_SIZE); } err = setsockopt(socket, SOL_TCP, TCP_ULP, "tls", sizeof("tls")); if (err) return err; #ifdef TLS_RX // kernel 4.17 adds TLS_RX support struct tls12_crypto_info_aes_gcm_128 crypto_info_read; crypto_info_read.info.cipher_type = TLS_CIPHER_AES_GCM_128; uint64_t remote_sequence_number = htonll(context->remote_sequence_number); if ((context->version == TLS_V12) || (context->version == DTLS_V12)) { crypto_info_read.info.version = TLS_1_2_VERSION; memcpy(crypto_info_read.iv, &remote_sequence_number, TLS_CIPHER_AES_GCM_128_IV_SIZE); memcpy(crypto_info_read.rec_seq, &remote_sequence_number, TLS_CIPHER_AES_GCM_128_REC_SEQ_SIZE); memcpy(crypto_info_read.key, context->exportable_keys + TLS_CIPHER_AES_GCM_128_KEY_SIZE, TLS_CIPHER_AES_GCM_128_KEY_SIZE); memcpy(crypto_info_read.salt, context->crypto.ctx_remote_mac.remote_aead_iv, TLS_CIPHER_AES_GCM_128_SALT_SIZE); } else if ((context->version == TLS_V13) || (context->version == DTLS_V13)) { crypto_info_read.info.version = TLS_1_3_VERSION; memcpy(crypto_info_read.iv, context->crypto.ctx_remote_mac.remote_iv + 4, TLS_CIPHER_AES_GCM_128_IV_SIZE); memcpy(crypto_info_read.rec_seq, &remote_sequence_number, TLS_CIPHER_AES_GCM_128_REC_SEQ_SIZE); memcpy(crypto_info_read.key, context->exportable_keys + TLS_CIPHER_AES_GCM_128_KEY_SIZE, TLS_CIPHER_AES_GCM_128_KEY_SIZE); memcpy(crypto_info_read.salt, context->crypto.ctx_remote_mac.remote_iv, TLS_CIPHER_AES_GCM_128_SALT_SIZE); } err = setsockopt(socket, SOL_TLS, TLS_RX, &crypto_info_read, sizeof(crypto_info_read)); if (err) return err; #endif return setsockopt(socket, SOL_TLS, TLS_TX, &crypto_info, sizeof(crypto_info)); #else DEBUG_PRINT("TLSe COMPILED WITHOUT kTLS SUPPORT\n"); return TLS_FEATURE_NOT_SUPPORTED; #endif } #ifdef DEBUG void tls_print_certificate(const char *fname) { unsigned char buf[0xFFFF]; char out_buf[0xFFFF]; int size = _private_tls_read_from_file(fname, buf, 0xFFFF); if (size > 0) { int idx = 0; unsigned int len; do { unsigned char *data; if (buf[0] == '-') { data = tls_pem_decode(buf, size, idx++, &len); } else { data = buf; len = size; } if ((!data) || (!len)) return; struct TLSCertificate *cert = asn1_parse(NULL, data, len, -1); if (data != buf) TLS_FREE(data); if (cert) { fprintf(stderr, "%s", tls_certificate_to_string(cert, out_buf, 0xFFFF)); tls_destroy_certificate(cert); } if (data == buf) break; } while (1); } } #endif int tls_remote_error(struct TLSContext *context) { if (!context) return TLS_GENERIC_ERROR; return context->error_code; } #ifdef SSL_COMPATIBLE_INTERFACE int SSL_library_init() { // dummy function return 1; } void SSL_load_error_strings() { // dummy function } void OpenSSL_add_all_algorithms() { // dummy function } void OpenSSL_add_all_ciphers() { // dummy function } void OpenSSL_add_all_digests() { // dummy function } void EVP_cleanup() { // dummy function } int _tls_ssl_private_send_pending(int client_sock, struct TLSContext *context) { unsigned int out_buffer_len = 0; const unsigned char *out_buffer = tls_get_write_buffer(context, &out_buffer_len); unsigned int out_buffer_index = 0; int send_res = 0; SOCKET_SEND_CALLBACK write_cb = NULL; SSLUserData *ssl_data = (SSLUserData *)context->user_data; if (ssl_data) write_cb = (SOCKET_SEND_CALLBACK)ssl_data->send; while ((out_buffer) && (out_buffer_len > 0)) { int res; if (write_cb) res = write_cb(client_sock, (char *)&out_buffer[out_buffer_index], out_buffer_len, 0); else res = send(client_sock, (char *)&out_buffer[out_buffer_index], out_buffer_len, 0); if (res <= 0) { if ((!write_cb) && (res < 0)) { #ifdef _WIN32 if (WSAGetLastError() == WSAEWOULDBLOCK) { context->tls_buffer_len = out_buffer_len; memmove(context->tls_buffer, out_buffer + out_buffer_index, out_buffer_len); return res; } #else if ((errno == EAGAIN) || (errno == EINTR)) { context->tls_buffer_len = out_buffer_len; memmove(context->tls_buffer, out_buffer + out_buffer_index, out_buffer_len); return res; } #endif } send_res = res; break; } out_buffer_len -= res; out_buffer_index += res; send_res += res; } tls_buffer_clear(context); return send_res; } struct TLSContext *SSL_new(struct TLSContext *context) { return tls_accept(context); } int SSLv3_server_method() { return 1; } int SSLv3_client_method() { return 0; } int SSL_CTX_use_certificate_file(struct TLSContext *context, const char *filename, int dummy) { // max 64k buffer unsigned char buf[0xFFFF]; int size = _private_tls_read_from_file(filename, buf, sizeof(buf)); if (size > 0) return tls_load_certificates(context, buf, size); return size; } int SSL_CTX_use_PrivateKey_file(struct TLSContext *context, const char *filename, int dummy) { unsigned char buf[0xFFFF]; int size = _private_tls_read_from_file(filename, buf, sizeof(buf)); if (size > 0) return tls_load_private_key(context, buf, size); return size; } int SSL_CTX_check_private_key(struct TLSContext *context) { if ((!context) || (((!context->private_key) || (!context->private_key->der_bytes) || (!context->private_key->der_len)) #ifdef TLS_ECDSA_SUPPORTED && ((!context->ec_private_key) || (!context->ec_private_key->der_bytes) || (!context->ec_private_key->der_len)) #endif )) return 0; return 1; } struct TLSContext *SSL_CTX_new(int method) { #ifdef WITH_TLS_13 return tls_create_context(method, TLS_V13); #else return tls_create_context(method, TLS_V12); #endif } void SSL_free(struct TLSContext *context) { if (context) { TLS_FREE(context->user_data); tls_destroy_context(context); } } void SSL_CTX_free(struct TLSContext *context) { SSL_free(context); } int SSL_get_error(struct TLSContext *context, int ret) { if (!context) return TLS_GENERIC_ERROR; return context->critical_error; } int SSL_set_fd(struct TLSContext *context, int socket) { if (!context) return 0; SSLUserData *ssl_data = (SSLUserData *)context->user_data; if (!ssl_data) { ssl_data = (SSLUserData *)TLS_MALLOC(sizeof(SSLUserData)); if (!ssl_data) return TLS_NO_MEMORY; memset(ssl_data, 0, sizeof(SSLUserData)); context->user_data = ssl_data; } ssl_data->fd = socket; return 1; } void *SSL_set_userdata(struct TLSContext *context, void *data) { if (!context) return NULL; SSLUserData *ssl_data = (SSLUserData *)context->user_data; if (!ssl_data) { ssl_data = (SSLUserData *)TLS_MALLOC(sizeof(SSLUserData)); if (!ssl_data) return NULL; memset(ssl_data, 0, sizeof(SSLUserData)); context->user_data = ssl_data; } void *old_data = ssl_data->user_data; ssl_data->user_data = data; return old_data; } void *SSL_userdata(struct TLSContext *context) { if (!context) return NULL; SSLUserData *ssl_data = (SSLUserData *)context->user_data; if (!ssl_data) return NULL; return ssl_data->user_data; } int SSL_CTX_root_ca(struct TLSContext *context, const char *pem_filename) { if (!context) return TLS_GENERIC_ERROR; int count = TLS_GENERIC_ERROR; FILE *f = fopen(pem_filename, "rb"); if (f) { fseek(f, 0, SEEK_END); size_t size = (size_t)ftell(f); fseek(f, 0, SEEK_SET); if (size) { unsigned char *buf = (unsigned char *)TLS_MALLOC(size + 1); if (buf) { buf[size] = 1; if (fread(buf, 1, size, f) == size) { count = tls_load_root_certificates(context, buf, size); if (count > 0) { SSLUserData *ssl_data = (SSLUserData *)context->user_data; if (!ssl_data) { ssl_data = (SSLUserData *)TLS_MALLOC(sizeof(SSLUserData)); if (!ssl_data) { fclose(f); return TLS_NO_MEMORY; } memset(ssl_data, 0, sizeof(SSLUserData)); context->user_data = ssl_data; } if (!ssl_data->certificate_verify) ssl_data->certificate_verify = tls_default_verify; } } TLS_FREE(buf); } } fclose(f); } return count; } void SSL_CTX_set_verify(struct TLSContext *context, int mode, tls_validation_function verify_callback) { if (!context) return; SSLUserData *ssl_data = (SSLUserData *)context->user_data; if (!ssl_data) { ssl_data = (SSLUserData *)TLS_MALLOC(sizeof(SSLUserData)); if (!ssl_data) return; memset(ssl_data, 0, sizeof(SSLUserData)); context->user_data = ssl_data; } if (mode == SSL_VERIFY_NONE) ssl_data->certificate_verify = NULL; else ssl_data->certificate_verify = verify_callback; } int _private_tls_safe_read(struct TLSContext *context, void *buffer, int buf_size) { SSLUserData *ssl_data = (SSLUserData *)context->user_data; if ((!ssl_data) || (ssl_data->fd < 0)) return TLS_GENERIC_ERROR; SOCKET_RECV_CALLBACK read_cb = (SOCKET_RECV_CALLBACK)ssl_data->recv; if (read_cb) return read_cb(ssl_data->fd, (char *)buffer, buf_size, 0); return recv(ssl_data->fd, (char *)buffer, buf_size, 0); } int SSL_accept(struct TLSContext *context) { if (!context) return TLS_GENERIC_ERROR; SSLUserData *ssl_data = (SSLUserData *)context->user_data; if ((!ssl_data) || (ssl_data->fd < 0)) return TLS_GENERIC_ERROR; if (tls_established(context)) return 1; unsigned char client_message[0xFFFF]; // accept int read_size = 0; while ((read_size = _private_tls_safe_read(context, (char *)client_message, sizeof(client_message))) > 0) { if (tls_consume_stream(context, client_message, read_size, ssl_data->certificate_verify) >= 0) { int res = _tls_ssl_private_send_pending(ssl_data->fd, context); if (res < 0) return res; } if (tls_established(context)) return 1; } if (read_size <= 0) return TLS_BROKEN_CONNECTION; return 0; } int SSL_connect(struct TLSContext *context) { if (!context) return TLS_GENERIC_ERROR; SSLUserData *ssl_data = (SSLUserData *)context->user_data; if ((!ssl_data) || (ssl_data->fd < 0) || (context->critical_error)) return TLS_GENERIC_ERROR; int res = tls_client_connect(context); if (res < 0) return res; res = _tls_ssl_private_send_pending(ssl_data->fd, context); if (res < 0) return res; int read_size; unsigned char client_message[0xFFFF]; while ((read_size = _private_tls_safe_read(context, (char *)client_message, sizeof(client_message))) > 0) { if (tls_consume_stream(context, client_message, read_size, ssl_data->certificate_verify) >= 0) { res = _tls_ssl_private_send_pending(ssl_data->fd, context); if (res < 0) return res; } if (tls_established(context)) return 1; if (context->critical_error) return TLS_GENERIC_ERROR; } return read_size; } int SSL_shutdown(struct TLSContext *context) { if (!context) return TLS_GENERIC_ERROR; SSLUserData *ssl_data = (SSLUserData *)context->user_data; if ((!ssl_data) || (ssl_data->fd < 0)) return TLS_GENERIC_ERROR; tls_close_notify(context); return 0; } int SSL_write(struct TLSContext *context, const void *buf, unsigned int len) { if (!context) return TLS_GENERIC_ERROR; SSLUserData *ssl_data = (SSLUserData *)context->user_data; if ((!ssl_data) || (ssl_data->fd < 0)) return TLS_GENERIC_ERROR; int written_size = tls_write(context, (const unsigned char *)buf, len); if (written_size > 0) { int res = _tls_ssl_private_send_pending(ssl_data->fd, context); if (res <= 0) return res; } return written_size; } int SSL_read(struct TLSContext *context, void *buf, unsigned int len) { if (!context) return TLS_GENERIC_ERROR; if (context->application_buffer_len) return tls_read(context, (unsigned char *)buf, len); SSLUserData *ssl_data = (SSLUserData *)context->user_data; if ((!ssl_data) || (ssl_data->fd < 0) || (context->critical_error)) return TLS_GENERIC_ERROR; if (tls_established(context) != 1) return TLS_GENERIC_ERROR; unsigned char client_message[0xFFFF]; // accept int read_size; while ((!context->application_buffer_len) && ((read_size = _private_tls_safe_read(context, (char *)client_message, sizeof(client_message))) > 0)) { if (tls_consume_stream(context, client_message, read_size, ssl_data->certificate_verify) > 0) _tls_ssl_private_send_pending(ssl_data->fd, context); if ((context->critical_error) && (!context->application_buffer_len)) return TLS_GENERIC_ERROR; } if ((read_size <= 0) && (!context->application_buffer_len)) return read_size; return tls_read(context, (unsigned char *)buf, len); } int SSL_pending(struct TLSContext *context) { if (!context) return TLS_GENERIC_ERROR; return context->application_buffer_len; } int SSL_set_io(struct TLSContext *context, void *recv_cb, void *send_cb) { if (!context) return TLS_GENERIC_ERROR; SSLUserData *ssl_data = (SSLUserData *)context->user_data; if (!ssl_data) { ssl_data = (SSLUserData *)TLS_MALLOC(sizeof(SSLUserData)); if (!ssl_data) return TLS_NO_MEMORY; memset(ssl_data, 0, sizeof(SSLUserData)); context->user_data = ssl_data; } ssl_data->recv = recv_cb; ssl_data->send = send_cb; return 0; } #endif // SSL_COMPATIBLE_INTERFACE #ifdef TLS_SRTP struct SRTPContext { symmetric_CTR aes; unsigned int salt[4]; unsigned char mac[TLS_SHA1_MAC_SIZE]; unsigned int tag_size; unsigned int roc; unsigned short seq; unsigned char mode; unsigned char auth_mode; }; struct SRTPContext *srtp_init(unsigned char mode, unsigned char auth_mode) { struct SRTPContext *context = NULL; tls_init(); switch (mode) { case SRTP_NULL: break; case SRTP_AES_CM: break; default: return NULL; } switch (auth_mode) { case SRTP_AUTH_NULL: break; case SRTP_AUTH_HMAC_SHA1: break; default: return NULL; } context = (struct SRTPContext *)TLS_MALLOC(sizeof(struct SRTPContext)); if (context) { memset(context, 0, sizeof(struct SRTPContext)); context->mode = mode; context->auth_mode = auth_mode; } return context; } static int _private_tls_srtp_key_derive(const void *key, int keylen, const void *salt, unsigned char label, void *out, int outlen) { unsigned char iv[16]; memcpy(iv, salt, 14); iv[14] = iv[15] = 0; void *in = TLS_MALLOC(outlen); if (!in) return TLS_GENERIC_ERROR; memset(in, 0, outlen); iv[7] ^= label; symmetric_CTR aes; if (ctr_start(find_cipher("aes"), iv, (const unsigned char *)key, keylen, 0, CTR_COUNTER_BIG_ENDIAN, &aes)) return TLS_GENERIC_ERROR; ctr_encrypt((unsigned char *)in, (unsigned char *)out, outlen, &aes); TLS_FREE(in); ctr_done(&aes); return 0; } int srtp_key(struct SRTPContext *context, const void *key, int keylen, const void *salt, int saltlen, int tag_bits) { if (!context) return TLS_GENERIC_ERROR; if (context->mode == SRTP_AES_CM) { if ((saltlen < 14) || (keylen < 16)) return TLS_GENERIC_ERROR; // key unsigned char key_buf[16]; unsigned char iv[16]; memset(iv, 0, sizeof(iv)); if (_private_tls_srtp_key_derive(key, keylen, salt, 0, key_buf, sizeof(key_buf))) return TLS_GENERIC_ERROR; DEBUG_DUMP_HEX_LABEL("KEY", key_buf, 16) if (_private_tls_srtp_key_derive(key, keylen, salt, 1, context->mac, 20)) return TLS_GENERIC_ERROR; DEBUG_DUMP_HEX_LABEL("AUTH", context->mac, 20) memset(context->salt, 0, sizeof(context->salt)); if (_private_tls_srtp_key_derive(key, keylen, salt, 2, context->salt, 14)) return TLS_GENERIC_ERROR; DEBUG_DUMP_HEX_LABEL("SALT", ((unsigned char *)context->salt), 14) if (ctr_start(find_cipher("aes"), iv, key_buf, sizeof(key_buf), 0, CTR_COUNTER_BIG_ENDIAN, &context->aes)) return TLS_GENERIC_ERROR; } if (context->auth_mode) context->tag_size = tag_bits / 8; return 0; } int srtp_inline(struct SRTPContext *context, const char *b64, int tag_bits) { char out_buffer[1024]; if (!b64) return TLS_GENERIC_ERROR; int len = strlen(b64); if (len >= sizeof(out_buffer)) len = sizeof(out_buffer); int size = _private_b64_decode(b64, len, (unsigned char *)out_buffer); if (size <= 0) return TLS_GENERIC_ERROR; switch (context->mode) { case SRTP_AES_CM: if (size < 30) return TLS_BROKEN_PACKET; return srtp_key(context, out_buffer, 16, out_buffer + 16, 14, tag_bits); } return TLS_GENERIC_ERROR; } int srtp_encrypt(struct SRTPContext *context, const unsigned char *pt_header, int pt_len, const unsigned char *payload, unsigned int payload_len, unsigned char *out, int *out_buffer_len) { if ((!context) || (!out) || (!out_buffer_len) || (*out_buffer_len < payload_len)) return TLS_GENERIC_ERROR; int out_len = payload_len; unsigned short seq = 0; unsigned int roc = context->roc; unsigned int ssrc = 0; if ((pt_header) && (pt_len >= 12)) { seq = ntohs(*((unsigned short *)&pt_header[2])); ssrc = ntohl(*((unsigned long *)&pt_header[8])); } if (seq < context->seq) roc++; unsigned int roc_be = htonl(roc); if (context->mode) { if (*out_buffer_len < out_len) return TLS_NO_MEMORY; unsigned int counter[4]; counter[0] = context->salt[0]; counter[1] = context->salt[1] ^ htonl (ssrc); counter[2] = context->salt[2] ^ roc_be; counter[3] = context->salt[3] ^ htonl (seq << 16); ctr_setiv((unsigned char *)&counter, 16, &context->aes); if (ctr_encrypt(payload, out, payload_len, &context->aes)) return TLS_GENERIC_ERROR; } else { memcpy(out, payload, payload_len); } *out_buffer_len = out_len; if (context->auth_mode == SRTP_AUTH_HMAC_SHA1) { unsigned char digest_out[TLS_SHA1_MAC_SIZE]; unsigned long dlen = TLS_SHA1_MAC_SIZE; hmac_state hmac; int err = hmac_init(&hmac, find_hash("sha1"), context->mac, 20); if (!err) { if (pt_len) err = hmac_process(&hmac, pt_header, pt_len); if (out_len) err = hmac_process(&hmac, out, payload_len); err = hmac_process(&hmac, (unsigned char *)&roc_be, 4); if (!err) err = hmac_done(&hmac, digest_out, &dlen); } if (err) return TLS_GENERIC_ERROR; if (dlen > context->tag_size) dlen = context->tag_size; *out_buffer_len += dlen; memcpy(out + out_len, digest_out, dlen); } context->roc = roc; context->seq = seq; return 0; } int srtp_decrypt(struct SRTPContext *context, const unsigned char *pt_header, int pt_len, const unsigned char *payload, unsigned int payload_len, unsigned char *out, int *out_buffer_len) { if ((!context) || (!out) || (!out_buffer_len) || (*out_buffer_len < payload_len) || (payload_len < context->tag_size) || (!pt_header) || (pt_len < 12)) return TLS_GENERIC_ERROR; int out_len = payload_len; unsigned short seq = ntohs(*((unsigned short *)&pt_header[2])); unsigned int roc = context->roc; unsigned int ssrc = ntohl(*((unsigned long *)&pt_header[8])); if (seq < context->seq) roc++; unsigned int roc_be = htonl(roc); if (context->mode) { unsigned int counter[4]; counter[0] = context->salt[0]; counter[1] = context->salt[1] ^ htonl (ssrc); counter[2] = context->salt[2] ^ roc_be; counter[3] = context->salt[3] ^ htonl (seq << 16); ctr_setiv((unsigned char *)&counter, 16, &context->aes); if (ctr_decrypt(payload, out, payload_len - context->tag_size, &context->aes)) return TLS_GENERIC_ERROR; if (context->auth_mode == SRTP_AUTH_HMAC_SHA1) { unsigned char digest_out[TLS_SHA1_MAC_SIZE]; unsigned long dlen = TLS_SHA1_MAC_SIZE; hmac_state hmac; int err = hmac_init(&hmac, find_hash("sha1"), context->mac, 20); if (!err) { if (pt_len) err = hmac_process(&hmac, pt_header, pt_len); if (out_len) err = hmac_process(&hmac, payload, payload_len - context->tag_size); err = hmac_process(&hmac, (unsigned char *)&roc_be, 4); if (!err) err = hmac_done(&hmac, digest_out, &dlen); } if (err) return TLS_GENERIC_ERROR; if (dlen > context->tag_size) dlen = context->tag_size; if (memcmp(digest_out, payload + payload_len - context->tag_size, dlen)) return TLS_INTEGRITY_FAILED; } } else { memcpy(out, payload, payload_len - context->tag_size); } context->seq = seq; context->roc = roc; *out_buffer_len = payload_len - context->tag_size; return 0; } void srtp_destroy(struct SRTPContext *context) { if (context) { if (context->mode) ctr_done(&context->aes); TLS_FREE(context); } } #endif // TLS_SRTP #endif // TLSE_C /* ------------------------------------------------------------------------------ END tlse.c ------------------------------------------------------------------------------ */ #endif /* HTTPS_NO_TLSE */ /* ------------------------------------------------------------------------------ HTTPS IMPLEMENTATION ------------------------------------------------------------------------------ */ typedef struct { /* keep this at the top!*/ https_t https; /* because https_internal_t* can be cast to https_t*. */ void* memctx; struct TLSContext * tls_context; HTTPS_SOCKET socket; int connect_pending; int handshake_pending; int request_sent; char address[ 256 ]; char request_header[ 256 ]; char* request_header_large; void* request_data; size_t request_data_size; char reason_phrase[ 1024 ]; char content_type[ 256 ]; size_t data_size; size_t data_capacity; void* data; } https_internal_t; static int https_internal_parse_url( char const* url, char* address, size_t address_capacity, char* port, size_t port_capacity, char const** resource ) { // make sure url starts with https:// if( strncmp( url, "https://", 8 ) != 0 ) return 0; url += 8; // skip https:// part of url size_t url_len = strlen( url ); // find end of address part of url char const* port_pos = strchr( url, ':' ); char const* rsrc_pos = strchr( url, '/' ); char const* address_end = port_pos ? port_pos : rsrc_pos; if( port_pos && port_pos < address_end ) address_end = port_pos; if( rsrc_pos && rsrc_pos < address_end ) address_end = rsrc_pos; if( !address_end ) address_end = url + url_len; // extract address size_t address_len = (size_t)( address_end - url ); if( address_len >= address_capacity ) return 0; memcpy( address, url, address_len ); address[ address_len ] = 0; // check if there's a port defined char const* port_end = address_end; if( *address_end == ':' ) { ++address_end; port_end = strchr( address_end, '/' ); if( !port_end ) port_end = address_end + strlen( address_end ); size_t port_len = (size_t)( port_end - address_end ); if( port_len >= port_capacity ) return 0; memcpy( port, address_end, port_len ); port[ port_len ] = 0; } else { // use default port number 443 if( port_capacity <= 3 ) return 0; strcpy( port, "443" ); } *resource = port_end; return 1; } HTTPS_SOCKET https_internal_connect( char const* address, char const* port ) { // set up hints for getaddrinfo struct addrinfo hints; memset( &hints, 0, sizeof( hints ) ); hints.ai_family = AF_UNSPEC; // the Internet Protocol version 4 (IPv4) address family. hints.ai_flags = AI_PASSIVE; hints.ai_socktype = SOCK_STREAM; hints.ai_protocol = IPPROTO_TCP; // Use Transmission Control Protocol (TCP). // resolve the server address and port struct addrinfo* addri = 0; int error = getaddrinfo( address, port, &hints, &addri ) ; if( error != 0 ) return HTTPS_INVALID_SOCKET; // create the socket HTTPS_SOCKET sock = socket( addri->ai_family, addri->ai_socktype, addri->ai_protocol ); if( sock == -1) { freeaddrinfo( addri ); return HTTPS_INVALID_SOCKET; } // set socket to nonblocking mode /* u_long nonblocking = 1; #ifdef _WIN32 int res = ioctlsocket( sock, FIONBIO, &nonblocking ); #else int flags = fcntl( sock, F_GETFL, 0 ); int res = fcntl( sock, F_SETFL, flags | O_NONBLOCK ); #endif if( res == -1 ) { freeaddrinfo( addri ); #ifdef _WIN32 closesocket( sock ); #else close( sock ); #endif return HTTPS_INVALID_SOCKET; }*/ // connect to server if( connect( sock, addri->ai_addr, (int)addri->ai_addrlen ) == -1 ) { #ifdef _WIN32 if( WSAGetLastError() != WSAEWOULDBLOCK && WSAGetLastError() != WSAEINPROGRESS ) { freeaddrinfo( addri ); closesocket( sock ); return HTTPS_INVALID_SOCKET; } #else if( errno != EWOULDBLOCK && errno != EINPROGRESS && errno != EAGAIN ) { freeaddrinfo( addri ); close( sock ); return HTTPS_INVALID_SOCKET; } #endif } freeaddrinfo( addri ); return sock; } static https_internal_t* https_internal_create( size_t request_data_size, void* memctx ) { https_internal_t* internal = (https_internal_t*) HTTPS_MALLOC( memctx, sizeof( https_internal_t ) + request_data_size ); internal->https.status = HTTPS_STATUS_PENDING; internal->https.status_code = 0; internal->https.response_size = 0; internal->https.response_data = NULL; internal->memctx = memctx; internal->connect_pending = 1; internal->request_sent = 0; strcpy( internal->reason_phrase, "" ); internal->https.reason_phrase = internal->reason_phrase; strcpy( internal->content_type, "" ); internal->https.content_type = internal->content_type; internal->data_size = 0; internal->data_capacity = 64 * 1024; internal->data = HTTPS_MALLOC( memctx, internal->data_capacity ); internal->request_data = NULL; internal->request_data_size = 0; internal->tls_context = tls_create_context( 0, TLS_V12 ); return internal; } https_t* https_get( char const* url, void* memctx ) { #if !HTTPS_NO_THREADING //< @r-lyeh, add option to disable threading #ifdef _WIN32 #if (defined(_MSC_VER) && _MSC_VER < 1600) typedef BOOL (WINAPI *InitOnceExecuteOnce_t)( PRTL_RUN_ONCE, BOOL (WINAPI*)( PRTL_RUN_ONCE, PVOID, PVOID* ), PVOID, LPVOID* ); HINSTANCE lib = LoadLibraryA( "kernel32.dll" ); InitOnceExecuteOnce_t InitOnceExecuteOnce_func = (InitOnceExecuteOnce_t) (uintptr_t) GetProcAddress( lib, "InitOnceExecuteOnce" ); ASSERT(InitOnceExecuteOnce_func); InitOnceExecuteOnce_func( &https_internal_one_time_init_instance, https_internal_one_time_init, NULL, NULL ); FreeLibrary( lib ); #else InitOnceExecuteOnce( &https_internal_one_time_init_instance, (void*)https_internal_one_time_init, NULL, NULL ); #endif #else pthread_once( &https_internal_one_time_init_instance, https_internal_one_time_init); #endif if( memctx ) https_internal_memctx( memctx ); #endif char address[ 256 ]; char port[ 16 ]; char const* resource; if( https_internal_parse_url( url, address, sizeof( address ), port, sizeof( port ), &resource ) == 0 ) return NULL; HTTPS_SOCKET socket = https_internal_connect( address, port ); if( socket == HTTPS_INVALID_SOCKET ) return NULL; https_internal_t* internal = https_internal_create( 0, memctx ); internal->socket = socket; char* request_header; size_t request_header_len = 256 + strlen( resource ) + strlen( address ) + strlen( port ); if( request_header_len < sizeof( internal->request_header ) ) { internal->request_header_large = NULL; request_header = internal->request_header; } else { internal->request_header_large = (char*) HTTPS_MALLOC( memctx, request_header_len + 1 ); request_header = internal->request_header_large; } sprintf( request_header, "GET %s HTTP/1.0\r\nHost: %s:%s\r\n\r\n", resource, address, port ); return &internal->https; } https_t* https_post( char const* url, void const* data, size_t size, void* memctx ) { #if !HTTPS_NO_THREADING //< @r-lyeh, add option to disable threading #ifdef _WIN32 #if (defined(_MSC_VER) && _MSC_VER < 1600) typedef BOOL (WINAPI *InitOnceExecuteOnce_t)( PRTL_RUN_ONCE, BOOL (WINAPI*)( PRTL_RUN_ONCE, PVOID, PVOID* ), PVOID, LPVOID* ); HINSTANCE lib = LoadLibraryA( "kernel32.dll" ); InitOnceExecuteOnce_t InitOnceExecuteOnce_func = (InitOnceExecuteOnce_t) (uintptr_t) GetProcAddress( lib, "InitOnceExecuteOnce" ); ASSERT(InitOnceExecuteOnce_func); InitOnceExecuteOnce_func( &https_internal_one_time_init_instance, https_internal_one_time_init, NULL, NULL ); FreeLibrary( lib ); #else InitOnceExecuteOnce( &https_internal_one_time_init_instance, (void*)https_internal_one_time_init, NULL, NULL ); #endif #else pthread_once( &https_internal_one_time_init_instance, https_internal_one_time_init); #endif if( memctx ) https_internal_memctx( memctx ); #endif char address[ 256 ]; char port[ 16 ]; char const* resource; if( https_internal_parse_url( url, address, sizeof( address ), port, sizeof( port ), &resource ) == 0 ) return NULL; HTTPS_SOCKET socket = https_internal_connect( address, port ); if( socket == HTTPS_INVALID_SOCKET ) return NULL; https_internal_t* internal = https_internal_create( size, memctx ); internal->socket = socket; char* request_header; size_t request_header_len = 256 + strlen( resource ) + strlen( address ) + strlen( port ); if( request_header_len < sizeof( internal->request_header ) ) { internal->request_header_large = NULL; request_header = internal->request_header; } else { internal->request_header_large = (char*) HTTPS_MALLOC( memctx, request_header_len + 1 ); request_header = internal->request_header_large; } sprintf( request_header, "POST %s HTTP/1.0\r\nHost: %s:%s\r\nContent-Length: %d\r\n\r\n", resource, address, port, (int) size ); internal->request_data_size = size; internal->request_data = ( internal + 1 ); memcpy( internal->request_data, data, size ); return &internal->https; } static int https_internal_send_pending( https_internal_t* internal ) { unsigned int send_size = 0; unsigned char const* send_buffer = tls_get_write_buffer( internal->tls_context, &send_size ); int res = 0; while( send_size > 0 ) { int bytes_sent = send( internal->socket, (char const*) send_buffer, send_size, 0 ); if( bytes_sent <= 0) { res = bytes_sent; break; } send_buffer += bytes_sent; send_size -= bytes_sent; res += bytes_sent; } tls_buffer_clear( internal->tls_context ); return res; } https_status_t https_process( https_t* https ) { https_internal_t* internal = (https_internal_t*) https; if( https->status > HTTPS_STATUS_COMPLETED ) return https->status; // == HTTPS_STATUS_FAILED ) //< @r-lyeh if( internal->connect_pending ) { fd_set sockets_to_check; FD_ZERO( &sockets_to_check ); #pragma warning( push ) #pragma warning( disable: 4548 ) // expression before comma has no effect; expected expression with side-effect FD_SET( internal->socket, &sockets_to_check ); #pragma warning( pop ) struct timeval timeout; timeout.tv_sec = 0; timeout.tv_usec = 0; // check if socket is ready for send if( select( (int)( internal->socket + 1 ), NULL, &sockets_to_check, NULL, &timeout ) == 1 ) { int opt = -1; socklen_t len = sizeof( opt ); if( getsockopt( internal->socket, SOL_SOCKET, SO_ERROR, (char*)( &opt ), &len) >= 0 && opt == 0 ) { internal->connect_pending = 0; // if it is, we're connected // do tls handshake tls_client_connect( internal->tls_context ); int res = https_internal_send_pending( internal ); if( res == -1 ) { https->status = __LINE__; // HTTPS_STATUS_FAILED; //< @r-lyeh return https->status; } internal->handshake_pending = 1; } } } if( internal->connect_pending ) return https->status; if( !internal->handshake_pending && !internal->request_sent ) { char const* request_header = internal->request_header_large ? internal->request_header_large : internal->request_header; tls_write( internal->tls_context, (unsigned char*) request_header, (int) strlen( request_header ) ); if( https_internal_send_pending( internal ) == -1 ) { https->status = __LINE__; // HTTPS_STATUS_FAILED; //< @r-lyeh return https->status; } if( internal->request_data_size ) { tls_write( internal->tls_context, (unsigned char*) internal->request_data, (int) internal->request_data_size ); int res = https_internal_send_pending( internal ); if( res == -1 ) { https->status = __LINE__; // HTTPS_STATUS_FAILED; //< @r-lyeh return https->status; } } internal->request_sent = 1; return https->status; } // check if socket is ready for recv fd_set sockets_to_check; FD_ZERO( &sockets_to_check ); #pragma warning( push ) #pragma warning( disable: 4548 ) // expression before comma has no effect; expected expression with side-effect FD_SET( internal->socket, &sockets_to_check ); #pragma warning( pop ) struct timeval timeout; while( (timeout.tv_sec = 1, timeout.tv_usec = 0), select( (int)( internal->socket + 1 ), &sockets_to_check, NULL, NULL, &timeout ) == 1 ) { enum { buflen = 4 * 1024 }; char buffer[ buflen ]; int size = recv( internal->socket, buffer, buflen, 0 ); if( size == -1 ) { https->status = __LINE__; // HTTPS_STATUS_FAILED; //< @r-lyeh return https->status; } #if is(tcc) && is(win32) // hexdump(buffer, size); //< @r-lyeh // printf(">+=%d,%d/%d\n", size,internal->data_size,internal->data_capacity); #endif tls_consume_stream( internal->tls_context, (unsigned char*) buffer, size, 0 ); int res = https_internal_send_pending( internal ); if( res == -1 ) { https->status = __LINE__; // HTTPS_STATUS_FAILED; //< @r-lyeh return https->status; } if( internal->handshake_pending ) { if( tls_established( internal->tls_context ) ) internal->handshake_pending = 0; else return https->status; continue; } if( size > 0 ) { size_t min_size = internal->data_size + size + 1; if( internal->data_capacity < min_size ) { internal->data_capacity *= 2; if( internal->data_capacity < min_size ) internal->data_capacity = min_size; void* new_data = HTTPS_MALLOC( internal->memctx, internal->data_capacity ); memcpy( new_data, internal->data, internal->data_size ); HTTPS_FREE( internal->memctx, internal->data ); internal->data = new_data; } int read_size = tls_read( internal->tls_context, (unsigned char*)( ( (uintptr_t) internal->data ) + internal->data_size ), size); internal->data_size += read_size; } else if( size == 0 ) { char const* status_line = (char const*) internal->data; int header_size = 0; char const* header_end = strstr( status_line, "\r\n\r\n" ); if( header_end ) { header_end += 4; header_size = (int)( header_end - status_line ); } else { https->status = __LINE__; // HTTPS_STATUS_FAILED; //< @r-lyeh return https->status; } char const* content_length = strstr( status_line, "Content-Length: " ); if( content_length && content_length < header_end ) { content_length += strlen( "Content-Length: " ); char const* content_length_end = strstr( content_length, "\r\n" ); if( content_length_end ) { char content_length_extracted[ 32 ]; int len = content_length_end - content_length; memcpy( content_length_extracted, content_length, len ); content_length_extracted[ len ] = '\0'; int content_length_num = atoi( content_length_extracted ); if( content_length_num > internal->data_size ) { https->status = __LINE__; // HTTPS_STATUS_FAILED; //< @r-lyeh return https->status; } } } // skip https version status_line = strchr( status_line, ' ' ); if( !status_line ) { https->status = __LINE__; // HTTPS_STATUS_FAILED; //< @r-lyeh return https->status; } ++status_line; // extract status code char status_code[ 16 ]; char const* status_code_end = strchr( status_line, ' ' ); if( !status_code_end ) { https->status = __LINE__; // HTTPS_STATUS_FAILED; //< @r-lyeh return https->status; } memcpy( status_code, status_line, (size_t)( status_code_end - status_line ) ); status_code[ status_code_end - status_line ] = 0; status_line = status_code_end + 1; https->status_code = atoi( status_code ); // extract reason phrase char const* reason_phrase_end = strstr( status_line, "\r\n" ); if( !reason_phrase_end ) { https->status = __LINE__; // HTTPS_STATUS_FAILED; //< @r-lyeh return https->status; } size_t reason_phrase_len = (size_t)( reason_phrase_end - status_line ); if( reason_phrase_len >= sizeof( internal->reason_phrase ) ) reason_phrase_len = sizeof( internal->reason_phrase ) - 1; memcpy( internal->reason_phrase, status_line, reason_phrase_len ); internal->reason_phrase[ reason_phrase_len ] = 0; status_line = reason_phrase_end + 1; // extract content type char const* content_type_start = strstr( status_line, "Content-Type: " ); if( content_type_start ) { content_type_start += strlen( "Content-Type: " ); char const* content_type_end = strstr( content_type_start, "\r\n" ); if( content_type_end ) { size_t content_type_len = (size_t)( content_type_end - content_type_start ); if( content_type_len >= sizeof( internal->content_type ) ) content_type_len = sizeof( internal->content_type ) - 1; memcpy( internal->content_type, content_type_start, content_type_len ); internal->content_type[ content_type_len ] = 0; } } https->status = https->status_code < 300 ? HTTPS_STATUS_COMPLETED : __LINE__; // HTTPS_STATUS_FAILED; //< @r-lyeh https->response_data = (void*)( ( (uintptr_t) internal->data ) + header_size ); https->response_size = internal->data_size - header_size; #if 1 //< @r-lyeh // add silently a trailing zero and do not resize response_size. that way, // response remains intact but it can also be used as a ascii C string when needed. ( (char*)https->response_data )[ https->response_size ] = 0; #endif return https->status; } } return https->status; } void https_release( https_t* https ) { https_internal_t* internal = (https_internal_t*) https; #ifdef _WIN32 closesocket( internal->socket ); #else close( internal->socket ); #endif tls_destroy_context( internal->tls_context ); if( internal->request_header_large) HTTPS_FREE( internal->memctx, internal->request_header_large ); HTTPS_FREE( internal->memctx, internal->data ); HTTPS_FREE( internal->memctx, internal ); } #endif /* HTTPS_IMPLEMENTATION */ /* revision history: 0.1 ... */ /* ------------------------------------------------------------------------------ This software is available under 2 licenses - you may choose the one you like. ------------------------------------------------------------------------------ ALTERNATIVE A - MIT License Copyright (c) 2018 Mattias Gustavsson Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. ------------------------------------------------------------------------------ ALTERNATIVE B - Public Domain (www.unlicense.org) This is free and unencumbered software released into the public domain. Anyone is free to copy, modify, publish, use, compile, sell, or distribute this software, either in source code form or as a compiled binary, for any purpose, commercial or non-commercial, and by any means. In jurisdictions that recognize copyright laws, the author or authors of this software dedicate any and all copyright interest in the software to the public domain. We make this dedication for the benefit of the public at large and to the detriment of our heirs and successors. We intend this dedication to be an overt act of relinquishment in perpetuity of all present and future rights to this software under copyright law. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. ------------------------------------------------------------------------------ */ #if 0 #include int main() { https_t *h = https_get("https://www.google.com/", NULL); while (!https_process(h)) { Sleep(0); } printf("%d %s\n", h->status_code, h->content_type); //printf("%.*s\n", (int)h->response_size, (char*)h->response_data); FILE *f = tmpfile(); fwrite(h->response_data, 1, h->response_size, f); printf("%u bytes\n", (unsigned)ftell(f)); fclose(f); https_release(h); } #endif